@charset "UTF-8";
/*!
 * Sonata CSS Framework v0.2.2
 * https://github.com/alexcandelas/sonata
 * MIT License
 */
/*
================================================================================
Dashboard
================================================================================
*/
/*
================================================================================
Menu
================================================================================
*/
/*
================================================================================
Subject statuses
================================================================================
*/
/*
===============================================================================
Triangle
===============================================================================
*/
/**
 * Create a triangle shape in generated content.
 */
/*
================================================================================
Box sizing
================================================================================
*/
*,
*::before,
*::after {
  box-sizing: inherit;
}

html {
  box-sizing: border-box;
}

/*! normalize.css v8.0.1 | MIT License | github.com/necolas/normalize.css */
/* Document
   ========================================================================== */
/**
 * 1. Correct the line height in all browsers.
 * 2. Prevent adjustments of font size after orientation changes in iOS.
 */
html {
  line-height: 1.15;
  /* 1 */
  -webkit-text-size-adjust: 100%;
  /* 2 */
}

/* Sections
   ========================================================================== */
/**
 * Remove the margin in all browsers.
 */
body {
  margin: 0;
}

/**
 * Render the `main` element consistently in IE.
 */
main {
  display: block;
}

/**
 * Correct the font size and margin on `h1` elements within `section` and
 * `article` contexts in Chrome, Firefox, and Safari.
 */
h1, .h1 {
  font-size: 2em;
  margin: 0.67em 0;
}

/* Grouping content
   ========================================================================== */
/**
 * 1. Add the correct box sizing in Firefox.
 * 2. Show the overflow in Edge and IE.
 */
hr {
  box-sizing: content-box;
  /* 1 */
  height: 0;
  /* 1 */
  overflow: visible;
  /* 2 */
}

/**
 * 1. Correct the inheritance and scaling of font size in all browsers.
 * 2. Correct the odd `em` font sizing in all browsers.
 */
pre {
  font-family: monospace, monospace;
  /* 1 */
  font-size: 1em;
  /* 2 */
}

/* Text-level semantics
   ========================================================================== */
/**
 * Remove the gray background on active links in IE 10.
 */
a {
  background-color: transparent;
}

/**
 * 1. Remove the bottom border in Chrome 57-
 * 2. Add the correct text decoration in Chrome, Edge, IE, Opera, and Safari.
 */
abbr[title] {
  border-bottom: none;
  /* 1 */
  text-decoration: underline;
  /* 2 */
  -webkit-text-decoration: underline dotted;
          text-decoration: underline dotted;
  /* 2 */
}

/**
 * Add the correct font weight in Chrome, Edge, and Safari.
 */
b,
strong {
  font-weight: bolder;
}

/**
 * 1. Correct the inheritance and scaling of font size in all browsers.
 * 2. Correct the odd `em` font sizing in all browsers.
 */
code,
kbd,
samp {
  font-family: monospace, monospace;
  /* 1 */
  font-size: 1em;
  /* 2 */
}

/**
 * Add the correct font size in all browsers.
 */
small {
  font-size: 80%;
}

/**
 * Prevent `sub` and `sup` elements from affecting the line height in
 * all browsers.
 */
sub,
sup {
  font-size: 75%;
  line-height: 0;
  position: relative;
  vertical-align: baseline;
}

sub {
  bottom: -0.25em;
}

sup {
  top: -0.5em;
}

/* Embedded content
   ========================================================================== */
/**
 * Remove the border on images inside links in IE 10.
 */
img {
  border-style: none;
}

/* Forms
   ========================================================================== */
/**
 * 1. Change the font styles in all browsers.
 * 2. Remove the margin in Firefox and Safari.
 */
button,
input,
optgroup,
select,
textarea {
  font-family: inherit;
  /* 1 */
  font-size: 100%;
  /* 1 */
  line-height: 1.15;
  /* 1 */
  margin: 0;
  /* 2 */
}

/**
 * Show the overflow in IE.
 * 1. Show the overflow in Edge.
 */
button,
input {
  /* 1 */
  overflow: visible;
}

/**
 * Remove the inheritance of text transform in Edge, Firefox, and IE.
 * 1. Remove the inheritance of text transform in Firefox.
 */
button,
select {
  /* 1 */
  text-transform: none;
}

/**
 * Correct the inability to style clickable types in iOS and Safari.
 */
button,
[type="button"],
[type="reset"],
[type="submit"] {
  -webkit-appearance: button;
}

/**
 * Remove the inner border and padding in Firefox.
 */
button::-moz-focus-inner,
[type="button"]::-moz-focus-inner,
[type="reset"]::-moz-focus-inner,
[type="submit"]::-moz-focus-inner {
  border-style: none;
  padding: 0;
}

/**
 * Restore the focus styles unset by the previous rule.
 */
button:-moz-focusring,
[type="button"]:-moz-focusring,
[type="reset"]:-moz-focusring,
[type="submit"]:-moz-focusring {
  outline: 1px dotted ButtonText;
}

/**
 * Correct the padding in Firefox.
 */
fieldset {
  padding: 0.35em 0.75em 0.625em;
}

/**
 * 1. Correct the text wrapping in Edge and IE.
 * 2. Correct the color inheritance from `fieldset` elements in IE.
 * 3. Remove the padding so developers are not caught out when they zero out
 *    `fieldset` elements in all browsers.
 */
legend {
  box-sizing: border-box;
  /* 1 */
  color: inherit;
  /* 2 */
  display: table;
  /* 1 */
  max-width: 100%;
  /* 1 */
  padding: 0;
  /* 3 */
  white-space: normal;
  /* 1 */
}

/**
 * Add the correct vertical alignment in Chrome, Firefox, and Opera.
 */
progress {
  vertical-align: baseline;
}

/**
 * Remove the default vertical scrollbar in IE 10+.
 */
textarea {
  overflow: auto;
}

/**
 * 1. Add the correct box sizing in IE 10.
 * 2. Remove the padding in IE 10.
 */
[type="checkbox"],
[type="radio"] {
  box-sizing: border-box;
  /* 1 */
  padding: 0;
  /* 2 */
}

/**
 * Correct the cursor style of increment and decrement buttons in Chrome.
 */
[type="number"]::-webkit-inner-spin-button,
[type="number"]::-webkit-outer-spin-button {
  height: auto;
}

/**
 * 1. Correct the odd appearance in Chrome and Safari.
 * 2. Correct the outline style in Safari.
 */
[type="search"] {
  -webkit-appearance: textfield;
  /* 1 */
  outline-offset: -2px;
  /* 2 */
}

/**
 * Remove the inner padding in Chrome and Safari on macOS.
 */
[type="search"]::-webkit-search-decoration {
  -webkit-appearance: none;
}

/**
 * 1. Correct the inability to style clickable types in iOS and Safari.
 * 2. Change font properties to `inherit` in Safari.
 */
::-webkit-file-upload-button {
  -webkit-appearance: button;
  /* 1 */
  font: inherit;
  /* 2 */
}

/* Interactive
   ========================================================================== */
/*
 * Add the correct display in Edge, IE 10+, and Firefox.
 */
details {
  display: block;
}

/*
 * Add the correct display in all browsers.
 */
summary {
  display: list-item;
}

/* Misc
   ========================================================================== */
/**
 * Add the correct display in IE 10+.
 */
template {
  display: none;
}

/**
 * Add the correct display in IE 10.
 */
[hidden] {
  display: none;
}

/*
================================================================================
Base
================================================================================

Resets and basic styles on top of Normalize.css.
*/
/*
 * Set up vertical rhythm in block elements.
 * A recommendation by Harry Roberts:
 * http://csswizardry.com/2012/06/single-direction-margin-declarations
 */
address, blockquote, figure, h1, .h1, h2, .h2, h3, .h3, h4, .h4, h5, .h5, h6, .h6,
dl, ol, ul, p, pre,
form, fieldset {
  margin-bottom: 1rem;
  margin-top: 0;
}

address:last-child, blockquote:last-child, figure:last-child,
h1:last-child,
.h1:last-child, h2:last-child, .h2:last-child, h3:last-child, .h3:last-child, h4:last-child, .h4:last-child, h5:last-child, .h5:last-child, h6:last-child, .h6:last-child,
dl:last-child, ol:last-child, ul:last-child, p:last-child, pre:last-child,
form:last-child, fieldset:last-child {
  margin-bottom: 0;
}

/*
 * Remove the gap between audio, canvas, iframes,
 * images, videos and the bottom of their containers:
 * https://github.com/h5bp/html5-boilerplate/issues/440
 */
audio,
canvas,
iframe,
img,
svg,
video {
  vertical-align: middle;
}

/*
 * Work around a Firefox/IE bug where the transparent button background
 * results in a loss of the default button focus styles.
 * Credit: https://github.com/suitcss/base
 */
button:focus {
  outline: 1px dotted;
  outline: 5px auto -webkit-focus-ring-color;
}

fieldset {
  border: 0;
  padding: 0;
}

iframe {
  border: 0;
}

img,
embed,
object,
audio,
video {
  max-width: 100%;
}

img,
video {
  height: auto;
}

table {
  border-collapse: collapse;
  border-spacing: 0;
  margin-top: 0;
}

caption,
td,
th {
  text-align: left;
}

textarea {
  resize: vertical;
}

/*
 * Suppress the focus outline on elements that cannot be accessed via keyboard.
 * This prevents an unwanted focus outline from appearing around elements that
 * might still respond to pointer events.
 * Credit: https://github.com/suitcss/base
 */
[tabindex="-1"]:focus {
  outline: none !important;
}

/*
================================================================================
Page
================================================================================
*/
/*
 * 1. Set the global font-size in ems.
 */
html {
  font-family: "Lato", sans-serif;
  font-size: 1em;
  /* 1 */
  font-weight: 400;
  line-height: 1.6;
  min-height: 100%;
}

body {
  background-color: #f0f2f3;
  color: #3a4148;
  padding: 0;
}

/*
================================================================================
Buttons
================================================================================
*/
button {
  cursor: pointer;
  display: inline-block;
  font-size: 1rem;
  vertical-align: middle;
}

button:disabled {
  cursor: not-allowed;
  filter: saturate(0.7);
  opacity: 0.6;
}

/*
================================================================================
Forms
================================================================================
*/
input,
select,
textarea {
  background-color: #fff;
  border: 1px solid #d6dadd;
  color: #3a4148;
}

input:disabled,
select:disabled,
textarea:disabled {
  cursor: not-allowed;
  filter: saturate(0.7);
  opacity: 0.6;
}

/*
 * Set a gray background for disabled controls.
 */
input:disabled:not([type="submit"]),
select:disabled,
textarea:disabled {
  background-color: #f0f2f3;
}

label,
legend {
  display: inline-block;
  margin-bottom: 0.25em;
  max-width: 100%;
}

option {
  overflow: hidden;
  text-overflow: ellipsis;
  white-space: nowrap;
  padding-bottom: 0.1em;
  padding-top: 0.1em;
}

[type="checkbox"],
[type="radio"] {
  cursor: pointer;
  margin-right: 0.25em;
  vertical-align: baseline;
}

/*
================================================================================
Lists
================================================================================
*/
dd {
  margin-bottom: 0.5rem;
  margin-left: 0;
  font-size: 15px;
}

dt {
  font-weight: 700;
  font-size: 12px;
}

ol, ul {
  margin-left: 1.2rem;
  padding-left: 0;
}

li > ol, li > ul {
  margin-bottom: 0;
}

.list-style-initial {
  list-style-type: initial;
}

/*
================================================================================
Headings
================================================================================
*/
h1, .h1, h2, .h2, h3, .h3, h4, .h4, h5, .h5, h6, .h6 {
  color: #202428;
  font-family: "Lato", sans-serif;
  font-weight: 400;
  line-height: 1.2;
}

h1, .h1 {
  font-size: 2.44rem;
  margin-bottom: 1em;
}

h2, .h2 {
  font-size: 1.95rem;
}

h3, .h3 {
  font-size: 1.56rem;
}

h4, .h4 {
  font-size: 1.25rem;
}

h5, .h5 {
  font-size: 1rem;
}

h6, .h6 {
  font-size: 0.85rem;
}

/*
================================================================================
Text
================================================================================
*/
a {
  color: #39c;
  text-decoration: none;
}

a:focus, a:hover, a:active {
  color: #246b8e;
  text-decoration: underline;
}

blockquote {
  background-color: #f9fafa;
  border-left: 4px solid #e7e9ec;
  margin-bottom: 2rem;
  padding: 2em 2em 2em 4em;
  position: relative;
  quotes: "\201C" "\201D";
}

blockquote::before {
  color: #d6dadd;
  content: open-quote;
  display: block;
  font: 3em/1 "Lato", sans-serif;
  position: absolute;
  top: 0.4em;
  left: 0.4em;
}

figcaption {
  color: #8a96a1;
  font-size: 0.8rem;
  padding-top: 0.25rem;
}

hr {
  border: 0;
  border-top: 1px solid #d6dadd;
  display: block;
  height: 1px;
  margin: 1rem 0;
  padding: 0;
}

/* Semantic inline elements
============================================================================= */
code, kbd, pre, samp, var {
  font-family: monospace;
  font-size: 90%;
}

code,
kbd,
samp {
  display: inline-block;
  line-height: 1;
  padding: 0.3em 0.3em 0.2em;
  position: relative;
  top: -1px;
}

abbr[title] {
  cursor: help;
  -webkit-text-decoration: underline dotted;
          text-decoration: underline dotted;
}

cite {
  color: #8a96a1;
}

code {
  background-color: #f0f2f3;
}

kbd {
  border: 1px solid #d6dadd;
  border-radius: 3px;
}

mark {
  background-color: #ffe86b;
  color: #3a4148;
}

small {
  font-size: 80%;
}

strong {
  font-weight: 700;
}

sub,
sup {
  font-size: 70%;
  line-height: 0;
  margin-left: 0.25em;
}

/*
================================================================================
Box
================================================================================

The box object is just a container with some padding for breathing room.
*/
.box {
  margin-bottom: 1rem;
  padding: 1rem;
}

.box > :last-child {
  margin-bottom: 0;
}

.box--xs {
  padding: 0.5rem;
}

.box--sm {
  padding: 0.75rem;
}

.box--lg {
  padding: 1.5rem;
}

.box--xl {
  padding: 2rem;
}

.box--2xl {
  padding: 3rem;
}

/*
================================================================================
Container
================================================================================

The container object is widely used in a project to wrap the content and
provide some padding between the elements and the edge of the window.

Two types of containers are provided: the `.fluid-container` will
always stretch to fill the full width of the browser window, while
the `.container` is limited to the defined max-width.
*/
.container,
.container-db-student,
.fluid-container {
  padding-left: 15px;
  padding-right: 15px;
  width: 100%;
}

@media (min-width: 20em) {
  .container,
  .container-db-student,
  .fluid-container {
    padding-left: calc(3px + 3.75vw);
  }
}

@media (min-width: 45em) {
  .container,
  .container-db-student,
  .fluid-container {
    padding-left: 30px;
  }
}

@media (min-width: 20em) {
  .container,
  .container-db-student,
  .fluid-container {
    padding-right: calc(3px + 3.75vw);
  }
}

@media (min-width: 45em) {
  .container,
  .container-db-student,
  .fluid-container {
    padding-right: 30px;
  }
}

.container {
  margin-left: auto;
  margin-right: auto;
  max-width: 1170px;
}

.container--admin {
  max-width: 1500px;
}

.container-db-student {
  margin: 0 auto;
  max-width: 1450px;
}

/*
================================================================================
Form control
================================================================================

For grouping a form field and all its related elements (label,
description or validation messages).
*/
.form-control {
  margin-bottom: 1.5rem;
  position: relative;
}

.form-control:last-child {
  margin-bottom: 0;
}

/*
================================================================================
Row
================================================================================

The row object is a flex container for grid columns.
*/
.row {
  display: flex;
  flex-flow: row wrap;
}

@media (min-width: 37.5em) {
  .sm\:row {
    display: flex;
    flex-flow: row wrap;
  }
}

@media (min-width: 45em) {
  .md\:row {
    display: flex;
    flex-flow: row wrap;
  }
}

@media (min-width: 50.625em) {
  .mdf\:row {
    display: flex;
    flex-flow: row wrap;
  }
}

@media (min-width: 60em) {
  .lg\:row {
    display: flex;
    flex-flow: row wrap;
  }
}

@media (min-width: 68.75em) {
  .xl\:row {
    display: flex;
    flex-flow: row wrap;
  }
}

@media (min-width: 81.25em) {
  .xxl\:row {
    display: flex;
    flex-flow: row wrap;
  }
}

@media (min-width: 82.625em) {
  .xxl-e\:row {
    display: flex;
    flex-flow: row wrap;
  }
}

@media (min-width: 100em) {
  .xxxl\:row {
    display: flex;
    flex-flow: row wrap;
  }
}

/*
================================================================================
Columns
================================================================================

Grid columns are built on flexbox and must be used inside a `.row` object
or another flex container to display properly. Widths are set in percentages.

The grid system is based on LostGrid (http://lostgrid.org).
*/
.col {
  flex-grow: 0;
  flex-shrink: 0;
  width: 100%;
}

.col:nth-child(n) {
  margin-left: 0;
  margin-right: 30px;
}

.col:last-child {
  margin-right: 0;
}

.col:nth-child(1n) {
  margin-left: auto;
  margin-right: 0;
}

.col-1\/12 {
  flex-grow: 0;
  flex-shrink: 0;
  width: calc(99.9% * 1/12 - (30px - 1/12 * 30px));
}

.col-1\/12:nth-child(n) {
  margin-left: 0;
  margin-right: 30px;
}

.col-1\/12:last-child {
  margin-right: 0;
}

.col-1\/10 {
  flex-grow: 0;
  flex-shrink: 0;
  width: calc(99.9% * 1/10 - (30px - 1/10 * 30px));
}

.col-1\/10:nth-child(n) {
  margin-left: 0;
  margin-right: 30px;
}

.col-1\/10:last-child {
  margin-right: 0;
}

.col-1\/6 {
  flex-grow: 0;
  flex-shrink: 0;
  width: calc(99.9% * 1/6 - (30px - 1/6 * 30px));
}

.col-1\/6:nth-child(n) {
  margin-left: 0;
  margin-right: 30px;
}

.col-1\/6:last-child {
  margin-right: 0;
}

.col-1\/5 {
  flex-grow: 0;
  flex-shrink: 0;
  width: calc(99.9% * 1/5 - (30px - 1/5 * 30px));
}

.col-1\/5:nth-child(n) {
  margin-left: 0;
  margin-right: 30px;
}

.col-1\/5:last-child {
  margin-right: 0;
}

.col-1\/4 {
  flex-grow: 0;
  flex-shrink: 0;
  width: calc(99.9% * 1/4 - (30px - 1/4 * 30px));
}

.col-1\/4:nth-child(n) {
  margin-left: 0;
  margin-right: 30px;
}

.col-1\/4:last-child {
  margin-right: 0;
}

.col-3\/10 {
  flex-grow: 0;
  flex-shrink: 0;
  width: calc(99.9% * 3/10 - (30px - 3/10 * 30px));
}

.col-3\/10:nth-child(n) {
  margin-left: 0;
  margin-right: 30px;
}

.col-3\/10:last-child {
  margin-right: 0;
}

.col-1\/3 {
  flex-grow: 0;
  flex-shrink: 0;
  width: calc(99.9% * 1/3 - (30px - 1/3 * 30px));
}

.col-1\/3:nth-child(n) {
  margin-left: 0;
  margin-right: 30px;
}

.col-1\/3:last-child {
  margin-right: 0;
}

.col-2\/5 {
  flex-grow: 0;
  flex-shrink: 0;
  width: calc(99.9% * 2/5 - (30px - 2/5 * 30px));
}

.col-2\/5:nth-child(n) {
  margin-left: 0;
  margin-right: 30px;
}

.col-2\/5:last-child {
  margin-right: 0;
}

.col-5\/12 {
  flex-grow: 0;
  flex-shrink: 0;
  width: calc(99.9% * 5/12 - (30px - 5/12 * 30px));
}

.col-5\/12:nth-child(n) {
  margin-left: 0;
  margin-right: 30px;
}

.col-5\/12:last-child {
  margin-right: 0;
}

.col-1\/2 {
  flex-grow: 0;
  flex-shrink: 0;
  width: calc(99.9% * 1/2 - (30px - 1/2 * 30px));
}

.col-1\/2:nth-child(n) {
  margin-left: 0;
  margin-right: 30px;
}

.col-1\/2:last-child {
  margin-right: 0;
}

.col-7\/12 {
  flex-grow: 0;
  flex-shrink: 0;
  width: calc(99.9% * 7/12 - (30px - 7/12 * 30px));
}

.col-7\/12:nth-child(n) {
  margin-left: 0;
  margin-right: 30px;
}

.col-7\/12:last-child {
  margin-right: 0;
}

.col-3\/5 {
  flex-grow: 0;
  flex-shrink: 0;
  width: calc(99.9% * 3/5 - (30px - 3/5 * 30px));
}

.col-3\/5:nth-child(n) {
  margin-left: 0;
  margin-right: 30px;
}

.col-3\/5:last-child {
  margin-right: 0;
}

.col-2\/3 {
  flex-grow: 0;
  flex-shrink: 0;
  width: calc(99.9% * 2/3 - (30px - 2/3 * 30px));
}

.col-2\/3:nth-child(n) {
  margin-left: 0;
  margin-right: 30px;
}

.col-2\/3:last-child {
  margin-right: 0;
}

.col-7\/10 {
  flex-grow: 0;
  flex-shrink: 0;
  width: calc(99.9% * 7/10 - (30px - 7/10 * 30px));
}

.col-7\/10:nth-child(n) {
  margin-left: 0;
  margin-right: 30px;
}

.col-7\/10:last-child {
  margin-right: 0;
}

.col-3\/4 {
  flex-grow: 0;
  flex-shrink: 0;
  width: calc(99.9% * 3/4 - (30px - 3/4 * 30px));
}

.col-3\/4:nth-child(n) {
  margin-left: 0;
  margin-right: 30px;
}

.col-3\/4:last-child {
  margin-right: 0;
}

.col-4\/5 {
  flex-grow: 0;
  flex-shrink: 0;
  width: calc(99.9% * 4/5 - (30px - 4/5 * 30px));
}

.col-4\/5:nth-child(n) {
  margin-left: 0;
  margin-right: 30px;
}

.col-4\/5:last-child {
  margin-right: 0;
}

.col-5\/6 {
  flex-grow: 0;
  flex-shrink: 0;
  width: calc(99.9% * 5/6 - (30px - 5/6 * 30px));
}

.col-5\/6:nth-child(n) {
  margin-left: 0;
  margin-right: 30px;
}

.col-5\/6:last-child {
  margin-right: 0;
}

.col-9\/10 {
  flex-grow: 0;
  flex-shrink: 0;
  width: calc(99.9% * 9/10 - (30px - 9/10 * 30px));
}

.col-9\/10:nth-child(n) {
  margin-left: 0;
  margin-right: 30px;
}

.col-9\/10:last-child {
  margin-right: 0;
}

.col-11\/12 {
  flex-grow: 0;
  flex-shrink: 0;
  width: calc(99.9% * 11/12 - (30px - 11/12 * 30px));
}

.col-11\/12:nth-child(n) {
  margin-left: 0;
  margin-right: 30px;
}

.col-11\/12:last-child {
  margin-right: 0;
}

.col-auto {
  flex: 1;
  width: auto;
}

.col-auto:nth-child(n) {
  margin-left: 0;
  margin-right: 30px;
}

.col-auto:last-child {
  margin-right: 0;
}

@media (min-width: 37.5em) {
  .sm\:col {
    flex-grow: 0;
    flex-shrink: 0;
    width: 100%;
  }
  .sm\:col:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .sm\:col:last-child {
    margin-right: 0;
  }
  .sm\:col:nth-child(1n) {
    margin-left: auto;
    margin-right: 0;
  }
  .sm\:col-1\/12 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/12 - (30px - 1/12 * 30px));
  }
  .sm\:col-1\/12:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .sm\:col-1\/12:last-child {
    margin-right: 0;
  }
  .sm\:col-1\/10 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/10 - (30px - 1/10 * 30px));
  }
  .sm\:col-1\/10:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .sm\:col-1\/10:last-child {
    margin-right: 0;
  }
  .sm\:col-1\/6 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/6 - (30px - 1/6 * 30px));
  }
  .sm\:col-1\/6:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .sm\:col-1\/6:last-child {
    margin-right: 0;
  }
  .sm\:col-1\/5 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/5 - (30px - 1/5 * 30px));
  }
  .sm\:col-1\/5:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .sm\:col-1\/5:last-child {
    margin-right: 0;
  }
  .sm\:col-1\/4 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/4 - (30px - 1/4 * 30px));
  }
  .sm\:col-1\/4:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .sm\:col-1\/4:last-child {
    margin-right: 0;
  }
  .sm\:col-3\/10 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 3/10 - (30px - 3/10 * 30px));
  }
  .sm\:col-3\/10:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .sm\:col-3\/10:last-child {
    margin-right: 0;
  }
  .sm\:col-1\/3 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/3 - (30px - 1/3 * 30px));
  }
  .sm\:col-1\/3:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .sm\:col-1\/3:last-child {
    margin-right: 0;
  }
  .sm\:col-2\/5 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 2/5 - (30px - 2/5 * 30px));
  }
  .sm\:col-2\/5:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .sm\:col-2\/5:last-child {
    margin-right: 0;
  }
  .sm\:col-5\/12 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 5/12 - (30px - 5/12 * 30px));
  }
  .sm\:col-5\/12:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .sm\:col-5\/12:last-child {
    margin-right: 0;
  }
  .sm\:col-1\/2 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/2 - (30px - 1/2 * 30px));
  }
  .sm\:col-1\/2:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .sm\:col-1\/2:last-child {
    margin-right: 0;
  }
  .sm\:col-7\/12 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 7/12 - (30px - 7/12 * 30px));
  }
  .sm\:col-7\/12:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .sm\:col-7\/12:last-child {
    margin-right: 0;
  }
  .sm\:col-3\/5 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 3/5 - (30px - 3/5 * 30px));
  }
  .sm\:col-3\/5:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .sm\:col-3\/5:last-child {
    margin-right: 0;
  }
  .sm\:col-2\/3 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 2/3 - (30px - 2/3 * 30px));
  }
  .sm\:col-2\/3:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .sm\:col-2\/3:last-child {
    margin-right: 0;
  }
  .sm\:col-7\/10 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 7/10 - (30px - 7/10 * 30px));
  }
  .sm\:col-7\/10:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .sm\:col-7\/10:last-child {
    margin-right: 0;
  }
  .sm\:col-3\/4 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 3/4 - (30px - 3/4 * 30px));
  }
  .sm\:col-3\/4:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .sm\:col-3\/4:last-child {
    margin-right: 0;
  }
  .sm\:col-4\/5 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 4/5 - (30px - 4/5 * 30px));
  }
  .sm\:col-4\/5:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .sm\:col-4\/5:last-child {
    margin-right: 0;
  }
  .sm\:col-5\/6 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 5/6 - (30px - 5/6 * 30px));
  }
  .sm\:col-5\/6:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .sm\:col-5\/6:last-child {
    margin-right: 0;
  }
  .sm\:col-9\/10 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 9/10 - (30px - 9/10 * 30px));
  }
  .sm\:col-9\/10:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .sm\:col-9\/10:last-child {
    margin-right: 0;
  }
  .sm\:col-11\/12 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 11/12 - (30px - 11/12 * 30px));
  }
  .sm\:col-11\/12:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .sm\:col-11\/12:last-child {
    margin-right: 0;
  }
  .sm\:col-auto {
    flex: 1;
    width: auto;
  }
  .sm\:col-auto:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .sm\:col-auto:last-child {
    margin-right: 0;
  }
}

@media (min-width: 45em) {
  .md\:col {
    flex-grow: 0;
    flex-shrink: 0;
    width: 100%;
  }
  .md\:col:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .md\:col:last-child {
    margin-right: 0;
  }
  .md\:col:nth-child(1n) {
    margin-left: auto;
    margin-right: 0;
  }
  .md\:col-1\/12 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/12 - (30px - 1/12 * 30px));
  }
  .md\:col-1\/12:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .md\:col-1\/12:last-child {
    margin-right: 0;
  }
  .md\:col-1\/10 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/10 - (30px - 1/10 * 30px));
  }
  .md\:col-1\/10:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .md\:col-1\/10:last-child {
    margin-right: 0;
  }
  .md\:col-1\/6 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/6 - (30px - 1/6 * 30px));
  }
  .md\:col-1\/6:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .md\:col-1\/6:last-child {
    margin-right: 0;
  }
  .md\:col-1\/5 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/5 - (30px - 1/5 * 30px));
  }
  .md\:col-1\/5:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .md\:col-1\/5:last-child {
    margin-right: 0;
  }
  .md\:col-1\/4 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/4 - (30px - 1/4 * 30px));
  }
  .md\:col-1\/4:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .md\:col-1\/4:last-child {
    margin-right: 0;
  }
  .md\:col-3\/10 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 3/10 - (30px - 3/10 * 30px));
  }
  .md\:col-3\/10:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .md\:col-3\/10:last-child {
    margin-right: 0;
  }
  .md\:col-1\/3 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/3 - (30px - 1/3 * 30px));
  }
  .md\:col-1\/3:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .md\:col-1\/3:last-child {
    margin-right: 0;
  }
  .md\:col-2\/5 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 2/5 - (30px - 2/5 * 30px));
  }
  .md\:col-2\/5:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .md\:col-2\/5:last-child {
    margin-right: 0;
  }
  .md\:col-5\/12 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 5/12 - (30px - 5/12 * 30px));
  }
  .md\:col-5\/12:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .md\:col-5\/12:last-child {
    margin-right: 0;
  }
  .md\:col-1\/2 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/2 - (30px - 1/2 * 30px));
  }
  .md\:col-1\/2:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .md\:col-1\/2:last-child {
    margin-right: 0;
  }
  .md\:col-7\/12 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 7/12 - (30px - 7/12 * 30px));
  }
  .md\:col-7\/12:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .md\:col-7\/12:last-child {
    margin-right: 0;
  }
  .md\:col-3\/5 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 3/5 - (30px - 3/5 * 30px));
  }
  .md\:col-3\/5:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .md\:col-3\/5:last-child {
    margin-right: 0;
  }
  .md\:col-2\/3 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 2/3 - (30px - 2/3 * 30px));
  }
  .md\:col-2\/3:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .md\:col-2\/3:last-child {
    margin-right: 0;
  }
  .md\:col-7\/10 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 7/10 - (30px - 7/10 * 30px));
  }
  .md\:col-7\/10:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .md\:col-7\/10:last-child {
    margin-right: 0;
  }
  .md\:col-3\/4 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 3/4 - (30px - 3/4 * 30px));
  }
  .md\:col-3\/4:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .md\:col-3\/4:last-child {
    margin-right: 0;
  }
  .md\:col-4\/5 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 4/5 - (30px - 4/5 * 30px));
  }
  .md\:col-4\/5:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .md\:col-4\/5:last-child {
    margin-right: 0;
  }
  .md\:col-5\/6 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 5/6 - (30px - 5/6 * 30px));
  }
  .md\:col-5\/6:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .md\:col-5\/6:last-child {
    margin-right: 0;
  }
  .md\:col-9\/10 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 9/10 - (30px - 9/10 * 30px));
  }
  .md\:col-9\/10:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .md\:col-9\/10:last-child {
    margin-right: 0;
  }
  .md\:col-11\/12 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 11/12 - (30px - 11/12 * 30px));
  }
  .md\:col-11\/12:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .md\:col-11\/12:last-child {
    margin-right: 0;
  }
  .md\:col-auto {
    flex: 1;
    width: auto;
  }
  .md\:col-auto:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .md\:col-auto:last-child {
    margin-right: 0;
  }
}

@media (min-width: 50.625em) {
  .mdf\:col {
    flex-grow: 0;
    flex-shrink: 0;
    width: 100%;
  }
  .mdf\:col:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .mdf\:col:last-child {
    margin-right: 0;
  }
  .mdf\:col:nth-child(1n) {
    margin-left: auto;
    margin-right: 0;
  }
  .mdf\:col-1\/12 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/12 - (30px - 1/12 * 30px));
  }
  .mdf\:col-1\/12:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .mdf\:col-1\/12:last-child {
    margin-right: 0;
  }
  .mdf\:col-1\/10 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/10 - (30px - 1/10 * 30px));
  }
  .mdf\:col-1\/10:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .mdf\:col-1\/10:last-child {
    margin-right: 0;
  }
  .mdf\:col-1\/6 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/6 - (30px - 1/6 * 30px));
  }
  .mdf\:col-1\/6:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .mdf\:col-1\/6:last-child {
    margin-right: 0;
  }
  .mdf\:col-1\/5 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/5 - (30px - 1/5 * 30px));
  }
  .mdf\:col-1\/5:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .mdf\:col-1\/5:last-child {
    margin-right: 0;
  }
  .mdf\:col-1\/4 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/4 - (30px - 1/4 * 30px));
  }
  .mdf\:col-1\/4:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .mdf\:col-1\/4:last-child {
    margin-right: 0;
  }
  .mdf\:col-3\/10 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 3/10 - (30px - 3/10 * 30px));
  }
  .mdf\:col-3\/10:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .mdf\:col-3\/10:last-child {
    margin-right: 0;
  }
  .mdf\:col-1\/3 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/3 - (30px - 1/3 * 30px));
  }
  .mdf\:col-1\/3:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .mdf\:col-1\/3:last-child {
    margin-right: 0;
  }
  .mdf\:col-2\/5 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 2/5 - (30px - 2/5 * 30px));
  }
  .mdf\:col-2\/5:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .mdf\:col-2\/5:last-child {
    margin-right: 0;
  }
  .mdf\:col-5\/12 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 5/12 - (30px - 5/12 * 30px));
  }
  .mdf\:col-5\/12:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .mdf\:col-5\/12:last-child {
    margin-right: 0;
  }
  .mdf\:col-1\/2 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/2 - (30px - 1/2 * 30px));
  }
  .mdf\:col-1\/2:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .mdf\:col-1\/2:last-child {
    margin-right: 0;
  }
  .mdf\:col-7\/12 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 7/12 - (30px - 7/12 * 30px));
  }
  .mdf\:col-7\/12:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .mdf\:col-7\/12:last-child {
    margin-right: 0;
  }
  .mdf\:col-3\/5 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 3/5 - (30px - 3/5 * 30px));
  }
  .mdf\:col-3\/5:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .mdf\:col-3\/5:last-child {
    margin-right: 0;
  }
  .mdf\:col-2\/3 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 2/3 - (30px - 2/3 * 30px));
  }
  .mdf\:col-2\/3:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .mdf\:col-2\/3:last-child {
    margin-right: 0;
  }
  .mdf\:col-7\/10 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 7/10 - (30px - 7/10 * 30px));
  }
  .mdf\:col-7\/10:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .mdf\:col-7\/10:last-child {
    margin-right: 0;
  }
  .mdf\:col-3\/4 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 3/4 - (30px - 3/4 * 30px));
  }
  .mdf\:col-3\/4:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .mdf\:col-3\/4:last-child {
    margin-right: 0;
  }
  .mdf\:col-4\/5 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 4/5 - (30px - 4/5 * 30px));
  }
  .mdf\:col-4\/5:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .mdf\:col-4\/5:last-child {
    margin-right: 0;
  }
  .mdf\:col-5\/6 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 5/6 - (30px - 5/6 * 30px));
  }
  .mdf\:col-5\/6:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .mdf\:col-5\/6:last-child {
    margin-right: 0;
  }
  .mdf\:col-9\/10 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 9/10 - (30px - 9/10 * 30px));
  }
  .mdf\:col-9\/10:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .mdf\:col-9\/10:last-child {
    margin-right: 0;
  }
  .mdf\:col-11\/12 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 11/12 - (30px - 11/12 * 30px));
  }
  .mdf\:col-11\/12:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .mdf\:col-11\/12:last-child {
    margin-right: 0;
  }
  .mdf\:col-auto {
    flex: 1;
    width: auto;
  }
  .mdf\:col-auto:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .mdf\:col-auto:last-child {
    margin-right: 0;
  }
}

@media (min-width: 60em) {
  .lg\:col {
    flex-grow: 0;
    flex-shrink: 0;
    width: 100%;
  }
  .lg\:col:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .lg\:col:last-child {
    margin-right: 0;
  }
  .lg\:col:nth-child(1n) {
    margin-left: auto;
    margin-right: 0;
  }
  .lg\:col-1\/12 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/12 - (30px - 1/12 * 30px));
  }
  .lg\:col-1\/12:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .lg\:col-1\/12:last-child {
    margin-right: 0;
  }
  .lg\:col-1\/10 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/10 - (30px - 1/10 * 30px));
  }
  .lg\:col-1\/10:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .lg\:col-1\/10:last-child {
    margin-right: 0;
  }
  .lg\:col-1\/6 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/6 - (30px - 1/6 * 30px));
  }
  .lg\:col-1\/6:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .lg\:col-1\/6:last-child {
    margin-right: 0;
  }
  .lg\:col-1\/5 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/5 - (30px - 1/5 * 30px));
  }
  .lg\:col-1\/5:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .lg\:col-1\/5:last-child {
    margin-right: 0;
  }
  .lg\:col-1\/4 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/4 - (30px - 1/4 * 30px));
  }
  .lg\:col-1\/4:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .lg\:col-1\/4:last-child {
    margin-right: 0;
  }
  .lg\:col-3\/10 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 3/10 - (30px - 3/10 * 30px));
  }
  .lg\:col-3\/10:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .lg\:col-3\/10:last-child {
    margin-right: 0;
  }
  .lg\:col-1\/3 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/3 - (30px - 1/3 * 30px));
  }
  .lg\:col-1\/3:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .lg\:col-1\/3:last-child {
    margin-right: 0;
  }
  .lg\:col-2\/5 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 2/5 - (30px - 2/5 * 30px));
  }
  .lg\:col-2\/5:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .lg\:col-2\/5:last-child {
    margin-right: 0;
  }
  .lg\:col-5\/12 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 5/12 - (30px - 5/12 * 30px));
  }
  .lg\:col-5\/12:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .lg\:col-5\/12:last-child {
    margin-right: 0;
  }
  .lg\:col-1\/2 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/2 - (30px - 1/2 * 30px));
  }
  .lg\:col-1\/2:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .lg\:col-1\/2:last-child {
    margin-right: 0;
  }
  .lg\:col-7\/12 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 7/12 - (30px - 7/12 * 30px));
  }
  .lg\:col-7\/12:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .lg\:col-7\/12:last-child {
    margin-right: 0;
  }
  .lg\:col-3\/5 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 3/5 - (30px - 3/5 * 30px));
  }
  .lg\:col-3\/5:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .lg\:col-3\/5:last-child {
    margin-right: 0;
  }
  .lg\:col-2\/3 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 2/3 - (30px - 2/3 * 30px));
  }
  .lg\:col-2\/3:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .lg\:col-2\/3:last-child {
    margin-right: 0;
  }
  .lg\:col-7\/10 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 7/10 - (30px - 7/10 * 30px));
  }
  .lg\:col-7\/10:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .lg\:col-7\/10:last-child {
    margin-right: 0;
  }
  .lg\:col-3\/4 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 3/4 - (30px - 3/4 * 30px));
  }
  .lg\:col-3\/4:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .lg\:col-3\/4:last-child {
    margin-right: 0;
  }
  .lg\:col-4\/5 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 4/5 - (30px - 4/5 * 30px));
  }
  .lg\:col-4\/5:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .lg\:col-4\/5:last-child {
    margin-right: 0;
  }
  .lg\:col-5\/6 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 5/6 - (30px - 5/6 * 30px));
  }
  .lg\:col-5\/6:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .lg\:col-5\/6:last-child {
    margin-right: 0;
  }
  .lg\:col-9\/10 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 9/10 - (30px - 9/10 * 30px));
  }
  .lg\:col-9\/10:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .lg\:col-9\/10:last-child {
    margin-right: 0;
  }
  .lg\:col-11\/12 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 11/12 - (30px - 11/12 * 30px));
  }
  .lg\:col-11\/12:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .lg\:col-11\/12:last-child {
    margin-right: 0;
  }
  .lg\:col-auto {
    flex: 1;
    width: auto;
  }
  .lg\:col-auto:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .lg\:col-auto:last-child {
    margin-right: 0;
  }
}

@media (min-width: 68.75em) {
  .xl\:col {
    flex-grow: 0;
    flex-shrink: 0;
    width: 100%;
  }
  .xl\:col:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xl\:col:last-child {
    margin-right: 0;
  }
  .xl\:col:nth-child(1n) {
    margin-left: auto;
    margin-right: 0;
  }
  .xl\:col-1\/12 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/12 - (30px - 1/12 * 30px));
  }
  .xl\:col-1\/12:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xl\:col-1\/12:last-child {
    margin-right: 0;
  }
  .xl\:col-1\/10 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/10 - (30px - 1/10 * 30px));
  }
  .xl\:col-1\/10:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xl\:col-1\/10:last-child {
    margin-right: 0;
  }
  .xl\:col-1\/6 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/6 - (30px - 1/6 * 30px));
  }
  .xl\:col-1\/6:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xl\:col-1\/6:last-child {
    margin-right: 0;
  }
  .xl\:col-1\/5 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/5 - (30px - 1/5 * 30px));
  }
  .xl\:col-1\/5:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xl\:col-1\/5:last-child {
    margin-right: 0;
  }
  .xl\:col-1\/4 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/4 - (30px - 1/4 * 30px));
  }
  .xl\:col-1\/4:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xl\:col-1\/4:last-child {
    margin-right: 0;
  }
  .xl\:col-3\/10 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 3/10 - (30px - 3/10 * 30px));
  }
  .xl\:col-3\/10:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xl\:col-3\/10:last-child {
    margin-right: 0;
  }
  .xl\:col-1\/3 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/3 - (30px - 1/3 * 30px));
  }
  .xl\:col-1\/3:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xl\:col-1\/3:last-child {
    margin-right: 0;
  }
  .xl\:col-2\/5 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 2/5 - (30px - 2/5 * 30px));
  }
  .xl\:col-2\/5:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xl\:col-2\/5:last-child {
    margin-right: 0;
  }
  .xl\:col-5\/12 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 5/12 - (30px - 5/12 * 30px));
  }
  .xl\:col-5\/12:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xl\:col-5\/12:last-child {
    margin-right: 0;
  }
  .xl\:col-1\/2 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/2 - (30px - 1/2 * 30px));
  }
  .xl\:col-1\/2:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xl\:col-1\/2:last-child {
    margin-right: 0;
  }
  .xl\:col-7\/12 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 7/12 - (30px - 7/12 * 30px));
  }
  .xl\:col-7\/12:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xl\:col-7\/12:last-child {
    margin-right: 0;
  }
  .xl\:col-3\/5 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 3/5 - (30px - 3/5 * 30px));
  }
  .xl\:col-3\/5:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xl\:col-3\/5:last-child {
    margin-right: 0;
  }
  .xl\:col-2\/3 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 2/3 - (30px - 2/3 * 30px));
  }
  .xl\:col-2\/3:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xl\:col-2\/3:last-child {
    margin-right: 0;
  }
  .xl\:col-7\/10 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 7/10 - (30px - 7/10 * 30px));
  }
  .xl\:col-7\/10:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xl\:col-7\/10:last-child {
    margin-right: 0;
  }
  .xl\:col-3\/4 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 3/4 - (30px - 3/4 * 30px));
  }
  .xl\:col-3\/4:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xl\:col-3\/4:last-child {
    margin-right: 0;
  }
  .xl\:col-4\/5 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 4/5 - (30px - 4/5 * 30px));
  }
  .xl\:col-4\/5:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xl\:col-4\/5:last-child {
    margin-right: 0;
  }
  .xl\:col-5\/6 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 5/6 - (30px - 5/6 * 30px));
  }
  .xl\:col-5\/6:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xl\:col-5\/6:last-child {
    margin-right: 0;
  }
  .xl\:col-9\/10 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 9/10 - (30px - 9/10 * 30px));
  }
  .xl\:col-9\/10:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xl\:col-9\/10:last-child {
    margin-right: 0;
  }
  .xl\:col-11\/12 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 11/12 - (30px - 11/12 * 30px));
  }
  .xl\:col-11\/12:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xl\:col-11\/12:last-child {
    margin-right: 0;
  }
  .xl\:col-auto {
    flex: 1;
    width: auto;
  }
  .xl\:col-auto:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xl\:col-auto:last-child {
    margin-right: 0;
  }
}

@media (min-width: 81.25em) {
  .xxl\:col {
    flex-grow: 0;
    flex-shrink: 0;
    width: 100%;
  }
  .xxl\:col:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl\:col:last-child {
    margin-right: 0;
  }
  .xxl\:col:nth-child(1n) {
    margin-left: auto;
    margin-right: 0;
  }
  .xxl\:col-1\/12 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/12 - (30px - 1/12 * 30px));
  }
  .xxl\:col-1\/12:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl\:col-1\/12:last-child {
    margin-right: 0;
  }
  .xxl\:col-1\/10 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/10 - (30px - 1/10 * 30px));
  }
  .xxl\:col-1\/10:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl\:col-1\/10:last-child {
    margin-right: 0;
  }
  .xxl\:col-1\/6 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/6 - (30px - 1/6 * 30px));
  }
  .xxl\:col-1\/6:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl\:col-1\/6:last-child {
    margin-right: 0;
  }
  .xxl\:col-1\/5 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/5 - (30px - 1/5 * 30px));
  }
  .xxl\:col-1\/5:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl\:col-1\/5:last-child {
    margin-right: 0;
  }
  .xxl\:col-1\/4 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/4 - (30px - 1/4 * 30px));
  }
  .xxl\:col-1\/4:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl\:col-1\/4:last-child {
    margin-right: 0;
  }
  .xxl\:col-3\/10 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 3/10 - (30px - 3/10 * 30px));
  }
  .xxl\:col-3\/10:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl\:col-3\/10:last-child {
    margin-right: 0;
  }
  .xxl\:col-1\/3 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/3 - (30px - 1/3 * 30px));
  }
  .xxl\:col-1\/3:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl\:col-1\/3:last-child {
    margin-right: 0;
  }
  .xxl\:col-2\/5 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 2/5 - (30px - 2/5 * 30px));
  }
  .xxl\:col-2\/5:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl\:col-2\/5:last-child {
    margin-right: 0;
  }
  .xxl\:col-5\/12 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 5/12 - (30px - 5/12 * 30px));
  }
  .xxl\:col-5\/12:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl\:col-5\/12:last-child {
    margin-right: 0;
  }
  .xxl\:col-1\/2 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/2 - (30px - 1/2 * 30px));
  }
  .xxl\:col-1\/2:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl\:col-1\/2:last-child {
    margin-right: 0;
  }
  .xxl\:col-7\/12 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 7/12 - (30px - 7/12 * 30px));
  }
  .xxl\:col-7\/12:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl\:col-7\/12:last-child {
    margin-right: 0;
  }
  .xxl\:col-3\/5 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 3/5 - (30px - 3/5 * 30px));
  }
  .xxl\:col-3\/5:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl\:col-3\/5:last-child {
    margin-right: 0;
  }
  .xxl\:col-2\/3 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 2/3 - (30px - 2/3 * 30px));
  }
  .xxl\:col-2\/3:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl\:col-2\/3:last-child {
    margin-right: 0;
  }
  .xxl\:col-7\/10 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 7/10 - (30px - 7/10 * 30px));
  }
  .xxl\:col-7\/10:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl\:col-7\/10:last-child {
    margin-right: 0;
  }
  .xxl\:col-3\/4 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 3/4 - (30px - 3/4 * 30px));
  }
  .xxl\:col-3\/4:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl\:col-3\/4:last-child {
    margin-right: 0;
  }
  .xxl\:col-4\/5 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 4/5 - (30px - 4/5 * 30px));
  }
  .xxl\:col-4\/5:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl\:col-4\/5:last-child {
    margin-right: 0;
  }
  .xxl\:col-5\/6 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 5/6 - (30px - 5/6 * 30px));
  }
  .xxl\:col-5\/6:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl\:col-5\/6:last-child {
    margin-right: 0;
  }
  .xxl\:col-9\/10 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 9/10 - (30px - 9/10 * 30px));
  }
  .xxl\:col-9\/10:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl\:col-9\/10:last-child {
    margin-right: 0;
  }
  .xxl\:col-11\/12 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 11/12 - (30px - 11/12 * 30px));
  }
  .xxl\:col-11\/12:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl\:col-11\/12:last-child {
    margin-right: 0;
  }
  .xxl\:col-auto {
    flex: 1;
    width: auto;
  }
  .xxl\:col-auto:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl\:col-auto:last-child {
    margin-right: 0;
  }
}

@media (min-width: 82.625em) {
  .xxl-e\:col {
    flex-grow: 0;
    flex-shrink: 0;
    width: 100%;
  }
  .xxl-e\:col:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl-e\:col:last-child {
    margin-right: 0;
  }
  .xxl-e\:col:nth-child(1n) {
    margin-left: auto;
    margin-right: 0;
  }
  .xxl-e\:col-1\/12 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/12 - (30px - 1/12 * 30px));
  }
  .xxl-e\:col-1\/12:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl-e\:col-1\/12:last-child {
    margin-right: 0;
  }
  .xxl-e\:col-1\/10 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/10 - (30px - 1/10 * 30px));
  }
  .xxl-e\:col-1\/10:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl-e\:col-1\/10:last-child {
    margin-right: 0;
  }
  .xxl-e\:col-1\/6 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/6 - (30px - 1/6 * 30px));
  }
  .xxl-e\:col-1\/6:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl-e\:col-1\/6:last-child {
    margin-right: 0;
  }
  .xxl-e\:col-1\/5 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/5 - (30px - 1/5 * 30px));
  }
  .xxl-e\:col-1\/5:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl-e\:col-1\/5:last-child {
    margin-right: 0;
  }
  .xxl-e\:col-1\/4 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/4 - (30px - 1/4 * 30px));
  }
  .xxl-e\:col-1\/4:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl-e\:col-1\/4:last-child {
    margin-right: 0;
  }
  .xxl-e\:col-3\/10 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 3/10 - (30px - 3/10 * 30px));
  }
  .xxl-e\:col-3\/10:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl-e\:col-3\/10:last-child {
    margin-right: 0;
  }
  .xxl-e\:col-1\/3 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/3 - (30px - 1/3 * 30px));
  }
  .xxl-e\:col-1\/3:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl-e\:col-1\/3:last-child {
    margin-right: 0;
  }
  .xxl-e\:col-2\/5 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 2/5 - (30px - 2/5 * 30px));
  }
  .xxl-e\:col-2\/5:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl-e\:col-2\/5:last-child {
    margin-right: 0;
  }
  .xxl-e\:col-5\/12 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 5/12 - (30px - 5/12 * 30px));
  }
  .xxl-e\:col-5\/12:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl-e\:col-5\/12:last-child {
    margin-right: 0;
  }
  .xxl-e\:col-1\/2 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/2 - (30px - 1/2 * 30px));
  }
  .xxl-e\:col-1\/2:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl-e\:col-1\/2:last-child {
    margin-right: 0;
  }
  .xxl-e\:col-7\/12 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 7/12 - (30px - 7/12 * 30px));
  }
  .xxl-e\:col-7\/12:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl-e\:col-7\/12:last-child {
    margin-right: 0;
  }
  .xxl-e\:col-3\/5 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 3/5 - (30px - 3/5 * 30px));
  }
  .xxl-e\:col-3\/5:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl-e\:col-3\/5:last-child {
    margin-right: 0;
  }
  .xxl-e\:col-2\/3 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 2/3 - (30px - 2/3 * 30px));
  }
  .xxl-e\:col-2\/3:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl-e\:col-2\/3:last-child {
    margin-right: 0;
  }
  .xxl-e\:col-7\/10 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 7/10 - (30px - 7/10 * 30px));
  }
  .xxl-e\:col-7\/10:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl-e\:col-7\/10:last-child {
    margin-right: 0;
  }
  .xxl-e\:col-3\/4 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 3/4 - (30px - 3/4 * 30px));
  }
  .xxl-e\:col-3\/4:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl-e\:col-3\/4:last-child {
    margin-right: 0;
  }
  .xxl-e\:col-4\/5 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 4/5 - (30px - 4/5 * 30px));
  }
  .xxl-e\:col-4\/5:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl-e\:col-4\/5:last-child {
    margin-right: 0;
  }
  .xxl-e\:col-5\/6 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 5/6 - (30px - 5/6 * 30px));
  }
  .xxl-e\:col-5\/6:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl-e\:col-5\/6:last-child {
    margin-right: 0;
  }
  .xxl-e\:col-9\/10 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 9/10 - (30px - 9/10 * 30px));
  }
  .xxl-e\:col-9\/10:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl-e\:col-9\/10:last-child {
    margin-right: 0;
  }
  .xxl-e\:col-11\/12 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 11/12 - (30px - 11/12 * 30px));
  }
  .xxl-e\:col-11\/12:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl-e\:col-11\/12:last-child {
    margin-right: 0;
  }
  .xxl-e\:col-auto {
    flex: 1;
    width: auto;
  }
  .xxl-e\:col-auto:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxl-e\:col-auto:last-child {
    margin-right: 0;
  }
}

@media (min-width: 100em) {
  .xxxl\:col {
    flex-grow: 0;
    flex-shrink: 0;
    width: 100%;
  }
  .xxxl\:col:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxxl\:col:last-child {
    margin-right: 0;
  }
  .xxxl\:col:nth-child(1n) {
    margin-left: auto;
    margin-right: 0;
  }
  .xxxl\:col-1\/12 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/12 - (30px - 1/12 * 30px));
  }
  .xxxl\:col-1\/12:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxxl\:col-1\/12:last-child {
    margin-right: 0;
  }
  .xxxl\:col-1\/10 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/10 - (30px - 1/10 * 30px));
  }
  .xxxl\:col-1\/10:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxxl\:col-1\/10:last-child {
    margin-right: 0;
  }
  .xxxl\:col-1\/6 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/6 - (30px - 1/6 * 30px));
  }
  .xxxl\:col-1\/6:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxxl\:col-1\/6:last-child {
    margin-right: 0;
  }
  .xxxl\:col-1\/5 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/5 - (30px - 1/5 * 30px));
  }
  .xxxl\:col-1\/5:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxxl\:col-1\/5:last-child {
    margin-right: 0;
  }
  .xxxl\:col-1\/4 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/4 - (30px - 1/4 * 30px));
  }
  .xxxl\:col-1\/4:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxxl\:col-1\/4:last-child {
    margin-right: 0;
  }
  .xxxl\:col-3\/10 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 3/10 - (30px - 3/10 * 30px));
  }
  .xxxl\:col-3\/10:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxxl\:col-3\/10:last-child {
    margin-right: 0;
  }
  .xxxl\:col-1\/3 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/3 - (30px - 1/3 * 30px));
  }
  .xxxl\:col-1\/3:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxxl\:col-1\/3:last-child {
    margin-right: 0;
  }
  .xxxl\:col-2\/5 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 2/5 - (30px - 2/5 * 30px));
  }
  .xxxl\:col-2\/5:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxxl\:col-2\/5:last-child {
    margin-right: 0;
  }
  .xxxl\:col-5\/12 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 5/12 - (30px - 5/12 * 30px));
  }
  .xxxl\:col-5\/12:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxxl\:col-5\/12:last-child {
    margin-right: 0;
  }
  .xxxl\:col-1\/2 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/2 - (30px - 1/2 * 30px));
  }
  .xxxl\:col-1\/2:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxxl\:col-1\/2:last-child {
    margin-right: 0;
  }
  .xxxl\:col-7\/12 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 7/12 - (30px - 7/12 * 30px));
  }
  .xxxl\:col-7\/12:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxxl\:col-7\/12:last-child {
    margin-right: 0;
  }
  .xxxl\:col-3\/5 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 3/5 - (30px - 3/5 * 30px));
  }
  .xxxl\:col-3\/5:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxxl\:col-3\/5:last-child {
    margin-right: 0;
  }
  .xxxl\:col-2\/3 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 2/3 - (30px - 2/3 * 30px));
  }
  .xxxl\:col-2\/3:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxxl\:col-2\/3:last-child {
    margin-right: 0;
  }
  .xxxl\:col-7\/10 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 7/10 - (30px - 7/10 * 30px));
  }
  .xxxl\:col-7\/10:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxxl\:col-7\/10:last-child {
    margin-right: 0;
  }
  .xxxl\:col-3\/4 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 3/4 - (30px - 3/4 * 30px));
  }
  .xxxl\:col-3\/4:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxxl\:col-3\/4:last-child {
    margin-right: 0;
  }
  .xxxl\:col-4\/5 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 4/5 - (30px - 4/5 * 30px));
  }
  .xxxl\:col-4\/5:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxxl\:col-4\/5:last-child {
    margin-right: 0;
  }
  .xxxl\:col-5\/6 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 5/6 - (30px - 5/6 * 30px));
  }
  .xxxl\:col-5\/6:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxxl\:col-5\/6:last-child {
    margin-right: 0;
  }
  .xxxl\:col-9\/10 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 9/10 - (30px - 9/10 * 30px));
  }
  .xxxl\:col-9\/10:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxxl\:col-9\/10:last-child {
    margin-right: 0;
  }
  .xxxl\:col-11\/12 {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 11/12 - (30px - 11/12 * 30px));
  }
  .xxxl\:col-11\/12:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxxl\:col-11\/12:last-child {
    margin-right: 0;
  }
  .xxxl\:col-auto {
    flex: 1;
    width: auto;
  }
  .xxxl\:col-auto:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .xxxl\:col-auto:last-child {
    margin-right: 0;
  }
}

/*
================================================================================
Offset
================================================================================

The offset object allows you to move grid columns to the right.
*/
:root .offset-0 {
  margin-left: 0;
}

:root .offset-1\/12 {
  margin-left: calc(99.9% * 1/12 + 1/12 * 30px);
}

:root .offset-1\/10 {
  margin-left: calc(99.9% * 1/10 + 1/10 * 30px);
}

:root .offset-1\/6 {
  margin-left: calc(99.9% * 1/6 + 1/6 * 30px);
}

:root .offset-1\/5 {
  margin-left: calc(99.9% * 1/5 + 1/5 * 30px);
}

:root .offset-1\/4 {
  margin-left: calc(99.9% * 1/4 + 1/4 * 30px);
}

:root .offset-3\/10 {
  margin-left: calc(99.9% * 3/10 + 3/10 * 30px);
}

:root .offset-1\/3 {
  margin-left: calc(99.9% * 1/3 + 1/3 * 30px);
}

:root .offset-2\/5 {
  margin-left: calc(99.9% * 2/5 + 2/5 * 30px);
}

:root .offset-5\/12 {
  margin-left: calc(99.9% * 5/12 + 5/12 * 30px);
}

:root .offset-1\/2 {
  margin-left: calc(99.9% * 1/2 + 1/2 * 30px);
}

:root .offset-7\/12 {
  margin-left: calc(99.9% * 7/12 + 7/12 * 30px);
}

:root .offset-3\/5 {
  margin-left: calc(99.9% * 3/5 + 3/5 * 30px);
}

:root .offset-2\/3 {
  margin-left: calc(99.9% * 2/3 + 2/3 * 30px);
}

:root .offset-7\/10 {
  margin-left: calc(99.9% * 7/10 + 7/10 * 30px);
}

:root .offset-3\/4 {
  margin-left: calc(99.9% * 3/4 + 3/4 * 30px);
}

:root .offset-4\/5 {
  margin-left: calc(99.9% * 4/5 + 4/5 * 30px);
}

:root .offset-5\/6 {
  margin-left: calc(99.9% * 5/6 + 5/6 * 30px);
}

:root .offset-9\/10 {
  margin-left: calc(99.9% * 9/10 + 9/10 * 30px);
}

:root .offset-11\/12 {
  margin-left: calc(99.9% * 11/12 + 11/12 * 30px);
}

@media (min-width: 37.5em) {
  :root .sm\:offset-0 {
    margin-left: 0;
  }
  :root .sm\:offset-1\/12 {
    margin-left: calc(99.9% * 1/12 + 1/12 * 30px);
  }
  :root .sm\:offset-1\/10 {
    margin-left: calc(99.9% * 1/10 + 1/10 * 30px);
  }
  :root .sm\:offset-1\/6 {
    margin-left: calc(99.9% * 1/6 + 1/6 * 30px);
  }
  :root .sm\:offset-1\/5 {
    margin-left: calc(99.9% * 1/5 + 1/5 * 30px);
  }
  :root .sm\:offset-1\/4 {
    margin-left: calc(99.9% * 1/4 + 1/4 * 30px);
  }
  :root .sm\:offset-3\/10 {
    margin-left: calc(99.9% * 3/10 + 3/10 * 30px);
  }
  :root .sm\:offset-1\/3 {
    margin-left: calc(99.9% * 1/3 + 1/3 * 30px);
  }
  :root .sm\:offset-2\/5 {
    margin-left: calc(99.9% * 2/5 + 2/5 * 30px);
  }
  :root .sm\:offset-5\/12 {
    margin-left: calc(99.9% * 5/12 + 5/12 * 30px);
  }
  :root .sm\:offset-1\/2 {
    margin-left: calc(99.9% * 1/2 + 1/2 * 30px);
  }
  :root .sm\:offset-7\/12 {
    margin-left: calc(99.9% * 7/12 + 7/12 * 30px);
  }
  :root .sm\:offset-3\/5 {
    margin-left: calc(99.9% * 3/5 + 3/5 * 30px);
  }
  :root .sm\:offset-2\/3 {
    margin-left: calc(99.9% * 2/3 + 2/3 * 30px);
  }
  :root .sm\:offset-7\/10 {
    margin-left: calc(99.9% * 7/10 + 7/10 * 30px);
  }
  :root .sm\:offset-3\/4 {
    margin-left: calc(99.9% * 3/4 + 3/4 * 30px);
  }
  :root .sm\:offset-4\/5 {
    margin-left: calc(99.9% * 4/5 + 4/5 * 30px);
  }
  :root .sm\:offset-5\/6 {
    margin-left: calc(99.9% * 5/6 + 5/6 * 30px);
  }
  :root .sm\:offset-9\/10 {
    margin-left: calc(99.9% * 9/10 + 9/10 * 30px);
  }
  :root .sm\:offset-11\/12 {
    margin-left: calc(99.9% * 11/12 + 11/12 * 30px);
  }
}

@media (min-width: 45em) {
  :root .md\:offset-0 {
    margin-left: 0;
  }
  :root .md\:offset-1\/12 {
    margin-left: calc(99.9% * 1/12 + 1/12 * 30px);
  }
  :root .md\:offset-1\/10 {
    margin-left: calc(99.9% * 1/10 + 1/10 * 30px);
  }
  :root .md\:offset-1\/6 {
    margin-left: calc(99.9% * 1/6 + 1/6 * 30px);
  }
  :root .md\:offset-1\/5 {
    margin-left: calc(99.9% * 1/5 + 1/5 * 30px);
  }
  :root .md\:offset-1\/4 {
    margin-left: calc(99.9% * 1/4 + 1/4 * 30px);
  }
  :root .md\:offset-3\/10 {
    margin-left: calc(99.9% * 3/10 + 3/10 * 30px);
  }
  :root .md\:offset-1\/3 {
    margin-left: calc(99.9% * 1/3 + 1/3 * 30px);
  }
  :root .md\:offset-2\/5 {
    margin-left: calc(99.9% * 2/5 + 2/5 * 30px);
  }
  :root .md\:offset-5\/12 {
    margin-left: calc(99.9% * 5/12 + 5/12 * 30px);
  }
  :root .md\:offset-1\/2 {
    margin-left: calc(99.9% * 1/2 + 1/2 * 30px);
  }
  :root .md\:offset-7\/12 {
    margin-left: calc(99.9% * 7/12 + 7/12 * 30px);
  }
  :root .md\:offset-3\/5 {
    margin-left: calc(99.9% * 3/5 + 3/5 * 30px);
  }
  :root .md\:offset-2\/3 {
    margin-left: calc(99.9% * 2/3 + 2/3 * 30px);
  }
  :root .md\:offset-7\/10 {
    margin-left: calc(99.9% * 7/10 + 7/10 * 30px);
  }
  :root .md\:offset-3\/4 {
    margin-left: calc(99.9% * 3/4 + 3/4 * 30px);
  }
  :root .md\:offset-4\/5 {
    margin-left: calc(99.9% * 4/5 + 4/5 * 30px);
  }
  :root .md\:offset-5\/6 {
    margin-left: calc(99.9% * 5/6 + 5/6 * 30px);
  }
  :root .md\:offset-9\/10 {
    margin-left: calc(99.9% * 9/10 + 9/10 * 30px);
  }
  :root .md\:offset-11\/12 {
    margin-left: calc(99.9% * 11/12 + 11/12 * 30px);
  }
}

@media (min-width: 50.625em) {
  :root .mdf\:offset-0 {
    margin-left: 0;
  }
  :root .mdf\:offset-1\/12 {
    margin-left: calc(99.9% * 1/12 + 1/12 * 30px);
  }
  :root .mdf\:offset-1\/10 {
    margin-left: calc(99.9% * 1/10 + 1/10 * 30px);
  }
  :root .mdf\:offset-1\/6 {
    margin-left: calc(99.9% * 1/6 + 1/6 * 30px);
  }
  :root .mdf\:offset-1\/5 {
    margin-left: calc(99.9% * 1/5 + 1/5 * 30px);
  }
  :root .mdf\:offset-1\/4 {
    margin-left: calc(99.9% * 1/4 + 1/4 * 30px);
  }
  :root .mdf\:offset-3\/10 {
    margin-left: calc(99.9% * 3/10 + 3/10 * 30px);
  }
  :root .mdf\:offset-1\/3 {
    margin-left: calc(99.9% * 1/3 + 1/3 * 30px);
  }
  :root .mdf\:offset-2\/5 {
    margin-left: calc(99.9% * 2/5 + 2/5 * 30px);
  }
  :root .mdf\:offset-5\/12 {
    margin-left: calc(99.9% * 5/12 + 5/12 * 30px);
  }
  :root .mdf\:offset-1\/2 {
    margin-left: calc(99.9% * 1/2 + 1/2 * 30px);
  }
  :root .mdf\:offset-7\/12 {
    margin-left: calc(99.9% * 7/12 + 7/12 * 30px);
  }
  :root .mdf\:offset-3\/5 {
    margin-left: calc(99.9% * 3/5 + 3/5 * 30px);
  }
  :root .mdf\:offset-2\/3 {
    margin-left: calc(99.9% * 2/3 + 2/3 * 30px);
  }
  :root .mdf\:offset-7\/10 {
    margin-left: calc(99.9% * 7/10 + 7/10 * 30px);
  }
  :root .mdf\:offset-3\/4 {
    margin-left: calc(99.9% * 3/4 + 3/4 * 30px);
  }
  :root .mdf\:offset-4\/5 {
    margin-left: calc(99.9% * 4/5 + 4/5 * 30px);
  }
  :root .mdf\:offset-5\/6 {
    margin-left: calc(99.9% * 5/6 + 5/6 * 30px);
  }
  :root .mdf\:offset-9\/10 {
    margin-left: calc(99.9% * 9/10 + 9/10 * 30px);
  }
  :root .mdf\:offset-11\/12 {
    margin-left: calc(99.9% * 11/12 + 11/12 * 30px);
  }
}

@media (min-width: 60em) {
  :root .lg\:offset-0 {
    margin-left: 0;
  }
  :root .lg\:offset-1\/12 {
    margin-left: calc(99.9% * 1/12 + 1/12 * 30px);
  }
  :root .lg\:offset-1\/10 {
    margin-left: calc(99.9% * 1/10 + 1/10 * 30px);
  }
  :root .lg\:offset-1\/6 {
    margin-left: calc(99.9% * 1/6 + 1/6 * 30px);
  }
  :root .lg\:offset-1\/5 {
    margin-left: calc(99.9% * 1/5 + 1/5 * 30px);
  }
  :root .lg\:offset-1\/4 {
    margin-left: calc(99.9% * 1/4 + 1/4 * 30px);
  }
  :root .lg\:offset-3\/10 {
    margin-left: calc(99.9% * 3/10 + 3/10 * 30px);
  }
  :root .lg\:offset-1\/3 {
    margin-left: calc(99.9% * 1/3 + 1/3 * 30px);
  }
  :root .lg\:offset-2\/5 {
    margin-left: calc(99.9% * 2/5 + 2/5 * 30px);
  }
  :root .lg\:offset-5\/12 {
    margin-left: calc(99.9% * 5/12 + 5/12 * 30px);
  }
  :root .lg\:offset-1\/2 {
    margin-left: calc(99.9% * 1/2 + 1/2 * 30px);
  }
  :root .lg\:offset-7\/12 {
    margin-left: calc(99.9% * 7/12 + 7/12 * 30px);
  }
  :root .lg\:offset-3\/5 {
    margin-left: calc(99.9% * 3/5 + 3/5 * 30px);
  }
  :root .lg\:offset-2\/3 {
    margin-left: calc(99.9% * 2/3 + 2/3 * 30px);
  }
  :root .lg\:offset-7\/10 {
    margin-left: calc(99.9% * 7/10 + 7/10 * 30px);
  }
  :root .lg\:offset-3\/4 {
    margin-left: calc(99.9% * 3/4 + 3/4 * 30px);
  }
  :root .lg\:offset-4\/5 {
    margin-left: calc(99.9% * 4/5 + 4/5 * 30px);
  }
  :root .lg\:offset-5\/6 {
    margin-left: calc(99.9% * 5/6 + 5/6 * 30px);
  }
  :root .lg\:offset-9\/10 {
    margin-left: calc(99.9% * 9/10 + 9/10 * 30px);
  }
  :root .lg\:offset-11\/12 {
    margin-left: calc(99.9% * 11/12 + 11/12 * 30px);
  }
}

@media (min-width: 68.75em) {
  :root .xl\:offset-0 {
    margin-left: 0;
  }
  :root .xl\:offset-1\/12 {
    margin-left: calc(99.9% * 1/12 + 1/12 * 30px);
  }
  :root .xl\:offset-1\/10 {
    margin-left: calc(99.9% * 1/10 + 1/10 * 30px);
  }
  :root .xl\:offset-1\/6 {
    margin-left: calc(99.9% * 1/6 + 1/6 * 30px);
  }
  :root .xl\:offset-1\/5 {
    margin-left: calc(99.9% * 1/5 + 1/5 * 30px);
  }
  :root .xl\:offset-1\/4 {
    margin-left: calc(99.9% * 1/4 + 1/4 * 30px);
  }
  :root .xl\:offset-3\/10 {
    margin-left: calc(99.9% * 3/10 + 3/10 * 30px);
  }
  :root .xl\:offset-1\/3 {
    margin-left: calc(99.9% * 1/3 + 1/3 * 30px);
  }
  :root .xl\:offset-2\/5 {
    margin-left: calc(99.9% * 2/5 + 2/5 * 30px);
  }
  :root .xl\:offset-5\/12 {
    margin-left: calc(99.9% * 5/12 + 5/12 * 30px);
  }
  :root .xl\:offset-1\/2 {
    margin-left: calc(99.9% * 1/2 + 1/2 * 30px);
  }
  :root .xl\:offset-7\/12 {
    margin-left: calc(99.9% * 7/12 + 7/12 * 30px);
  }
  :root .xl\:offset-3\/5 {
    margin-left: calc(99.9% * 3/5 + 3/5 * 30px);
  }
  :root .xl\:offset-2\/3 {
    margin-left: calc(99.9% * 2/3 + 2/3 * 30px);
  }
  :root .xl\:offset-7\/10 {
    margin-left: calc(99.9% * 7/10 + 7/10 * 30px);
  }
  :root .xl\:offset-3\/4 {
    margin-left: calc(99.9% * 3/4 + 3/4 * 30px);
  }
  :root .xl\:offset-4\/5 {
    margin-left: calc(99.9% * 4/5 + 4/5 * 30px);
  }
  :root .xl\:offset-5\/6 {
    margin-left: calc(99.9% * 5/6 + 5/6 * 30px);
  }
  :root .xl\:offset-9\/10 {
    margin-left: calc(99.9% * 9/10 + 9/10 * 30px);
  }
  :root .xl\:offset-11\/12 {
    margin-left: calc(99.9% * 11/12 + 11/12 * 30px);
  }
}

@media (min-width: 81.25em) {
  :root .xxl\:offset-0 {
    margin-left: 0;
  }
  :root .xxl\:offset-1\/12 {
    margin-left: calc(99.9% * 1/12 + 1/12 * 30px);
  }
  :root .xxl\:offset-1\/10 {
    margin-left: calc(99.9% * 1/10 + 1/10 * 30px);
  }
  :root .xxl\:offset-1\/6 {
    margin-left: calc(99.9% * 1/6 + 1/6 * 30px);
  }
  :root .xxl\:offset-1\/5 {
    margin-left: calc(99.9% * 1/5 + 1/5 * 30px);
  }
  :root .xxl\:offset-1\/4 {
    margin-left: calc(99.9% * 1/4 + 1/4 * 30px);
  }
  :root .xxl\:offset-3\/10 {
    margin-left: calc(99.9% * 3/10 + 3/10 * 30px);
  }
  :root .xxl\:offset-1\/3 {
    margin-left: calc(99.9% * 1/3 + 1/3 * 30px);
  }
  :root .xxl\:offset-2\/5 {
    margin-left: calc(99.9% * 2/5 + 2/5 * 30px);
  }
  :root .xxl\:offset-5\/12 {
    margin-left: calc(99.9% * 5/12 + 5/12 * 30px);
  }
  :root .xxl\:offset-1\/2 {
    margin-left: calc(99.9% * 1/2 + 1/2 * 30px);
  }
  :root .xxl\:offset-7\/12 {
    margin-left: calc(99.9% * 7/12 + 7/12 * 30px);
  }
  :root .xxl\:offset-3\/5 {
    margin-left: calc(99.9% * 3/5 + 3/5 * 30px);
  }
  :root .xxl\:offset-2\/3 {
    margin-left: calc(99.9% * 2/3 + 2/3 * 30px);
  }
  :root .xxl\:offset-7\/10 {
    margin-left: calc(99.9% * 7/10 + 7/10 * 30px);
  }
  :root .xxl\:offset-3\/4 {
    margin-left: calc(99.9% * 3/4 + 3/4 * 30px);
  }
  :root .xxl\:offset-4\/5 {
    margin-left: calc(99.9% * 4/5 + 4/5 * 30px);
  }
  :root .xxl\:offset-5\/6 {
    margin-left: calc(99.9% * 5/6 + 5/6 * 30px);
  }
  :root .xxl\:offset-9\/10 {
    margin-left: calc(99.9% * 9/10 + 9/10 * 30px);
  }
  :root .xxl\:offset-11\/12 {
    margin-left: calc(99.9% * 11/12 + 11/12 * 30px);
  }
}

@media (min-width: 82.625em) {
  :root .xxl-e\:offset-0 {
    margin-left: 0;
  }
  :root .xxl-e\:offset-1\/12 {
    margin-left: calc(99.9% * 1/12 + 1/12 * 30px);
  }
  :root .xxl-e\:offset-1\/10 {
    margin-left: calc(99.9% * 1/10 + 1/10 * 30px);
  }
  :root .xxl-e\:offset-1\/6 {
    margin-left: calc(99.9% * 1/6 + 1/6 * 30px);
  }
  :root .xxl-e\:offset-1\/5 {
    margin-left: calc(99.9% * 1/5 + 1/5 * 30px);
  }
  :root .xxl-e\:offset-1\/4 {
    margin-left: calc(99.9% * 1/4 + 1/4 * 30px);
  }
  :root .xxl-e\:offset-3\/10 {
    margin-left: calc(99.9% * 3/10 + 3/10 * 30px);
  }
  :root .xxl-e\:offset-1\/3 {
    margin-left: calc(99.9% * 1/3 + 1/3 * 30px);
  }
  :root .xxl-e\:offset-2\/5 {
    margin-left: calc(99.9% * 2/5 + 2/5 * 30px);
  }
  :root .xxl-e\:offset-5\/12 {
    margin-left: calc(99.9% * 5/12 + 5/12 * 30px);
  }
  :root .xxl-e\:offset-1\/2 {
    margin-left: calc(99.9% * 1/2 + 1/2 * 30px);
  }
  :root .xxl-e\:offset-7\/12 {
    margin-left: calc(99.9% * 7/12 + 7/12 * 30px);
  }
  :root .xxl-e\:offset-3\/5 {
    margin-left: calc(99.9% * 3/5 + 3/5 * 30px);
  }
  :root .xxl-e\:offset-2\/3 {
    margin-left: calc(99.9% * 2/3 + 2/3 * 30px);
  }
  :root .xxl-e\:offset-7\/10 {
    margin-left: calc(99.9% * 7/10 + 7/10 * 30px);
  }
  :root .xxl-e\:offset-3\/4 {
    margin-left: calc(99.9% * 3/4 + 3/4 * 30px);
  }
  :root .xxl-e\:offset-4\/5 {
    margin-left: calc(99.9% * 4/5 + 4/5 * 30px);
  }
  :root .xxl-e\:offset-5\/6 {
    margin-left: calc(99.9% * 5/6 + 5/6 * 30px);
  }
  :root .xxl-e\:offset-9\/10 {
    margin-left: calc(99.9% * 9/10 + 9/10 * 30px);
  }
  :root .xxl-e\:offset-11\/12 {
    margin-left: calc(99.9% * 11/12 + 11/12 * 30px);
  }
}

@media (min-width: 100em) {
  :root .xxxl\:offset-0 {
    margin-left: 0;
  }
  :root .xxxl\:offset-1\/12 {
    margin-left: calc(99.9% * 1/12 + 1/12 * 30px);
  }
  :root .xxxl\:offset-1\/10 {
    margin-left: calc(99.9% * 1/10 + 1/10 * 30px);
  }
  :root .xxxl\:offset-1\/6 {
    margin-left: calc(99.9% * 1/6 + 1/6 * 30px);
  }
  :root .xxxl\:offset-1\/5 {
    margin-left: calc(99.9% * 1/5 + 1/5 * 30px);
  }
  :root .xxxl\:offset-1\/4 {
    margin-left: calc(99.9% * 1/4 + 1/4 * 30px);
  }
  :root .xxxl\:offset-3\/10 {
    margin-left: calc(99.9% * 3/10 + 3/10 * 30px);
  }
  :root .xxxl\:offset-1\/3 {
    margin-left: calc(99.9% * 1/3 + 1/3 * 30px);
  }
  :root .xxxl\:offset-2\/5 {
    margin-left: calc(99.9% * 2/5 + 2/5 * 30px);
  }
  :root .xxxl\:offset-5\/12 {
    margin-left: calc(99.9% * 5/12 + 5/12 * 30px);
  }
  :root .xxxl\:offset-1\/2 {
    margin-left: calc(99.9% * 1/2 + 1/2 * 30px);
  }
  :root .xxxl\:offset-7\/12 {
    margin-left: calc(99.9% * 7/12 + 7/12 * 30px);
  }
  :root .xxxl\:offset-3\/5 {
    margin-left: calc(99.9% * 3/5 + 3/5 * 30px);
  }
  :root .xxxl\:offset-2\/3 {
    margin-left: calc(99.9% * 2/3 + 2/3 * 30px);
  }
  :root .xxxl\:offset-7\/10 {
    margin-left: calc(99.9% * 7/10 + 7/10 * 30px);
  }
  :root .xxxl\:offset-3\/4 {
    margin-left: calc(99.9% * 3/4 + 3/4 * 30px);
  }
  :root .xxxl\:offset-4\/5 {
    margin-left: calc(99.9% * 4/5 + 4/5 * 30px);
  }
  :root .xxxl\:offset-5\/6 {
    margin-left: calc(99.9% * 5/6 + 5/6 * 30px);
  }
  :root .xxxl\:offset-9\/10 {
    margin-left: calc(99.9% * 9/10 + 9/10 * 30px);
  }
  :root .xxxl\:offset-11\/12 {
    margin-left: calc(99.9% * 11/12 + 11/12 * 30px);
  }
}

/*
================================================================================
List bare
================================================================================

Removes bullets and indentation from lists.
*/
.list-bare {
  list-style: none;
  margin-left: 0;
}

/*
================================================================================
List inline
================================================================================

Removes bullets from a list and displays its items in a single line.
*/
.list-inline {
  list-style: none;
  margin-left: 0;
}

.list-inline > li {
  display: inline-block;
}

/*
================================================================================
List spaced
================================================================================

An object specifically for lists that spaces out their items
to provide more breathing room.
*/
.list-spaced > dd:not(:last-child), .list-spaced > li:not(:last-child) {
  margin-bottom: 1rem;
}

.list-spaced--sm > dd:not(:last-child), .list-spaced--sm > li:not(:last-child) {
  margin-bottom: 0.5rem;
}

.list-spaced--lg > dd:not(:last-child), .list-spaced--lg > li:not(:last-child) {
  margin-bottom: 1.5rem;
}

/*
================================================================================
Ratio
================================================================================

A responsive container that mantains a specific aspect ratio.
*/
.ratio-4-3 {
  height: 0;
  overflow: hidden;
  padding-bottom: calc(100% * 0.75);
  position: relative;
  width: 100%;
}

.ratio-4-3 > * {
  display: block;
  height: 100%;
  position: absolute;
  top: 0;
  left: 0;
  width: 100%;
}

.ratio-16-9 {
  height: 0;
  overflow: hidden;
  padding-bottom: calc(100% * 0.5625);
  position: relative;
  width: 100%;
}

.ratio-16-9 > * {
  display: block;
  height: 100%;
  position: absolute;
  top: 0;
  left: 0;
  width: 100%;
}

/*
================================================================================
Table scrollable
================================================================================

A wrapper for tables that automatically adds horizontal scrolling
when the table's width is large enough.
*/
.table-scrollable {
  -webkit-overflow-scrolling: touch;
  margin-bottom: 2rem;
  overflow-x: auto;
}

.table-scrollable > table {
  margin-bottom: 0;
}

/*
===============================================================================
Main
===============================================================================
*/
.main {
  background-color: #f5f6f7;
  height: calc(100vh - 60px);
  overflow: auto;
  transition: padding-left 0ms linear;
  width: 100%;
}

@media (min-width: 37.5em) {
  .main {
    padding-left: 60px;
  }
}

@media (min-width: 68.75em) {
  .main {
    padding-left: 220px;
  }
  .main--menu-collapsed {
    padding-left: 60px;
  }
}

.main--admin {
  padding-left: 0;
}

@media (min-width: 68.75em) {
  .main--admin {
    padding-left: 60px;
  }
}

@media (min-width: 93.75em) {
  .main--admin.main--has-menu-admin {
    padding-left: 300px;
    padding-right: 0;
  }
}

/* Main pago
============================================================================= */
.main-pago__col-summary {
  flex-grow: 0;
  flex-shrink: 0;
  width: 100%;
  margin-bottom: 1.5rem;
  order: 1;
}

.main-pago__col-summary:nth-child(n) {
  margin-left: 0;
  margin-right: 30px;
}

.main-pago__col-summary:last-child {
  margin-right: 0;
}

.main-pago__col-summary:nth-child(1n) {
  margin-left: auto;
  margin-right: 0;
}

@media (min-width: 81.25em) {
  .main-pago__col-summary {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 3/4 - (30px - 3/4 * 30px));
    margin-bottom: 0;
    order: 0;
  }
  .main-pago__col-summary:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .main-pago__col-summary:last-child {
    margin-right: 0;
  }
  .main-pago__col-summary:nth-child(4n) {
    margin-left: auto;
    margin-right: 0;
  }
}

.main-pago__col-options {
  flex-grow: 0;
  flex-shrink: 0;
  width: 100%;
  margin-bottom: 1.5rem;
}

.main-pago__col-options:nth-child(n) {
  margin-left: 0;
  margin-right: 30px;
}

.main-pago__col-options:last-child {
  margin-right: 0;
}

.main-pago__col-options:nth-child(1n) {
  margin-left: auto;
  margin-right: 0;
}

@media (min-width: 81.25em) {
  .main-pago__col-options {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/4 - (30px - 1/4 * 30px));
    margin-bottom: 0;
  }
  .main-pago__col-options:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .main-pago__col-options:last-child {
    margin-right: 0;
  }
  .main-pago__col-options:nth-child(4n) {
    margin-left: auto;
    margin-right: 0;
  }
}

/*
================================================================================
Spin
================================================================================
*/
@keyframes spin {
  0% {
    transform: rotate(0);
  }
  100% {
    transform: rotate(360deg);
  }
}

.spin {
  animation: spin 1s linear infinite;
}

/*
================================================================================
Icons
================================================================================
*/
.icon-position {
  position: relative;
  top: -1px;
}

/*
================================================================================
Confirmation
================================================================================
*/
.icon-confirmation {
  animation: icon-confirmation-pop 500ms ease-out forwards;
  border: 2px solid #f0f2f3;
  border-radius: 9999px;
  display: block;
  height: 66px;
  margin: 0 auto 20px;
  opacity: 0;
  position: relative;
  width: 66px;
}

.icon-confirmation__check {
  animation: icon-confirmation-check 250ms ease-out 200ms forwards;
  border-bottom: 4px solid #20c372;
  border-left: 4px solid #20c372;
  display: block;
  height: 0;
  opacity: 0;
  position: absolute;
  top: calc(50%);
  left: calc(50%);
  transform: rotate(-45deg);
  transform-origin: left;
  width: 0;
}

/* - - - - - Animations - - - - - */
@keyframes icon-confirmation-pop {
  0% {
    opacity: 0;
    transform: scale(0.5);
  }
  50% {
    opacity: 1;
    transform: scale(1.15);
  }
  70% {
    transform: scale(0.95);
  }
  85% {
    transform: scale(1.1);
  }
  100% {
    opacity: 1;
    transform: scale(1);
  }
}

@keyframes icon-confirmation-check {
  0% {
    height: 0;
    opacity: 1;
    transform: translate(-15px, 0) rotate(-45deg);
    width: 0;
  }
  20% {
    height: 15px;
    transform: translate(-10px, 0) rotate(-45deg);
    width: 0;
  }
  100% {
    height: 15px;
    opacity: 1;
    transform: translate(-10px, 0) rotate(-45deg);
    width: 30px;
  }
}

/*
================================================================================
Loader
================================================================================
*/
.loader {
  animation: spin 750ms linear infinite;
  border: 4px solid rgba(0, 0, 0, 0.2);
  border-radius: 50%;
  border-top: 4px solid #BA0000;
  color: transparent;
  content: "";
  display: inline-block;
  height: 40px;
  position: relative;
  width: 40px;
}

/*
================================================================================
Headings
================================================================================
*/
/*
 * Classes that match the styles defined for h1-h6 tags.
 * For situations where you may need to use a heading for semantics and/or
 * accessibility, but want it to look like another for visual hierarchy.
 */
/*
================================================================================
Descriptions
================================================================================
*/
/*
 * Small paragraphs for providing helpful text.
 */
.description,
.error,
.success {
  font-size: 0.75rem;
  list-style: none;
  margin-left: 0;
  margin-top: 0.5em;
}

.description {
  color: #8a96a1;
}

label > .description {
  margin-left: 0.3em;
}

/*
 * The `.error` class is used in paragraphs and lists to show
 * validation error messages.
 */
.error {
  color: #d03a40;
}

.success {
  color: #20c372;
}

.db-term {
  color: #5f6b78;
  display: block;
  font-size: 0.75rem;
  line-height: 1.4;
  margin-bottom: 0;
}

/*
================================================================================
Lead
================================================================================
*/
/*
 * A class that makes text more noticeable. Useful for the opening
 * paragraph of an article or page.
 */
.lead {
  color: #8a96a1;
  font-size: 1.25rem;
  font-weight: 300;
}

/*
================================================================================
Muted
================================================================================
*/
/*
 * Reduce the importance of text by lowering its opacity.
 */
.muted {
  opacity: 0.55;
}

/*
================================================================================
Validation icons
================================================================================

Success and warning background icons.
*/
.has-check,
.has-warning {
  background-position: right top;
  background-repeat: no-repeat;
}

.has-check {
  background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='%2320c372' stroke-width='2' stroke-miterlimit='10'%3E%3Cpath d='M5.5 12.5L10 17 20 7'/%3E%3C/svg%3E");
}

.has-warning {
  background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 1 24 24' fill='%23ffca34'%3E%3Cpath d='M20.58 16.51l-6.5-11.25c-.51-.87-1.26-1.38-2.08-1.38s-1.57.5-2.08 1.38l-6.5 11.25c-.5.88-.56 1.79-.15 2.49.41.71 1.22 1.11 2.23 1.11h13c1.01 0 1.83-.41 2.23-1.11.41-.7.35-1.61-.15-2.49zM12 18.15c-.64 0-1.15-.51-1.15-1.15s.51-1.15 1.15-1.15 1.15.51 1.15 1.15-.51 1.15-1.15 1.15zm1-3.65h-2l-.3-6h2.5l-.2 6z'/%3E%3C/svg%3E");
}

/*
================================================================================
Alerts
================================================================================

Show feedback to users in a nice dedicated container.
*/
/*
 * For simple messages, you can add the class directly to a paragraph element.
 * Alternatively, it can be applied to a div tag with any content you wish.
 */
.alert {
  background-color: #f0f2f3;
  border-radius: 3px;
  color: #5f6b78;
  font-size: 0.9375rem;
  margin-bottom: 1rem;
  padding: 0.75em 1em;
}

.alert--info {
  background-color: #d1e8f3;
  color: #154258;
}

.alert--info-transparent {
  background-color: transparent;
  color: #154258;
}

.alert--danger {
  background-color: #f3cecf;
  color: #a1262b;
}

.alert--forbidden {
  background-color: #f3cecf;
  color: #a1262b;
}

.alert--success {
  background-color: #b6f3d5;
  color: #126b3f;
}

.alert--warning {
  background-color: #fff2cc;
  color: #7b5b00;
}

/* Bordered variant
============================================================================= */
/*
 * Add a thin border for a better contrast in certain backgrounds.
 */
.alert--bordered {
  border: 1px solid #d6dadd;
}

.alert--bordered.alert--info {
  border-color: #9acde6;
}

.alert--bordered.alert--danger {
  border-color: #eaa6a9;
}

.alert--bordered.alert--success {
  border-color: #55e39c;
}

.alert--bordered.alert--warning {
  border-color: #ffdd7b;
}

/* Accent border variant
============================================================================= */
/*
 * Make one border stand out with color and size.
 */
.alert--has-accent-border {
  border-left: 4px solid #3a4148;
}

.alert--has-accent-border.alert--info {
  border-left-color: #2d86b3;
}

.alert--has-accent-border.alert--danger {
  border-left-color: #d03a40;
}

.alert--has-accent-border.alert--success {
  border-left-color: #20c372;
}

.alert--has-accent-border.alert--warning {
  border-left-color: #ffca34;
}

/* Strong background variant
============================================================================= */
/*
 * Use a stronger background color.
 */
.alert--strong {
  background-color: #3a4148;
  color: rgba(255, 255, 255, 0.95);
}

.alert--strong.alert--danger {
  background-color: #d03a40;
}

.alert--strong.alert--info {
  background-color: #2d86b3;
}

.alert--strong.alert--success {
  background-color: #20c372;
}

.alert--strong.alert--warning {
  background-color: #ffca34;
  color: #7b5b00;
}

/* With icons
============================================================================= */
/*
 * Emphasize the text with a status icon.
 */
.alert--has-icon {
  background-position: 1em 0.75em;
  background-repeat: no-repeat;
  padding-left: 50px;
}

.alert--has-icon.alert--info {
  background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='23' height='23' viewBox='0 0 24 24' fill='%232d86b3'%3E%3Ccircle fill='none' stroke='%232d86b3' stroke-width='2' stroke-miterlimit='10' cx='12' cy='12' r='9'/%3E%3Ccircle cx='12' cy='16' r='1.25'/%3E%3Cpath d='M13 13.5h-2L10.5 6h3z'/%3E%3C/svg%3E");
}

.alert--has-icon.alert--success {
  background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='%2320c372' stroke-width='2' stroke-miterlimit='10'%3E%3Cpath d='M5.5 12.5L10 17 20 7'/%3E%3C/svg%3E");
}

.alert--has-icon.alert--warning {
  background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 1 24 24' fill='%23ffca34'%3E%3Cpath d='M20.58 16.51l-6.5-11.25c-.51-.87-1.26-1.38-2.08-1.38s-1.57.5-2.08 1.38l-6.5 11.25c-.5.88-.56 1.79-.15 2.49.41.71 1.22 1.11 2.23 1.11h13c1.01 0 1.83-.41 2.23-1.11.41-.7.35-1.61-.15-2.49zM12 18.15c-.64 0-1.15-.51-1.15-1.15s.51-1.15 1.15-1.15 1.15.51 1.15 1.15-.51 1.15-1.15 1.15zm1-3.65h-2l-.3-6h2.5l-.2 6z'/%3E%3C/svg%3E");
}

.alert--has-icon.alert--danger {
  background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='23' height='23' viewBox='0 0 24 24' fill='none' stroke='%23d03a40' stroke-width='2' stroke-miterlimit='10'%3E%3Ccircle cx='12' cy='12' r='9'/%3E%3Cpath d='M8 8l8 8m0-8l-8 8'/%3E%3C/svg%3E");
}

.alert--has-icon.alert--forbidden {
  background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='20' height='20' viewBox='0 0 24 24' fill='none' stroke='%23d03a40' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Ccircle cx='12' cy='12' r='10'%3E%3C/circle%3E%3Cline x1='4.93' y1='4.93' x2='19.07' y2='19.07'%3E%3C/line%3E%3C/svg%3E");
}

.alert--has-icon.alert--info-transparent {
  background-position: 0em 0.75em;
  padding-left: 30px;
}

.alert--has-icon.alert--strong.alert--info {
  background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='23' height='23' viewBox='0 0 24 24' fill='%23fff'%3E%3Ccircle fill='none' stroke='%23fff' stroke-width='2' stroke-miterlimit='10' cx='12' cy='12' r='9'/%3E%3Ccircle cx='12' cy='16' r='1.25'/%3E%3Cpath d='M13 13.5h-2L10.5 6h3z'/%3E%3C/svg%3E");
}

.alert--has-icon.alert--strong.alert--success {
  background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='%23fff' stroke-width='2' stroke-miterlimit='10'%3E%3Cpath d='M5.5 12.5L10 17 20 7'/%3E%3C/svg%3E");
}

.alert--has-icon.alert--strong.alert--warning {
  background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='23' height='23' viewBox='0 0 24 24' fill='%237b5b00'%3E%3Cpath fill='none' stroke='%237b5b00' stroke-width='2' stroke-miterlimit='10' d='M4.98 19.79c-1.54 0-2.18-1.09-1.4-2.43L10.6 5.21c.77-1.34 2.03-1.34 2.81 0l7.02 12.15c.77 1.34.14 2.43-1.4 2.43H4.98z'/%3E%3Ccircle cx='12' cy='16.5' r='1'/%3E%3Cpath d='M12.7 14.5h-1.4l-.3-6h2z'/%3E%3C/svg%3E");
}

.alert--has-icon.alert--strong.alert--danger {
  background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='23' height='23' viewBox='0 0 24 24' fill='none' stroke='%23fff' stroke-width='2' stroke-miterlimit='10'%3E%3Ccircle cx='12' cy='12' r='9'/%3E%3Cpath d='M8 8l8 8m0-8l-8 8'/%3E%3C/svg%3E");
}

/*
================================================================================
Buttons
================================================================================

Sonata provides you with buttons for the most common uses,
but feel free to register as many as you need.

Optionally, color variants can easily be created with the `button` mixin.
*/
/*
 * The neutral base class for any button.
 */
.btn {
  background-color: #fff;
  border: 1px solid #e7e9ec;
  color: rgba(0, 0, 0, 0.7);
  transition: background-color 150ms ease-out, border-color 150ms ease-out, color 150ms ease-out;
  border-radius: 3px;
  padding: 0.75em 1.25em;
}

.btn:focus, .btn:hover, .btn:active {
  color: rgba(0, 0, 0, 0.7);
  text-decoration: none;
}

.btn:focus, .btn:hover {
  background-color: #ebebeb;
  border-color: #e7e9ec;
}

.btn:active {
  background-color: #e0e0e0;
  border-color: #e7e9ec;
}

.btn:disabled:focus, .btn:disabled:hover, .btn:disabled:active {
  background-color: #fff;
  border-color: #e7e9ec;
  color: rgba(0, 0, 0, 0.7);
}

.btn.btn--loading::after {
  border-right-color: rgba(0, 0, 0, 0.7);
  border-top-color: rgba(0, 0, 0, 0.7);
}

/* Types
============================================================================= */
.btn--primary {
  background-color: #BA0000;
  border: 1px solid transparent;
  color: #fff;
  transition: background-color 150ms ease-out, border-color 150ms ease-out, color 150ms ease-out;
}

.btn--primary:focus, .btn--primary:hover, .btn--primary:active {
  color: #fff;
  text-decoration: none;
}

.btn--primary:focus, .btn--primary:hover {
  background-color: #da0000;
  border-color: transparent;
}

.btn--primary:active {
  background-color: #eb0000;
  border-color: transparent;
}

.btn--primary:disabled:focus, .btn--primary:disabled:hover, .btn--primary:disabled:active {
  background-color: #BA0000;
  border-color: transparent;
  color: #fff;
}

.btn--primary.btn--loading::after {
  border-right-color: #fff;
  border-top-color: #fff;
}

.btn--light {
  background-color: #f0f2f3;
  border: 1px solid transparent;
  color: rgba(0, 0, 0, 0.7);
  transition: background-color 150ms ease-out, border-color 150ms ease-out, color 150ms ease-out;
}

.btn--light:focus, .btn--light:hover, .btn--light:active {
  color: rgba(0, 0, 0, 0.7);
  text-decoration: none;
}

.btn--light:focus, .btn--light:hover {
  background-color: #dbdfe2;
  border-color: transparent;
}

.btn--light:active {
  background-color: #d0d6d9;
  border-color: transparent;
}

.btn--light:disabled:focus, .btn--light:disabled:hover, .btn--light:disabled:active {
  background-color: #f0f2f3;
  border-color: transparent;
  color: rgba(0, 0, 0, 0.7);
}

.btn--light.btn--loading::after {
  border-right-color: rgba(0, 0, 0, 0.7);
  border-top-color: rgba(0, 0, 0, 0.7);
}

.btn--white {
  background-color: #fff;
  border: 1px solid transparent;
  color: rgba(0, 0, 0, 0.7);
  transition: background-color 150ms ease-out, border-color 150ms ease-out, color 150ms ease-out;
}

.btn--white:focus, .btn--white:hover, .btn--white:active {
  color: rgba(0, 0, 0, 0.7);
  text-decoration: none;
}

.btn--white:focus, .btn--white:hover {
  background-color: #ebebeb;
  border-color: transparent;
}

.btn--white:active {
  background-color: #e0e0e0;
  border-color: transparent;
}

.btn--white:disabled:focus, .btn--white:disabled:hover, .btn--white:disabled:active {
  background-color: #fff;
  border-color: transparent;
  color: rgba(0, 0, 0, 0.7);
}

.btn--white.btn--loading::after {
  border-right-color: rgba(0, 0, 0, 0.7);
  border-top-color: rgba(0, 0, 0, 0.7);
}

.btn--danger {
  background-color: #d03a40;
  border: 1px solid transparent;
  color: #fff;
  transition: background-color 150ms ease-out, border-color 150ms ease-out, color 150ms ease-out;
}

.btn--danger:focus, .btn--danger:hover, .btn--danger:active {
  color: #fff;
  text-decoration: none;
}

.btn--danger:focus, .btn--danger:hover {
  background-color: #c62f35;
  border-color: transparent;
}

.btn--danger:active {
  background-color: #bd2d33;
  border-color: transparent;
}

.btn--danger:disabled:focus, .btn--danger:disabled:hover, .btn--danger:disabled:active {
  background-color: #d03a40;
  border-color: transparent;
  color: #fff;
}

.btn--danger.btn--loading::after {
  border-right-color: #fff;
  border-top-color: #fff;
}

.btn--success {
  background-color: #20c372;
  border: 1px solid transparent;
  color: #fff;
  transition: background-color 150ms ease-out, border-color 150ms ease-out, color 150ms ease-out;
}

.btn--success:focus, .btn--success:hover, .btn--success:active {
  color: #fff;
  text-decoration: none;
}

.btn--success:focus, .btn--success:hover {
  background-color: #1db369;
  border-color: transparent;
}

.btn--success:active {
  background-color: #1cac64;
  border-color: transparent;
}

.btn--success:disabled:focus, .btn--success:disabled:hover, .btn--success:disabled:active {
  background-color: #20c372;
  border-color: transparent;
  color: #fff;
}

.btn--success.btn--loading::after {
  border-right-color: #fff;
  border-top-color: #fff;
}

.btn--blue {
  background-color: #4285F4;
  border: 1px solid transparent;
  color: #fff;
  transition: background-color 150ms ease-out, border-color 150ms ease-out, color 150ms ease-out;
}

.btn--blue:focus, .btn--blue:hover, .btn--blue:active {
  color: #fff;
  text-decoration: none;
}

.btn--blue:focus, .btn--blue:hover {
  background-color: #2b76f3;
  border-color: transparent;
}

.btn--blue:active {
  background-color: #1f6ef2;
  border-color: transparent;
}

.btn--blue:disabled:focus, .btn--blue:disabled:hover, .btn--blue:disabled:active {
  background-color: #4285F4;
  border-color: transparent;
  color: #fff;
}

.btn--blue.btn--loading::after {
  border-right-color: #fff;
  border-top-color: #fff;
}

.btn--ujed {
  background-color: #BA0000;
  border: 1px solid transparent;
  color: #fff;
  transition: background-color 150ms ease-out, border-color 150ms ease-out, color 150ms ease-out;
}

.btn--ujed:focus, .btn--ujed:hover, .btn--ujed:active {
  color: #fff;
  text-decoration: none;
}

.btn--ujed:focus, .btn--ujed:hover {
  background-color: #da0000;
  border-color: transparent;
}

.btn--ujed:active {
  background-color: #eb0000;
  border-color: transparent;
}

.btn--ujed:disabled:focus, .btn--ujed:disabled:hover, .btn--ujed:disabled:active {
  background-color: #BA0000;
  border-color: transparent;
  color: #fff;
}

.btn--ujed.btn--loading::after {
  border-right-color: #fff;
  border-top-color: #fff;
}

.btn--db {
  background-color: #50ab87;
  border: 1px solid transparent;
  color: #fff;
  transition: background-color 150ms ease-out, border-color 150ms ease-out, color 150ms ease-out;
}

.btn--db:focus, .btn--db:hover, .btn--db:active {
  color: #fff;
  text-decoration: none;
}

.btn--db:focus, .btn--db:hover {
  background-color: #4a9d7c;
  border-color: transparent;
}

.btn--db:active {
  background-color: #469677;
  border-color: transparent;
}

.btn--db:disabled:focus, .btn--db:disabled:hover, .btn--db:disabled:active {
  background-color: #50ab87;
  border-color: transparent;
  color: #fff;
}

.btn--db.btn--loading::after {
  border-right-color: #fff;
  border-top-color: #fff;
}

.btn--db-index {
  display: inline-block;
  font-size: 0.8125rem;
  padding: 0.5em 1.5em;
  background-color: #50ab87;
  border: 1px solid transparent;
  color: #fff;
  transition: background-color 150ms ease-out, border-color 150ms ease-out, color 150ms ease-out;
}

.btn--db-index:focus, .btn--db-index:hover, .btn--db-index:active {
  color: #fff;
  text-decoration: none;
}

.btn--db-index:focus, .btn--db-index:hover {
  background-color: #4a9d7c;
  border-color: transparent;
}

.btn--db-index:active {
  background-color: #469677;
  border-color: transparent;
}

.btn--db-index:disabled:focus, .btn--db-index:disabled:hover, .btn--db-index:disabled:active {
  background-color: #50ab87;
  border-color: transparent;
  color: #fff;
}

.btn--db-index.btn--loading::after {
  border-right-color: #fff;
  border-top-color: #fff;
}

.btn--pdf {
  background-color: #fff;
  border: 1px solid transparent;
  color: #d32f2f;
  transition: background-color 150ms ease-out, border-color 150ms ease-out, color 150ms ease-out;
  border: 1px solid #d32f2f;
  display: flex;
  align-items: center;
  justify-content: center;
  gap: 0.5rem;
}

.btn--pdf:focus, .btn--pdf:hover, .btn--pdf:active {
  color: #d32f2f;
  text-decoration: none;
}

.btn--pdf:focus, .btn--pdf:hover {
  background-color: #ebebeb;
  border-color: transparent;
}

.btn--pdf:active {
  background-color: #e0e0e0;
  border-color: transparent;
}

.btn--pdf:disabled:focus, .btn--pdf:disabled:hover, .btn--pdf:disabled:active {
  background-color: #fff;
  border-color: transparent;
  color: #d32f2f;
}

.btn--pdf.btn--loading::after {
  border-right-color: #d32f2f;
  border-top-color: #d32f2f;
}

.btn--link {
  background-color: transparent;
  border: 0;
  color: #39c;
  padding: 0;
  text-decoration: none;
}

.btn--link:focus, .btn--link:hover, .btn--link:active {
  color: #246b8e;
  text-decoration: underline;
}

/* Outline variants
================================================================================

Buttons that have a solid border and a transparent background in their
default state. They can be created with the `button-outline` mixin.
*/
.btn--outline-primary {
  background-color: transparent;
  border: 1px solid #BA0000;
  color: #BA0000;
  transition: background-color 150ms ease-out, border-color 150ms ease-out, color 150ms ease-out;
}

.btn--outline-primary:focus, .btn--outline-primary:hover, .btn--outline-primary:active {
  color: #fff;
  text-decoration: none;
}

.btn--outline-primary:focus, .btn--outline-primary:hover {
  background-color: #BA0000;
  border-color: #BA0000;
}

.btn--outline-primary:active {
  background-color: #eb0000;
  border-color: #BA0000;
}

.btn--outline-primary:disabled:focus, .btn--outline-primary:disabled:hover, .btn--outline-primary:disabled:active {
  background-color: transparent;
  border-color: #BA0000;
  color: #BA0000;
}

.btn--outline-primary.btn--loading::after {
  border-right-color: #BA0000;
  border-top-color: #BA0000;
}

/*
 * A white outlined button for dark backgrounds.
 */
.btn--outline-inverted {
  background-color: transparent;
  border: 1px solid #fff;
  color: #fff;
  transition: background-color 150ms ease-out, border-color 150ms ease-out, color 150ms ease-out;
}

.btn--outline-inverted:focus, .btn--outline-inverted:hover, .btn--outline-inverted:active {
  color: #fff;
  text-decoration: none;
}

.btn--outline-inverted:focus, .btn--outline-inverted:hover {
  background-color: rgba(255, 255, 255, 0.15);
  border-color: #fff;
}

.btn--outline-inverted:active {
  background-color: transparent;
  border-color: #fff;
}

.btn--outline-inverted:disabled:focus, .btn--outline-inverted:disabled:hover, .btn--outline-inverted:disabled:active {
  background-color: transparent;
  border-color: #fff;
  color: #fff;
}

.btn--outline-inverted.btn--loading::after {
  border-right-color: #fff;
  border-top-color: #fff;
}

/* Loading
============================================================================= */
/*
 * This modifier replaces the button's text with a loading icon
 * to give users feedback when submitting.
 */
.btn--loading {
  color: transparent !important;
  position: relative;
}

.btn--loading::after {
  animation: spin 750ms linear infinite;
  border: 2px solid rgba(0, 0, 0, 0.2);
  border-radius: 50%;
  content: "";
  display: block;
  height: 1.2em;
  position: absolute;
  top: calc(50% - 0.6em);
  left: calc(50% - 0.6em);
  width: 1.2em;
}

.btn--loading:disabled {
  filter: none;
  opacity: 1;
}

/* Size variants
============================================================================= */
.btn--xs {
  font-size: 0.65rem;
  padding: 0.5625em 0.9375em;
}

.btn--sm {
  font-size: 0.8rem;
  padding: 0.7125em 1.1875em;
}

.btn--lg {
  font-size: 1.2rem;
  padding: 0.825em 1.5em;
}

/* Width variants
============================================================================= */
.btn--narrow {
  padding-left: 0.5625em;
  padding-right: 0.5625em;
}

.btn--wide {
  padding-left: 2.1875em;
  padding-right: 2.1875em;
}

.btn--min-width {
  min-width: 250px;
}

.panel {
  background-color: #fff;
  border-radius: 5px;
  height: auto;
  width: 100%;
}

.panel__title {
  border: 1px solid #f0f2f3;
  border-bottom: 1px solid #e7e9ec;
  border-top-left-radius: 2px;
  border-top-right-radius: 2px;
  color: #686d7a;
  font-size: 14px;
  padding: 16px 15px;
  position: relative;
}

@media (min-width: 37.5em) {
  .panel__title {
    padding: 16px 30px;
  }
}

.panel__title p svg {
  height: 1.2em;
  margin-right: 3px;
}

.panel__title button svg {
  height: 1.3em;
}

.panel__title p {
  display: initial;
  font-size: 13px;
}

.panel__title--less-padding {
  padding: 25px 15px;
}

@media (min-width: 37.5em) {
  .panel__title--less-padding {
    padding: 25px 15px;
  }
}

.profile-image {
  width: 8rem;
  height: 10rem;
  border-radius: 50%;
  overflow: hidden;
  border: 2px solid #f3f4f6;
  box-shadow: 0 1px 2px rgba(0, 0, 0, 0.05);
  margin-bottom: 1rem;
}

.profile-image img {
  width: 100%;
  height: 100%;
  -o-object-fit: contain;
     object-fit: contain;
}

.panel__body {
  border: 1px solid #f0f2f3;
  border-bottom-left-radius: 2px;
  border-bottom-right-radius: 2px;
  border-top: 0;
  color: #3a4148;
  padding: 50px 15px;
}

@media (min-width: 37.5em) {
  .panel__body {
    padding: 50px 30px;
  }
}

.panel__body--less-padding {
  padding: 25px 15px;
}

@media (min-width: 37.5em) {
  .panel__body--less-padding {
    padding: 25px 15px;
  }
}

.panel__body--wide {
  margin: auto;
  margin-bottom: 40px;
  max-width: 700px;
}

.panel__subtitle {
  font-weight: bold;
}

/*
================================================================================
Checkbox
================================================================================

The custom checkbox component allows for a better cross browser positioning
and the use of the `invalid` variant.

Note that although IE11 ignores the basic styles, the component is still
completely functional and accessible.
*/
/*
 * Add the class directly to any checkbox input.
 */
.checkbox {
  -webkit-appearance: none;
     -moz-appearance: none;
          appearance: none;
  background-color: #fff;
  border: 1px solid #adb5bd;
  border-radius: 3px;
  height: 13px;
  position: relative;
  top: 0.05em;
  transition: background-color 150ms ease-out;
  width: 13px;
}

.checkbox:checked {
  background: #209fdf url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='13px' height='13px' viewBox='0 0 24 24' fill='none' stroke='%23fff' stroke-width='3' stroke-miterlimit='10'%3E%3Cpath d='M5.5 12.5L10 17 20 7'/%3E%3C/svg%3E") center center no-repeat;
  border-color: #209fdf;
}

.checkbox:focus {
  border-color: #39c;
  box-shadow: 0 0 0 3px #d1e8f3;
  outline: 0;
}

.checkbox:active {
  box-shadow: 0 0 0 1px rgba(0, 0, 0, 0.2) inset;
  filter: brightness(0.95) saturate(2);
}

/* Validation
============================================================================= */
/*
 * Styles for checkbox components that failed validation.
 */
.checkbox--invalid {
  border-color: #d03a40;
  box-shadow: 0 0 4px #d96166;
}

/*
==============
Main datos
==============
*/
.main__datos {
  display: flex;
  justify-content: center;
  width: 100%;
}

/*
===========
Datos header
===========
*/
@media (min-width: 64em) {
  .main__datos-flex {
    display: flex;
    flex-direction: row-reverse;
  }
}

.datos__head {
  align-items: center;
  display: flex;
  flex-direction: column;
  width: 100%;
}

@media (min-width: 46.25em) {
  .datos__head {
    align-items: justify;
    flex-direction: row;
    margin-bottom: 91px;
  }
}

@media (min-width: 64em) {
  .datos__head {
    align-items: flex-start;
    margin-bottom: 78px;
    flex-direction: row;
  }
}

.datos__head-data {
  display: block;
  margin-top: 0px;
  max-width: 1072px;
  width: 100%;
}

@media (min-width: 46.25em) {
  .datos__head-data {
    max-height: auto;
    margin-left: 50px;
  }
}

@media (min-width: 64em) {
  .datos__head-data {
    border-bottom: 1px solid #D6DADD;
    min-height: 180px;
    margin-bottom: 0px;
    margin-left: 30px;
    padding-bottom: 15px;
  }
}

.datos__matricula-data {
  display: block;
  margin-top: 0px;
  max-width: 1072px;
  width: 100%;
}

@media (min-width: 46.25em) {
  .datos__matricula-data {
    text-align: left;
    margin-bottom: 0px;
    max-width: 486px;
  }
}

@media (min-width: 64em) {
  .datos__matricula-data {
    margin: 0px;
    padding-bottom: 15px;
  }
}

.datos__head-nombre {
  align-items: center;
  color: #3A4148 !important;
  display: flex;
  flex-direction: column;
  text-align: center;
  justify-content: flex-start;
  margin: 20px 0px 20px 0px;
  min-height: auto;
  opacity: 1;
  width: 100%;
}

@media (min-width: 46.25em) {
  .datos__head-nombre {
    align-items: flex-start;
    margin: 20px 0px 0px 0px;
    text-align: left;
  }
}

@media (min-width: 64em) {
  .datos__head-nombre {
    text-align: left;
    margin-left: 0px;
    margin-bottom: 10px;
  }
}

.datos__head-nombre h2, .datos__head-nombre .h2 {
  margin-bottom: 0px;
}

.datos__head-img {
  border: 6px solid white;
  border-radius: 10px;
  display: block;
  height: 180px;
  min-width: 180px;
  overflow: hidden;
}

.datos__head-img img {
  display: block;
  height: 180px;
  width: 180px;
}

.datos__head-card {
  align-items: center;
  display: flex;
  flex-direction: column;
  width: 100%;
}

@media (min-width: 46.25em) {
  .datos__head-card {
    align-items: left;
  }
}

@media (min-width: 64em) {
  .datos__head-card {
    flex-direction: row;
    justify-items: flex-start;
  }
}

.datos__head-info {
  align-content: center;
  color: #3A4148;
  display: flex;
  flex-direction: column;
  justify-content: left;
  margin-bottom: 24px;
  width: 60%;
}

.datos__head-info:first-child {
  padding: 0px 10px 20px 0px;
}

@media (min-width: 46.25em) {
  .datos__head-info {
    flex-direction: row;
    justify-content: left;
    margin-bottom: 0px;
    text-align: left;
    width: 100%;
  }
}

@media (min-width: 64em) {
  .datos__head-info {
    border-right: 1px solid #D6DADD;
    flex-direction: column;
    width: auto;
    padding: 0px 10px;
  }
}

.datos__info-titulo {
  color: gray;
  font: Bold 13px/26px Lato;
  font-size: 13px;
  display: block;
  padding: 0px;
  margin: 0px;
  text-align: center;
  width: 100%;
}

.datos__info-titulo:first-child {
  padding-left: 0px;
}

@media (min-width: 46.25em) {
  .datos__info-titulo {
    font-size: 13px;
    text-align: left;
    width: 40%;
  }
}

@media (min-width: 64em) {
  .datos__info-titulo {
    margin-bottom: 10px;
    padding: 0px 10px;
    width: 100%;
  }
}

.datos__head-matricula {
  align-content: center;
  color: #3A4148;
  display: flex;
  flex-direction: column;
  justify-content: left;
  margin-top: 30px;
  width: 60%;
}

@media (min-width: 46.25em) {
  .datos__head-matricula {
    flex-direction: row;
    height: 24px;
    justify-content: left;
    margin-bottom: 0px;
    margin-top: 0px;
    text-align: left;
    width: 100%;
  }
}

@media (min-width: 64em) {
  .datos__head-matricula {
    flex-direction: row;
    width: auto;
    margin-top: 0px;
    padding: 0px;
  }
}

.datos__info-data {
  color: black;
  font-size: 16px;
  display: block;
  text-align: center;
  width: 100%;
}

@media (min-width: 46.25em) {
  .datos__info-data {
    text-align: left;
    margin-bottom: 0px;
    max-width: 486px;
  }
}

@media (min-width: 64em) {
  .datos__info-data {
    text-align: left;
    width: 100%;
  }
}

.datos__info-matricula {
  color: gray;
  font: Bold 13px/26px Lato;
  font-size: 13px;
  display: block;
  padding: 0px;
  margin: 0px;
  text-align: center;
  width: 100%;
}

@media (min-width: 46.25em) {
  .datos__info-matricula {
    font-size: 13px;
    text-align: left;
    width: 40%;
  }
}

@media (min-width: 64em) {
  .datos__info-matricula {
    display: none;
  }
}

.card__main-mensaje {
  border-radius: 5px;
  color: #154258;
  background: #9acde6;
  margin-top: 30px;
  padding: 10px;
}

.card__main {
  display: flex;
  background-color: white;
  margin-top: 30px;
}

.informacion__tabs {
  align-items: justify;
  border-bottom: 1px solid cornsilk;
  display: flex;
  width: 100%;
}

.tab__icon {
  align-items: center;
  display: flex;
  flex-direction: column;
  width: 50%;
}

.tab__icon-img {
  border: 1px solid purple;
  display: block;
  height: 50px;
  width: 50px;
}

.tab__icon-titulo {
  font-size: 10px;
}

.card__forms-background {
  background: white;
  padding: 0px;
  border-radius: 5px;
}

/*
================================================================================
Form field
================================================================================

The form field component provides styles for form inputs, selects
and textareas. It contains modifiers for validation feedback.
*/
.form-field, .form-file__text,
.form-file__upload {
  border-radius: 3px;
  padding: 0.6em;
  position: relative;
  transition: border-color 150ms ease-out, box-shadow 150ms ease-out;
  width: 100%;
}

/*
 * Use a background icon in select elements for cross-browser consistency.
 *
 * 1. Hide the native arrow button in IE.
 */
select.form-field, select.form-file__text,
select.form-file__upload {
  -webkit-appearance: none;
     -moz-appearance: none;
          appearance: none;
  text-overflow: ellipsis;
}

select.form-field::-ms-expand, select.form-file__text::-ms-expand,
select.form-file__upload::-ms-expand {
  display: none;
  /* 1 */
}

select.form-field:not([size]):not([multiple]), select.form-file__text:not([size]):not([multiple]),
select.form-file__upload:not([size]):not([multiple]) {
  background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24'%3E%3Cpath fill='%233a4148' d='M12 16l-6-6h12z'/%3E%3C/svg%3E");
  background-position: right 0.5em center;
  background-repeat: no-repeat;
  padding-right: 2.2em;
}

/* Validation
============================================================================= */
.form-field--invalid,
.form-field--valid {
  background-position: right 0.5em center;
  background-repeat: no-repeat;
  padding-right: 2.2em;
}

/*
 * Styles for fields that failed validation.
 */
.form-field--invalid {
  border-color: #d03a40;
  box-shadow: 0 0 6px #eaa6a9;
  background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 1 24 24' fill='%23ffca34'%3E%3Cpath d='M20.58 16.51l-6.5-11.25c-.51-.87-1.26-1.38-2.08-1.38s-1.57.5-2.08 1.38l-6.5 11.25c-.5.88-.56 1.79-.15 2.49.41.71 1.22 1.11 2.23 1.11h13c1.01 0 1.83-.41 2.23-1.11.41-.7.35-1.61-.15-2.49zM12 18.15c-.64 0-1.15-.51-1.15-1.15s.51-1.15 1.15-1.15 1.15.51 1.15 1.15-.51 1.15-1.15 1.15zm1-3.65h-2l-.3-6h2.5l-.2 6z'/%3E%3C/svg%3E");
}

/*
     * Styles for fields that passed validation.
     */
.form-field--valid {
  background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='%2320c372' stroke-width='2' stroke-miterlimit='10'%3E%3Cpath d='M5.5 12.5L10 17 20 7'/%3E%3C/svg%3E");
}

/*
     * Icons are positioned on the top right in elements that span
     * multiple lines, leaving room for the scrollbar.
     *
     * 1. Note that IE has a bug in select elements where padding
     *    affects the scrollbar position.
     */
.form-field--invalid[multiple],
.form-field--invalid[size],
.form-field--valid[multiple],
.form-field--valid[size],
textarea.form-field--invalid,
textarea.form-field--valid {
  background-position: right 1.2em top 0.4em;
  padding-right: 2.7em;
  /* 1 */
}

/*
     * The `no-scrollbar` modifier can be used in textareas
     * to position the icon when there is no scrollbar.
     */
textarea.form-field--invalid.form-field--no-scrollbar,
textarea.form-field--valid.form-field--no-scrollbar {
  background-position: right 0.5em top 0.4em;
  padding-right: 2.2em;
}

/*
     * Dropdowns already have a background icon (caret),
     * so two backgrounds are necessary.
     */
select:not([size]):not([multiple]).form-field--invalid, select:not([size]):not([multiple]).form-field--valid {
  background-position: right 0.5em center, right 2em center;
  padding-right: 4em;
}

select:not([size]):not([multiple]).form-field--invalid {
  background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24'%3E%3Cpath fill='%233a4148' d='M12 16l-6-6h12z'/%3E%3C/svg%3E"), url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 1 24 24' fill='%23ffca34'%3E%3Cpath d='M20.58 16.51l-6.5-11.25c-.51-.87-1.26-1.38-2.08-1.38s-1.57.5-2.08 1.38l-6.5 11.25c-.5.88-.56 1.79-.15 2.49.41.71 1.22 1.11 2.23 1.11h13c1.01 0 1.83-.41 2.23-1.11.41-.7.35-1.61-.15-2.49zM12 18.15c-.64 0-1.15-.51-1.15-1.15s.51-1.15 1.15-1.15 1.15.51 1.15 1.15-.51 1.15-1.15 1.15zm1-3.65h-2l-.3-6h2.5l-.2 6z'/%3E%3C/svg%3E");
}

select:not([size]):not([multiple]).form-field--valid {
  background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24'%3E%3Cpath fill='%233a4148' d='M12 16l-6-6h12z'/%3E%3C/svg%3E"), url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='%2320c372' stroke-width='2' stroke-miterlimit='10'%3E%3Cpath d='M5.5 12.5L10 17 20 7'/%3E%3C/svg%3E");
}

/* Focus state
============================================================================= */
/*
 * The focus modifier is defined after validation classes
 * so that it can override them without increasing specificity.
 */
.form-field:focus, .form-file__text:focus,
.form-file__upload:focus,
.form-field--focus {
  border-color: #9acde6;
  box-shadow: 0 0 3px #d1e8f3;
}

/*
================================================================================
Dashboard search
================================================================================
*/
.dashboard-search {
  display: flex;
  margin-bottom: 0;
  width: 100%;
}

.dashboard-search__btn {
  border-radius: 0 3px 3px 0;
  padding: 0 0.7em;
}

.dashboard-search__field {
  border-radius: 3px 0 0 3px;
  border-right: 0;
  padding: 0.8em 0.6em;
}

.dashboard-search__icon {
  height: 1.5em;
  width: 1.5em;
}

.tramite-usuario {
  font-size: 11px;
  padding: 3px 5px;
  background: #50AB87;
  border-radius: 12px;
  margin-right: 3px;
  color: #fff !important;
}

/*
================================================================================
File
================================================================================

Component that makes a native file input look more consistent with the
visual style of the framework. It works by hiding the file input inside
a wrapper and positioning it over a text input.

The structure looks like this:

.form-file (wrapper)
    .form-file__upload (file input)
    .form-file__text (text input)
    .form-file__btn (focusable button)

Requires javascript for full functionality.
*/
/*
 * 1. Prevents the contents of the component from appearing above
 *    other elements on the page.
 */
.form-file {
  display: flex;
  position: relative;
  z-index: 0;
  /* 1 */
}

/*
 * 1. Hide the text without affecting width, keeping it accessible
 *    to screen readers.
 * 2. The button is positioned over the native file input, so that the hover
 *    effect works properly.
 */
.form-file__btn {
  background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='%233a4148' stroke-width='2' stroke-miterlimit='10' stroke-linecap='round'%3E%3Cpath stroke-linejoin='round' d='M13.019 19.019H5.023a2.004 2.004 0 0 1-2.002-2.006V6.024c0-1.107.896-2.005 2.002-2.005H11l2 2h6.019c1.105 0 2.002.898 2.002 2.005v2.893'/%3E%3Ccircle cx='16' cy='14' r='3'/%3E%3Cpath d='M18.5 16.5L21 19'/%3E%3C/svg%3E");
  background-position: center center;
  background-repeat: no-repeat;
  color: transparent;
  /* 1 */
  font-size: 1px;
  /* 1 */
  margin-left: 5px;
  min-width: 40px;
  padding-bottom: 0;
  padding-top: 0;
  z-index: 2;
  /* 2 */
}

.form-file__btn:focus, .form-file__btn:hover, .form-file__btn:active {
  color: transparent;
}

@media (min-width: 26.25em) {
  .form-file__btn {
    background-image: none;
    color: #3a4148;
    font-size: 0.95rem;
    min-width: auto;
    width: auto;
  }
  .form-file__btn:focus, .form-file__btn:hover, .form-file__btn:active {
    color: #3a4148;
  }
}

/*
 * Style the text field and make both inputs have the same height.
 */
.form-file__text {
  overflow: hidden;
  text-overflow: ellipsis;
  white-space: nowrap;
}

/*
 * 1. Prevent scrolling on small screens.
 */
.form-file__upload {
  cursor: pointer;
  opacity: 0;
  overflow: hidden;
  /* 1 */
  position: absolute;
  top: 0;
  left: 0;
  z-index: 1;
}

.google-button {
  box-shadow: 1px 1px 3px #0000001a;
  display: flex;
  margin: auto;
  margin-bottom: 20px;
  margin-top: 20px;
  padding: 3px;
  width: 230px;
  height: 48px;
  float: right;
}

.google-button__icon {
  background: #fff;
  border-radius: 3px;
  display: flex;
  height: 40px;
  justify-content: center;
  width: 40px;
}

.google-button__icon img {
  align-self: center;
  display: block;
  height: 20px;
  margin-bottom: 0px;
}

.google-button__text {
  align-self: center;
  color: #fff;
  text-align: center;
  width: 184px;
}

.home-button__text {
  align-self: center;
  color: #fff;
  text-align: center;
  width: 100%;
}

.home-button {
  box-shadow: 1px 1px 3px #0000001a;
  display: flex;
  margin: auto;
  margin-bottom: 20px;
  padding: 3px;
  width: 230px;
  height: 48px;
  float: right;
}

.privacy-button {
  width: 230px;
  height: 30px;
  text-align: center;
  border: 0px;
}

.subject-badge {
  border-radius: 2px;
  font-size: 9px;
  margin-left: 10px;
  padding: 2px 6px;
  vertical-align: text-bottom;
}

.subject-badge svg {
  color: #20c372;
  height: 12px;
  margin-right: 2px;
  width: 12px;
}

.subject-badge--aproved {
  background-color: #B6F3D5;
  color: #126B3F;
}

.link {
  text-decoration: underline;
}

.link:hover {
  text-decoration: none;
}

.link-no-style {
  color: #3a4148;
}

.link-no-style:hover {
  color: #3a4148;
  text-decoration: none;
}

.link-pdf svg {
  height: 25px;
  margin-right: 10px;
  width: 25px;
}

.link-invert {
  text-decoration: none;
}

.link-invert:hover {
  text-decoration: underline;
}

.link-small {
  font-size: 13px;
}

.link-disabled {
  cursor: default;
  pointer-events: none;
}

.link-toggle {
  background-color: transparent;
  border: 0;
  color: #39c;
  font-size: 13px;
  margin: auto;
  text-decoration: underline;
}

.link-toggle:hover {
  text-decoration: none;
}

.skip-to-main {
  background-color: #50ab87;
  border-radius: 0 0 3px 3px;
  box-shadow: 0 2px 4px rgba(0, 0, 0, 0.1);
  color: #fff;
  padding: 0.5em 1em;
  position: absolute;
  top: 0;
  left: 50%;
  text-decoration: none;
  transform: translateY(-100%);
  transition: transform 300ms ease-out;
  z-index: 10;
}

.skip-to-main:focus-visible {
  color: #fff;
  text-decoration: none;
  transform: translateY(0%);
}

.text-link {
  color: #3a4148;
}

.text-link:focus, .text-link:hover, .text-link:active {
  color: #3a4148;
  text-decoration: underline;
}

/*
================================================================================
Login
================================================================================
*/
.login {
  align-items: flex-start;
  align-self: stretch;
  display: flex;
  flex-wrap: wrap;
  height: 100vh;
  margin: 0 auto;
  min-width: 300px;
  text-align: center;
  width: 100%;
}

.container-login {
  display: flex;
  align-items: center;
  justify-content: center;
  flex-direction: column;
}

.login__media {
  display: none;
}

@media (min-width: 46.25em) {
  .login__media {
    align-items: flex-start;
    align-self: stretch;
    background-image: url("/static/img/cover-sm.jpg");
    background-position: center;
    background-repeat: no-repeat;
    background-size: cover;
    display: flex;
    flex-wrap: wrap;
    margin: 0 auto;
    min-height: 100vh;
    min-width: 300px;
    text-align: center;
    width: 50%;
  }
}

@media (min-width: 75em) {
  .login__media {
    background-image: url("/static/img/cover-lg.jpg");
    min-width: 65%;
    width: 65%;
  }
}

.degradado {
  background: linear-gradient(to left, rgba(15, 46, 61, 0.5), rgba(15, 46, 61, 0) 50%);
  height: 100%;
  min-height: 100vh;
  width: 100%;
}

/*
================================================================================
    FORM
================================================================================
*/
.login__form-data {
  display: inline-block;
  max-width: 324px;
  padding-bottom: 15%;
  padding-top: 15%;
}

@media (min-width: 740px) and (max-height: 764px) {
  .login__form-data {
    padding-top: 64px;
  }
}

.login__logo-ujed {
  margin-bottom: 45px;
  max-width: 140px;
  min-width: 140px;
}

.login__form-descripcion {
  color: #5f6b78;
  font-size: 15px;
  margin-bottom: 35px;
}

.login__form {
  align-items: center;
  background: white;
  display: flex;
  flex-wrap: wrap;
  justify-content: center;
  min-height: 100vh;
  min-width: 50%;
  padding-bottom: 1%;
  padding-top: 1%;
  width: 100%;
}

@media (min-width: 46.25em) {
  .login__form {
    min-width: 50%;
    width: 50%;
  }
}

@media (min-width: 75em) {
  .login__form {
    min-width: 35%;
    width: 35%;
  }
}

.login__form .form-control {
  text-align: left;
}

/*
================================================================================
    recibido
================================================================================
*/
.recibido {
  padding: 0 30px;
}

.recibido__titulo {
  color: #3a4148;
  font-size: 18px;
  font-weight: 400;
  margin-bottom: 45px;
  text-align: center;
  width: 100%;
}

.recibido__descripcion {
  color: #5f6b78;
  font-size: 15px;
  margin-bottom: 55px;
  text-align: center;
  width: 100%;
}

.recibido__icon-success {
  color: #20c372;
}

.recibido__icon-success > svg {
  border: 2px solid #20c372;
  border-radius: 50%;
  height: 52px;
  margin: 16px;
  padding: 8px;
  width: 52px;
}

.recibido__btn-inicio {
  min-width: 225px;
}

/*
================================================================================
Messages
================================================================================

A message displays information to users. It consists of a title
and a section for the content.
*/
/*
 * The `.message` class should be applied to a container element.
 */
.message {
  background-color: #f9fafa;
  border-radius: 3px;
  font-size: 0.9375rem;
  margin-bottom: 1rem;
}

.message--info {
  background-color: #d1e8f3;
  color: #154258;
}

.message--danger {
  background-color: #f3cecf;
  color: #a1262b;
}

.message--success {
  background-color: #b6f3d5;
  color: #126b3f;
}

.message--warning {
  background-color: #fff2cc;
  color: #7b5b00;
}

.message__body,
.message__title {
  padding: 0.75em 1em;
}

/*
 * For simple messages, you can add the body class directly
 * to a paragraph element. Alternatively, it can be applied
 * to a div tag with any content you wish.
 */
.message__body {
  border-radius: 0 0 3px 3px;
}

/*
 * The title class can be applied directly to a paragraph element.
 */
.message__title {
  background-color: #3a4148;
  border-radius: 3px 3px 0 0;
  color: #fff;
  line-height: 1.4;
  margin-bottom: 0;
}

.message--danger > .message__title {
  background-color: #d03a40;
}

.message--info > .message__title {
  background-color: #2d86b3;
}

.message--success > .message__title {
  background-color: #20c372;
}

.message--warning > .message__title {
  background-color: #ffca34;
  color: #7b5b00;
}

/* Bordered body
============================================================================= */
/*
 * Add a thin border to the body element of the message component with
 * this modifier class to get a better contrast in certain backgrounds.
 */
.message__body--bordered {
  border-color: #d6dadd;
  border-style: solid;
  border-width: 0 1px 1px;
}

.message--info > .message__body--bordered {
  border-color: #9acde6;
}

.message--danger > .message__body--bordered {
  border-color: #eaa6a9;
}

.message--success > .message__body--bordered {
  border-color: #55e39c;
}

.message--warning > .message__body--bordered {
  border-color: #ffdd7b;
}

/* Title with icons
============================================================================= */
/*
 * Add a status icon to the title element.
 */
.message__title--has-icon {
  background-position: 1em 0.65em;
  background-repeat: no-repeat;
  padding-left: calc(1em + 35px);
}

.message--info .message__title--has-icon {
  background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='23' height='23' viewBox='0 0 24 24' fill='%23fff'%3E%3Ccircle fill='none' stroke='%23fff' stroke-width='2' stroke-miterlimit='10' cx='12' cy='12' r='9'/%3E%3Ccircle cx='12' cy='16' r='1.25'/%3E%3Cpath d='M13 13.5h-2L10.5 6h3z'/%3E%3C/svg%3E");
}

.message--success .message__title--has-icon {
  background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='%23fff' stroke-width='2' stroke-miterlimit='10'%3E%3Cpath d='M5.5 12.5L10 17 20 7'/%3E%3C/svg%3E");
}

.message--warning .message__title--has-icon {
  background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='23' height='23' viewBox='0 0 24 24' fill='%237b5b00'%3E%3Cpath fill='none' stroke='%237b5b00' stroke-width='2' stroke-miterlimit='10' d='M4.98 19.79c-1.54 0-2.18-1.09-1.4-2.43L10.6 5.21c.77-1.34 2.03-1.34 2.81 0l7.02 12.15c.77 1.34.14 2.43-1.4 2.43H4.98z'/%3E%3Ccircle cx='12' cy='16.5' r='1'/%3E%3Cpath d='M12.7 14.5h-1.4l-.3-6h2z'/%3E%3C/svg%3E");
}

.message--danger .message__title--has-icon {
  background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='23' height='23' viewBox='0 0 24 24' fill='none' stroke='%23fff' stroke-width='2' stroke-miterlimit='10'%3E%3Ccircle cx='12' cy='12' r='9'/%3E%3Cpath d='M8 8l8 8m0-8l-8 8'/%3E%3C/svg%3E");
}

/*
================================================================================
Overlay
================================================================================
*/
.overlay {
  background-color: #000;
  height: 100vh;
  opacity: 0;
  position: fixed;
  top: 0;
  left: 0;
  transition: opacity 200ms ease-out, visibility 200ms ease-out;
  visibility: hidden;
  width: 100vw;
  z-index: 2;
}

.overlay--active {
  opacity: 0.3;
  visibility: visible;
}

.menu-overlay {
  background-color: #000;
  height: 100vh;
  opacity: 0;
  position: fixed;
  top: 0;
  left: 0;
  transition: opacity 200ms ease-out, visibility 200ms ease-out;
  visibility: hidden;
  width: 100vw;
  z-index: 1;
}

.menu-overlay--active {
  opacity: 0.3;
  visibility: visible;
}

@media (min-width: 68.75em) {
  .menu-overlay--active {
    opacity: 0.3;
    visibility: hidden;
  }
}

/*
================================================================================
Pago opcion
================================================================================
*/
.pago__opcion {
  background: white;
  display: block;
  max-width: 100%;
}

@media (min-width: 66.1875em) {
  .pago__opcion {
    justify-content: center;
    margin-left: 0;
    width: 100%;
  }
}

@media (min-width: 75em) {
  .pago__opcion {
    align-content: space-between;
    display: flex;
  }
}

/*
================================================================================
Payment card
================================================================================
*/
.payment-card {
  border: 1px solid #d6dadd;
  border-radius: 4px;
  font-size: 15px;
  margin: auto;
  margin-bottom: 1.5rem;
  max-width: 360px;
  width: 100%;
}

@media (min-width: 45em) {
  .payment-card {
    max-width: none;
  }
}

@media (min-width: 75em) {
  .payment-card {
    margin: 0;
    max-width: 320px;
    margin-right: 30px;
  }
  .payment-card:last-child {
    margin-right: 0px;
  }
}

.payment-card__line {
  border-color: #3a4148;
}

.payment-card__description {
  margin-bottom: 3.75rem;
}

.payment-card__title {
  background: #67b3d9;
  color: white;
  display: block;
  font-size: 11px;
  height: 30px;
  margin: 0;
  padding-top: 5px;
  text-align: center;
}

.payment-card__body {
  color: #3a4148;
  display: block;
  padding: 30px 15px;
}

@media (min-width: 45em) and (max-width: 74.9375em) {
  .payment-card__body {
    display: flex;
    padding-left: 30px;
    padding-right: 30px;
  }
}

.payment-card .link-pdf svg {
  height: auto;
  margin-top: -1px;
  width: 2em;
}

/* Payment icon
============================================================================= */
.payment-icon {
  margin-bottom: 40px;
  text-align: center;
}

.payment-icon__card {
  background-color: #ebf5fa;
  border-radius: 11px;
  height: 64px;
  margin: auto;
  margin-bottom: 15px;
  width: 64px;
}

.payment-icon__title {
  font-size: 22px;
  line-height: 30px;
}

@media (min-width: 45em) and (max-width: 74.9375em) {
  .payment-icon {
    flex-shrink: 0;
    margin-right: 30px;
    width: 160px;
  }
}

/* Payment content
============================================================================= */
.payment-content__info-transfer {
  background: #f9fafa;
  color: #5f6b78;
  font-size: 0.875em;
  margin: 20px 0;
  padding: 14px;
  text-align: left;
}

.payment-content__info-bcria {
  align-items: flex-start;
  display: flex;
  padding-right: 1rem;
}

.payment-content__info-bcria svg {
  color: #67b3d9;
  height: auto;
  margin-right: 10px;
  position: relative;
  top: -3px;
  width: 1.2em;
}

.payment-content__info-bcria p {
  color: #8a96a1;
  font-size: 0.8125rem;
}

/*
================================================================================
Procedure payment columns
================================================================================
*/
.procedure-payment__col-options {
  flex-grow: 0;
  flex-shrink: 0;
  width: 100%;
}

.procedure-payment__col-options:nth-child(n) {
  margin-left: 0;
  margin-right: 30px;
}

.procedure-payment__col-options:last-child {
  margin-right: 0;
}

.procedure-payment__col-options:nth-child(1n) {
  margin-left: auto;
  margin-right: 0;
}

@media (min-width: 68.75em) {
  .procedure-payment__col-options {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 2/3 - (30px - 2/3 * 30px));
  }
  .procedure-payment__col-options:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .procedure-payment__col-options:last-child {
    margin-right: 0;
  }
  .procedure-payment__col-options:nth-child(3n) {
    margin-left: auto;
    margin-right: 0;
  }
  .procedure-payment__col-options {
    margin-right: auto !important;
  }
}

@media (min-width: 87.5em) {
  .procedure-payment__col-options {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 3/4 - (30px - 3/4 * 30px));
  }
  .procedure-payment__col-options:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .procedure-payment__col-options:last-child {
    margin-right: 0;
  }
  .procedure-payment__col-options:nth-child(4n) {
    margin-left: auto;
    margin-right: 0;
  }
}

.procedure-payment__col-summary {
  flex-grow: 0;
  flex-shrink: 0;
  width: 100%;
}

.procedure-payment__col-summary:nth-child(n) {
  margin-left: 0;
  margin-right: 30px;
}

.procedure-payment__col-summary:last-child {
  margin-right: 0;
}

.procedure-payment__col-summary:nth-child(1n) {
  margin-left: auto;
  margin-right: 0;
}

@media (min-width: 68.75em) {
  .procedure-payment__col-summary {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/3 - (30px - 1/3 * 30px));
  }
  .procedure-payment__col-summary:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .procedure-payment__col-summary:last-child {
    margin-right: 0;
  }
  .procedure-payment__col-summary:nth-child(3n) {
    margin-left: auto;
    margin-right: 0;
  }
  .procedure-payment__col-summary {
    margin-right: 0 !important;
  }
}

@media (min-width: 87.5em) {
  .procedure-payment__col-summary {
    flex-grow: 0;
    flex-shrink: 0;
    width: calc(99.9% * 1/4 - (30px - 1/4 * 30px));
  }
  .procedure-payment__col-summary:nth-child(n) {
    margin-left: 0;
    margin-right: 30px;
  }
  .procedure-payment__col-summary:last-child {
    margin-right: 0;
  }
  .procedure-payment__col-summary:nth-child(4n) {
    margin-left: auto;
    margin-right: 0;
  }
}

/*
================================================================================
Radio
================================================================================

The custom radio component allows for a better cross browser positioning
and the use of the `invalid` variant.

Note that although IE11 ignores the basic styles, the component is still
completely functional and accessible.
*/
/*
 * Add the class directly to any radio input.
 */
.radio {
  -webkit-appearance: none;
     -moz-appearance: none;
          appearance: none;
  background-color: #fff;
  border: 1px solid #adb5bd;
  border-radius: 50%;
  height: 14px;
  position: relative;
  top: 0.1em;
  transition: border 100ms ease-out;
  width: 14px;
}

.radio:checked {
  background-color: #fff;
  border: 5px solid #209fdf;
}

.radio:focus {
  border-color: #39c;
  box-shadow: 0 0 0 3px #d1e8f3;
  outline: 0;
}

.radio:active {
  filter: brightness(0.95) saturate(2);
}

/* Validation
============================================================================= */
/*
 * Styles for radio components that failed validation.
 */
.radio--invalid {
  border-color: #d03a40;
  box-shadow: 0 0 4px #d96166;
}

/*
================================================================================
Section
================================================================================

Stylized container for grouping contents of a page.
*/
.section {
  padding-bottom: 4rem;
  padding-top: 4rem;
}

.section--bordered {
  border-bottom: 1px solid #d6dadd;
  border-top: 1px solid #d6dadd;
}

/* Background variants
============================================================================= */
.section--light {
  background-color: #f9fafa;
}

/* Size variants
============================================================================= */
.section--xs {
  padding-bottom: 2rem;
  padding-top: 2rem;
}

.section--sm {
  padding-bottom: 3rem;
  padding-top: 3rem;
}

.section--lg {
  padding-bottom: 6rem;
  padding-top: 6rem;
}

.section--xl {
  padding-bottom: 8rem;
  padding-top: 8rem;
}

.solicitud {
  align-items: flex-start;
  align-self: stretch;
  display: flex;
  flex-wrap: wrap;
  height: 100vh;
  margin: 0 auto;
  min-width: 300px;
  text-align: center;
  width: 100%;
}

.solicitud__media {
  display: none;
}

@media (min-width: 46.25em) {
  .solicitud__media {
    align-items: flex-start;
    align-self: stretch;
    background-image: url("/static/img/cover-sm.jpg");
    background-position: center;
    background-repeat: no-repeat;
    background-size: cover;
    display: flex;
    flex-wrap: wrap;
    margin: 0 auto;
    min-height: 100vh;
    min-width: 300px;
    text-align: center;
    width: 50%;
  }
}

@media (min-width: 75em) {
  .solicitud__media {
    background-image: url("/static/img/cover-lg.jpg");
    min-width: 65%;
    width: 65%;
  }
}

.degradado {
  background: linear-gradient(to left, rgba(15, 46, 61, 0.5), rgba(15, 46, 61, 0) 50%);
  height: 100%;
  min-height: 100vh;
  width: 100%;
}

/*
================================================================================
    FORM
================================================================================
*/
.solicitud__form-data {
  display: inline-block;
  max-width: 324px;
  padding-bottom: 15%;
  padding-top: 15%;
}

@media (min-width: 740px) and (max-height: 764px) {
  .solicitud__form-data {
    padding-top: 64px;
  }
}

.solicitud__logo-ujed {
  margin-bottom: 45px;
  max-width: 140PX;
  min-width: 140PX;
}

.solicitud__form-descripcion {
  color: #5f6b78;
  font-size: 15px;
  margin-bottom: 5px;
  text-align: left;
}

.solicitud__form {
  align-items: center;
  background: white;
  display: flex;
  flex-wrap: wrap;
  text-align: left;
  justify-content: center;
  min-height: 100vh;
  min-width: 50%;
  padding-bottom: 0%;
  padding-top: 5%;
  width: 100%;
}

@media (min-width: 46.25em) {
  .solicitud__form {
    min-width: 50%;
    width: 50%;
  }
}

@media (min-width: 75em) {
  .solicitud__form {
    min-width: 35%;
    width: 35%;
  }
}

.solicitud_acciones {
  align-items: center;
  justify-content: center;
  display: flex;
  flex-direction: column;
}

.switch {
  height: 0;
  width: 0;
  visibility: hidden;
}

.switch:checked + .switch-label {
  background: #e7e9ec;
}

.switch:checked + .switch-label:after {
  left: calc(100% - 1px);
  transform: translateX(-100%);
}

.switch-label {
  cursor: pointer;
  width: 38px;
  height: 20px;
  background: #e7e9ec;
  display: block;
  border-radius: 10px;
  position: relative;
  margin-bottom: 0px;
}

.switch-label:after {
  content: '';
  position: absolute;
  top: 1px;
  left: 1px;
  width: 18px;
  height: 18px;
  border: 1px solid #adb5bd;
  background: #fff;
  border-radius: 50%;
  transition: 0.3s;
}

.switch-label__span {
  display: block;
  float: left;
  margin-left: 45px;
  width: 300px;
}

@media (min-width: 37.5em) {
  .switch-label__span {
    width: 500px;
  }
}

/*
================================================================================
Tables
================================================================================

A component for styling every table of your project.
Given that tables have many elements, Sonata uses nested selectors instead
of a pure BEM approach to avoid unnecessary CSS classes.
*/
.table {
  background-color: #fff;
  font-size: 1rem;
  margin-bottom: 2rem;
  max-width: 100%;
}

.table caption {
  font-size: 0.9rem;
  padding: 0.3em 0.8em;
}

.table tbody {
  font-size: 15px;
}

.table td, .table th {
  padding: 0.6em 0.8em;
  vertical-align: top;
}

.table th {
  font-weight: 700;
}

.table tr {
  border-bottom: 1px solid #d6dadd;
}

.table tfoot {
  font-weight: 700;
}

.table thead th {
  vertical-align: bottom;
}

.table thead tr {
  border-bottom: 2px solid #3a4148;
}

/*
 * Make the table fill the entire width of its container.
 */
.table--full-width {
  width: 100%;
}

/*
 * Highlight rows when the cursor is over them.
 */
.table--hoverable tbody tr {
  transition: background-color 150ms ease-out;
}

.table--hoverable tbody tr:hover {
  background-color: #ebf5fa;
}

/*
 * Add zebra stripes to body rows.
 */
.table--striped tbody > :nth-child(even) {
  background-color: #f0f2f3;
}

.table--striped tbody > tr > td.calificaciones {
  border-left-width: 3.5px;
  border-left-color: #ddd;
}

.table--striped thead > tr > th.calificaciones {
  border-left-width: 3.5px;
  border-left-color: #ddd;
}

/* Header color variants
============================================================================= */
.table--header-primary thead tr, .table--header-light thead tr, .table--header-dark thead tr {
  border-bottom: 0;
}

.table--header-primary thead th, .table--header-light thead th, .table--header-dark thead th {
  font-weight: 600;
}

.table--header-primary thead {
  background-color: #BA0000;
  color: #fff;
}

.table--header-light thead {
  background-color: #f0f2f3;
  color: rgba(0, 0, 0, 0.7);
}

.table--header-dark thead {
  background-color: #202428;
  color: #fff;
}

/* Border variants
============================================================================= */
/*
 * Add borders to all cells.
 */
.table--bordered td, .table--bordered th {
  border: 1px solid #d6dadd;
}

.table--bordered tr,
.table--bordered thead tr {
  border: 0;
}

/*
 * Remove borders from body rows.
 */
.table--borderless tbody tr {
  border: 0;
}

/* Size variants
============================================================================= */
.table--xs td, .table--xs th {
  padding: 0.18em 0.32em;
}

.table--sm td, .table--sm th {
  padding: 0.36em 0.64em;
}

.table--lg td, .table--lg th {
  padding: 0.84em 0.96em;
}

.table--xl td, .table--xl th {
  padding: 1.08em 1.12em;
}

/* ACCORDION
============================================================================= */
.accordion {
  background-color: white;
  color: #444;
  cursor: pointer;
  padding: 18px;
  width: 100%;
  text-align: left;
  border: none;
  outline: none;
  transition: 0.4s;
}

.active_accordion, .accordion:hover {
  background-color: #e7e5e5;
}

.panel_accordion {
  padding: 0 18px;
  background-color: white;
  display: none;
  overflow: hidden;
}

.panel_accordion_description {
  padding: 0 18px;
  background-color: #e7e5e5;
  text-align: justify;
  display: none;
  overflow: hidden;
}

/* Responsive variants
============================================================================= */
/*
 * By using the `.{breakpoint}:table--responsive` classes, the table cells
 * will be displayed as blocks in a two-column layout in small screens,
 * and change to the original table layout when the viewport width
 * matches the desired breakpoint.
 *
 * Each cell in the body needs a `data-label` attribute with
 * the label/title, e.g.:
 *
 * <td data-label="Name:">John</td>
 *
 * Credit: https://css-tricks.com/responsive-data-tables/
 */
@media (max-width: 37.4375em) {
  .sm\:table--responsive {
    display: inline-block;
  }
  .sm\:table--responsive tbody > :nth-child(even) {
    background-color: #f0f2f3;
  }
  .sm\:table--responsive tbody > tr > td.calificaciones {
    border-left-width: 3.5px;
    border-left-color: #ddd;
  }
  .sm\:table--responsive thead > tr > th.calificaciones {
    border-left-width: 3.5px;
    border-left-color: #ddd;
  }
  .sm\:table--responsive tbody {
    display: block;
  }
  .sm\:table--responsive td, .sm\:table--responsive th {
    display: flex;
  }
  .sm\:table--responsive td {
    padding: 0.6em 0.8em;
    /* &:first-child {
            color: $color-gray-80;
            font-size: 18px;
            font-weight: 600;
        }

        &:first-child::before {
            margin: 0px;
            width: 0px;
        } */
  }
  .sm\:table--responsive td::before {
    color: #5f6b78;
    content: attr(data-label);
    font-size: 15px;
    flex-shrink: 0;
    margin-right: 0.8em;
    width: calc(45% - 0.8em);
  }
  .sm\:table--responsive td.table-resource__main {
    font-weight: 600;
    font-size: 18px;
  }
  .sm\:table--responsive td.table-resource__main::before {
    margin: 0px;
    width: 0px;
  }
  .sm\:table--responsive td:last-child {
    border-bottom: 0;
  }
  .sm\:table--responsive td.td-lineal {
    color: #5f6b78;
    border-bottom: 0px;
    font-size: 14px;
    font-weight: 400;
    padding-bottom: 0px;
    padding-top: 0px;
  }
  .sm\:table--responsive td.td-lineal::before {
    margin-right: 0;
    width: 0;
  }
  .sm\:table--responsive td.td-lineal::before {
    color: #5f6b78;
    font-size: 14px;
    font-weight: 400;
    margin-right: 0;
    width: 0;
  }
  .sm\:table--responsive thead {
    border: 0;
    clip: rect(0 0 0 0);
    height: 1px;
    margin: -1px;
    overflow: hidden;
    padding: 0;
    position: absolute;
    white-space: nowrap;
    width: 1px;
  }
  .sm\:table--responsive tr {
    display: block;
    padding-bottom: 0.5em;
    padding-top: 0.5em;
  }
  .sm\:table--responsive tr:first-child {
    border-top: 1px solid rgba(214, 218, 221, 0.5);
  }
}

@media (max-width: 44.9375em) {
  .md\:table--responsive {
    display: inline-block;
  }
  .md\:table--responsive tbody > :nth-child(even) {
    background-color: #f0f2f3;
  }
  .md\:table--responsive tbody > tr > td.calificaciones {
    border-left-width: 3.5px;
    border-left-color: #ddd;
  }
  .md\:table--responsive thead > tr > th.calificaciones {
    border-left-width: 3.5px;
    border-left-color: #ddd;
  }
  .md\:table--responsive tbody {
    display: block;
  }
  .md\:table--responsive td, .md\:table--responsive th {
    display: flex;
  }
  .md\:table--responsive td {
    padding: 0.6em 0.8em;
    /* &:first-child {
            color: $color-gray-80;
            font-size: 18px;
            font-weight: 600;
        }

        &:first-child::before {
            margin: 0px;
            width: 0px;
        } */
  }
  .md\:table--responsive td::before {
    color: #5f6b78;
    content: attr(data-label);
    font-size: 15px;
    flex-shrink: 0;
    margin-right: 0.8em;
    width: calc(45% - 0.8em);
  }
  .md\:table--responsive td.table-resource__main {
    font-weight: 600;
    font-size: 18px;
  }
  .md\:table--responsive td.table-resource__main::before {
    margin: 0px;
    width: 0px;
  }
  .md\:table--responsive td:last-child {
    border-bottom: 0;
  }
  .md\:table--responsive td.td-lineal {
    color: #5f6b78;
    border-bottom: 0px;
    font-size: 14px;
    font-weight: 400;
    padding-bottom: 0px;
    padding-top: 0px;
  }
  .md\:table--responsive td.td-lineal::before {
    margin-right: 0;
    width: 0;
  }
  .md\:table--responsive td.td-lineal::before {
    color: #5f6b78;
    font-size: 14px;
    font-weight: 400;
    margin-right: 0;
    width: 0;
  }
  .md\:table--responsive thead {
    border: 0;
    clip: rect(0 0 0 0);
    height: 1px;
    margin: -1px;
    overflow: hidden;
    padding: 0;
    position: absolute;
    white-space: nowrap;
    width: 1px;
  }
  .md\:table--responsive tr {
    display: block;
    padding-bottom: 0.5em;
    padding-top: 0.5em;
  }
  .md\:table--responsive tr:first-child {
    border-top: 1px solid rgba(214, 218, 221, 0.5);
  }
}

@media (max-width: 50.5625em) {
  .mdf\:table--responsive {
    display: inline-block;
  }
  .mdf\:table--responsive tbody > :nth-child(even) {
    background-color: #f0f2f3;
  }
  .mdf\:table--responsive tbody > tr > td.calificaciones {
    border-left-width: 3.5px;
    border-left-color: #ddd;
  }
  .mdf\:table--responsive thead > tr > th.calificaciones {
    border-left-width: 3.5px;
    border-left-color: #ddd;
  }
  .mdf\:table--responsive tbody {
    display: block;
  }
  .mdf\:table--responsive td, .mdf\:table--responsive th {
    display: flex;
  }
  .mdf\:table--responsive td {
    padding: 0.6em 0.8em;
    /* &:first-child {
            color: $color-gray-80;
            font-size: 18px;
            font-weight: 600;
        }

        &:first-child::before {
            margin: 0px;
            width: 0px;
        } */
  }
  .mdf\:table--responsive td::before {
    color: #5f6b78;
    content: attr(data-label);
    font-size: 15px;
    flex-shrink: 0;
    margin-right: 0.8em;
    width: calc(45% - 0.8em);
  }
  .mdf\:table--responsive td.table-resource__main {
    font-weight: 600;
    font-size: 18px;
  }
  .mdf\:table--responsive td.table-resource__main::before {
    margin: 0px;
    width: 0px;
  }
  .mdf\:table--responsive td:last-child {
    border-bottom: 0;
  }
  .mdf\:table--responsive td.td-lineal {
    color: #5f6b78;
    border-bottom: 0px;
    font-size: 14px;
    font-weight: 400;
    padding-bottom: 0px;
    padding-top: 0px;
  }
  .mdf\:table--responsive td.td-lineal::before {
    margin-right: 0;
    width: 0;
  }
  .mdf\:table--responsive td.td-lineal::before {
    color: #5f6b78;
    font-size: 14px;
    font-weight: 400;
    margin-right: 0;
    width: 0;
  }
  .mdf\:table--responsive thead {
    border: 0;
    clip: rect(0 0 0 0);
    height: 1px;
    margin: -1px;
    overflow: hidden;
    padding: 0;
    position: absolute;
    white-space: nowrap;
    width: 1px;
  }
  .mdf\:table--responsive tr {
    display: block;
    padding-bottom: 0.5em;
    padding-top: 0.5em;
  }
  .mdf\:table--responsive tr:first-child {
    border-top: 1px solid rgba(214, 218, 221, 0.5);
  }
}

@media (max-width: 59.9375em) {
  .lg\:table--responsive {
    display: inline-block;
  }
  .lg\:table--responsive tbody > :nth-child(even) {
    background-color: #f0f2f3;
  }
  .lg\:table--responsive tbody > tr > td.calificaciones {
    border-left-width: 3.5px;
    border-left-color: #ddd;
  }
  .lg\:table--responsive thead > tr > th.calificaciones {
    border-left-width: 3.5px;
    border-left-color: #ddd;
  }
  .lg\:table--responsive tbody {
    display: block;
  }
  .lg\:table--responsive td, .lg\:table--responsive th {
    display: flex;
  }
  .lg\:table--responsive td {
    padding: 0.6em 0.8em;
    /* &:first-child {
            color: $color-gray-80;
            font-size: 18px;
            font-weight: 600;
        }

        &:first-child::before {
            margin: 0px;
            width: 0px;
        } */
  }
  .lg\:table--responsive td::before {
    color: #5f6b78;
    content: attr(data-label);
    font-size: 15px;
    flex-shrink: 0;
    margin-right: 0.8em;
    width: calc(45% - 0.8em);
  }
  .lg\:table--responsive td.table-resource__main {
    font-weight: 600;
    font-size: 18px;
  }
  .lg\:table--responsive td.table-resource__main::before {
    margin: 0px;
    width: 0px;
  }
  .lg\:table--responsive td:last-child {
    border-bottom: 0;
  }
  .lg\:table--responsive td.td-lineal {
    color: #5f6b78;
    border-bottom: 0px;
    font-size: 14px;
    font-weight: 400;
    padding-bottom: 0px;
    padding-top: 0px;
  }
  .lg\:table--responsive td.td-lineal::before {
    margin-right: 0;
    width: 0;
  }
  .lg\:table--responsive td.td-lineal::before {
    color: #5f6b78;
    font-size: 14px;
    font-weight: 400;
    margin-right: 0;
    width: 0;
  }
  .lg\:table--responsive thead {
    border: 0;
    clip: rect(0 0 0 0);
    height: 1px;
    margin: -1px;
    overflow: hidden;
    padding: 0;
    position: absolute;
    white-space: nowrap;
    width: 1px;
  }
  .lg\:table--responsive tr {
    display: block;
    padding-bottom: 0.5em;
    padding-top: 0.5em;
  }
  .lg\:table--responsive tr:first-child {
    border-top: 1px solid rgba(214, 218, 221, 0.5);
  }
}

@media (max-width: 68.6875em) {
  .xl\:table--responsive {
    display: inline-block;
  }
  .xl\:table--responsive tbody > :nth-child(even) {
    background-color: #f0f2f3;
  }
  .xl\:table--responsive tbody > tr > td.calificaciones {
    border-left-width: 3.5px;
    border-left-color: #ddd;
  }
  .xl\:table--responsive thead > tr > th.calificaciones {
    border-left-width: 3.5px;
    border-left-color: #ddd;
  }
  .xl\:table--responsive tbody {
    display: block;
  }
  .xl\:table--responsive td, .xl\:table--responsive th {
    display: flex;
  }
  .xl\:table--responsive td {
    padding: 0.6em 0.8em;
    /* &:first-child {
            color: $color-gray-80;
            font-size: 18px;
            font-weight: 600;
        }

        &:first-child::before {
            margin: 0px;
            width: 0px;
        } */
  }
  .xl\:table--responsive td::before {
    color: #5f6b78;
    content: attr(data-label);
    font-size: 15px;
    flex-shrink: 0;
    margin-right: 0.8em;
    width: calc(45% - 0.8em);
  }
  .xl\:table--responsive td.table-resource__main {
    font-weight: 600;
    font-size: 18px;
  }
  .xl\:table--responsive td.table-resource__main::before {
    margin: 0px;
    width: 0px;
  }
  .xl\:table--responsive td:last-child {
    border-bottom: 0;
  }
  .xl\:table--responsive td.td-lineal {
    color: #5f6b78;
    border-bottom: 0px;
    font-size: 14px;
    font-weight: 400;
    padding-bottom: 0px;
    padding-top: 0px;
  }
  .xl\:table--responsive td.td-lineal::before {
    margin-right: 0;
    width: 0;
  }
  .xl\:table--responsive td.td-lineal::before {
    color: #5f6b78;
    font-size: 14px;
    font-weight: 400;
    margin-right: 0;
    width: 0;
  }
  .xl\:table--responsive thead {
    border: 0;
    clip: rect(0 0 0 0);
    height: 1px;
    margin: -1px;
    overflow: hidden;
    padding: 0;
    position: absolute;
    white-space: nowrap;
    width: 1px;
  }
  .xl\:table--responsive tr {
    display: block;
    padding-bottom: 0.5em;
    padding-top: 0.5em;
  }
  .xl\:table--responsive tr:first-child {
    border-top: 1px solid rgba(214, 218, 221, 0.5);
  }
}

@media (max-width: 81.1875em) {
  .xxl\:table--responsive {
    display: inline-block;
  }
  .xxl\:table--responsive tbody > :nth-child(even) {
    background-color: #f0f2f3;
  }
  .xxl\:table--responsive tbody > tr > td.calificaciones {
    border-left-width: 3.5px;
    border-left-color: #ddd;
  }
  .xxl\:table--responsive thead > tr > th.calificaciones {
    border-left-width: 3.5px;
    border-left-color: #ddd;
  }
  .xxl\:table--responsive tbody {
    display: block;
  }
  .xxl\:table--responsive td, .xxl\:table--responsive th {
    display: flex;
  }
  .xxl\:table--responsive td {
    padding: 0.6em 0.8em;
    /* &:first-child {
            color: $color-gray-80;
            font-size: 18px;
            font-weight: 600;
        }

        &:first-child::before {
            margin: 0px;
            width: 0px;
        } */
  }
  .xxl\:table--responsive td::before {
    color: #5f6b78;
    content: attr(data-label);
    font-size: 15px;
    flex-shrink: 0;
    margin-right: 0.8em;
    width: calc(45% - 0.8em);
  }
  .xxl\:table--responsive td.table-resource__main {
    font-weight: 600;
    font-size: 18px;
  }
  .xxl\:table--responsive td.table-resource__main::before {
    margin: 0px;
    width: 0px;
  }
  .xxl\:table--responsive td:last-child {
    border-bottom: 0;
  }
  .xxl\:table--responsive td.td-lineal {
    color: #5f6b78;
    border-bottom: 0px;
    font-size: 14px;
    font-weight: 400;
    padding-bottom: 0px;
    padding-top: 0px;
  }
  .xxl\:table--responsive td.td-lineal::before {
    margin-right: 0;
    width: 0;
  }
  .xxl\:table--responsive td.td-lineal::before {
    color: #5f6b78;
    font-size: 14px;
    font-weight: 400;
    margin-right: 0;
    width: 0;
  }
  .xxl\:table--responsive thead {
    border: 0;
    clip: rect(0 0 0 0);
    height: 1px;
    margin: -1px;
    overflow: hidden;
    padding: 0;
    position: absolute;
    white-space: nowrap;
    width: 1px;
  }
  .xxl\:table--responsive tr {
    display: block;
    padding-bottom: 0.5em;
    padding-top: 0.5em;
  }
  .xxl\:table--responsive tr:first-child {
    border-top: 1px solid rgba(214, 218, 221, 0.5);
  }
}

@media (max-width: 82.5625em) {
  .xxl-e\:table--responsive {
    display: inline-block;
  }
  .xxl-e\:table--responsive tbody > :nth-child(even) {
    background-color: #f0f2f3;
  }
  .xxl-e\:table--responsive tbody > tr > td.calificaciones {
    border-left-width: 3.5px;
    border-left-color: #ddd;
  }
  .xxl-e\:table--responsive thead > tr > th.calificaciones {
    border-left-width: 3.5px;
    border-left-color: #ddd;
  }
  .xxl-e\:table--responsive tbody {
    display: block;
  }
  .xxl-e\:table--responsive td, .xxl-e\:table--responsive th {
    display: flex;
  }
  .xxl-e\:table--responsive td {
    padding: 0.6em 0.8em;
    /* &:first-child {
            color: $color-gray-80;
            font-size: 18px;
            font-weight: 600;
        }

        &:first-child::before {
            margin: 0px;
            width: 0px;
        } */
  }
  .xxl-e\:table--responsive td::before {
    color: #5f6b78;
    content: attr(data-label);
    font-size: 15px;
    flex-shrink: 0;
    margin-right: 0.8em;
    width: calc(45% - 0.8em);
  }
  .xxl-e\:table--responsive td.table-resource__main {
    font-weight: 600;
    font-size: 18px;
  }
  .xxl-e\:table--responsive td.table-resource__main::before {
    margin: 0px;
    width: 0px;
  }
  .xxl-e\:table--responsive td:last-child {
    border-bottom: 0;
  }
  .xxl-e\:table--responsive td.td-lineal {
    color: #5f6b78;
    border-bottom: 0px;
    font-size: 14px;
    font-weight: 400;
    padding-bottom: 0px;
    padding-top: 0px;
  }
  .xxl-e\:table--responsive td.td-lineal::before {
    margin-right: 0;
    width: 0;
  }
  .xxl-e\:table--responsive td.td-lineal::before {
    color: #5f6b78;
    font-size: 14px;
    font-weight: 400;
    margin-right: 0;
    width: 0;
  }
  .xxl-e\:table--responsive thead {
    border: 0;
    clip: rect(0 0 0 0);
    height: 1px;
    margin: -1px;
    overflow: hidden;
    padding: 0;
    position: absolute;
    white-space: nowrap;
    width: 1px;
  }
  .xxl-e\:table--responsive tr {
    display: block;
    padding-bottom: 0.5em;
    padding-top: 0.5em;
  }
  .xxl-e\:table--responsive tr:first-child {
    border-top: 1px solid rgba(214, 218, 221, 0.5);
  }
}

@media (max-width: 99.9375em) {
  .xxxl\:table--responsive {
    display: inline-block;
  }
  .xxxl\:table--responsive tbody > :nth-child(even) {
    background-color: #f0f2f3;
  }
  .xxxl\:table--responsive tbody > tr > td.calificaciones {
    border-left-width: 3.5px;
    border-left-color: #ddd;
  }
  .xxxl\:table--responsive thead > tr > th.calificaciones {
    border-left-width: 3.5px;
    border-left-color: #ddd;
  }
  .xxxl\:table--responsive tbody {
    display: block;
  }
  .xxxl\:table--responsive td, .xxxl\:table--responsive th {
    display: flex;
  }
  .xxxl\:table--responsive td {
    padding: 0.6em 0.8em;
    /* &:first-child {
            color: $color-gray-80;
            font-size: 18px;
            font-weight: 600;
        }

        &:first-child::before {
            margin: 0px;
            width: 0px;
        } */
  }
  .xxxl\:table--responsive td::before {
    color: #5f6b78;
    content: attr(data-label);
    font-size: 15px;
    flex-shrink: 0;
    margin-right: 0.8em;
    width: calc(45% - 0.8em);
  }
  .xxxl\:table--responsive td.table-resource__main {
    font-weight: 600;
    font-size: 18px;
  }
  .xxxl\:table--responsive td.table-resource__main::before {
    margin: 0px;
    width: 0px;
  }
  .xxxl\:table--responsive td:last-child {
    border-bottom: 0;
  }
  .xxxl\:table--responsive td.td-lineal {
    color: #5f6b78;
    border-bottom: 0px;
    font-size: 14px;
    font-weight: 400;
    padding-bottom: 0px;
    padding-top: 0px;
  }
  .xxxl\:table--responsive td.td-lineal::before {
    margin-right: 0;
    width: 0;
  }
  .xxxl\:table--responsive td.td-lineal::before {
    color: #5f6b78;
    font-size: 14px;
    font-weight: 400;
    margin-right: 0;
    width: 0;
  }
  .xxxl\:table--responsive thead {
    border: 0;
    clip: rect(0 0 0 0);
    height: 1px;
    margin: -1px;
    overflow: hidden;
    padding: 0;
    position: absolute;
    white-space: nowrap;
    width: 1px;
  }
  .xxxl\:table--responsive tr {
    display: block;
    padding-bottom: 0.5em;
    padding-top: 0.5em;
  }
  .xxxl\:table--responsive tr:first-child {
    border-top: 1px solid rgba(214, 218, 221, 0.5);
  }
}

/*
================================================================================
profile
================================================================================
*/
.profile-panel {
  align-items: flex-start;
  display: flex;
  flex-wrap: wrap;
}

@media (min-width: 60em) {
  .profile-panel {
    flex-wrap: nowrap;
  }
}

/*
================================================================================
user-profile
================================================================================
*/
.profile-card {
  background-color: #fff;
  margin-bottom: 30px;
  margin-right: 30px;
  min-width: 100%;
  overflow: auto;
  position: relative;
}

@media (min-width: 60em) {
  .profile-card {
    min-width: 295px;
  }
}

.profile-card__button {
  width: 100%;
}

.profile-card__name {
  color: #3a4148;
  font-size: 22px;
}

.profile-card__picture {
  margin: 1.5rem 0;
  text-align: center;
}

.profile-card__property-name {
  color: #8a96a1;
  font-size: 0.8125rem;
}

.profile-card__property-value {
  color: #3a4148;
  font-size: 1rem;
}

.profile-card__empty-value {
  color: #8a96a1;
  font-size: 1rem;
}

/*
================================================================================
Overlay
================================================================================
*/
.overlay {
  background-color: #000;
  height: 100vh;
  opacity: 0;
  position: fixed;
  top: 0;
  left: 0;
  transition: opacity 200ms ease-out, visibility 200ms ease-out;
  visibility: hidden;
  width: 100vw;
  z-index: 2;
}

.overlay--active {
  opacity: 0.3;
  visibility: visible;
}

.menu-overlay {
  background-color: #000;
  height: 100vh;
  opacity: 0;
  position: fixed;
  top: 0;
  left: 0;
  transition: opacity 200ms ease-out, visibility 200ms ease-out;
  visibility: hidden;
  width: 100vw;
  z-index: 1;
}

.menu-overlay--active {
  opacity: 0.3;
  visibility: visible;
}

@media (min-width: 68.75em) {
  .menu-overlay--active {
    opacity: 0.3;
    visibility: hidden;
  }
}

/*
================================================================================
Base modal
================================================================================
*/
.base-modal {
  align-items: center;
  display: flex;
  flex-direction: column;
  height: 100vh;
  justify-content: flex-start;
  overflow-y: auto;
  padding: 30px 15px;
  position: fixed;
  top: 0;
  left: 0;
  width: 100vw;
  z-index: 11;
}

.base-modal::after {
  content: "";
  display: block;
  flex-shrink: 0;
  height: 30px;
  width: 100%;
}

.base-modal__close-btn {
  background-color: transparent;
  border-color: transparent;
  color: #adb5bd;
  padding: 6px 5px;
  position: absolute;
  top: 0;
  right: 0;
}

.base-modal__close-btn:focus, .base-modal__close-btn:hover, .base-modal__close-btn:active {
  color: #d03a40;
}

.base-modal__close-btn svg {
  height: 30px;
  stroke-width: 1.5;
  width: 30px;
}

.base-modal__panel {
  background-color: #fff;
  border-radius: 3px;
  box-shadow: 0 4px 8px -2px rgba(0, 0, 0, 0.2);
  margin: auto;
  max-width: 600px;
  padding: 15px 15px 20px;
  position: relative;
  width: 100%;
}

.base-modal__title {
  color: #3a4148;
  font-size: 1rem;
  font-weight: 600;
  padding-right: 30px;
}

/*
================================================================================
Modal
================================================================================
*/
.modal {
  align-items: center;
  display: flex;
  flex-direction: row;
  height: 100vh;
  justify-content: center;
  left: 0;
  overflow-y: auto;
  padding: 10px;
  position: absolute;
  top: 0;
  width: 100vw;
  z-index: 11;
}

.modal__card {
  background-color: #fff;
  border-radius: 4px;
  display: block;
  height: auto;
  margin: auto;
  max-height: auto;
  max-width: 600px;
  width: 90vw;
}

.modal__close-btn {
  background-color: transparent;
  border-color: transparent;
  color: #5f6b78;
  float: right;
  padding: 0px;
}

.modal__close-btn svg {
  height: 20px;
}

.modal__close-btn .close {
  vertical-align: bottom;
}

.modal__close-btn--process {
  position: absolute;
  right: 0;
  z-index: 1;
}

.modal__success-btn {
  background-color: #50AB87;
  border: 1px solid transparent;
  color: #fff;
  transition: background-color 150ms ease-out, border-color 150ms ease-out, color 150ms ease-out;
}

.modal__success-btn:focus, .modal__success-btn:hover, .modal__success-btn:active {
  color: #fff;
  text-decoration: none;
}

.modal__success-btn:focus, .modal__success-btn:hover {
  background-color: #4a9d7c;
  border-color: transparent;
}

.modal__success-btn:active {
  background-color: #469677;
  border-color: transparent;
}

.modal__success-btn:disabled:focus, .modal__success-btn:disabled:hover, .modal__success-btn:disabled:active {
  background-color: #50AB87;
  border-color: transparent;
  color: #fff;
}

.modal__success-btn.btn--loading::after {
  border-right-color: #fff;
  border-top-color: #fff;
}

.modal__success-btn .btn--loading:after {
  border-right-color: #fff;
  border-top-color: #fff;
}

/*
-------------------------------
group-panel  componente
---------------------------------
*/
.optativa-panel {
  margin-bottom: 30px;
}

.optativa-panel--selected {
  border: 2px solid #39c;
  border-radius: 4px 0;
}

.optativa-panel--selected::before {
  background-color: #39c;
  color: #fff;
  content: "Grupo seleccionado";
  display: blocK;
  font-size: 14px;
  padding: 5px;
  text-align: center;
  width: 100%;
}

.optativa-panel__container {
  background-color: #fff;
  border: 1px solid #d6dadd;
  border-radius: 4px;
  display: flex;
  flex-wrap: wrap;
  justify-content: stretch;
  margin-bottom: 30px;
  overflow: auto;
  position: relative;
  width: 100%;
}

.optativa-panel__container--optional-subject {
  padding-bottom: 25px;
}

.optativa-panel__container--practice {
  border-top: 0;
  border-top-left-radius: 0;
  border-top-right-radius: 0;
}

.optativa-panel__container--has-practice {
  border-bottom-left-radius: 0;
  border-bottom-right-radius: 0;
  margin-bottom: 0;
}

.optativa-panel__container--selected {
  border: 2px solid #39c;
  border-radius: 4px 0;
}

.optativa-panel__container--selected::before {
  background-color: #39c;
  color: #fff;
  content: "Grupo seleccionado";
  display: blocK;
  font-size: 14px;
  padding: 5px;
  text-align: center;
  width: 100%;
}

@media (min-width: 45em) {
  .optativa-panel__container {
    padding-bottom: 10px;
  }
}

.optativa-panel__container--has-practice .optativa-panel__item-selection {
  height: 10px;
}

@media (min-width: 45em) {
  .optativa-panel__container--has-practice .optativa-panel__item-selection {
    height: auto;
  }
}

.optativa-panel__container--has-practice .optativa-panel__item-selection section {
  display: none;
}

@media (min-width: 45em) {
  .optativa-panel__container--has-practice .optativa-panel__item-selection section {
    display: initial;
  }
}

.optativa-panel__button--info {
  background-color: #d1e8f3;
  border: 1px solid transparent;
  color: #3a4148;
  transition: background-color 150ms ease-out, border-color 150ms ease-out, color 150ms ease-out;
}

.optativa-panel__button--info:focus, .optativa-panel__button--info:hover, .optativa-panel__button--info:active {
  color: #3a4148;
  text-decoration: none;
}

.optativa-panel__button--info:focus, .optativa-panel__button--info:hover {
  background-color: #b4daec;
  border-color: transparent;
}

.optativa-panel__button--info:active {
  background-color: #a6d2e8;
  border-color: transparent;
}

.optativa-panel__button--info:disabled:focus, .optativa-panel__button--info:disabled:hover, .optativa-panel__button--info:disabled:active {
  background-color: #d1e8f3;
  border-color: transparent;
  color: #3a4148;
}

.optativa-panel__button--info.btn--loading::after {
  border-right-color: #3a4148;
  border-top-color: #3a4148;
}

.optativa-panel__container--practice .optativa-panel__item-classroom {
  border-bottom: 0;
  height: 90px;
  width: 100%;
  border: 1px solid red;
}

@media (min-width: 45em) {
  .optativa-panel__container--practice .optativa-panel__item-classroom {
    border-bottom: 1px solid #d6dadd;
    width: 65%;
  }
}

@media (min-width: 45em) {
  .optativa-panel__container--practice .optativa-panel__item-selection section {
    display: none;
  }
}

.optativa-panel__error-message {
  display: flex;
  order: 6;
  padding: 15px 30px;
  width: 100%;
}

.optativa-panel__error-message section {
  border-radius: 5px;
  display: flex;
  width: 100%;
}

.optativa-panel__item-classroom {
  display: flex;
  flex-direction: column;
  justify-content: center;
  align-self: flex-start;
  border-bottom: 0;
  font-size: 15px;
  margin-top: 20px;
  order: 3;
  padding-left: 25px;
  padding-right: 25px;
  text-align: left;
  width: 100%;
}

@media (min-width: 45em) {
  .optativa-panel__item-classroom {
    align-self: stretch;
    background-color: #f9fafa;
    border-bottom: 1px solid #d6dadd;
    display: flex;
    margin: 0;
    order: 2;
    width: 45%;
  }
  .optativa-panel__item-classroom--optional-subject {
    width: 70%;
  }
  .optativa-panel__item-classroom p {
    margin-bottom: 0.1rem;
  }
  .optativa-panel__item-classroom section {
    margin: auto 0;
  }
}

.optativa-panel__item-meter-section {
  background-color: #f9fafa;
  border-bottom: 1px solid #d6dadd;
  font-size: 12px;
  height: 90px;
  order: 2;
  text-align: center;
  width: 80%;
}

.optativa-panel__item-meter-section section {
  display: flex;
  height: 100%;
}

@media (min-width: 45em) {
  .optativa-panel__item-meter-section {
    background-color: #f9fafa;
    order: 3;
    width: 20%;
  }
}

.optativa-panel__item-name {
  align-self: stretch;
  background-color: #f9fafa;
  border-bottom: 1px solid #d6dadd;
  border-right: 1px solid #d6dadd;
  display: flex;
  flex-direction: column;
  align-items: center;
  justify-content: center;
  height: 90px;
  line-height: 1px;
  min-height: 75px;
  order: 1;
  text-align: center;
  width: 20%;
}

.optativa-panel__item-name p {
  color: #BA0000;
  font-size: 32px;
  line-height: 12px;
  height: 25px;
}

.optativa-panel__item-name span {
  text-align: center;
}

.optativa-panel__item-name section {
  margin: auto;
}

@media (min-width: 45em) {
  .optativa-panel__item-name {
    order: 1;
    width: 10%;
  }
}

.optativa-panel__item-schedule {
  align-self: center;
  margin-left: 2rem;
  margin-top: 40px;
  order: 4;
  text-align: center;
  width: 100%;
}

@media (min-width: 45em) {
  .optativa-panel__item-schedule {
    margin-left: 0;
    margin-top: 0;
    order: 5;
  }
}

.optativa-panel__item-selection {
  align-self: stretch;
  display: flex;
  height: 90px;
  justify-content: flex-end;
  margin-top: 10px;
  order: 5;
  padding-right: 0;
  text-align: center;
  width: 100%;
}

.optativa-panel__item-selection section {
  margin: auto 2px;
  width: 100%;
}

.optativa-panel__item-selection section button {
  max-width: 230px;
  width: 100%;
}

@media (min-width: 45em) {
  .optativa-panel__item-selection {
    background-color: #f9fafa;
    border-bottom: 1px solid #d6dadd;
    margin: 0;
    order: 4;
    padding-right: 15px;
    text-align: center;
    width: 25%;
  }
  .optativa-panel__item-selection section {
    width: initial;
  }
}

.optativa-panel__item-selection--error {
  height: 10px;
}

@media (min-width: 45em) {
  .optativa-panel__item-selection--error {
    height: auto;
  }
}

.optativa-panel__item-selection--error button {
  display: none;
}

@media (min-width: 45em) {
  .optativa-panel__item-selection--error button {
    display: initial;
  }
}

.optativa-panel__group-icon svg {
  color: #BA0000;
  height: 15px;
  margin-right: 5px;
  text-align: center;
  width: 20px;
}

.optativa-panel__teacher-icon svg {
  color: #BA0000;
  height: 20px;
  margin-right: 5px;
  text-align: center;
  width: 20px;
}

.optativa-panel__forbidden-icon svg {
  color: #BA0000;
  height: 16px;
  margin-right: 5px;
  text-align: center;
  width: 20px;
}

/*
-------------------------------
group-panel  componente
---------------------------------
*/
.group-panel {
  margin-bottom: 30px;
}

.group-panel--selected {
  border: 2px solid #39c;
  border-radius: 4px 0;
}

.group-panel--selected::before {
  background-color: #39c;
  color: #fff;
  content: "Grupo seleccionado";
  display: blocK;
  font-size: 14px;
  padding: 5px;
  text-align: center;
  width: 100%;
}

.group-panel__container {
  background-color: #fff;
  border: 1px solid #d6dadd;
  border-radius: 4px;
  display: flex;
  flex-wrap: wrap;
  justify-content: stretch;
  margin-bottom: 0;
  overflow: auto;
  position: relative;
  width: 100%;
}

.group-panel__container--optional-subject {
  padding-bottom: 25px;
}

.group-panel__container--practice {
  border-top: 0;
  border-top-left-radius: 0;
  border-top-right-radius: 0;
}

.group-panel__container--has-practice {
  border-bottom-left-radius: 0;
  border-bottom-right-radius: 0;
  margin-bottom: 0;
}

.group-panel__container--selected {
  border: 2px solid #39c;
  border-radius: 4px 0;
}

.group-panel__container--selected::before {
  background-color: #39c;
  color: #fff;
  content: "Grupo seleccionado";
  display: blocK;
  font-size: 14px;
  padding: 5px;
  text-align: center;
  width: 100%;
}

@media (min-width: 45em) {
  .group-panel__container {
    padding-bottom: 10px;
  }
}

.group-panel__container--has-practice .group-panel__item-selection {
  height: 10px;
}

@media (min-width: 45em) {
  .group-panel__container--has-practice .group-panel__item-selection {
    height: auto;
  }
}

.group-panel__container--has-practice .group-panel__item-selection section {
  display: none;
}

@media (min-width: 45em) {
  .group-panel__container--has-practice .group-panel__item-selection section {
    display: initial;
  }
}

.group-panel__button--info {
  background-color: #d1e8f3;
  border: 1px solid transparent;
  color: #3a4148;
  transition: background-color 150ms ease-out, border-color 150ms ease-out, color 150ms ease-out;
}

.group-panel__button--info:focus, .group-panel__button--info:hover, .group-panel__button--info:active {
  color: #3a4148;
  text-decoration: none;
}

.group-panel__button--info:focus, .group-panel__button--info:hover {
  background-color: #b4daec;
  border-color: transparent;
}

.group-panel__button--info:active {
  background-color: #a6d2e8;
  border-color: transparent;
}

.group-panel__button--info:disabled:focus, .group-panel__button--info:disabled:hover, .group-panel__button--info:disabled:active {
  background-color: #d1e8f3;
  border-color: transparent;
  color: #3a4148;
}

.group-panel__button--info.btn--loading::after {
  border-right-color: #3a4148;
  border-top-color: #3a4148;
}

.group-panel__container--practice .group-panel__item-classroom {
  border-bottom: 0;
  height: 90px;
  width: 100%;
}

@media (min-width: 45em) {
  .group-panel__container--practice .group-panel__item-classroom {
    border-bottom: 1px solid #d6dadd;
    width: 65%;
  }
}

@media (min-width: 45em) {
  .group-panel__container--practice .group-panel__item-selection section {
    display: none;
  }
}

.group-panel__error-message {
  display: flex;
  order: 6;
  padding: 15px 30px;
  width: 100%;
}

.group-panel__error-message section {
  border-radius: 5px;
  display: flex;
  width: 100%;
}

.group-panel__item-classroom {
  align-self: flex-start;
  border-bottom: 0;
  font-size: 15px;
  margin-top: 20px;
  order: 3;
  padding-left: 25px;
  padding-right: 25px;
  text-align: left;
  width: 100%;
}

@media (min-width: 45em) {
  .group-panel__item-classroom {
    align-self: stretch;
    background-color: #f9fafa;
    border-bottom: 1px solid #d6dadd;
    display: flex;
    margin: 0;
    order: 2;
    width: 45%;
  }
  .group-panel__item-classroom--optional-subject {
    width: 70%;
  }
  .group-panel__item-classroom p {
    margin-bottom: 0.1rem;
  }
  .group-panel__item-classroom section {
    margin: auto 0;
  }
}

.group-panel__item-meter-section {
  background-color: #f9fafa;
  border-bottom: 1px solid #d6dadd;
  font-size: 12px;
  height: 90px;
  order: 2;
  text-align: center;
  width: 80%;
}

.group-panel__item-meter-section section {
  display: flex;
  height: 100%;
}

@media (min-width: 45em) {
  .group-panel__item-meter-section {
    background-color: #f9fafa;
    order: 3;
    width: 20%;
  }
}

.group-panel__item-name {
  align-self: stretch;
  background-color: #f9fafa;
  border-bottom: 1px solid #d6dadd;
  border-right: 1px solid #d6dadd;
  display: flex;
  height: 90px;
  line-height: 1px;
  min-height: 75px;
  order: 1;
  text-align: center;
  width: 20%;
}

.group-panel__item-name p {
  color: #BA0000;
  font-size: 32px;
  line-height: 12px;
}

.group-panel__item-name span {
  text-align: center;
}

.group-panel__item-name section {
  margin: auto;
}

@media (min-width: 45em) {
  .group-panel__item-name {
    order: 1;
    width: 10%;
  }
}

.group-panel__item-schedule {
  align-self: center;
  margin-left: 2rem;
  margin-top: 40px;
  order: 4;
  text-align: center;
  width: 100%;
}

@media (min-width: 45em) {
  .group-panel__item-schedule {
    margin-left: 0;
    margin-top: 0;
    order: 5;
  }
}

.group-panel__item-selection {
  align-self: stretch;
  display: flex;
  height: 90px;
  justify-content: flex-end;
  margin-top: 10px;
  order: 5;
  padding-right: 0;
  text-align: center;
  width: 100%;
}

.group-panel__item-selection section {
  margin: auto 2px;
  width: 100%;
}

.group-panel__item-selection section button {
  max-width: 230px;
  width: 100%;
}

@media (min-width: 45em) {
  .group-panel__item-selection {
    background-color: #f9fafa;
    border-bottom: 1px solid #d6dadd;
    margin: 0;
    order: 4;
    padding-right: 15px;
    text-align: center;
    width: 25%;
  }
  .group-panel__item-selection section {
    width: initial;
  }
}

.group-panel__item-selection--error {
  height: 10px;
}

@media (min-width: 45em) {
  .group-panel__item-selection--error {
    height: auto;
  }
}

.group-panel__item-selection--error button {
  display: none;
}

@media (min-width: 45em) {
  .group-panel__item-selection--error button {
    display: initial;
  }
}

.group-panel__group-icon svg {
  color: #BA0000;
  height: 15px;
  margin-right: 5px;
  text-align: center;
  width: 20px;
}

.group-panel__teacher-icon svg {
  color: #BA0000;
  height: 20px;
  margin-right: 5px;
  text-align: center;
  width: 20px;
}

.group-panel__forbidden-icon svg {
  color: #BA0000;
  height: 16px;
  margin-right: 5px;
  text-align: center;
  width: 20px;
}

/*
================================================================================
meter
================================================================================
*/
.meter {
  -moz-border-radius: 25px;
  -moz-box-shadow: inset 0 -1px 1px #e7e9ec;
  -webkit-border-radius: 25px;
  -webkit-box-shadow: inset 0 -1px 1px #e7e9ec;
  background: #e7e9ec;
  border-radius: 25px;
  box-shadow: inset 0 -1px 1px #e7e9ec;
  height: 4px;
  /* Can be anything */
  margin: 0 auto;
  max-width: 150px;
  padding: 0;
  width: 70%;
}

.meter--large {
  min-width: 150px;
}

.meter__progress {
  border-radius: 20px;
  display: block;
  height: 100%;
  height: 4px;
  overflow: hidden;
  position: relative;
}

.meter-red > span {
  background-color: #d03a40;
}

.meter-yellow > span {
  background-color: #ffca34;
}

.meter-green > span {
  background-color: #20c372;
}

/*
================================================================================
groups-table
================================================================================
*/
.groups-table {
  font-size: 10px;
}

.groups-table__b {
  position: sticky;
  top: 20px;
}

.groups-table tr {
  vertical-align: top;
}

.groups-table__cell--bordered {
  border: 1px solid #f0f2f3;
  height: 17.5px;
  padding: 0;
  width: 29px;
}

.groups-table__cell--assigned {
  background: #ebf5fa;
}

.groups-table__cell--last {
  display: none;
}

.groups-table__hour {
  line-height: 0.5;
  padding: 0  10px 0 0;
  text-align: right;
}

.groups-table__footer {
  color: #5f6b78;
  font-size: 13px;
  margin-top: 8px;
  text-align: center;
}

/*
================================================================================
modal-groups
================================================================================
*/
.modal-groups--loading::after {
  position: absolute;
  top: calc(50% - 0.6em);
  left: calc(50% - 2.15em);
  animation: spin 1750ms linear infinite;
  border: 4px solid rgba(0, 0, 0, 0.2);
  border-radius: 50%;
  border-top: 4px solid #BA0000;
  color: transparent !important;
  content: "";
  display: block;
  height: 60px;
  position: relative;
  width: 60px;
}

.modal-groups__card {
  background-color: #fff;
  border-radius: 4px;
  display: block;
  height: auto;
  margin: auto;
  max-height: auto;
  max-width: 900px;
  width: 90vw;
}

.modal-groups__close-button {
  display: flex;
  justify-content: space-between;
}

.modal-groups__close-button svg {
  height: 20px;
}

.modal-groups__close-button span {
  cursor: pointer;
}

.modal-groups__details {
  padding: 0 30px;
}

.modal-groups__group-list {
  background-color: #fff;
  overflow: auto;
  padding: 15px 30px;
  position: relative;
}

.modal-groups__return {
  margin-bottom: 30px;
}

.modal-groups__heading {
  background-color: #fff;
  border: 1px solid #e7e9ec;
  margin-bottom: 30px;
  overflow: auto;
  padding: 20px 15px;
  position: relative;
}

@media (min-width: 37.5em) {
  .modal-groups__heading {
    padding: 15px 30px;
  }
}

.modal-groups__selected-groups {
  display: flex;
  justify-content: center;
}

@media (min-width: 45em) {
  .modal-groups__selected-groups {
    justify-content: flex-end;
  }
}

/*
================================================================================
group-schedule
================================================================================
*/
.group-schedule {
  display: flex;
  flex-direction: column;
  justify-content: space-around;
}

@media (min-width: 720px) {
  .group-schedule {
    flex-direction: row;
    justify-content: space-around;
  }
}

.group-schedule__day {
  display: flex;
  margin-bottom: 10px;
  text-align: left;
}

.group-schedule__day--empty {
  display: none;
}

@media (min-width: 720px) {
  .group-schedule__day {
    display: block;
    padding: 0.5em;
    margin-bottom: 0px;
    text-align: center;
  }
  .group-schedule__day--empty {
    display: block;
  }
}

.group-schedule__day-acronym {
  color: #8a96a1;
  display: none;
  font-size: 13px;
  opacity: 0.3;
  width: 100px;
}

.group-schedule__day-acronym--bold {
  font-weight: 700;
  opacity: 1;
}

@media (min-width: 720px) {
  .group-schedule__day-acronym {
    display: block;
    width: 100%;
  }
}

.group-schedule__day-name {
  color: #8a96a1;
  display: inline-block;
  width: 100px;
}

@media (min-width: 720px) {
  .group-schedule__day-name {
    display: none;
    width: 100%;
  }
}

.group-schedule__time {
  color: #3a4148;
  display: inline-block;
  font-size: 15px;
}

.group-schedule__time--empty {
  display: none;
}

.group-schedule__time--forbidden > svg {
  background-size: 10px 10px;
  color: #BA0000;
  display: inline-block;
  height: 13px;
  margin-left: 5px;
  width: 13px;
}

@media (min-width: 720px) {
  .group-schedule__time {
    display: block;
    margin-top: 10px;
  }
}

/*
================================================================================
Steps
================================================================================
*/
.steps {
  max-width: 1059px;
}

@media (min-width: 37.5em) {
  .steps {
    margin: 5px 15px 0;
  }
}

.steps__info {
  color: #5f6b78;
  font-size: 0.8125rem;
}

.steps__list {
  list-style: none;
  padding-left: 15px;
  position: relative;
}

.steps__list:last-child::before {
  border: 0;
}

.steps__subtitle {
  color: #154258;
  margin-bottom: 40px;
  padding: 0;
}

/* Item
============================================================================= */
.steps__item {
  counter-increment: list;
  min-height: 60px;
  padding-left: 0.5rem;
  padding-top: 40px;
  position: relative;
  margin-top: 5px;
}

.steps__item::before {
  border-left: 2px solid #d6dadd;
  content: "";
  height: 100%;
  min-height: 24px;
  position: absolute;
  top: 0;
  left: -20px;
  width: 1px;
}

.steps__item:last-child {
  min-height: 0;
}

.steps__item:last-child::before {
  border: 0;
  min-height: 0;
  top: 0;
}

.steps__item--completed::before {
  border-color: #20c372;
}

/* - - - - - Header - - - - - */
.steps__item-header {
  cursor: pointer;
  position: absolute;
  top: 0;
  left: -39px;
  width: 100%;
}

.steps__item-number {
  align-items: center;
  background: #d6dadd;
  border: 5px solid #fff;
  border-radius: 50%;
  color: #5f6b78;
  display: inline-flex;
  font-size: 0.8125rem;
  font-weight: 600;
  height: 40px;
  justify-content: center;
  line-height: 2.35em;
  margin-right: 0.25em;
  text-align: center;
  vertical-align: top;
  width: 40px;
}

.steps__item-number::after {
  content: counter(list);
}

.steps__item--completed .steps__item-number {
  background: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='1.3em' height='1.3em' viewBox='0 0 24 24' fill='none' stroke='%23fff' stroke-width='2' stroke-miterlimit='10'%3E%3Cpath d='M5.5 12.5L10 17 20 7'/%3E%3C/svg%3E");
  background-color: #20c372;
  background-position: center;
  background-repeat: no-repeat;
  color: #fff;
}

.steps__item--completed .steps__item-number::after {
  content: "";
}

.steps__item--current .steps__item-number {
  background-color: #BA0000;
  color: #fff;
}

.steps__item-title {
  display: inline-block;
  font-weight: bold;
  margin-top: 0.5em;
  width: calc(100% - 50px);
}

/* - - - - - Body - - - - - */
.steps__item-body {
  color: #5f6b78;
  padding: 10px 0 20px;
  margin-top: 15px;
}

.steps__item--collapsed .steps__item-body {
  display: none;
}

@media (min-width: 40em) {
  .steps__item-body {
    margin-top: 1em;
  }
}

.steps__alert {
  background: #ebf5fa;
  border-radius: 4px;
  color: #3a4148;
  margin-bottom: 10px;
  padding: 15px;
}

.steps__alert small {
  color: #5f6b78;
}

.optional-subject__header {
  display: block;
  margin-bottom: 30px;
  text-align: center;
}

@media (min-width: 45em) {
  .optional-subject__header {
    align-items: flex-end;
    display: flex;
    justify-content: space-between;
    padding-bottom: 0;
  }
}

.optional-subject__subject-list {
  list-style-type: none;
  margin-bottom: 0;
  margin-left: 0;
  text-align: left;
}

.optional-subject__button {
  margin-bottom: 3px;
  margin-top: 40px;
  max-width: 181px;
  width: 181px;
}

@media (min-width: 45em) {
  .optional-subject__button {
    margin-top: 0;
  }
}

.optional-subject__label {
  background-color: #f0f2f3;
  border-radius: 3px;
  color: #5f6b78;
  font-size: 0.9375rem;
  margin: 1rem auto;
  max-width: 181px;
  padding: 0.75em 1em;
  text-align: center;
  width: 181px;
}

.optional-subject__label--danger {
  background-color: #f3cecf;
  color: #a1262b;
}

@media (min-width: 45em) {
  .optional-subject__label {
    margin: 0;
  }
}

@page {
  margin: 4.3cm 1.3cm 1.4cm 1.3cm;
  size: 21.6cm 35.4cm;
}

@media print {
  body {
    line-height: 1.3;
  }
  .text-center-nombre {
    width: 100%;
  }
  .grado {
    max-width: 400px;
    margin: 0 auto;
  }
  .header-container {
    display: flex;
    align-items: center;
    justify-content: space-around;
    text-align: center;
  }
  .foto {
    border-radius: 50%;
    border: solid 3px black;
    width: 200px !important;
    height: 230px !important;
  }
  .container-foto--certificado {
    display: flex;
    justify-content: center;
    align-items: flex-end;
    width: 2.2cm;
    height: 3.3cm;
    border-radius: 50%;
    background-color: white !important;
    margin-left: 1.5rem;
    margin-right: 2.5rem;
    overflow: hidden;
  }
  .foto-certificado {
    width: 2.2cm;
    height: auto;
    -o-object-fit: cover;
       object-fit: cover;
  }
  .container-foto--titulo {
    display: flex;
    justify-content: center;
    align-items: flex-end;
    width: 4cm;
    height: 6cm;
    background-color: white !important;
    border-radius: 50%;
    overflow: hidden;
  }
  .foto-titulo {
    width: 4cm;
    height: auto;
    -o-object-fit: cover;
       object-fit: cover;
  }
  .texto-foto {
    flex: 1;
    min-width: 0;
    text-align: justify;
    align-items: center;
  }
  .logo_left {
    width: 80px;
  }
  .logo_right {
    width: 100px;
  }
  .title-text {
    flex: 1;
    margin: 0;
    font-family: 'Arial';
    font-size: 25px;
    line-height: normal;
  }
  .marco-1 {
    border: 4px solid #5b463c;
    /* gruesa */
    padding: 5px;
    height: 100%;
    box-sizing: border-box;
  }
  .marco-2 {
    border: 1px solid #5b463c;
    /* delgada */
    padding: 5px;
    height: 100%;
    box-sizing: border-box;
  }
  .marco-3 {
    border: 6px solid #5b463c;
    /* gruesa */
    padding: 5px;
    height: 100%;
    box-sizing: border-box;
  }
  .marco-4 {
    border: 1px solid #5b463c;
    /* delgada */
    padding: 20px;
    height: 100%;
    box-sizing: border-box;
  }
  .flex {
    display: flex;
    justify-content: space-between;
  }
  .qr {
    display: block;
    width: 10%;
    height: 10%;
  }
  .qr-acta {
    display: block;
    width: 13%;
    height: 13%;
  }
  .qr-titulo {
    width: 2cm;
    height: 2cm;
  }
  .acta_qr {
    float: right;
    width: 15%;
    height: 15%;
    margin: 220px 0px 0px 600px;
  }
  .qr-certificado {
    width: 70px;
    height: 70px;
  }
  .qr-posgrado {
    width: 60px;
    height: 60px;
  }
  .container-qr {
    display: flex;
    flex-direction: column;
    align-items: flex-end;
    justify-content: flex-end;
    width: auto;
  }
  .sello {
    word-wrap: break-word;
    white-space: space;
    width: auto !important;
  }
  .container-firmas {
    margin-top: 0.5rem;
    width: 88%;
    box-sizing: border-box;
    align-items: start;
  }
  .container-firmas--posgrado {
    margin-top: 0.5rem;
    width: 82%;
    box-sizing: border-box;
    align-items: start;
  }
  .col-sello {
    display: flex;
    flex-direction: column;
    text-align: center;
    justify-content: center;
  }
  .container-sellos {
    display: flex;
    justify-content: space-between;
    align-items: flex-end;
  }
  .firma-rector {
    height: 65px;
    width: auto;
    margin: 0;
  }
  .firma-secretario {
    height: 90px;
    width: auto;
    margin: 0;
  }
  .titulo--firma-rector {
    height: 75px;
    width: auto;
    margin: 0;
  }
  .titulo--firma-secretario {
    height: 115px;
    width: auto;
    margin: 0;
  }
  .autority {
    width: 50%;
  }
  .title {
    font-size: 23px;
    font-weight: bold;
  }
  .letter_title {
    font-size: 25px;
    font-weight: bold;
    margin-left: 40px;
    margin-right: 40px;
  }
  .acta_title {
    font-size: 50px;
    line-height: 100%;
  }
  .pr-20 {
    padding-right: 120px;
  }
  .mt_50 {
    margin-top: 50px;
  }
  .mt_40 {
    margin-top: 40px;
  }
  .mt_10 {
    margin-top: 10px;
  }
  .mb_80 {
    margin-bottom: 80px;
  }
  .mb_50 {
    margin-bottom: 50px;
  }
  .mb_40 {
    margin-bottom: 40px;
  }
  .mb_30 {
    margin-bottom: 30px;
  }
  .mb_5 {
    margin-bottom: 5px;
  }
  .mb_-3 {
    margin-bottom: -3px;
  }
  .mr_25 {
    margin-right: 25px;
  }
  .ml_550 {
    margin-left: 550px;
  }
  .mx_50 {
    margin-left: 50px;
    margin-right: 50px;
  }
  .mx_40 {
    margin-left: 40px;
    margin-right: 40px;
  }
  .mx_70 {
    margin-left: 35px;
    margin-right: 35px;
  }
  .ml_600 {
    margin-left: 50px;
    margin-right: 50px;
  }
  .mx_30 {
    margin-left: 30px;
    margin-right: 30px;
  }
  .mx_20 {
    margin-left: 20px;
    margin-right: 20px;
  }
  .my_20 {
    margin-top: 20px;
    margin-bottom: 20px;
  }
  .mx_15 {
    margin-left: 15px;
    margin-right: 15px;
  }
  .size_60 {
    font-size: 60px;
  }
  .size_titulo_title {
    font-size: 60px;
  }
  .size_35 {
    font-size: 35px;
  }
  .size_33 {
    font-size: 33px;
  }
  .size_30 {
    font-size: 30px;
  }
  .size_26 {
    font-size: 26px;
  }
  .size_24 {
    font-size: 24px;
  }
  .size_22 {
    font-size: 22px;
  }
  .size_20 {
    font-size: 20px;
  }
  .size_19 {
    font-size: 19px;
  }
  .size_18 {
    font-size: 18px;
  }
  .size_17 {
    font-size: 17px;
  }
  .size_15 {
    font-size: 15px;
  }
  .size_14 {
    font-size: 14px;
  }
  .size_13 {
    font-size: 13px;
  }
  .size_12 {
    font-size: 12px;
  }
  .size_11 {
    font-size: 11px;
  }
  .size_10-5 {
    font-size: 10.5px;
  }
  .size_10 {
    font-size: 10px;
  }
  .size_9 {
    font-size: 9px;
  }
  .size_8 {
    font-size: 8px;
  }
  .size_7 {
    font-size: 7px;
  }
  .text-justify {
    text-align: justify;
  }
  .text-center {
    text-align: center;
  }
  .bold {
    font-weight: bold;
  }
  .arial {
    font-family: 'Arial';
  }
  .font {
    font-family: 'Arial';
  }
  .letter_font {
    font-family: 'Dancing Script', cursive;
    font-size: 45px;
  }
  .f-r {
    float: right;
  }
  .subscribed {
    margin-bottom: -1px;
    margin-top: -20px;
  }
  .program {
    margin-top: -15px;
    margin-bottom: 0px;
  }
  /* Aplica solo para la segunda mitad de tablas */
  .tabla-con-padding td:first-child,
  .tabla-con-padding th:first-child {
    padding-left: 8px !important;
  }
  .tabla-padding-derecho td:last-child,
  .tabla-padding-derecho th:last-child {
    padding-right: 8px !important;
  }
  .table_subjects {
    width: 50%;
    display: table-cell;
    font-family: 'Arial';
  }
  .table_subjects tbody {
    line-height: 1.2 !important;
  }
  .table_subjects td:first-child,
  .table_subjects th:first-child {
    padding-left: 0;
  }
  .table_subjects td, .table_subjects th {
    padding-left: 10px;
    vertical-align: top;
  }
  .table_subjects th {
    font-weight: bold;
  }
  .table_subjects tfoot {
    font-weight: bold;
  }
  .table_subjects thead th {
    vertical-align: bottom;
  }
}

.acta-flex-contenedor {
  display: flex;
  justify-content: space-between;
  align-items: stretch;
  line-height: 1.8;
  margin-bottom: 3.5rem;
  padding-left: 1.5rem;
}

.acta-datos {
  display: flex;
  flex-direction: column;
  gap: 20px;
  flex: 1;
}

.acta-campo {
  display: flex;
  flex-direction: column;
}

.acta-etiqueta {
  font-weight: bold;
  text-align: left;
}

.acta-valor {
  text-transform: uppercase;
  padding-left: 50px;
  word-break: break-word;
}

.acta-qr {
  display: flex;
  flex-direction: column;
  justify-content: flex-end;
}

.acta-qr-img {
  width: 100px;
  height: 100px;
}

.header-posgrado {
  display: flex;
  align-items: center;
  justify-content: space-between;
  text-align: center;
  padding-left: 1rem;
}

/*
 Card con los tramites
*/
.tramites-container {
  background: white;
  border-radius: 4px;
  color: #686d7a;
  display: block;
  width: 100%;
}

.tramites-thead {
  display: none;
}

@media (min-width: 46.25em) {
  .tramites-thead {
    border-bottom: 2px solid #202428;
    color: #3a4148;
    display: flex;
    font-size: 14px;
    margin: 0 30px;
    padding: 15px 0;
    width: 95%;
  }
}

.tramites-title {
  border-bottom: 1px solid #d6dadd;
  font-size: 17px;
  margin-bottom: 20px;
  padding: 10px 15px;
  width: 100%;
}

@media (min-width: 46.25em) {
  .tramites-title {
    display: flex;
    width: 100%;
  }
}

.tramites-detalle__title {
  font-size: 18px;
  font-weight: bold;
  margin-top: 2em;
}

.tramites-detalle__title:first-child {
  margin-top: 0;
}

.card-tramite {
  border-bottom: 1px solid #d6dadd;
  display: block;
  padding: 20px 15px;
  width: 100%;
}

@media (min-width: 46.25em) {
  .card-tramite {
    display: flex;
    margin: 0 30px;
    padding: 20px 0;
    width: 95%;
  }
  .card-tramite:nth-child(even) {
    background-color: #fcfdfd;
  }
}

.tramite-text {
  display: flex;
  font-size: 0.95em;
  padding: 10px;
  width: 100%;
}

@media (min-width: 46.25em) {
  .tramite-text {
    display: block;
    padding: 0;
    width: 25%;
  }
}

.tramite-text__consideraciones {
  display: flex;
  font-size: 0.95em;
  padding: 0;
  width: 100%;
}

@media (min-width: 46.25em) {
  .tramite-text__consideraciones {
    display: block;
    padding: 0;
    width: 100%;
  }
}

.tramite-text__consideraciones:nth-child(odd) {
  color: #3a4148;
  font-weight: bold;
  margin: 0;
  padding: 0;
}

.parrafo-tramite__consideraciones {
  display: flex;
  font-size: 0.95em;
  margin: 0;
  padding: 0;
  width: 100%;
}

@media (min-width: 46.25em) {
  .parrafo-tramite__consideraciones {
    display: block;
    padding: 0;
    width: 100%;
  }
}

@media (min-width: 46.25em) {
  .tramite-text__hide {
    display: none;
  }
}

.tramite-text__title {
  color: #3a4148;
  font-size: 18px;
  padding: 10px;
}

@media (min-width: 46.25em) {
  .tramite-text__title {
    display: flex;
    padding: 0;
    width: 50%;
  }
}

.address-container {
  width: 100%;
}

@media (min-width: 43.75em) {
  .address-container {
    width: auto;
  }
}

.tramites-confirmacion {
  background: white;
  color: #3a4148;
  font-size: 1em;
}

.tramite-col-sm {
  width: 100%;
}

@media (min-width: 37.5em) {
  .tramite-col-sm {
    width: 50%;
  }
}

@media (min-width: 60em) {
  .tramite-col-sm {
    width: 100%;
  }
}

/*
================================================================================
Toast
================================================================================
*/
.toast-container {
  margin: 0 10px;
  max-width: calc(100% - 20px);
  width: 350px;
  z-index: 6;
}

.toast-container--bottom-left {
  position: fixed;
  bottom: 20px;
  left: 0;
}

.toast-container--bottom-right {
  position: fixed;
  right: 0;
  bottom: 20px;
}

.toast-container--top-left {
  position: fixed;
  top: 20px;
  left: 0;
}

.toast-container--top-right {
  position: fixed;
  top: 20px;
  right: 0;
}

@media (min-width: 25em) {
  .toast-container {
    margin: 0 20px;
    max-width: calc(100% - 40px);
  }
}

.toast-container > * {
  align-items: flex-end;
  display: flex;
  flex-direction: column;
}

.toast {
  align-items: center;
  background-color: #e7e9ec;
  border: 1px solid #d6dadd;
  border-radius: 3px;
  display: flex;
  font-size: 0.875rem;
  line-height: 1.4;
  margin-bottom: 0.5rem;
  max-width: 350px;
  padding: 0.75em 0.5em 0.75em 1em;
  position: relative;
  transform-origin: right bottom;
  transition: all 1s;
  width: 100%;
}

.toast--info {
  background-color: #d1e8f3;
  border-color: #9acde6;
  color: #154258;
}

.toast--danger {
  background-color: #f3cecf;
  border-color: #eaa6a9;
  color: #a1262b;
}

.toast--success {
  background-color: #b6f3d5;
  border-color: #55e39c;
  color: #126b3f;
}

.toast--warning {
  background-color: #fff2cc;
  border-color: #ffdd7b;
  color: #7b5b00;
}

/* With icons
============================================================================= */
/*
 * Emphasize the text with a status icon.
 */
.toast--has-icon {
  background-position: 1em center;
  background-repeat: no-repeat;
  padding-left: 50px;
}

.toast--has-icon.toast--info {
  background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='23' height='23' viewBox='0 0 24 24' fill='%232d86b3'%3E%3Ccircle fill='none' stroke='%232d86b3' stroke-width='2' stroke-miterlimit='10' cx='12' cy='12' r='9'/%3E%3Ccircle cx='12' cy='16' r='1.25'/%3E%3Cpath d='M13 13.5h-2L10.5 6h3z'/%3E%3C/svg%3E");
}

.toast--has-icon.toast--success {
  background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='%2320c372' stroke-width='2' stroke-miterlimit='10'%3E%3Cpath d='M5.5 12.5L10 17 20 7'/%3E%3C/svg%3E");
}

.toast--has-icon.toast--warning {
  background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 1 24 24' fill='%23ffca34'%3E%3Cpath d='M20.58 16.51l-6.5-11.25c-.51-.87-1.26-1.38-2.08-1.38s-1.57.5-2.08 1.38l-6.5 11.25c-.5.88-.56 1.79-.15 2.49.41.71 1.22 1.11 2.23 1.11h13c1.01 0 1.83-.41 2.23-1.11.41-.7.35-1.61-.15-2.49zM12 18.15c-.64 0-1.15-.51-1.15-1.15s.51-1.15 1.15-1.15 1.15.51 1.15 1.15-.51 1.15-1.15 1.15zm1-3.65h-2l-.3-6h2.5l-.2 6z'/%3E%3C/svg%3E");
}

.toast--has-icon.toast--danger {
  background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='23' height='23' viewBox='0 0 24 24' fill='none' stroke='%23d03a40' stroke-width='2' stroke-miterlimit='10'%3E%3Ccircle cx='12' cy='12' r='9'/%3E%3Cpath d='M8 8l8 8m0-8l-8 8'/%3E%3C/svg%3E");
}

/* Close button
============================================================================= */
.toast__btn {
  background-color: transparent;
  background-position: center center;
  background-repeat: no-repeat;
  border: 0;
  font-size: 0.875rem;
  justify-self: flex-end;
  margin-left: 0.75em;
  opacity: 0.8;
  padding: 1em;
}

.toast__btn:focus, .toast__btn:hover, .toast__btn:active {
  opacity: 1;
}

.toast--danger .toast__btn {
  background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='16px' height='16px' viewBox='0 0 24 24' fill='none' stroke='%23a1262b' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Cline x1='18' y1='6' x2='6' y2='18'%3E%3C/line%3E%3Cline x1='6' y1='6' x2='18' y2='18'%3E%3C/line%3E%3C/svg%3E");
}

.toast--info .toast__btn {
  background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='16px' height='16px' viewBox='0 0 24 24' fill='none' stroke='%23154258' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Cline x1='18' y1='6' x2='6' y2='18'%3E%3C/line%3E%3Cline x1='6' y1='6' x2='18' y2='18'%3E%3C/line%3E%3C/svg%3E");
}

.toast--success .toast__btn {
  background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='16px' height='16px' viewBox='0 0 24 24' fill='none' stroke='%23126b3f' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Cline x1='18' y1='6' x2='6' y2='18'%3E%3C/line%3E%3Cline x1='6' y1='6' x2='18' y2='18'%3E%3C/line%3E%3C/svg%3E");
}

.toast--warning .toast__btn {
  background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='16px' height='16px' viewBox='0 0 24 24' fill='none' stroke='%237b5b00' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Cline x1='18' y1='6' x2='6' y2='18'%3E%3C/line%3E%3Cline x1='6' y1='6' x2='18' y2='18'%3E%3C/line%3E%3C/svg%3E");
}

/* Progress bar
============================================================================= */
.toast__progress {
  height: 2px;
  position: absolute;
  bottom: 0;
  left: 0;
  transform: scaleX(0);
  transform-origin: left center;
  width: 100%;
}

.toast--danger .toast__progress {
  background-color: #d03a40;
}

.toast--info .toast__progress {
  background-color: #2d86b3;
}

.toast--success .toast__progress {
  background-color: #20c372;
}

.toast--warning .toast__progress {
  background-color: #ffca34;
}

@keyframes toast-progress {
  0% {
    transform: scaleX(0);
  }
  100% {
    transform: scaleX(1);
  }
}

/* Animations
============================================================================= */
.toast--enter {
  animation: toast-enter 500ms ease-in-out forwards;
}

.toast--leave-to {
  animation: toast-leave 500ms ease-in-out forwards, toast-leave-space 300ms ease-in-out forwards 500ms;
}

@keyframes toast-enter {
  0% {
    opacity: 0;
    transform: translateY(-20px);
  }
  100% {
    opacity: 1;
    transform: translateY(0);
  }
}

@keyframes toast-leave {
  0% {
    opacity: 1;
    transform: translateX(0);
  }
  100% {
    opacity: 0;
    transform: translateX(40px);
  }
}

@keyframes toast-leave-space {
  100% {
    border: 0;
    height: 0;
    margin: 0;
    padding: 0;
  }
}

.header {
  background-color: #BA0000;
}

.logo {
  margin-left: 20px;
  margin-top: 20px;
  margin-bottom: 20px;
  display: absolute;
  height: 100px;
}

.promedio {
  background-color: #AEFE9D;
}

.nav-progress {
  color: #BA0000;
}

.nav {
  background-color: #BA0000;
  padding: 25px;
  position: relative;
}

#nav-button {
  float: right;
  text-decoration: none;
  margin-top: 0px;
}

.nav-ul {
  list-style-type: none;
  margin: 0;
  padding: 0;
  overflow: hidden;
  background-color: #BA0000;
}

.nav-li {
  float: right;
  display: flex;
}

.nav-li a {
  display: block;
  color: white;
  text-align: center;
  padding: 16px;
  text-decoration: none;
  margin-top: 20px;
  margin-right: 10px;
  border-radius: 5px;
}

.nav-li li a:hover {
  background-color: white;
  color: gray;
  text-decoration: none;
}

.footer {
  bottom: 0;
  font-size: 10px;
  line-height: 0.7cm;
  text-align: center;
  width: 100%;
}

.menu {
  list-style: none;
  background-color: #333;
  padding: 0;
  margin: 0;
}

.menu li {
  display: inline-block;
  margin-right: 10px;
}

.menu li a {
  display: block;
  color: #fff;
  text-align: center;
  padding: 10px 15px;
  text-decoration: none;
}

.menu li a:hover {
  background-color: #666;
}

/*
================================================================================
Print styles
================================================================================

Credit: https://github.com/h5bp/html5-boilerplate
*/
@media print {
  /*
     * 1. Black prints faster.
     */
  *,
  *::before,
  *::after {
    background: transparent !important;
    box-shadow: none !important;
    color: #000 !important;
    /* 1 */
    text-shadow: none !important;
  }
  a,
  a:visited {
    text-decoration: underline;
  }
  a[href]::after {
    content: " (" attr(href) ")";
  }
  abbr[title]::after {
    content: " (" attr(title) ")";
  }
  /*
     * Don't show links that are fragment identifiers,
     * or use the "javascript:" pseudo protocol.
     */
  a[href^="#"]::after,
  a[href^="javascript:"]::after {
    content: "";
  }
  pre {
    white-space: pre-wrap !important;
  }
  pre,
  blockquote {
    border: 1px solid #999;
    page-break-inside: avoid;
  }
  /*
     * Printing Tables:
     * http://css-discuss.incutio.com/wiki/Printing_Tables
     */
  thead {
    display: table-header-group;
  }
  tr,
  img {
    page-break-inside: avoid;
  }
  p, h2, .h2, h3, .h3 {
    orphans: 3;
    widows: 3;
  }
  h2, .h2, h3, .h3 {
    page-break-after: avoid;
  }
}

/*
================================================================================
Background colors
================================================================================
*/
.bg-transparent {
  background-color: transparent !important;
}

.bg-primary {
  background-color: #BA0000 !important;
}

.bg-black {
  background-color: #000 !important;
}

.bg-white {
  background-color: #fff !important;
}

.bg-link {
  background-color: #39c !important;
}

.bg-gray-10 {
  background-color: #f9fafa !important;
}

.bg-gray-20 {
  background-color: #f0f2f3 !important;
}

.bg-gray-30 {
  background-color: #e7e9ec !important;
}

.bg-gray-40 {
  background-color: #d6dadd !important;
}

.bg-gray-50 {
  background-color: #adb5bd !important;
}

.bg-gray-60 {
  background-color: #8a96a1 !important;
}

.bg-gray-70 {
  background-color: #5f6b78 !important;
}

.bg-gray-80 {
  background-color: #3a4148 !important;
}

.bg-gray-90 {
  background-color: #202428 !important;
}

.bg-blue-10 {
  background-color: #ebf5fa !important;
}

.bg-blue-20 {
  background-color: #d1e8f3 !important;
}

.bg-blue-30 {
  background-color: #9acde6 !important;
}

.bg-blue-40 {
  background-color: #67b3d9 !important;
}

.bg-blue-50 {
  background-color: #39c !important;
}

.bg-blue-60 {
  background-color: #2d86b3 !important;
}

.bg-blue-70 {
  background-color: #246b8e !important;
}

.bg-blue-80 {
  background-color: #154258 !important;
}

.bg-blue-90 {
  background-color: #0f2e3d !important;
}

.bg-info {
  background-color: #2d86b3 !important;
}

.bg-info-light {
  background-color: #d1e8f3 !important;
}

.bg-info-text {
  background-color: #154258 !important;
}

.bg-success {
  background-color: #20c372 !important;
}

.bg-success-light {
  background-color: #b6f3d5 !important;
}

.bg-success-text {
  background-color: #126b3f !important;
}

.bg-danger {
  background-color: #d03a40 !important;
}

.bg-danger-light {
  background-color: #f3cecf !important;
}

.bg-danger-text {
  background-color: #a1262b !important;
}

.bg-warning {
  background-color: #ffca34 !important;
}

.bg-warning-light {
  background-color: #fff2cc !important;
}

.bg-warning-text {
  background-color: #7b5b00 !important;
}

.bg-db {
  background-color: #50ab87 !important;
}

/*
================================================================================
Border
================================================================================
*/
.b-0 {
  border: 0 !important;
}

.bb-0 {
  border-bottom: 0 !important;
}

.bl-0 {
  border-left: 0 !important;
}

.br-0 {
  border-right: 0 !important;
}

.bt-0 {
  border-top: 0 !important;
}

.b-1 {
  border: 1px solid #d6dadd !important;
}

.bb-1 {
  border-bottom: 1px solid #d6dadd !important;
}

.bl-1 {
  border-left: 1px solid #d6dadd !important;
}

.br-1 {
  border-right: 1px solid #d6dadd !important;
}

.bt-1 {
  border-top: 1px solid #d6dadd !important;
}

.b-2 {
  border: 2px solid #d6dadd !important;
}

.bb-2 {
  border-bottom: 2px solid #d6dadd !important;
}

.bl-2 {
  border-left: 2px solid #d6dadd !important;
}

.br-2 {
  border-right: 2px solid #d6dadd !important;
}

.bt-2 {
  border-top: 2px solid #d6dadd !important;
}

.b-3 {
  border: 3px solid #d6dadd !important;
}

.bb-3 {
  border-bottom: 3px solid #d6dadd !important;
}

.bl-3 {
  border-left: 3px solid #d6dadd !important;
}

.br-3 {
  border-right: 3px solid #d6dadd !important;
}

.bt-3 {
  border-top: 3px solid #d6dadd !important;
}

.b-4 {
  border: 4px solid #d6dadd !important;
}

.bb-4 {
  border-bottom: 4px solid #d6dadd !important;
}

.bl-4 {
  border-left: 4px solid #d6dadd !important;
}

.br-4 {
  border-right: 4px solid #d6dadd !important;
}

.bt-4 {
  border-top: 4px solid #d6dadd !important;
}

.b-5 {
  border: 5px solid #d6dadd !important;
}

.bb-5 {
  border-bottom: 5px solid #d6dadd !important;
}

.bl-5 {
  border-left: 5px solid #d6dadd !important;
}

.br-5 {
  border-right: 5px solid #d6dadd !important;
}

.bt-5 {
  border-top: 5px solid #d6dadd !important;
}

@media (min-width: 37.5em) {
  .sm\:b-0 {
    border: 0 !important;
  }
  .sm\:bb-0 {
    border-bottom: 0 !important;
  }
  .sm\:bl-0 {
    border-left: 0 !important;
  }
  .sm\:br-0 {
    border-right: 0 !important;
  }
  .sm\:bt-0 {
    border-top: 0 !important;
  }
  .sm\:b-1 {
    border: 1px solid #d6dadd !important;
  }
  .sm\:bb-1 {
    border-bottom: 1px solid #d6dadd !important;
  }
  .sm\:bl-1 {
    border-left: 1px solid #d6dadd !important;
  }
  .sm\:br-1 {
    border-right: 1px solid #d6dadd !important;
  }
  .sm\:bt-1 {
    border-top: 1px solid #d6dadd !important;
  }
  .sm\:b-2 {
    border: 2px solid #d6dadd !important;
  }
  .sm\:bb-2 {
    border-bottom: 2px solid #d6dadd !important;
  }
  .sm\:bl-2 {
    border-left: 2px solid #d6dadd !important;
  }
  .sm\:br-2 {
    border-right: 2px solid #d6dadd !important;
  }
  .sm\:bt-2 {
    border-top: 2px solid #d6dadd !important;
  }
  .sm\:b-3 {
    border: 3px solid #d6dadd !important;
  }
  .sm\:bb-3 {
    border-bottom: 3px solid #d6dadd !important;
  }
  .sm\:bl-3 {
    border-left: 3px solid #d6dadd !important;
  }
  .sm\:br-3 {
    border-right: 3px solid #d6dadd !important;
  }
  .sm\:bt-3 {
    border-top: 3px solid #d6dadd !important;
  }
  .sm\:b-4 {
    border: 4px solid #d6dadd !important;
  }
  .sm\:bb-4 {
    border-bottom: 4px solid #d6dadd !important;
  }
  .sm\:bl-4 {
    border-left: 4px solid #d6dadd !important;
  }
  .sm\:br-4 {
    border-right: 4px solid #d6dadd !important;
  }
  .sm\:bt-4 {
    border-top: 4px solid #d6dadd !important;
  }
  .sm\:b-5 {
    border: 5px solid #d6dadd !important;
  }
  .sm\:bb-5 {
    border-bottom: 5px solid #d6dadd !important;
  }
  .sm\:bl-5 {
    border-left: 5px solid #d6dadd !important;
  }
  .sm\:br-5 {
    border-right: 5px solid #d6dadd !important;
  }
  .sm\:bt-5 {
    border-top: 5px solid #d6dadd !important;
  }
}

@media (min-width: 45em) {
  .md\:b-0 {
    border: 0 !important;
  }
  .md\:bb-0 {
    border-bottom: 0 !important;
  }
  .md\:bl-0 {
    border-left: 0 !important;
  }
  .md\:br-0 {
    border-right: 0 !important;
  }
  .md\:bt-0 {
    border-top: 0 !important;
  }
  .md\:b-1 {
    border: 1px solid #d6dadd !important;
  }
  .md\:bb-1 {
    border-bottom: 1px solid #d6dadd !important;
  }
  .md\:bl-1 {
    border-left: 1px solid #d6dadd !important;
  }
  .md\:br-1 {
    border-right: 1px solid #d6dadd !important;
  }
  .md\:bt-1 {
    border-top: 1px solid #d6dadd !important;
  }
  .md\:b-2 {
    border: 2px solid #d6dadd !important;
  }
  .md\:bb-2 {
    border-bottom: 2px solid #d6dadd !important;
  }
  .md\:bl-2 {
    border-left: 2px solid #d6dadd !important;
  }
  .md\:br-2 {
    border-right: 2px solid #d6dadd !important;
  }
  .md\:bt-2 {
    border-top: 2px solid #d6dadd !important;
  }
  .md\:b-3 {
    border: 3px solid #d6dadd !important;
  }
  .md\:bb-3 {
    border-bottom: 3px solid #d6dadd !important;
  }
  .md\:bl-3 {
    border-left: 3px solid #d6dadd !important;
  }
  .md\:br-3 {
    border-right: 3px solid #d6dadd !important;
  }
  .md\:bt-3 {
    border-top: 3px solid #d6dadd !important;
  }
  .md\:b-4 {
    border: 4px solid #d6dadd !important;
  }
  .md\:bb-4 {
    border-bottom: 4px solid #d6dadd !important;
  }
  .md\:bl-4 {
    border-left: 4px solid #d6dadd !important;
  }
  .md\:br-4 {
    border-right: 4px solid #d6dadd !important;
  }
  .md\:bt-4 {
    border-top: 4px solid #d6dadd !important;
  }
  .md\:b-5 {
    border: 5px solid #d6dadd !important;
  }
  .md\:bb-5 {
    border-bottom: 5px solid #d6dadd !important;
  }
  .md\:bl-5 {
    border-left: 5px solid #d6dadd !important;
  }
  .md\:br-5 {
    border-right: 5px solid #d6dadd !important;
  }
  .md\:bt-5 {
    border-top: 5px solid #d6dadd !important;
  }
}

@media (min-width: 50.625em) {
  .mdf\:b-0 {
    border: 0 !important;
  }
  .mdf\:bb-0 {
    border-bottom: 0 !important;
  }
  .mdf\:bl-0 {
    border-left: 0 !important;
  }
  .mdf\:br-0 {
    border-right: 0 !important;
  }
  .mdf\:bt-0 {
    border-top: 0 !important;
  }
  .mdf\:b-1 {
    border: 1px solid #d6dadd !important;
  }
  .mdf\:bb-1 {
    border-bottom: 1px solid #d6dadd !important;
  }
  .mdf\:bl-1 {
    border-left: 1px solid #d6dadd !important;
  }
  .mdf\:br-1 {
    border-right: 1px solid #d6dadd !important;
  }
  .mdf\:bt-1 {
    border-top: 1px solid #d6dadd !important;
  }
  .mdf\:b-2 {
    border: 2px solid #d6dadd !important;
  }
  .mdf\:bb-2 {
    border-bottom: 2px solid #d6dadd !important;
  }
  .mdf\:bl-2 {
    border-left: 2px solid #d6dadd !important;
  }
  .mdf\:br-2 {
    border-right: 2px solid #d6dadd !important;
  }
  .mdf\:bt-2 {
    border-top: 2px solid #d6dadd !important;
  }
  .mdf\:b-3 {
    border: 3px solid #d6dadd !important;
  }
  .mdf\:bb-3 {
    border-bottom: 3px solid #d6dadd !important;
  }
  .mdf\:bl-3 {
    border-left: 3px solid #d6dadd !important;
  }
  .mdf\:br-3 {
    border-right: 3px solid #d6dadd !important;
  }
  .mdf\:bt-3 {
    border-top: 3px solid #d6dadd !important;
  }
  .mdf\:b-4 {
    border: 4px solid #d6dadd !important;
  }
  .mdf\:bb-4 {
    border-bottom: 4px solid #d6dadd !important;
  }
  .mdf\:bl-4 {
    border-left: 4px solid #d6dadd !important;
  }
  .mdf\:br-4 {
    border-right: 4px solid #d6dadd !important;
  }
  .mdf\:bt-4 {
    border-top: 4px solid #d6dadd !important;
  }
  .mdf\:b-5 {
    border: 5px solid #d6dadd !important;
  }
  .mdf\:bb-5 {
    border-bottom: 5px solid #d6dadd !important;
  }
  .mdf\:bl-5 {
    border-left: 5px solid #d6dadd !important;
  }
  .mdf\:br-5 {
    border-right: 5px solid #d6dadd !important;
  }
  .mdf\:bt-5 {
    border-top: 5px solid #d6dadd !important;
  }
}

@media (min-width: 60em) {
  .lg\:b-0 {
    border: 0 !important;
  }
  .lg\:bb-0 {
    border-bottom: 0 !important;
  }
  .lg\:bl-0 {
    border-left: 0 !important;
  }
  .lg\:br-0 {
    border-right: 0 !important;
  }
  .lg\:bt-0 {
    border-top: 0 !important;
  }
  .lg\:b-1 {
    border: 1px solid #d6dadd !important;
  }
  .lg\:bb-1 {
    border-bottom: 1px solid #d6dadd !important;
  }
  .lg\:bl-1 {
    border-left: 1px solid #d6dadd !important;
  }
  .lg\:br-1 {
    border-right: 1px solid #d6dadd !important;
  }
  .lg\:bt-1 {
    border-top: 1px solid #d6dadd !important;
  }
  .lg\:b-2 {
    border: 2px solid #d6dadd !important;
  }
  .lg\:bb-2 {
    border-bottom: 2px solid #d6dadd !important;
  }
  .lg\:bl-2 {
    border-left: 2px solid #d6dadd !important;
  }
  .lg\:br-2 {
    border-right: 2px solid #d6dadd !important;
  }
  .lg\:bt-2 {
    border-top: 2px solid #d6dadd !important;
  }
  .lg\:b-3 {
    border: 3px solid #d6dadd !important;
  }
  .lg\:bb-3 {
    border-bottom: 3px solid #d6dadd !important;
  }
  .lg\:bl-3 {
    border-left: 3px solid #d6dadd !important;
  }
  .lg\:br-3 {
    border-right: 3px solid #d6dadd !important;
  }
  .lg\:bt-3 {
    border-top: 3px solid #d6dadd !important;
  }
  .lg\:b-4 {
    border: 4px solid #d6dadd !important;
  }
  .lg\:bb-4 {
    border-bottom: 4px solid #d6dadd !important;
  }
  .lg\:bl-4 {
    border-left: 4px solid #d6dadd !important;
  }
  .lg\:br-4 {
    border-right: 4px solid #d6dadd !important;
  }
  .lg\:bt-4 {
    border-top: 4px solid #d6dadd !important;
  }
  .lg\:b-5 {
    border: 5px solid #d6dadd !important;
  }
  .lg\:bb-5 {
    border-bottom: 5px solid #d6dadd !important;
  }
  .lg\:bl-5 {
    border-left: 5px solid #d6dadd !important;
  }
  .lg\:br-5 {
    border-right: 5px solid #d6dadd !important;
  }
  .lg\:bt-5 {
    border-top: 5px solid #d6dadd !important;
  }
}

@media (min-width: 68.75em) {
  .xl\:b-0 {
    border: 0 !important;
  }
  .xl\:bb-0 {
    border-bottom: 0 !important;
  }
  .xl\:bl-0 {
    border-left: 0 !important;
  }
  .xl\:br-0 {
    border-right: 0 !important;
  }
  .xl\:bt-0 {
    border-top: 0 !important;
  }
  .xl\:b-1 {
    border: 1px solid #d6dadd !important;
  }
  .xl\:bb-1 {
    border-bottom: 1px solid #d6dadd !important;
  }
  .xl\:bl-1 {
    border-left: 1px solid #d6dadd !important;
  }
  .xl\:br-1 {
    border-right: 1px solid #d6dadd !important;
  }
  .xl\:bt-1 {
    border-top: 1px solid #d6dadd !important;
  }
  .xl\:b-2 {
    border: 2px solid #d6dadd !important;
  }
  .xl\:bb-2 {
    border-bottom: 2px solid #d6dadd !important;
  }
  .xl\:bl-2 {
    border-left: 2px solid #d6dadd !important;
  }
  .xl\:br-2 {
    border-right: 2px solid #d6dadd !important;
  }
  .xl\:bt-2 {
    border-top: 2px solid #d6dadd !important;
  }
  .xl\:b-3 {
    border: 3px solid #d6dadd !important;
  }
  .xl\:bb-3 {
    border-bottom: 3px solid #d6dadd !important;
  }
  .xl\:bl-3 {
    border-left: 3px solid #d6dadd !important;
  }
  .xl\:br-3 {
    border-right: 3px solid #d6dadd !important;
  }
  .xl\:bt-3 {
    border-top: 3px solid #d6dadd !important;
  }
  .xl\:b-4 {
    border: 4px solid #d6dadd !important;
  }
  .xl\:bb-4 {
    border-bottom: 4px solid #d6dadd !important;
  }
  .xl\:bl-4 {
    border-left: 4px solid #d6dadd !important;
  }
  .xl\:br-4 {
    border-right: 4px solid #d6dadd !important;
  }
  .xl\:bt-4 {
    border-top: 4px solid #d6dadd !important;
  }
  .xl\:b-5 {
    border: 5px solid #d6dadd !important;
  }
  .xl\:bb-5 {
    border-bottom: 5px solid #d6dadd !important;
  }
  .xl\:bl-5 {
    border-left: 5px solid #d6dadd !important;
  }
  .xl\:br-5 {
    border-right: 5px solid #d6dadd !important;
  }
  .xl\:bt-5 {
    border-top: 5px solid #d6dadd !important;
  }
}

@media (min-width: 81.25em) {
  .xxl\:b-0 {
    border: 0 !important;
  }
  .xxl\:bb-0 {
    border-bottom: 0 !important;
  }
  .xxl\:bl-0 {
    border-left: 0 !important;
  }
  .xxl\:br-0 {
    border-right: 0 !important;
  }
  .xxl\:bt-0 {
    border-top: 0 !important;
  }
  .xxl\:b-1 {
    border: 1px solid #d6dadd !important;
  }
  .xxl\:bb-1 {
    border-bottom: 1px solid #d6dadd !important;
  }
  .xxl\:bl-1 {
    border-left: 1px solid #d6dadd !important;
  }
  .xxl\:br-1 {
    border-right: 1px solid #d6dadd !important;
  }
  .xxl\:bt-1 {
    border-top: 1px solid #d6dadd !important;
  }
  .xxl\:b-2 {
    border: 2px solid #d6dadd !important;
  }
  .xxl\:bb-2 {
    border-bottom: 2px solid #d6dadd !important;
  }
  .xxl\:bl-2 {
    border-left: 2px solid #d6dadd !important;
  }
  .xxl\:br-2 {
    border-right: 2px solid #d6dadd !important;
  }
  .xxl\:bt-2 {
    border-top: 2px solid #d6dadd !important;
  }
  .xxl\:b-3 {
    border: 3px solid #d6dadd !important;
  }
  .xxl\:bb-3 {
    border-bottom: 3px solid #d6dadd !important;
  }
  .xxl\:bl-3 {
    border-left: 3px solid #d6dadd !important;
  }
  .xxl\:br-3 {
    border-right: 3px solid #d6dadd !important;
  }
  .xxl\:bt-3 {
    border-top: 3px solid #d6dadd !important;
  }
  .xxl\:b-4 {
    border: 4px solid #d6dadd !important;
  }
  .xxl\:bb-4 {
    border-bottom: 4px solid #d6dadd !important;
  }
  .xxl\:bl-4 {
    border-left: 4px solid #d6dadd !important;
  }
  .xxl\:br-4 {
    border-right: 4px solid #d6dadd !important;
  }
  .xxl\:bt-4 {
    border-top: 4px solid #d6dadd !important;
  }
  .xxl\:b-5 {
    border: 5px solid #d6dadd !important;
  }
  .xxl\:bb-5 {
    border-bottom: 5px solid #d6dadd !important;
  }
  .xxl\:bl-5 {
    border-left: 5px solid #d6dadd !important;
  }
  .xxl\:br-5 {
    border-right: 5px solid #d6dadd !important;
  }
  .xxl\:bt-5 {
    border-top: 5px solid #d6dadd !important;
  }
}

@media (min-width: 82.625em) {
  .xxl-e\:b-0 {
    border: 0 !important;
  }
  .xxl-e\:bb-0 {
    border-bottom: 0 !important;
  }
  .xxl-e\:bl-0 {
    border-left: 0 !important;
  }
  .xxl-e\:br-0 {
    border-right: 0 !important;
  }
  .xxl-e\:bt-0 {
    border-top: 0 !important;
  }
  .xxl-e\:b-1 {
    border: 1px solid #d6dadd !important;
  }
  .xxl-e\:bb-1 {
    border-bottom: 1px solid #d6dadd !important;
  }
  .xxl-e\:bl-1 {
    border-left: 1px solid #d6dadd !important;
  }
  .xxl-e\:br-1 {
    border-right: 1px solid #d6dadd !important;
  }
  .xxl-e\:bt-1 {
    border-top: 1px solid #d6dadd !important;
  }
  .xxl-e\:b-2 {
    border: 2px solid #d6dadd !important;
  }
  .xxl-e\:bb-2 {
    border-bottom: 2px solid #d6dadd !important;
  }
  .xxl-e\:bl-2 {
    border-left: 2px solid #d6dadd !important;
  }
  .xxl-e\:br-2 {
    border-right: 2px solid #d6dadd !important;
  }
  .xxl-e\:bt-2 {
    border-top: 2px solid #d6dadd !important;
  }
  .xxl-e\:b-3 {
    border: 3px solid #d6dadd !important;
  }
  .xxl-e\:bb-3 {
    border-bottom: 3px solid #d6dadd !important;
  }
  .xxl-e\:bl-3 {
    border-left: 3px solid #d6dadd !important;
  }
  .xxl-e\:br-3 {
    border-right: 3px solid #d6dadd !important;
  }
  .xxl-e\:bt-3 {
    border-top: 3px solid #d6dadd !important;
  }
  .xxl-e\:b-4 {
    border: 4px solid #d6dadd !important;
  }
  .xxl-e\:bb-4 {
    border-bottom: 4px solid #d6dadd !important;
  }
  .xxl-e\:bl-4 {
    border-left: 4px solid #d6dadd !important;
  }
  .xxl-e\:br-4 {
    border-right: 4px solid #d6dadd !important;
  }
  .xxl-e\:bt-4 {
    border-top: 4px solid #d6dadd !important;
  }
  .xxl-e\:b-5 {
    border: 5px solid #d6dadd !important;
  }
  .xxl-e\:bb-5 {
    border-bottom: 5px solid #d6dadd !important;
  }
  .xxl-e\:bl-5 {
    border-left: 5px solid #d6dadd !important;
  }
  .xxl-e\:br-5 {
    border-right: 5px solid #d6dadd !important;
  }
  .xxl-e\:bt-5 {
    border-top: 5px solid #d6dadd !important;
  }
}

@media (min-width: 100em) {
  .xxxl\:b-0 {
    border: 0 !important;
  }
  .xxxl\:bb-0 {
    border-bottom: 0 !important;
  }
  .xxxl\:bl-0 {
    border-left: 0 !important;
  }
  .xxxl\:br-0 {
    border-right: 0 !important;
  }
  .xxxl\:bt-0 {
    border-top: 0 !important;
  }
  .xxxl\:b-1 {
    border: 1px solid #d6dadd !important;
  }
  .xxxl\:bb-1 {
    border-bottom: 1px solid #d6dadd !important;
  }
  .xxxl\:bl-1 {
    border-left: 1px solid #d6dadd !important;
  }
  .xxxl\:br-1 {
    border-right: 1px solid #d6dadd !important;
  }
  .xxxl\:bt-1 {
    border-top: 1px solid #d6dadd !important;
  }
  .xxxl\:b-2 {
    border: 2px solid #d6dadd !important;
  }
  .xxxl\:bb-2 {
    border-bottom: 2px solid #d6dadd !important;
  }
  .xxxl\:bl-2 {
    border-left: 2px solid #d6dadd !important;
  }
  .xxxl\:br-2 {
    border-right: 2px solid #d6dadd !important;
  }
  .xxxl\:bt-2 {
    border-top: 2px solid #d6dadd !important;
  }
  .xxxl\:b-3 {
    border: 3px solid #d6dadd !important;
  }
  .xxxl\:bb-3 {
    border-bottom: 3px solid #d6dadd !important;
  }
  .xxxl\:bl-3 {
    border-left: 3px solid #d6dadd !important;
  }
  .xxxl\:br-3 {
    border-right: 3px solid #d6dadd !important;
  }
  .xxxl\:bt-3 {
    border-top: 3px solid #d6dadd !important;
  }
  .xxxl\:b-4 {
    border: 4px solid #d6dadd !important;
  }
  .xxxl\:bb-4 {
    border-bottom: 4px solid #d6dadd !important;
  }
  .xxxl\:bl-4 {
    border-left: 4px solid #d6dadd !important;
  }
  .xxxl\:br-4 {
    border-right: 4px solid #d6dadd !important;
  }
  .xxxl\:bt-4 {
    border-top: 4px solid #d6dadd !important;
  }
  .xxxl\:b-5 {
    border: 5px solid #d6dadd !important;
  }
  .xxxl\:bb-5 {
    border-bottom: 5px solid #d6dadd !important;
  }
  .xxxl\:bl-5 {
    border-left: 5px solid #d6dadd !important;
  }
  .xxxl\:br-5 {
    border-right: 5px solid #d6dadd !important;
  }
  .xxxl\:bt-5 {
    border-top: 5px solid #d6dadd !important;
  }
}

/*
================================================================================
Border color
================================================================================
*/
.border-transparent {
  border-color: transparent !important;
}

.border-primary {
  border-color: #BA0000 !important;
}

.border-black {
  border-color: #000 !important;
}

.border-white {
  border-color: #fff !important;
}

.border-link {
  border-color: #39c !important;
}

.border-gray-10 {
  border-color: #f9fafa !important;
}

.border-gray-20 {
  border-color: #f0f2f3 !important;
}

.border-gray-30 {
  border-color: #e7e9ec !important;
}

.border-gray-40 {
  border-color: #d6dadd !important;
}

.border-gray-50 {
  border-color: #adb5bd !important;
}

.border-gray-60 {
  border-color: #8a96a1 !important;
}

.border-gray-70 {
  border-color: #5f6b78 !important;
}

.border-gray-80 {
  border-color: #3a4148 !important;
}

.border-gray-90 {
  border-color: #202428 !important;
}

.border-blue-10 {
  border-color: #ebf5fa !important;
}

.border-blue-20 {
  border-color: #d1e8f3 !important;
}

.border-blue-30 {
  border-color: #9acde6 !important;
}

.border-blue-40 {
  border-color: #67b3d9 !important;
}

.border-blue-50 {
  border-color: #39c !important;
}

.border-blue-60 {
  border-color: #2d86b3 !important;
}

.border-blue-70 {
  border-color: #246b8e !important;
}

.border-blue-80 {
  border-color: #154258 !important;
}

.border-blue-90 {
  border-color: #0f2e3d !important;
}

.border-info {
  border-color: #2d86b3 !important;
}

.border-info-light {
  border-color: #d1e8f3 !important;
}

.border-info-text {
  border-color: #154258 !important;
}

.border-success {
  border-color: #20c372 !important;
}

.border-success-light {
  border-color: #b6f3d5 !important;
}

.border-success-text {
  border-color: #126b3f !important;
}

.border-danger {
  border-color: #d03a40 !important;
}

.border-danger-light {
  border-color: #f3cecf !important;
}

.border-danger-text {
  border-color: #a1262b !important;
}

.border-warning {
  border-color: #ffca34 !important;
}

.border-warning-light {
  border-color: #fff2cc !important;
}

.border-warning-text {
  border-color: #7b5b00 !important;
}

.border-db {
  border-color: #50ab87 !important;
}

/*
================================================================================
Border radius
================================================================================
*/
.rounded {
  border-radius: 3px !important;
}

.rounded-bottom {
  border-bottom-left-radius: 3px !important;
  border-bottom-right-radius: 3px !important;
}

.rounded-left {
  border-bottom-left-radius: 3px !important;
  border-top-left-radius: 3px !important;
}

.rounded-right {
  border-bottom-right-radius: 3px !important;
  border-top-right-radius: 3px !important;
}

.rounded-top {
  border-top-left-radius: 3px !important;
  border-top-right-radius: 3px !important;
}

.rounded-full {
  border-radius: 9999px !important;
}

.rounded-bottom-full {
  border-bottom-left-radius: 9999px !important;
  border-bottom-right-radius: 9999px !important;
}

.rounded-left-full {
  border-bottom-left-radius: 9999px !important;
  border-top-left-radius: 9999px !important;
}

.rounded-right-full {
  border-bottom-right-radius: 9999px !important;
  border-top-right-radius: 9999px !important;
}

.rounded-top-full {
  border-top-left-radius: 9999px !important;
  border-top-right-radius: 9999px !important;
}

.rounded-0 {
  border-radius: 0 !important;
}

.rounded-bottom-0 {
  border-bottom-left-radius: 0 !important;
  border-bottom-right-radius: 0 !important;
}

.rounded-left-0 {
  border-bottom-left-radius: 0 !important;
  border-top-left-radius: 0 !important;
}

.rounded-right-0 {
  border-bottom-right-radius: 0 !important;
  border-top-right-radius: 0 !important;
}

.rounded-top-0 {
  border-top-left-radius: 0 !important;
  border-top-right-radius: 0 !important;
}

.rounded-5 {
  border-radius: 5px !important;
}

.rounded-bottom-5 {
  border-bottom-left-radius: 5px !important;
  border-bottom-right-radius: 5px !important;
}

.rounded-left-5 {
  border-bottom-left-radius: 5px !important;
  border-top-left-radius: 5px !important;
}

.rounded-right-5 {
  border-bottom-right-radius: 5px !important;
  border-top-right-radius: 5px !important;
}

.rounded-top-5 {
  border-top-left-radius: 5px !important;
  border-top-right-radius: 5px !important;
}

.pointer {
  cursor: pointer;
}

/*
================================================================================
Display
================================================================================
*/
.d-block {
  display: block !important;
}

.d-inline {
  display: inline !important;
}

.d-inline-block {
  display: inline-block !important;
}

.d-flex {
  display: flex !important;
}

.d-inline-flex {
  display: inline-flex !important;
}

.d-table {
  display: table !important;
}

.hidden {
  display: none !important;
}

@media (min-width: 37.5em) {
  .sm\:d-block {
    display: block !important;
  }
  .sm\:d-inline {
    display: inline !important;
  }
  .sm\:d-inline-block {
    display: inline-block !important;
  }
  .sm\:d-flex {
    display: flex !important;
  }
  .sm\:d-inline-flex {
    display: inline-flex !important;
  }
  .sm\:d-table {
    display: table !important;
  }
  .sm\:hidden {
    display: none !important;
  }
}

@media (min-width: 45em) {
  .md\:d-block {
    display: block !important;
  }
  .md\:d-inline {
    display: inline !important;
  }
  .md\:d-inline-block {
    display: inline-block !important;
  }
  .md\:d-flex {
    display: flex !important;
  }
  .md\:d-inline-flex {
    display: inline-flex !important;
  }
  .md\:d-table {
    display: table !important;
  }
  .md\:hidden {
    display: none !important;
  }
}

@media (min-width: 50.625em) {
  .mdf\:d-block {
    display: block !important;
  }
  .mdf\:d-inline {
    display: inline !important;
  }
  .mdf\:d-inline-block {
    display: inline-block !important;
  }
  .mdf\:d-flex {
    display: flex !important;
  }
  .mdf\:d-inline-flex {
    display: inline-flex !important;
  }
  .mdf\:d-table {
    display: table !important;
  }
  .mdf\:hidden {
    display: none !important;
  }
}

@media (min-width: 60em) {
  .lg\:d-block {
    display: block !important;
  }
  .lg\:d-inline {
    display: inline !important;
  }
  .lg\:d-inline-block {
    display: inline-block !important;
  }
  .lg\:d-flex {
    display: flex !important;
  }
  .lg\:d-inline-flex {
    display: inline-flex !important;
  }
  .lg\:d-table {
    display: table !important;
  }
  .lg\:hidden {
    display: none !important;
  }
}

@media (min-width: 68.75em) {
  .xl\:d-block {
    display: block !important;
  }
  .xl\:d-inline {
    display: inline !important;
  }
  .xl\:d-inline-block {
    display: inline-block !important;
  }
  .xl\:d-flex {
    display: flex !important;
  }
  .xl\:d-inline-flex {
    display: inline-flex !important;
  }
  .xl\:d-table {
    display: table !important;
  }
  .xl\:hidden {
    display: none !important;
  }
}

@media (min-width: 81.25em) {
  .xxl\:d-block {
    display: block !important;
  }
  .xxl\:d-inline {
    display: inline !important;
  }
  .xxl\:d-inline-block {
    display: inline-block !important;
  }
  .xxl\:d-flex {
    display: flex !important;
  }
  .xxl\:d-inline-flex {
    display: inline-flex !important;
  }
  .xxl\:d-table {
    display: table !important;
  }
  .xxl\:hidden {
    display: none !important;
  }
}

@media (min-width: 82.625em) {
  .xxl-e\:d-block {
    display: block !important;
  }
  .xxl-e\:d-inline {
    display: inline !important;
  }
  .xxl-e\:d-inline-block {
    display: inline-block !important;
  }
  .xxl-e\:d-flex {
    display: flex !important;
  }
  .xxl-e\:d-inline-flex {
    display: inline-flex !important;
  }
  .xxl-e\:d-table {
    display: table !important;
  }
  .xxl-e\:hidden {
    display: none !important;
  }
}

@media (min-width: 100em) {
  .xxxl\:d-block {
    display: block !important;
  }
  .xxxl\:d-inline {
    display: inline !important;
  }
  .xxxl\:d-inline-block {
    display: inline-block !important;
  }
  .xxxl\:d-flex {
    display: flex !important;
  }
  .xxxl\:d-inline-flex {
    display: inline-flex !important;
  }
  .xxxl\:d-table {
    display: table !important;
  }
  .xxxl\:hidden {
    display: none !important;
  }
}

[v-cloak] {
  display: none !important;
}

/* Print
============================================================================= */
@media print {
  /*
     * Visible for printers.
     */
  .print\:d-block {
    display: block !important;
  }
  /*
     * Hidden from printers.
     */
  .print\:hidden {
    display: none !important;
  }
}

/*
================================================================================
Flex
================================================================================
*/
/*
 * Credit:
 * https://tailwindcss.com (flex utilities)
 * https://github.com/suitcss/utils-flex (order utilities)
 */
.flex-initial {
  flex: initial !important;
}

.flex-auto {
  flex: auto !important;
}

.flex-none {
  flex: none !important;
}

.flex-1 {
  flex: 1 !important;
}

.content-start {
  align-content: flex-start !important;
}

.content-center {
  align-content: center !important;
}

.content-end {
  align-content: flex-end !important;
}

.content-around {
  align-content: space-around !important;
}

.content-between {
  align-content: space-between !important;
}

.content-stretch {
  align-content: stretch !important;
}

.items-start {
  align-items: flex-start !important;
}

.items-center {
  align-items: center !important;
}

.items-end {
  align-items: flex-end !important;
}

.items-stretch {
  align-items: stretch !important;
}

.self-auto {
  align-self: auto !important;
}

.self-start {
  align-self: flex-start !important;
}

.self-center {
  align-self: center !important;
}

.self-end {
  align-self: flex-end !important;
}

.self-stretch {
  align-self: stretch !important;
}

.flex-col {
  flex-direction: column !important;
}

.flex-col-reverse {
  flex-direction: column-reverse !important;
}

.flex-row {
  flex-direction: row !important;
}

.flex-row-reverse {
  flex-direction: row-reverse !important;
}

.flex-grow-0 {
  flex-grow: 0 !important;
}

.flex-grow-1 {
  flex-grow: 1 !important;
}

.justify-start {
  justify-content: flex-start !important;
}

.justify-center {
  justify-content: center !important;
}

.justify-end {
  justify-content: flex-end !important;
}

.justify-around {
  justify-content: space-around !important;
}

.justify-between {
  justify-content: space-between !important;
}

.justify-evenly {
  justify-content: space-evenly !important;
}

.order-first {
  order: -1 !important;
}

.order-none {
  order: 0 !important;
}

.order-last {
  order: 1 !important;
}

.flex-nowrap {
  flex-wrap: nowrap !important;
}

.flex-wrap {
  flex-wrap: wrap !important;
}

.flex-wrap-reverse {
  flex-wrap: wrap-reverse !important;
}

@media (min-width: 37.5em) {
  .sm\:flex-initial {
    flex: initial !important;
  }
  .sm\:flex-auto {
    flex: auto !important;
  }
  .sm\:flex-none {
    flex: none !important;
  }
  .sm\:flex-1 {
    flex: 1 !important;
  }
  .sm\:content-start {
    align-content: flex-start !important;
  }
  .sm\:content-center {
    align-content: center !important;
  }
  .sm\:content-end {
    align-content: flex-end !important;
  }
  .sm\:content-around {
    align-content: space-around !important;
  }
  .sm\:content-between {
    align-content: space-between !important;
  }
  .sm\:content-stretch {
    align-content: stretch !important;
  }
  .sm\:items-start {
    align-items: flex-start !important;
  }
  .sm\:items-center {
    align-items: center !important;
  }
  .sm\:items-end {
    align-items: flex-end !important;
  }
  .sm\:items-stretch {
    align-items: stretch !important;
  }
  .sm\:self-auto {
    align-self: auto !important;
  }
  .sm\:self-start {
    align-self: flex-start !important;
  }
  .sm\:self-center {
    align-self: center !important;
  }
  .sm\:self-end {
    align-self: flex-end !important;
  }
  .sm\:self-stretch {
    align-self: stretch !important;
  }
  .sm\:flex-col {
    flex-direction: column !important;
  }
  .sm\:flex-col-reverse {
    flex-direction: column-reverse !important;
  }
  .sm\:flex-row {
    flex-direction: row !important;
  }
  .sm\:flex-row-reverse {
    flex-direction: row-reverse !important;
  }
  .sm\:flex-grow-0 {
    flex-grow: 0 !important;
  }
  .sm\:flex-grow-1 {
    flex-grow: 1 !important;
  }
  .sm\:justify-start {
    justify-content: flex-start !important;
  }
  .sm\:justify-center {
    justify-content: center !important;
  }
  .sm\:justify-end {
    justify-content: flex-end !important;
  }
  .sm\:justify-around {
    justify-content: space-around !important;
  }
  .sm\:justify-between {
    justify-content: space-between !important;
  }
  .sm\:justify-evenly {
    justify-content: space-evenly !important;
  }
  .sm\:order-first {
    order: -1 !important;
  }
  .sm\:order-none {
    order: 0 !important;
  }
  .sm\:order-last {
    order: 1 !important;
  }
  .sm\:flex-nowrap {
    flex-wrap: nowrap !important;
  }
  .sm\:flex-wrap {
    flex-wrap: wrap !important;
  }
  .sm\:flex-wrap-reverse {
    flex-wrap: wrap-reverse !important;
  }
}

@media (min-width: 45em) {
  .md\:flex-initial {
    flex: initial !important;
  }
  .md\:flex-auto {
    flex: auto !important;
  }
  .md\:flex-none {
    flex: none !important;
  }
  .md\:flex-1 {
    flex: 1 !important;
  }
  .md\:content-start {
    align-content: flex-start !important;
  }
  .md\:content-center {
    align-content: center !important;
  }
  .md\:content-end {
    align-content: flex-end !important;
  }
  .md\:content-around {
    align-content: space-around !important;
  }
  .md\:content-between {
    align-content: space-between !important;
  }
  .md\:content-stretch {
    align-content: stretch !important;
  }
  .md\:items-start {
    align-items: flex-start !important;
  }
  .md\:items-center {
    align-items: center !important;
  }
  .md\:items-end {
    align-items: flex-end !important;
  }
  .md\:items-stretch {
    align-items: stretch !important;
  }
  .md\:self-auto {
    align-self: auto !important;
  }
  .md\:self-start {
    align-self: flex-start !important;
  }
  .md\:self-center {
    align-self: center !important;
  }
  .md\:self-end {
    align-self: flex-end !important;
  }
  .md\:self-stretch {
    align-self: stretch !important;
  }
  .md\:flex-col {
    flex-direction: column !important;
  }
  .md\:flex-col-reverse {
    flex-direction: column-reverse !important;
  }
  .md\:flex-row {
    flex-direction: row !important;
  }
  .md\:flex-row-reverse {
    flex-direction: row-reverse !important;
  }
  .md\:flex-grow-0 {
    flex-grow: 0 !important;
  }
  .md\:flex-grow-1 {
    flex-grow: 1 !important;
  }
  .md\:justify-start {
    justify-content: flex-start !important;
  }
  .md\:justify-center {
    justify-content: center !important;
  }
  .md\:justify-end {
    justify-content: flex-end !important;
  }
  .md\:justify-around {
    justify-content: space-around !important;
  }
  .md\:justify-between {
    justify-content: space-between !important;
  }
  .md\:justify-evenly {
    justify-content: space-evenly !important;
  }
  .md\:order-first {
    order: -1 !important;
  }
  .md\:order-none {
    order: 0 !important;
  }
  .md\:order-last {
    order: 1 !important;
  }
  .md\:flex-nowrap {
    flex-wrap: nowrap !important;
  }
  .md\:flex-wrap {
    flex-wrap: wrap !important;
  }
  .md\:flex-wrap-reverse {
    flex-wrap: wrap-reverse !important;
  }
}

@media (min-width: 50.625em) {
  .mdf\:flex-initial {
    flex: initial !important;
  }
  .mdf\:flex-auto {
    flex: auto !important;
  }
  .mdf\:flex-none {
    flex: none !important;
  }
  .mdf\:flex-1 {
    flex: 1 !important;
  }
  .mdf\:content-start {
    align-content: flex-start !important;
  }
  .mdf\:content-center {
    align-content: center !important;
  }
  .mdf\:content-end {
    align-content: flex-end !important;
  }
  .mdf\:content-around {
    align-content: space-around !important;
  }
  .mdf\:content-between {
    align-content: space-between !important;
  }
  .mdf\:content-stretch {
    align-content: stretch !important;
  }
  .mdf\:items-start {
    align-items: flex-start !important;
  }
  .mdf\:items-center {
    align-items: center !important;
  }
  .mdf\:items-end {
    align-items: flex-end !important;
  }
  .mdf\:items-stretch {
    align-items: stretch !important;
  }
  .mdf\:self-auto {
    align-self: auto !important;
  }
  .mdf\:self-start {
    align-self: flex-start !important;
  }
  .mdf\:self-center {
    align-self: center !important;
  }
  .mdf\:self-end {
    align-self: flex-end !important;
  }
  .mdf\:self-stretch {
    align-self: stretch !important;
  }
  .mdf\:flex-col {
    flex-direction: column !important;
  }
  .mdf\:flex-col-reverse {
    flex-direction: column-reverse !important;
  }
  .mdf\:flex-row {
    flex-direction: row !important;
  }
  .mdf\:flex-row-reverse {
    flex-direction: row-reverse !important;
  }
  .mdf\:flex-grow-0 {
    flex-grow: 0 !important;
  }
  .mdf\:flex-grow-1 {
    flex-grow: 1 !important;
  }
  .mdf\:justify-start {
    justify-content: flex-start !important;
  }
  .mdf\:justify-center {
    justify-content: center !important;
  }
  .mdf\:justify-end {
    justify-content: flex-end !important;
  }
  .mdf\:justify-around {
    justify-content: space-around !important;
  }
  .mdf\:justify-between {
    justify-content: space-between !important;
  }
  .mdf\:justify-evenly {
    justify-content: space-evenly !important;
  }
  .mdf\:order-first {
    order: -1 !important;
  }
  .mdf\:order-none {
    order: 0 !important;
  }
  .mdf\:order-last {
    order: 1 !important;
  }
  .mdf\:flex-nowrap {
    flex-wrap: nowrap !important;
  }
  .mdf\:flex-wrap {
    flex-wrap: wrap !important;
  }
  .mdf\:flex-wrap-reverse {
    flex-wrap: wrap-reverse !important;
  }
}

@media (min-width: 60em) {
  .lg\:flex-initial {
    flex: initial !important;
  }
  .lg\:flex-auto {
    flex: auto !important;
  }
  .lg\:flex-none {
    flex: none !important;
  }
  .lg\:flex-1 {
    flex: 1 !important;
  }
  .lg\:content-start {
    align-content: flex-start !important;
  }
  .lg\:content-center {
    align-content: center !important;
  }
  .lg\:content-end {
    align-content: flex-end !important;
  }
  .lg\:content-around {
    align-content: space-around !important;
  }
  .lg\:content-between {
    align-content: space-between !important;
  }
  .lg\:content-stretch {
    align-content: stretch !important;
  }
  .lg\:items-start {
    align-items: flex-start !important;
  }
  .lg\:items-center {
    align-items: center !important;
  }
  .lg\:items-end {
    align-items: flex-end !important;
  }
  .lg\:items-stretch {
    align-items: stretch !important;
  }
  .lg\:self-auto {
    align-self: auto !important;
  }
  .lg\:self-start {
    align-self: flex-start !important;
  }
  .lg\:self-center {
    align-self: center !important;
  }
  .lg\:self-end {
    align-self: flex-end !important;
  }
  .lg\:self-stretch {
    align-self: stretch !important;
  }
  .lg\:flex-col {
    flex-direction: column !important;
  }
  .lg\:flex-col-reverse {
    flex-direction: column-reverse !important;
  }
  .lg\:flex-row {
    flex-direction: row !important;
  }
  .lg\:flex-row-reverse {
    flex-direction: row-reverse !important;
  }
  .lg\:flex-grow-0 {
    flex-grow: 0 !important;
  }
  .lg\:flex-grow-1 {
    flex-grow: 1 !important;
  }
  .lg\:justify-start {
    justify-content: flex-start !important;
  }
  .lg\:justify-center {
    justify-content: center !important;
  }
  .lg\:justify-end {
    justify-content: flex-end !important;
  }
  .lg\:justify-around {
    justify-content: space-around !important;
  }
  .lg\:justify-between {
    justify-content: space-between !important;
  }
  .lg\:justify-evenly {
    justify-content: space-evenly !important;
  }
  .lg\:order-first {
    order: -1 !important;
  }
  .lg\:order-none {
    order: 0 !important;
  }
  .lg\:order-last {
    order: 1 !important;
  }
  .lg\:flex-nowrap {
    flex-wrap: nowrap !important;
  }
  .lg\:flex-wrap {
    flex-wrap: wrap !important;
  }
  .lg\:flex-wrap-reverse {
    flex-wrap: wrap-reverse !important;
  }
}

@media (min-width: 68.75em) {
  .xl\:flex-initial {
    flex: initial !important;
  }
  .xl\:flex-auto {
    flex: auto !important;
  }
  .xl\:flex-none {
    flex: none !important;
  }
  .xl\:flex-1 {
    flex: 1 !important;
  }
  .xl\:content-start {
    align-content: flex-start !important;
  }
  .xl\:content-center {
    align-content: center !important;
  }
  .xl\:content-end {
    align-content: flex-end !important;
  }
  .xl\:content-around {
    align-content: space-around !important;
  }
  .xl\:content-between {
    align-content: space-between !important;
  }
  .xl\:content-stretch {
    align-content: stretch !important;
  }
  .xl\:items-start {
    align-items: flex-start !important;
  }
  .xl\:items-center {
    align-items: center !important;
  }
  .xl\:items-end {
    align-items: flex-end !important;
  }
  .xl\:items-stretch {
    align-items: stretch !important;
  }
  .xl\:self-auto {
    align-self: auto !important;
  }
  .xl\:self-start {
    align-self: flex-start !important;
  }
  .xl\:self-center {
    align-self: center !important;
  }
  .xl\:self-end {
    align-self: flex-end !important;
  }
  .xl\:self-stretch {
    align-self: stretch !important;
  }
  .xl\:flex-col {
    flex-direction: column !important;
  }
  .xl\:flex-col-reverse {
    flex-direction: column-reverse !important;
  }
  .xl\:flex-row {
    flex-direction: row !important;
  }
  .xl\:flex-row-reverse {
    flex-direction: row-reverse !important;
  }
  .xl\:flex-grow-0 {
    flex-grow: 0 !important;
  }
  .xl\:flex-grow-1 {
    flex-grow: 1 !important;
  }
  .xl\:justify-start {
    justify-content: flex-start !important;
  }
  .xl\:justify-center {
    justify-content: center !important;
  }
  .xl\:justify-end {
    justify-content: flex-end !important;
  }
  .xl\:justify-around {
    justify-content: space-around !important;
  }
  .xl\:justify-between {
    justify-content: space-between !important;
  }
  .xl\:justify-evenly {
    justify-content: space-evenly !important;
  }
  .xl\:order-first {
    order: -1 !important;
  }
  .xl\:order-none {
    order: 0 !important;
  }
  .xl\:order-last {
    order: 1 !important;
  }
  .xl\:flex-nowrap {
    flex-wrap: nowrap !important;
  }
  .xl\:flex-wrap {
    flex-wrap: wrap !important;
  }
  .xl\:flex-wrap-reverse {
    flex-wrap: wrap-reverse !important;
  }
}

@media (min-width: 81.25em) {
  .xxl\:flex-initial {
    flex: initial !important;
  }
  .xxl\:flex-auto {
    flex: auto !important;
  }
  .xxl\:flex-none {
    flex: none !important;
  }
  .xxl\:flex-1 {
    flex: 1 !important;
  }
  .xxl\:content-start {
    align-content: flex-start !important;
  }
  .xxl\:content-center {
    align-content: center !important;
  }
  .xxl\:content-end {
    align-content: flex-end !important;
  }
  .xxl\:content-around {
    align-content: space-around !important;
  }
  .xxl\:content-between {
    align-content: space-between !important;
  }
  .xxl\:content-stretch {
    align-content: stretch !important;
  }
  .xxl\:items-start {
    align-items: flex-start !important;
  }
  .xxl\:items-center {
    align-items: center !important;
  }
  .xxl\:items-end {
    align-items: flex-end !important;
  }
  .xxl\:items-stretch {
    align-items: stretch !important;
  }
  .xxl\:self-auto {
    align-self: auto !important;
  }
  .xxl\:self-start {
    align-self: flex-start !important;
  }
  .xxl\:self-center {
    align-self: center !important;
  }
  .xxl\:self-end {
    align-self: flex-end !important;
  }
  .xxl\:self-stretch {
    align-self: stretch !important;
  }
  .xxl\:flex-col {
    flex-direction: column !important;
  }
  .xxl\:flex-col-reverse {
    flex-direction: column-reverse !important;
  }
  .xxl\:flex-row {
    flex-direction: row !important;
  }
  .xxl\:flex-row-reverse {
    flex-direction: row-reverse !important;
  }
  .xxl\:flex-grow-0 {
    flex-grow: 0 !important;
  }
  .xxl\:flex-grow-1 {
    flex-grow: 1 !important;
  }
  .xxl\:justify-start {
    justify-content: flex-start !important;
  }
  .xxl\:justify-center {
    justify-content: center !important;
  }
  .xxl\:justify-end {
    justify-content: flex-end !important;
  }
  .xxl\:justify-around {
    justify-content: space-around !important;
  }
  .xxl\:justify-between {
    justify-content: space-between !important;
  }
  .xxl\:justify-evenly {
    justify-content: space-evenly !important;
  }
  .xxl\:order-first {
    order: -1 !important;
  }
  .xxl\:order-none {
    order: 0 !important;
  }
  .xxl\:order-last {
    order: 1 !important;
  }
  .xxl\:flex-nowrap {
    flex-wrap: nowrap !important;
  }
  .xxl\:flex-wrap {
    flex-wrap: wrap !important;
  }
  .xxl\:flex-wrap-reverse {
    flex-wrap: wrap-reverse !important;
  }
}

@media (min-width: 82.625em) {
  .xxl-e\:flex-initial {
    flex: initial !important;
  }
  .xxl-e\:flex-auto {
    flex: auto !important;
  }
  .xxl-e\:flex-none {
    flex: none !important;
  }
  .xxl-e\:flex-1 {
    flex: 1 !important;
  }
  .xxl-e\:content-start {
    align-content: flex-start !important;
  }
  .xxl-e\:content-center {
    align-content: center !important;
  }
  .xxl-e\:content-end {
    align-content: flex-end !important;
  }
  .xxl-e\:content-around {
    align-content: space-around !important;
  }
  .xxl-e\:content-between {
    align-content: space-between !important;
  }
  .xxl-e\:content-stretch {
    align-content: stretch !important;
  }
  .xxl-e\:items-start {
    align-items: flex-start !important;
  }
  .xxl-e\:items-center {
    align-items: center !important;
  }
  .xxl-e\:items-end {
    align-items: flex-end !important;
  }
  .xxl-e\:items-stretch {
    align-items: stretch !important;
  }
  .xxl-e\:self-auto {
    align-self: auto !important;
  }
  .xxl-e\:self-start {
    align-self: flex-start !important;
  }
  .xxl-e\:self-center {
    align-self: center !important;
  }
  .xxl-e\:self-end {
    align-self: flex-end !important;
  }
  .xxl-e\:self-stretch {
    align-self: stretch !important;
  }
  .xxl-e\:flex-col {
    flex-direction: column !important;
  }
  .xxl-e\:flex-col-reverse {
    flex-direction: column-reverse !important;
  }
  .xxl-e\:flex-row {
    flex-direction: row !important;
  }
  .xxl-e\:flex-row-reverse {
    flex-direction: row-reverse !important;
  }
  .xxl-e\:flex-grow-0 {
    flex-grow: 0 !important;
  }
  .xxl-e\:flex-grow-1 {
    flex-grow: 1 !important;
  }
  .xxl-e\:justify-start {
    justify-content: flex-start !important;
  }
  .xxl-e\:justify-center {
    justify-content: center !important;
  }
  .xxl-e\:justify-end {
    justify-content: flex-end !important;
  }
  .xxl-e\:justify-around {
    justify-content: space-around !important;
  }
  .xxl-e\:justify-between {
    justify-content: space-between !important;
  }
  .xxl-e\:justify-evenly {
    justify-content: space-evenly !important;
  }
  .xxl-e\:order-first {
    order: -1 !important;
  }
  .xxl-e\:order-none {
    order: 0 !important;
  }
  .xxl-e\:order-last {
    order: 1 !important;
  }
  .xxl-e\:flex-nowrap {
    flex-wrap: nowrap !important;
  }
  .xxl-e\:flex-wrap {
    flex-wrap: wrap !important;
  }
  .xxl-e\:flex-wrap-reverse {
    flex-wrap: wrap-reverse !important;
  }
}

@media (min-width: 100em) {
  .xxxl\:flex-initial {
    flex: initial !important;
  }
  .xxxl\:flex-auto {
    flex: auto !important;
  }
  .xxxl\:flex-none {
    flex: none !important;
  }
  .xxxl\:flex-1 {
    flex: 1 !important;
  }
  .xxxl\:content-start {
    align-content: flex-start !important;
  }
  .xxxl\:content-center {
    align-content: center !important;
  }
  .xxxl\:content-end {
    align-content: flex-end !important;
  }
  .xxxl\:content-around {
    align-content: space-around !important;
  }
  .xxxl\:content-between {
    align-content: space-between !important;
  }
  .xxxl\:content-stretch {
    align-content: stretch !important;
  }
  .xxxl\:items-start {
    align-items: flex-start !important;
  }
  .xxxl\:items-center {
    align-items: center !important;
  }
  .xxxl\:items-end {
    align-items: flex-end !important;
  }
  .xxxl\:items-stretch {
    align-items: stretch !important;
  }
  .xxxl\:self-auto {
    align-self: auto !important;
  }
  .xxxl\:self-start {
    align-self: flex-start !important;
  }
  .xxxl\:self-center {
    align-self: center !important;
  }
  .xxxl\:self-end {
    align-self: flex-end !important;
  }
  .xxxl\:self-stretch {
    align-self: stretch !important;
  }
  .xxxl\:flex-col {
    flex-direction: column !important;
  }
  .xxxl\:flex-col-reverse {
    flex-direction: column-reverse !important;
  }
  .xxxl\:flex-row {
    flex-direction: row !important;
  }
  .xxxl\:flex-row-reverse {
    flex-direction: row-reverse !important;
  }
  .xxxl\:flex-grow-0 {
    flex-grow: 0 !important;
  }
  .xxxl\:flex-grow-1 {
    flex-grow: 1 !important;
  }
  .xxxl\:justify-start {
    justify-content: flex-start !important;
  }
  .xxxl\:justify-center {
    justify-content: center !important;
  }
  .xxxl\:justify-end {
    justify-content: flex-end !important;
  }
  .xxxl\:justify-around {
    justify-content: space-around !important;
  }
  .xxxl\:justify-between {
    justify-content: space-between !important;
  }
  .xxxl\:justify-evenly {
    justify-content: space-evenly !important;
  }
  .xxxl\:order-first {
    order: -1 !important;
  }
  .xxxl\:order-none {
    order: 0 !important;
  }
  .xxxl\:order-last {
    order: 1 !important;
  }
  .xxxl\:flex-nowrap {
    flex-wrap: nowrap !important;
  }
  .xxxl\:flex-wrap {
    flex-wrap: wrap !important;
  }
  .xxxl\:flex-wrap-reverse {
    flex-wrap: wrap-reverse !important;
  }
}

/*
================================================================================
Float
================================================================================
*/
.clearfix::after {
  clear: both;
  content: "";
  display: block;
}

.float-left {
  float: left !important;
}

.float-none {
  float: none !important;
}

.float-right {
  float: right !important;
}

@media (min-width: 37.5em) {
  .sm\:clearfix::after {
    clear: both;
    content: "";
    display: block;
  }
  .sm\:float-left {
    float: left !important;
  }
  .sm\:float-none {
    float: none !important;
  }
  .sm\:float-right {
    float: right !important;
  }
}

@media (min-width: 45em) {
  .md\:clearfix::after {
    clear: both;
    content: "";
    display: block;
  }
  .md\:float-left {
    float: left !important;
  }
  .md\:float-none {
    float: none !important;
  }
  .md\:float-right {
    float: right !important;
  }
}

@media (min-width: 50.625em) {
  .mdf\:clearfix::after {
    clear: both;
    content: "";
    display: block;
  }
  .mdf\:float-left {
    float: left !important;
  }
  .mdf\:float-none {
    float: none !important;
  }
  .mdf\:float-right {
    float: right !important;
  }
}

@media (min-width: 60em) {
  .lg\:clearfix::after {
    clear: both;
    content: "";
    display: block;
  }
  .lg\:float-left {
    float: left !important;
  }
  .lg\:float-none {
    float: none !important;
  }
  .lg\:float-right {
    float: right !important;
  }
}

@media (min-width: 68.75em) {
  .xl\:clearfix::after {
    clear: both;
    content: "";
    display: block;
  }
  .xl\:float-left {
    float: left !important;
  }
  .xl\:float-none {
    float: none !important;
  }
  .xl\:float-right {
    float: right !important;
  }
}

@media (min-width: 81.25em) {
  .xxl\:clearfix::after {
    clear: both;
    content: "";
    display: block;
  }
  .xxl\:float-left {
    float: left !important;
  }
  .xxl\:float-none {
    float: none !important;
  }
  .xxl\:float-right {
    float: right !important;
  }
}

@media (min-width: 82.625em) {
  .xxl-e\:clearfix::after {
    clear: both;
    content: "";
    display: block;
  }
  .xxl-e\:float-left {
    float: left !important;
  }
  .xxl-e\:float-none {
    float: none !important;
  }
  .xxl-e\:float-right {
    float: right !important;
  }
}

@media (min-width: 100em) {
  .xxxl\:clearfix::after {
    clear: both;
    content: "";
    display: block;
  }
  .xxxl\:float-left {
    float: left !important;
  }
  .xxxl\:float-none {
    float: none !important;
  }
  .xxxl\:float-right {
    float: right !important;
  }
}

/*
================================================================================
Margin
================================================================================
*/
.m-auto {
  margin: auto !important;
}

.mb-auto {
  margin-bottom: auto !important;
}

.ml-auto {
  margin-left: auto !important;
}

.mr-auto {
  margin-right: auto !important;
}

.mt-auto {
  margin-top: auto !important;
}

.mx-auto {
  margin-left: auto !important;
  margin-right: auto !important;
}

.my-auto {
  margin-bottom: auto !important;
  margin-top: auto !important;
}

.m-0 {
  margin: 0 !important;
}

.mb-0 {
  margin-bottom: 0 !important;
}

.ml-0 {
  margin-left: 0 !important;
}

.mr-0 {
  margin-right: 0 !important;
}

.mt-0 {
  margin-top: 0 !important;
}

.mx-0 {
  margin-left: 0 !important;
  margin-right: 0 !important;
}

.my-0 {
  margin-bottom: 0 !important;
  margin-top: 0 !important;
}

.m-1 {
  margin: 0.25rem !important;
}

.mb-1 {
  margin-bottom: 0.25rem !important;
}

.ml-1 {
  margin-left: 0.25rem !important;
}

.mr-1 {
  margin-right: 0.25rem !important;
}

.mt-1 {
  margin-top: 0.25rem !important;
}

.mx-1 {
  margin-left: 0.25rem !important;
  margin-right: 0.25rem !important;
}

.my-1 {
  margin-bottom: 0.25rem !important;
  margin-top: 0.25rem !important;
}

.m-2 {
  margin: 0.5rem !important;
}

.mb-2 {
  margin-bottom: 0.5rem !important;
}

.ml-2 {
  margin-left: 0.5rem !important;
}

.mr-2 {
  margin-right: 0.5rem !important;
}

.mt-2 {
  margin-top: 0.5rem !important;
}

.mx-2 {
  margin-left: 0.5rem !important;
  margin-right: 0.5rem !important;
}

.my-2 {
  margin-bottom: 0.5rem !important;
  margin-top: 0.5rem !important;
}

.m-3 {
  margin: 0.75rem !important;
}

.mb-3 {
  margin-bottom: 0.75rem !important;
}

.ml-3 {
  margin-left: 0.75rem !important;
}

.mr-3 {
  margin-right: 0.75rem !important;
}

.mt-3 {
  margin-top: 0.75rem !important;
}

.mx-3 {
  margin-left: 0.75rem !important;
  margin-right: 0.75rem !important;
}

.my-3 {
  margin-bottom: 0.75rem !important;
  margin-top: 0.75rem !important;
}

.m-4 {
  margin: 1rem !important;
}

.mb-4 {
  margin-bottom: 1rem !important;
}

.ml-4 {
  margin-left: 1rem !important;
}

.mr-4 {
  margin-right: 1rem !important;
}

.mt-4 {
  margin-top: 1rem !important;
}

.mx-4 {
  margin-left: 1rem !important;
  margin-right: 1rem !important;
}

.my-4 {
  margin-bottom: 1rem !important;
  margin-top: 1rem !important;
}

.m-6 {
  margin: 1.5rem !important;
}

.mb-6 {
  margin-bottom: 1.5rem !important;
}

.ml-6 {
  margin-left: 1.5rem !important;
}

.mr-6 {
  margin-right: 1.5rem !important;
}

.mt-6 {
  margin-top: 1.5rem !important;
}

.mx-6 {
  margin-left: 1.5rem !important;
  margin-right: 1.5rem !important;
}

.my-6 {
  margin-bottom: 1.5rem !important;
  margin-top: 1.5rem !important;
}

.m-8 {
  margin: 2rem !important;
}

.mb-8 {
  margin-bottom: 2rem !important;
}

.ml-8 {
  margin-left: 2rem !important;
}

.mr-8 {
  margin-right: 2rem !important;
}

.mt-8 {
  margin-top: 2rem !important;
}

.mx-8 {
  margin-left: 2rem !important;
  margin-right: 2rem !important;
}

.my-8 {
  margin-bottom: 2rem !important;
  margin-top: 2rem !important;
}

.m-10 {
  margin: 2.5rem !important;
}

.mb-10 {
  margin-bottom: 2.5rem !important;
}

.ml-10 {
  margin-left: 2.5rem !important;
}

.mr-10 {
  margin-right: 2.5rem !important;
}

.mt-10 {
  margin-top: 2.5rem !important;
}

.mx-10 {
  margin-left: 2.5rem !important;
  margin-right: 2.5rem !important;
}

.my-10 {
  margin-bottom: 2.5rem !important;
  margin-top: 2.5rem !important;
}

.m-12 {
  margin: 3rem !important;
}

.mb-12 {
  margin-bottom: 3rem !important;
}

.ml-12 {
  margin-left: 3rem !important;
}

.mr-12 {
  margin-right: 3rem !important;
}

.mt-12 {
  margin-top: 3rem !important;
}

.mx-12 {
  margin-left: 3rem !important;
  margin-right: 3rem !important;
}

.my-12 {
  margin-bottom: 3rem !important;
  margin-top: 3rem !important;
}

.m-16 {
  margin: 4rem !important;
}

.mb-16 {
  margin-bottom: 4rem !important;
}

.ml-16 {
  margin-left: 4rem !important;
}

.mr-16 {
  margin-right: 4rem !important;
}

.mt-16 {
  margin-top: 4rem !important;
}

.mx-16 {
  margin-left: 4rem !important;
  margin-right: 4rem !important;
}

.my-16 {
  margin-bottom: 4rem !important;
  margin-top: 4rem !important;
}

.m-18 {
  margin: 5rem !important;
}

.mb-18 {
  margin-bottom: 5rem !important;
}

.ml-18 {
  margin-left: 5rem !important;
}

.mr-18 {
  margin-right: 5rem !important;
}

.mt-18 {
  margin-top: 5rem !important;
}

.mx-18 {
  margin-left: 5rem !important;
  margin-right: 5rem !important;
}

.my-18 {
  margin-bottom: 5rem !important;
  margin-top: 5rem !important;
}

.m-gutter {
  margin: 30px !important;
}

.mb-gutter {
  margin-bottom: 30px !important;
}

.ml-gutter {
  margin-left: 30px !important;
}

.mr-gutter {
  margin-right: 30px !important;
}

.mt-gutter {
  margin-top: 30px !important;
}

.mx-gutter {
  margin-left: 30px !important;
  margin-right: 30px !important;
}

.my-gutter {
  margin-bottom: 30px !important;
  margin-top: 30px !important;
}

@media (min-width: 37.5em) {
  .sm\:m-auto {
    margin: auto !important;
  }
  .sm\:mb-auto {
    margin-bottom: auto !important;
  }
  .sm\:ml-auto {
    margin-left: auto !important;
  }
  .sm\:mr-auto {
    margin-right: auto !important;
  }
  .sm\:mt-auto {
    margin-top: auto !important;
  }
  .sm\:mx-auto {
    margin-left: auto !important;
    margin-right: auto !important;
  }
  .sm\:my-auto {
    margin-bottom: auto !important;
    margin-top: auto !important;
  }
  .sm\:m-0 {
    margin: 0 !important;
  }
  .sm\:mb-0 {
    margin-bottom: 0 !important;
  }
  .sm\:ml-0 {
    margin-left: 0 !important;
  }
  .sm\:mr-0 {
    margin-right: 0 !important;
  }
  .sm\:mt-0 {
    margin-top: 0 !important;
  }
  .sm\:mx-0 {
    margin-left: 0 !important;
    margin-right: 0 !important;
  }
  .sm\:my-0 {
    margin-bottom: 0 !important;
    margin-top: 0 !important;
  }
  .sm\:m-1 {
    margin: 0.25rem !important;
  }
  .sm\:mb-1 {
    margin-bottom: 0.25rem !important;
  }
  .sm\:ml-1 {
    margin-left: 0.25rem !important;
  }
  .sm\:mr-1 {
    margin-right: 0.25rem !important;
  }
  .sm\:mt-1 {
    margin-top: 0.25rem !important;
  }
  .sm\:mx-1 {
    margin-left: 0.25rem !important;
    margin-right: 0.25rem !important;
  }
  .sm\:my-1 {
    margin-bottom: 0.25rem !important;
    margin-top: 0.25rem !important;
  }
  .sm\:m-2 {
    margin: 0.5rem !important;
  }
  .sm\:mb-2 {
    margin-bottom: 0.5rem !important;
  }
  .sm\:ml-2 {
    margin-left: 0.5rem !important;
  }
  .sm\:mr-2 {
    margin-right: 0.5rem !important;
  }
  .sm\:mt-2 {
    margin-top: 0.5rem !important;
  }
  .sm\:mx-2 {
    margin-left: 0.5rem !important;
    margin-right: 0.5rem !important;
  }
  .sm\:my-2 {
    margin-bottom: 0.5rem !important;
    margin-top: 0.5rem !important;
  }
  .sm\:m-3 {
    margin: 0.75rem !important;
  }
  .sm\:mb-3 {
    margin-bottom: 0.75rem !important;
  }
  .sm\:ml-3 {
    margin-left: 0.75rem !important;
  }
  .sm\:mr-3 {
    margin-right: 0.75rem !important;
  }
  .sm\:mt-3 {
    margin-top: 0.75rem !important;
  }
  .sm\:mx-3 {
    margin-left: 0.75rem !important;
    margin-right: 0.75rem !important;
  }
  .sm\:my-3 {
    margin-bottom: 0.75rem !important;
    margin-top: 0.75rem !important;
  }
  .sm\:m-4 {
    margin: 1rem !important;
  }
  .sm\:mb-4 {
    margin-bottom: 1rem !important;
  }
  .sm\:ml-4 {
    margin-left: 1rem !important;
  }
  .sm\:mr-4 {
    margin-right: 1rem !important;
  }
  .sm\:mt-4 {
    margin-top: 1rem !important;
  }
  .sm\:mx-4 {
    margin-left: 1rem !important;
    margin-right: 1rem !important;
  }
  .sm\:my-4 {
    margin-bottom: 1rem !important;
    margin-top: 1rem !important;
  }
  .sm\:m-6 {
    margin: 1.5rem !important;
  }
  .sm\:mb-6 {
    margin-bottom: 1.5rem !important;
  }
  .sm\:ml-6 {
    margin-left: 1.5rem !important;
  }
  .sm\:mr-6 {
    margin-right: 1.5rem !important;
  }
  .sm\:mt-6 {
    margin-top: 1.5rem !important;
  }
  .sm\:mx-6 {
    margin-left: 1.5rem !important;
    margin-right: 1.5rem !important;
  }
  .sm\:my-6 {
    margin-bottom: 1.5rem !important;
    margin-top: 1.5rem !important;
  }
  .sm\:m-8 {
    margin: 2rem !important;
  }
  .sm\:mb-8 {
    margin-bottom: 2rem !important;
  }
  .sm\:ml-8 {
    margin-left: 2rem !important;
  }
  .sm\:mr-8 {
    margin-right: 2rem !important;
  }
  .sm\:mt-8 {
    margin-top: 2rem !important;
  }
  .sm\:mx-8 {
    margin-left: 2rem !important;
    margin-right: 2rem !important;
  }
  .sm\:my-8 {
    margin-bottom: 2rem !important;
    margin-top: 2rem !important;
  }
  .sm\:m-10 {
    margin: 2.5rem !important;
  }
  .sm\:mb-10 {
    margin-bottom: 2.5rem !important;
  }
  .sm\:ml-10 {
    margin-left: 2.5rem !important;
  }
  .sm\:mr-10 {
    margin-right: 2.5rem !important;
  }
  .sm\:mt-10 {
    margin-top: 2.5rem !important;
  }
  .sm\:mx-10 {
    margin-left: 2.5rem !important;
    margin-right: 2.5rem !important;
  }
  .sm\:my-10 {
    margin-bottom: 2.5rem !important;
    margin-top: 2.5rem !important;
  }
  .sm\:m-12 {
    margin: 3rem !important;
  }
  .sm\:mb-12 {
    margin-bottom: 3rem !important;
  }
  .sm\:ml-12 {
    margin-left: 3rem !important;
  }
  .sm\:mr-12 {
    margin-right: 3rem !important;
  }
  .sm\:mt-12 {
    margin-top: 3rem !important;
  }
  .sm\:mx-12 {
    margin-left: 3rem !important;
    margin-right: 3rem !important;
  }
  .sm\:my-12 {
    margin-bottom: 3rem !important;
    margin-top: 3rem !important;
  }
  .sm\:m-16 {
    margin: 4rem !important;
  }
  .sm\:mb-16 {
    margin-bottom: 4rem !important;
  }
  .sm\:ml-16 {
    margin-left: 4rem !important;
  }
  .sm\:mr-16 {
    margin-right: 4rem !important;
  }
  .sm\:mt-16 {
    margin-top: 4rem !important;
  }
  .sm\:mx-16 {
    margin-left: 4rem !important;
    margin-right: 4rem !important;
  }
  .sm\:my-16 {
    margin-bottom: 4rem !important;
    margin-top: 4rem !important;
  }
  .sm\:m-18 {
    margin: 5rem !important;
  }
  .sm\:mb-18 {
    margin-bottom: 5rem !important;
  }
  .sm\:ml-18 {
    margin-left: 5rem !important;
  }
  .sm\:mr-18 {
    margin-right: 5rem !important;
  }
  .sm\:mt-18 {
    margin-top: 5rem !important;
  }
  .sm\:mx-18 {
    margin-left: 5rem !important;
    margin-right: 5rem !important;
  }
  .sm\:my-18 {
    margin-bottom: 5rem !important;
    margin-top: 5rem !important;
  }
  .sm\:m-gutter {
    margin: 30px !important;
  }
  .sm\:mb-gutter {
    margin-bottom: 30px !important;
  }
  .sm\:ml-gutter {
    margin-left: 30px !important;
  }
  .sm\:mr-gutter {
    margin-right: 30px !important;
  }
  .sm\:mt-gutter {
    margin-top: 30px !important;
  }
  .sm\:mx-gutter {
    margin-left: 30px !important;
    margin-right: 30px !important;
  }
  .sm\:my-gutter {
    margin-bottom: 30px !important;
    margin-top: 30px !important;
  }
}

@media (min-width: 45em) {
  .md\:m-auto {
    margin: auto !important;
  }
  .md\:mb-auto {
    margin-bottom: auto !important;
  }
  .md\:ml-auto {
    margin-left: auto !important;
  }
  .md\:mr-auto {
    margin-right: auto !important;
  }
  .md\:mt-auto {
    margin-top: auto !important;
  }
  .md\:mx-auto {
    margin-left: auto !important;
    margin-right: auto !important;
  }
  .md\:my-auto {
    margin-bottom: auto !important;
    margin-top: auto !important;
  }
  .md\:m-0 {
    margin: 0 !important;
  }
  .md\:mb-0 {
    margin-bottom: 0 !important;
  }
  .md\:ml-0 {
    margin-left: 0 !important;
  }
  .md\:mr-0 {
    margin-right: 0 !important;
  }
  .md\:mt-0 {
    margin-top: 0 !important;
  }
  .md\:mx-0 {
    margin-left: 0 !important;
    margin-right: 0 !important;
  }
  .md\:my-0 {
    margin-bottom: 0 !important;
    margin-top: 0 !important;
  }
  .md\:m-1 {
    margin: 0.25rem !important;
  }
  .md\:mb-1 {
    margin-bottom: 0.25rem !important;
  }
  .md\:ml-1 {
    margin-left: 0.25rem !important;
  }
  .md\:mr-1 {
    margin-right: 0.25rem !important;
  }
  .md\:mt-1 {
    margin-top: 0.25rem !important;
  }
  .md\:mx-1 {
    margin-left: 0.25rem !important;
    margin-right: 0.25rem !important;
  }
  .md\:my-1 {
    margin-bottom: 0.25rem !important;
    margin-top: 0.25rem !important;
  }
  .md\:m-2 {
    margin: 0.5rem !important;
  }
  .md\:mb-2 {
    margin-bottom: 0.5rem !important;
  }
  .md\:ml-2 {
    margin-left: 0.5rem !important;
  }
  .md\:mr-2 {
    margin-right: 0.5rem !important;
  }
  .md\:mt-2 {
    margin-top: 0.5rem !important;
  }
  .md\:mx-2 {
    margin-left: 0.5rem !important;
    margin-right: 0.5rem !important;
  }
  .md\:my-2 {
    margin-bottom: 0.5rem !important;
    margin-top: 0.5rem !important;
  }
  .md\:m-3 {
    margin: 0.75rem !important;
  }
  .md\:mb-3 {
    margin-bottom: 0.75rem !important;
  }
  .md\:ml-3 {
    margin-left: 0.75rem !important;
  }
  .md\:mr-3 {
    margin-right: 0.75rem !important;
  }
  .md\:mt-3 {
    margin-top: 0.75rem !important;
  }
  .md\:mx-3 {
    margin-left: 0.75rem !important;
    margin-right: 0.75rem !important;
  }
  .md\:my-3 {
    margin-bottom: 0.75rem !important;
    margin-top: 0.75rem !important;
  }
  .md\:m-4 {
    margin: 1rem !important;
  }
  .md\:mb-4 {
    margin-bottom: 1rem !important;
  }
  .md\:ml-4 {
    margin-left: 1rem !important;
  }
  .md\:mr-4 {
    margin-right: 1rem !important;
  }
  .md\:mt-4 {
    margin-top: 1rem !important;
  }
  .md\:mx-4 {
    margin-left: 1rem !important;
    margin-right: 1rem !important;
  }
  .md\:my-4 {
    margin-bottom: 1rem !important;
    margin-top: 1rem !important;
  }
  .md\:m-6 {
    margin: 1.5rem !important;
  }
  .md\:mb-6 {
    margin-bottom: 1.5rem !important;
  }
  .md\:ml-6 {
    margin-left: 1.5rem !important;
  }
  .md\:mr-6 {
    margin-right: 1.5rem !important;
  }
  .md\:mt-6 {
    margin-top: 1.5rem !important;
  }
  .md\:mx-6 {
    margin-left: 1.5rem !important;
    margin-right: 1.5rem !important;
  }
  .md\:my-6 {
    margin-bottom: 1.5rem !important;
    margin-top: 1.5rem !important;
  }
  .md\:m-8 {
    margin: 2rem !important;
  }
  .md\:mb-8 {
    margin-bottom: 2rem !important;
  }
  .md\:ml-8 {
    margin-left: 2rem !important;
  }
  .md\:mr-8 {
    margin-right: 2rem !important;
  }
  .md\:mt-8 {
    margin-top: 2rem !important;
  }
  .md\:mx-8 {
    margin-left: 2rem !important;
    margin-right: 2rem !important;
  }
  .md\:my-8 {
    margin-bottom: 2rem !important;
    margin-top: 2rem !important;
  }
  .md\:m-10 {
    margin: 2.5rem !important;
  }
  .md\:mb-10 {
    margin-bottom: 2.5rem !important;
  }
  .md\:ml-10 {
    margin-left: 2.5rem !important;
  }
  .md\:mr-10 {
    margin-right: 2.5rem !important;
  }
  .md\:mt-10 {
    margin-top: 2.5rem !important;
  }
  .md\:mx-10 {
    margin-left: 2.5rem !important;
    margin-right: 2.5rem !important;
  }
  .md\:my-10 {
    margin-bottom: 2.5rem !important;
    margin-top: 2.5rem !important;
  }
  .md\:m-12 {
    margin: 3rem !important;
  }
  .md\:mb-12 {
    margin-bottom: 3rem !important;
  }
  .md\:ml-12 {
    margin-left: 3rem !important;
  }
  .md\:mr-12 {
    margin-right: 3rem !important;
  }
  .md\:mt-12 {
    margin-top: 3rem !important;
  }
  .md\:mx-12 {
    margin-left: 3rem !important;
    margin-right: 3rem !important;
  }
  .md\:my-12 {
    margin-bottom: 3rem !important;
    margin-top: 3rem !important;
  }
  .md\:m-16 {
    margin: 4rem !important;
  }
  .md\:mb-16 {
    margin-bottom: 4rem !important;
  }
  .md\:ml-16 {
    margin-left: 4rem !important;
  }
  .md\:mr-16 {
    margin-right: 4rem !important;
  }
  .md\:mt-16 {
    margin-top: 4rem !important;
  }
  .md\:mx-16 {
    margin-left: 4rem !important;
    margin-right: 4rem !important;
  }
  .md\:my-16 {
    margin-bottom: 4rem !important;
    margin-top: 4rem !important;
  }
  .md\:m-18 {
    margin: 5rem !important;
  }
  .md\:mb-18 {
    margin-bottom: 5rem !important;
  }
  .md\:ml-18 {
    margin-left: 5rem !important;
  }
  .md\:mr-18 {
    margin-right: 5rem !important;
  }
  .md\:mt-18 {
    margin-top: 5rem !important;
  }
  .md\:mx-18 {
    margin-left: 5rem !important;
    margin-right: 5rem !important;
  }
  .md\:my-18 {
    margin-bottom: 5rem !important;
    margin-top: 5rem !important;
  }
  .md\:m-gutter {
    margin: 30px !important;
  }
  .md\:mb-gutter {
    margin-bottom: 30px !important;
  }
  .md\:ml-gutter {
    margin-left: 30px !important;
  }
  .md\:mr-gutter {
    margin-right: 30px !important;
  }
  .md\:mt-gutter {
    margin-top: 30px !important;
  }
  .md\:mx-gutter {
    margin-left: 30px !important;
    margin-right: 30px !important;
  }
  .md\:my-gutter {
    margin-bottom: 30px !important;
    margin-top: 30px !important;
  }
}

@media (min-width: 50.625em) {
  .mdf\:m-auto {
    margin: auto !important;
  }
  .mdf\:mb-auto {
    margin-bottom: auto !important;
  }
  .mdf\:ml-auto {
    margin-left: auto !important;
  }
  .mdf\:mr-auto {
    margin-right: auto !important;
  }
  .mdf\:mt-auto {
    margin-top: auto !important;
  }
  .mdf\:mx-auto {
    margin-left: auto !important;
    margin-right: auto !important;
  }
  .mdf\:my-auto {
    margin-bottom: auto !important;
    margin-top: auto !important;
  }
  .mdf\:m-0 {
    margin: 0 !important;
  }
  .mdf\:mb-0 {
    margin-bottom: 0 !important;
  }
  .mdf\:ml-0 {
    margin-left: 0 !important;
  }
  .mdf\:mr-0 {
    margin-right: 0 !important;
  }
  .mdf\:mt-0 {
    margin-top: 0 !important;
  }
  .mdf\:mx-0 {
    margin-left: 0 !important;
    margin-right: 0 !important;
  }
  .mdf\:my-0 {
    margin-bottom: 0 !important;
    margin-top: 0 !important;
  }
  .mdf\:m-1 {
    margin: 0.25rem !important;
  }
  .mdf\:mb-1 {
    margin-bottom: 0.25rem !important;
  }
  .mdf\:ml-1 {
    margin-left: 0.25rem !important;
  }
  .mdf\:mr-1 {
    margin-right: 0.25rem !important;
  }
  .mdf\:mt-1 {
    margin-top: 0.25rem !important;
  }
  .mdf\:mx-1 {
    margin-left: 0.25rem !important;
    margin-right: 0.25rem !important;
  }
  .mdf\:my-1 {
    margin-bottom: 0.25rem !important;
    margin-top: 0.25rem !important;
  }
  .mdf\:m-2 {
    margin: 0.5rem !important;
  }
  .mdf\:mb-2 {
    margin-bottom: 0.5rem !important;
  }
  .mdf\:ml-2 {
    margin-left: 0.5rem !important;
  }
  .mdf\:mr-2 {
    margin-right: 0.5rem !important;
  }
  .mdf\:mt-2 {
    margin-top: 0.5rem !important;
  }
  .mdf\:mx-2 {
    margin-left: 0.5rem !important;
    margin-right: 0.5rem !important;
  }
  .mdf\:my-2 {
    margin-bottom: 0.5rem !important;
    margin-top: 0.5rem !important;
  }
  .mdf\:m-3 {
    margin: 0.75rem !important;
  }
  .mdf\:mb-3 {
    margin-bottom: 0.75rem !important;
  }
  .mdf\:ml-3 {
    margin-left: 0.75rem !important;
  }
  .mdf\:mr-3 {
    margin-right: 0.75rem !important;
  }
  .mdf\:mt-3 {
    margin-top: 0.75rem !important;
  }
  .mdf\:mx-3 {
    margin-left: 0.75rem !important;
    margin-right: 0.75rem !important;
  }
  .mdf\:my-3 {
    margin-bottom: 0.75rem !important;
    margin-top: 0.75rem !important;
  }
  .mdf\:m-4 {
    margin: 1rem !important;
  }
  .mdf\:mb-4 {
    margin-bottom: 1rem !important;
  }
  .mdf\:ml-4 {
    margin-left: 1rem !important;
  }
  .mdf\:mr-4 {
    margin-right: 1rem !important;
  }
  .mdf\:mt-4 {
    margin-top: 1rem !important;
  }
  .mdf\:mx-4 {
    margin-left: 1rem !important;
    margin-right: 1rem !important;
  }
  .mdf\:my-4 {
    margin-bottom: 1rem !important;
    margin-top: 1rem !important;
  }
  .mdf\:m-6 {
    margin: 1.5rem !important;
  }
  .mdf\:mb-6 {
    margin-bottom: 1.5rem !important;
  }
  .mdf\:ml-6 {
    margin-left: 1.5rem !important;
  }
  .mdf\:mr-6 {
    margin-right: 1.5rem !important;
  }
  .mdf\:mt-6 {
    margin-top: 1.5rem !important;
  }
  .mdf\:mx-6 {
    margin-left: 1.5rem !important;
    margin-right: 1.5rem !important;
  }
  .mdf\:my-6 {
    margin-bottom: 1.5rem !important;
    margin-top: 1.5rem !important;
  }
  .mdf\:m-8 {
    margin: 2rem !important;
  }
  .mdf\:mb-8 {
    margin-bottom: 2rem !important;
  }
  .mdf\:ml-8 {
    margin-left: 2rem !important;
  }
  .mdf\:mr-8 {
    margin-right: 2rem !important;
  }
  .mdf\:mt-8 {
    margin-top: 2rem !important;
  }
  .mdf\:mx-8 {
    margin-left: 2rem !important;
    margin-right: 2rem !important;
  }
  .mdf\:my-8 {
    margin-bottom: 2rem !important;
    margin-top: 2rem !important;
  }
  .mdf\:m-10 {
    margin: 2.5rem !important;
  }
  .mdf\:mb-10 {
    margin-bottom: 2.5rem !important;
  }
  .mdf\:ml-10 {
    margin-left: 2.5rem !important;
  }
  .mdf\:mr-10 {
    margin-right: 2.5rem !important;
  }
  .mdf\:mt-10 {
    margin-top: 2.5rem !important;
  }
  .mdf\:mx-10 {
    margin-left: 2.5rem !important;
    margin-right: 2.5rem !important;
  }
  .mdf\:my-10 {
    margin-bottom: 2.5rem !important;
    margin-top: 2.5rem !important;
  }
  .mdf\:m-12 {
    margin: 3rem !important;
  }
  .mdf\:mb-12 {
    margin-bottom: 3rem !important;
  }
  .mdf\:ml-12 {
    margin-left: 3rem !important;
  }
  .mdf\:mr-12 {
    margin-right: 3rem !important;
  }
  .mdf\:mt-12 {
    margin-top: 3rem !important;
  }
  .mdf\:mx-12 {
    margin-left: 3rem !important;
    margin-right: 3rem !important;
  }
  .mdf\:my-12 {
    margin-bottom: 3rem !important;
    margin-top: 3rem !important;
  }
  .mdf\:m-16 {
    margin: 4rem !important;
  }
  .mdf\:mb-16 {
    margin-bottom: 4rem !important;
  }
  .mdf\:ml-16 {
    margin-left: 4rem !important;
  }
  .mdf\:mr-16 {
    margin-right: 4rem !important;
  }
  .mdf\:mt-16 {
    margin-top: 4rem !important;
  }
  .mdf\:mx-16 {
    margin-left: 4rem !important;
    margin-right: 4rem !important;
  }
  .mdf\:my-16 {
    margin-bottom: 4rem !important;
    margin-top: 4rem !important;
  }
  .mdf\:m-18 {
    margin: 5rem !important;
  }
  .mdf\:mb-18 {
    margin-bottom: 5rem !important;
  }
  .mdf\:ml-18 {
    margin-left: 5rem !important;
  }
  .mdf\:mr-18 {
    margin-right: 5rem !important;
  }
  .mdf\:mt-18 {
    margin-top: 5rem !important;
  }
  .mdf\:mx-18 {
    margin-left: 5rem !important;
    margin-right: 5rem !important;
  }
  .mdf\:my-18 {
    margin-bottom: 5rem !important;
    margin-top: 5rem !important;
  }
  .mdf\:m-gutter {
    margin: 30px !important;
  }
  .mdf\:mb-gutter {
    margin-bottom: 30px !important;
  }
  .mdf\:ml-gutter {
    margin-left: 30px !important;
  }
  .mdf\:mr-gutter {
    margin-right: 30px !important;
  }
  .mdf\:mt-gutter {
    margin-top: 30px !important;
  }
  .mdf\:mx-gutter {
    margin-left: 30px !important;
    margin-right: 30px !important;
  }
  .mdf\:my-gutter {
    margin-bottom: 30px !important;
    margin-top: 30px !important;
  }
}

@media (min-width: 60em) {
  .lg\:m-auto {
    margin: auto !important;
  }
  .lg\:mb-auto {
    margin-bottom: auto !important;
  }
  .lg\:ml-auto {
    margin-left: auto !important;
  }
  .lg\:mr-auto {
    margin-right: auto !important;
  }
  .lg\:mt-auto {
    margin-top: auto !important;
  }
  .lg\:mx-auto {
    margin-left: auto !important;
    margin-right: auto !important;
  }
  .lg\:my-auto {
    margin-bottom: auto !important;
    margin-top: auto !important;
  }
  .lg\:m-0 {
    margin: 0 !important;
  }
  .lg\:mb-0 {
    margin-bottom: 0 !important;
  }
  .lg\:ml-0 {
    margin-left: 0 !important;
  }
  .lg\:mr-0 {
    margin-right: 0 !important;
  }
  .lg\:mt-0 {
    margin-top: 0 !important;
  }
  .lg\:mx-0 {
    margin-left: 0 !important;
    margin-right: 0 !important;
  }
  .lg\:my-0 {
    margin-bottom: 0 !important;
    margin-top: 0 !important;
  }
  .lg\:m-1 {
    margin: 0.25rem !important;
  }
  .lg\:mb-1 {
    margin-bottom: 0.25rem !important;
  }
  .lg\:ml-1 {
    margin-left: 0.25rem !important;
  }
  .lg\:mr-1 {
    margin-right: 0.25rem !important;
  }
  .lg\:mt-1 {
    margin-top: 0.25rem !important;
  }
  .lg\:mx-1 {
    margin-left: 0.25rem !important;
    margin-right: 0.25rem !important;
  }
  .lg\:my-1 {
    margin-bottom: 0.25rem !important;
    margin-top: 0.25rem !important;
  }
  .lg\:m-2 {
    margin: 0.5rem !important;
  }
  .lg\:mb-2 {
    margin-bottom: 0.5rem !important;
  }
  .lg\:ml-2 {
    margin-left: 0.5rem !important;
  }
  .lg\:mr-2 {
    margin-right: 0.5rem !important;
  }
  .lg\:mt-2 {
    margin-top: 0.5rem !important;
  }
  .lg\:mx-2 {
    margin-left: 0.5rem !important;
    margin-right: 0.5rem !important;
  }
  .lg\:my-2 {
    margin-bottom: 0.5rem !important;
    margin-top: 0.5rem !important;
  }
  .lg\:m-3 {
    margin: 0.75rem !important;
  }
  .lg\:mb-3 {
    margin-bottom: 0.75rem !important;
  }
  .lg\:ml-3 {
    margin-left: 0.75rem !important;
  }
  .lg\:mr-3 {
    margin-right: 0.75rem !important;
  }
  .lg\:mt-3 {
    margin-top: 0.75rem !important;
  }
  .lg\:mx-3 {
    margin-left: 0.75rem !important;
    margin-right: 0.75rem !important;
  }
  .lg\:my-3 {
    margin-bottom: 0.75rem !important;
    margin-top: 0.75rem !important;
  }
  .lg\:m-4 {
    margin: 1rem !important;
  }
  .lg\:mb-4 {
    margin-bottom: 1rem !important;
  }
  .lg\:ml-4 {
    margin-left: 1rem !important;
  }
  .lg\:mr-4 {
    margin-right: 1rem !important;
  }
  .lg\:mt-4 {
    margin-top: 1rem !important;
  }
  .lg\:mx-4 {
    margin-left: 1rem !important;
    margin-right: 1rem !important;
  }
  .lg\:my-4 {
    margin-bottom: 1rem !important;
    margin-top: 1rem !important;
  }
  .lg\:m-6 {
    margin: 1.5rem !important;
  }
  .lg\:mb-6 {
    margin-bottom: 1.5rem !important;
  }
  .lg\:ml-6 {
    margin-left: 1.5rem !important;
  }
  .lg\:mr-6 {
    margin-right: 1.5rem !important;
  }
  .lg\:mt-6 {
    margin-top: 1.5rem !important;
  }
  .lg\:mx-6 {
    margin-left: 1.5rem !important;
    margin-right: 1.5rem !important;
  }
  .lg\:my-6 {
    margin-bottom: 1.5rem !important;
    margin-top: 1.5rem !important;
  }
  .lg\:m-8 {
    margin: 2rem !important;
  }
  .lg\:mb-8 {
    margin-bottom: 2rem !important;
  }
  .lg\:ml-8 {
    margin-left: 2rem !important;
  }
  .lg\:mr-8 {
    margin-right: 2rem !important;
  }
  .lg\:mt-8 {
    margin-top: 2rem !important;
  }
  .lg\:mx-8 {
    margin-left: 2rem !important;
    margin-right: 2rem !important;
  }
  .lg\:my-8 {
    margin-bottom: 2rem !important;
    margin-top: 2rem !important;
  }
  .lg\:m-10 {
    margin: 2.5rem !important;
  }
  .lg\:mb-10 {
    margin-bottom: 2.5rem !important;
  }
  .lg\:ml-10 {
    margin-left: 2.5rem !important;
  }
  .lg\:mr-10 {
    margin-right: 2.5rem !important;
  }
  .lg\:mt-10 {
    margin-top: 2.5rem !important;
  }
  .lg\:mx-10 {
    margin-left: 2.5rem !important;
    margin-right: 2.5rem !important;
  }
  .lg\:my-10 {
    margin-bottom: 2.5rem !important;
    margin-top: 2.5rem !important;
  }
  .lg\:m-12 {
    margin: 3rem !important;
  }
  .lg\:mb-12 {
    margin-bottom: 3rem !important;
  }
  .lg\:ml-12 {
    margin-left: 3rem !important;
  }
  .lg\:mr-12 {
    margin-right: 3rem !important;
  }
  .lg\:mt-12 {
    margin-top: 3rem !important;
  }
  .lg\:mx-12 {
    margin-left: 3rem !important;
    margin-right: 3rem !important;
  }
  .lg\:my-12 {
    margin-bottom: 3rem !important;
    margin-top: 3rem !important;
  }
  .lg\:m-16 {
    margin: 4rem !important;
  }
  .lg\:mb-16 {
    margin-bottom: 4rem !important;
  }
  .lg\:ml-16 {
    margin-left: 4rem !important;
  }
  .lg\:mr-16 {
    margin-right: 4rem !important;
  }
  .lg\:mt-16 {
    margin-top: 4rem !important;
  }
  .lg\:mx-16 {
    margin-left: 4rem !important;
    margin-right: 4rem !important;
  }
  .lg\:my-16 {
    margin-bottom: 4rem !important;
    margin-top: 4rem !important;
  }
  .lg\:m-18 {
    margin: 5rem !important;
  }
  .lg\:mb-18 {
    margin-bottom: 5rem !important;
  }
  .lg\:ml-18 {
    margin-left: 5rem !important;
  }
  .lg\:mr-18 {
    margin-right: 5rem !important;
  }
  .lg\:mt-18 {
    margin-top: 5rem !important;
  }
  .lg\:mx-18 {
    margin-left: 5rem !important;
    margin-right: 5rem !important;
  }
  .lg\:my-18 {
    margin-bottom: 5rem !important;
    margin-top: 5rem !important;
  }
  .lg\:m-gutter {
    margin: 30px !important;
  }
  .lg\:mb-gutter {
    margin-bottom: 30px !important;
  }
  .lg\:ml-gutter {
    margin-left: 30px !important;
  }
  .lg\:mr-gutter {
    margin-right: 30px !important;
  }
  .lg\:mt-gutter {
    margin-top: 30px !important;
  }
  .lg\:mx-gutter {
    margin-left: 30px !important;
    margin-right: 30px !important;
  }
  .lg\:my-gutter {
    margin-bottom: 30px !important;
    margin-top: 30px !important;
  }
}

@media (min-width: 68.75em) {
  .xl\:m-auto {
    margin: auto !important;
  }
  .xl\:mb-auto {
    margin-bottom: auto !important;
  }
  .xl\:ml-auto {
    margin-left: auto !important;
  }
  .xl\:mr-auto {
    margin-right: auto !important;
  }
  .xl\:mt-auto {
    margin-top: auto !important;
  }
  .xl\:mx-auto {
    margin-left: auto !important;
    margin-right: auto !important;
  }
  .xl\:my-auto {
    margin-bottom: auto !important;
    margin-top: auto !important;
  }
  .xl\:m-0 {
    margin: 0 !important;
  }
  .xl\:mb-0 {
    margin-bottom: 0 !important;
  }
  .xl\:ml-0 {
    margin-left: 0 !important;
  }
  .xl\:mr-0 {
    margin-right: 0 !important;
  }
  .xl\:mt-0 {
    margin-top: 0 !important;
  }
  .xl\:mx-0 {
    margin-left: 0 !important;
    margin-right: 0 !important;
  }
  .xl\:my-0 {
    margin-bottom: 0 !important;
    margin-top: 0 !important;
  }
  .xl\:m-1 {
    margin: 0.25rem !important;
  }
  .xl\:mb-1 {
    margin-bottom: 0.25rem !important;
  }
  .xl\:ml-1 {
    margin-left: 0.25rem !important;
  }
  .xl\:mr-1 {
    margin-right: 0.25rem !important;
  }
  .xl\:mt-1 {
    margin-top: 0.25rem !important;
  }
  .xl\:mx-1 {
    margin-left: 0.25rem !important;
    margin-right: 0.25rem !important;
  }
  .xl\:my-1 {
    margin-bottom: 0.25rem !important;
    margin-top: 0.25rem !important;
  }
  .xl\:m-2 {
    margin: 0.5rem !important;
  }
  .xl\:mb-2 {
    margin-bottom: 0.5rem !important;
  }
  .xl\:ml-2 {
    margin-left: 0.5rem !important;
  }
  .xl\:mr-2 {
    margin-right: 0.5rem !important;
  }
  .xl\:mt-2 {
    margin-top: 0.5rem !important;
  }
  .xl\:mx-2 {
    margin-left: 0.5rem !important;
    margin-right: 0.5rem !important;
  }
  .xl\:my-2 {
    margin-bottom: 0.5rem !important;
    margin-top: 0.5rem !important;
  }
  .xl\:m-3 {
    margin: 0.75rem !important;
  }
  .xl\:mb-3 {
    margin-bottom: 0.75rem !important;
  }
  .xl\:ml-3 {
    margin-left: 0.75rem !important;
  }
  .xl\:mr-3 {
    margin-right: 0.75rem !important;
  }
  .xl\:mt-3 {
    margin-top: 0.75rem !important;
  }
  .xl\:mx-3 {
    margin-left: 0.75rem !important;
    margin-right: 0.75rem !important;
  }
  .xl\:my-3 {
    margin-bottom: 0.75rem !important;
    margin-top: 0.75rem !important;
  }
  .xl\:m-4 {
    margin: 1rem !important;
  }
  .xl\:mb-4 {
    margin-bottom: 1rem !important;
  }
  .xl\:ml-4 {
    margin-left: 1rem !important;
  }
  .xl\:mr-4 {
    margin-right: 1rem !important;
  }
  .xl\:mt-4 {
    margin-top: 1rem !important;
  }
  .xl\:mx-4 {
    margin-left: 1rem !important;
    margin-right: 1rem !important;
  }
  .xl\:my-4 {
    margin-bottom: 1rem !important;
    margin-top: 1rem !important;
  }
  .xl\:m-6 {
    margin: 1.5rem !important;
  }
  .xl\:mb-6 {
    margin-bottom: 1.5rem !important;
  }
  .xl\:ml-6 {
    margin-left: 1.5rem !important;
  }
  .xl\:mr-6 {
    margin-right: 1.5rem !important;
  }
  .xl\:mt-6 {
    margin-top: 1.5rem !important;
  }
  .xl\:mx-6 {
    margin-left: 1.5rem !important;
    margin-right: 1.5rem !important;
  }
  .xl\:my-6 {
    margin-bottom: 1.5rem !important;
    margin-top: 1.5rem !important;
  }
  .xl\:m-8 {
    margin: 2rem !important;
  }
  .xl\:mb-8 {
    margin-bottom: 2rem !important;
  }
  .xl\:ml-8 {
    margin-left: 2rem !important;
  }
  .xl\:mr-8 {
    margin-right: 2rem !important;
  }
  .xl\:mt-8 {
    margin-top: 2rem !important;
  }
  .xl\:mx-8 {
    margin-left: 2rem !important;
    margin-right: 2rem !important;
  }
  .xl\:my-8 {
    margin-bottom: 2rem !important;
    margin-top: 2rem !important;
  }
  .xl\:m-10 {
    margin: 2.5rem !important;
  }
  .xl\:mb-10 {
    margin-bottom: 2.5rem !important;
  }
  .xl\:ml-10 {
    margin-left: 2.5rem !important;
  }
  .xl\:mr-10 {
    margin-right: 2.5rem !important;
  }
  .xl\:mt-10 {
    margin-top: 2.5rem !important;
  }
  .xl\:mx-10 {
    margin-left: 2.5rem !important;
    margin-right: 2.5rem !important;
  }
  .xl\:my-10 {
    margin-bottom: 2.5rem !important;
    margin-top: 2.5rem !important;
  }
  .xl\:m-12 {
    margin: 3rem !important;
  }
  .xl\:mb-12 {
    margin-bottom: 3rem !important;
  }
  .xl\:ml-12 {
    margin-left: 3rem !important;
  }
  .xl\:mr-12 {
    margin-right: 3rem !important;
  }
  .xl\:mt-12 {
    margin-top: 3rem !important;
  }
  .xl\:mx-12 {
    margin-left: 3rem !important;
    margin-right: 3rem !important;
  }
  .xl\:my-12 {
    margin-bottom: 3rem !important;
    margin-top: 3rem !important;
  }
  .xl\:m-16 {
    margin: 4rem !important;
  }
  .xl\:mb-16 {
    margin-bottom: 4rem !important;
  }
  .xl\:ml-16 {
    margin-left: 4rem !important;
  }
  .xl\:mr-16 {
    margin-right: 4rem !important;
  }
  .xl\:mt-16 {
    margin-top: 4rem !important;
  }
  .xl\:mx-16 {
    margin-left: 4rem !important;
    margin-right: 4rem !important;
  }
  .xl\:my-16 {
    margin-bottom: 4rem !important;
    margin-top: 4rem !important;
  }
  .xl\:m-18 {
    margin: 5rem !important;
  }
  .xl\:mb-18 {
    margin-bottom: 5rem !important;
  }
  .xl\:ml-18 {
    margin-left: 5rem !important;
  }
  .xl\:mr-18 {
    margin-right: 5rem !important;
  }
  .xl\:mt-18 {
    margin-top: 5rem !important;
  }
  .xl\:mx-18 {
    margin-left: 5rem !important;
    margin-right: 5rem !important;
  }
  .xl\:my-18 {
    margin-bottom: 5rem !important;
    margin-top: 5rem !important;
  }
  .xl\:m-gutter {
    margin: 30px !important;
  }
  .xl\:mb-gutter {
    margin-bottom: 30px !important;
  }
  .xl\:ml-gutter {
    margin-left: 30px !important;
  }
  .xl\:mr-gutter {
    margin-right: 30px !important;
  }
  .xl\:mt-gutter {
    margin-top: 30px !important;
  }
  .xl\:mx-gutter {
    margin-left: 30px !important;
    margin-right: 30px !important;
  }
  .xl\:my-gutter {
    margin-bottom: 30px !important;
    margin-top: 30px !important;
  }
}

@media (min-width: 81.25em) {
  .xxl\:m-auto {
    margin: auto !important;
  }
  .xxl\:mb-auto {
    margin-bottom: auto !important;
  }
  .xxl\:ml-auto {
    margin-left: auto !important;
  }
  .xxl\:mr-auto {
    margin-right: auto !important;
  }
  .xxl\:mt-auto {
    margin-top: auto !important;
  }
  .xxl\:mx-auto {
    margin-left: auto !important;
    margin-right: auto !important;
  }
  .xxl\:my-auto {
    margin-bottom: auto !important;
    margin-top: auto !important;
  }
  .xxl\:m-0 {
    margin: 0 !important;
  }
  .xxl\:mb-0 {
    margin-bottom: 0 !important;
  }
  .xxl\:ml-0 {
    margin-left: 0 !important;
  }
  .xxl\:mr-0 {
    margin-right: 0 !important;
  }
  .xxl\:mt-0 {
    margin-top: 0 !important;
  }
  .xxl\:mx-0 {
    margin-left: 0 !important;
    margin-right: 0 !important;
  }
  .xxl\:my-0 {
    margin-bottom: 0 !important;
    margin-top: 0 !important;
  }
  .xxl\:m-1 {
    margin: 0.25rem !important;
  }
  .xxl\:mb-1 {
    margin-bottom: 0.25rem !important;
  }
  .xxl\:ml-1 {
    margin-left: 0.25rem !important;
  }
  .xxl\:mr-1 {
    margin-right: 0.25rem !important;
  }
  .xxl\:mt-1 {
    margin-top: 0.25rem !important;
  }
  .xxl\:mx-1 {
    margin-left: 0.25rem !important;
    margin-right: 0.25rem !important;
  }
  .xxl\:my-1 {
    margin-bottom: 0.25rem !important;
    margin-top: 0.25rem !important;
  }
  .xxl\:m-2 {
    margin: 0.5rem !important;
  }
  .xxl\:mb-2 {
    margin-bottom: 0.5rem !important;
  }
  .xxl\:ml-2 {
    margin-left: 0.5rem !important;
  }
  .xxl\:mr-2 {
    margin-right: 0.5rem !important;
  }
  .xxl\:mt-2 {
    margin-top: 0.5rem !important;
  }
  .xxl\:mx-2 {
    margin-left: 0.5rem !important;
    margin-right: 0.5rem !important;
  }
  .xxl\:my-2 {
    margin-bottom: 0.5rem !important;
    margin-top: 0.5rem !important;
  }
  .xxl\:m-3 {
    margin: 0.75rem !important;
  }
  .xxl\:mb-3 {
    margin-bottom: 0.75rem !important;
  }
  .xxl\:ml-3 {
    margin-left: 0.75rem !important;
  }
  .xxl\:mr-3 {
    margin-right: 0.75rem !important;
  }
  .xxl\:mt-3 {
    margin-top: 0.75rem !important;
  }
  .xxl\:mx-3 {
    margin-left: 0.75rem !important;
    margin-right: 0.75rem !important;
  }
  .xxl\:my-3 {
    margin-bottom: 0.75rem !important;
    margin-top: 0.75rem !important;
  }
  .xxl\:m-4 {
    margin: 1rem !important;
  }
  .xxl\:mb-4 {
    margin-bottom: 1rem !important;
  }
  .xxl\:ml-4 {
    margin-left: 1rem !important;
  }
  .xxl\:mr-4 {
    margin-right: 1rem !important;
  }
  .xxl\:mt-4 {
    margin-top: 1rem !important;
  }
  .xxl\:mx-4 {
    margin-left: 1rem !important;
    margin-right: 1rem !important;
  }
  .xxl\:my-4 {
    margin-bottom: 1rem !important;
    margin-top: 1rem !important;
  }
  .xxl\:m-6 {
    margin: 1.5rem !important;
  }
  .xxl\:mb-6 {
    margin-bottom: 1.5rem !important;
  }
  .xxl\:ml-6 {
    margin-left: 1.5rem !important;
  }
  .xxl\:mr-6 {
    margin-right: 1.5rem !important;
  }
  .xxl\:mt-6 {
    margin-top: 1.5rem !important;
  }
  .xxl\:mx-6 {
    margin-left: 1.5rem !important;
    margin-right: 1.5rem !important;
  }
  .xxl\:my-6 {
    margin-bottom: 1.5rem !important;
    margin-top: 1.5rem !important;
  }
  .xxl\:m-8 {
    margin: 2rem !important;
  }
  .xxl\:mb-8 {
    margin-bottom: 2rem !important;
  }
  .xxl\:ml-8 {
    margin-left: 2rem !important;
  }
  .xxl\:mr-8 {
    margin-right: 2rem !important;
  }
  .xxl\:mt-8 {
    margin-top: 2rem !important;
  }
  .xxl\:mx-8 {
    margin-left: 2rem !important;
    margin-right: 2rem !important;
  }
  .xxl\:my-8 {
    margin-bottom: 2rem !important;
    margin-top: 2rem !important;
  }
  .xxl\:m-10 {
    margin: 2.5rem !important;
  }
  .xxl\:mb-10 {
    margin-bottom: 2.5rem !important;
  }
  .xxl\:ml-10 {
    margin-left: 2.5rem !important;
  }
  .xxl\:mr-10 {
    margin-right: 2.5rem !important;
  }
  .xxl\:mt-10 {
    margin-top: 2.5rem !important;
  }
  .xxl\:mx-10 {
    margin-left: 2.5rem !important;
    margin-right: 2.5rem !important;
  }
  .xxl\:my-10 {
    margin-bottom: 2.5rem !important;
    margin-top: 2.5rem !important;
  }
  .xxl\:m-12 {
    margin: 3rem !important;
  }
  .xxl\:mb-12 {
    margin-bottom: 3rem !important;
  }
  .xxl\:ml-12 {
    margin-left: 3rem !important;
  }
  .xxl\:mr-12 {
    margin-right: 3rem !important;
  }
  .xxl\:mt-12 {
    margin-top: 3rem !important;
  }
  .xxl\:mx-12 {
    margin-left: 3rem !important;
    margin-right: 3rem !important;
  }
  .xxl\:my-12 {
    margin-bottom: 3rem !important;
    margin-top: 3rem !important;
  }
  .xxl\:m-16 {
    margin: 4rem !important;
  }
  .xxl\:mb-16 {
    margin-bottom: 4rem !important;
  }
  .xxl\:ml-16 {
    margin-left: 4rem !important;
  }
  .xxl\:mr-16 {
    margin-right: 4rem !important;
  }
  .xxl\:mt-16 {
    margin-top: 4rem !important;
  }
  .xxl\:mx-16 {
    margin-left: 4rem !important;
    margin-right: 4rem !important;
  }
  .xxl\:my-16 {
    margin-bottom: 4rem !important;
    margin-top: 4rem !important;
  }
  .xxl\:m-18 {
    margin: 5rem !important;
  }
  .xxl\:mb-18 {
    margin-bottom: 5rem !important;
  }
  .xxl\:ml-18 {
    margin-left: 5rem !important;
  }
  .xxl\:mr-18 {
    margin-right: 5rem !important;
  }
  .xxl\:mt-18 {
    margin-top: 5rem !important;
  }
  .xxl\:mx-18 {
    margin-left: 5rem !important;
    margin-right: 5rem !important;
  }
  .xxl\:my-18 {
    margin-bottom: 5rem !important;
    margin-top: 5rem !important;
  }
  .xxl\:m-gutter {
    margin: 30px !important;
  }
  .xxl\:mb-gutter {
    margin-bottom: 30px !important;
  }
  .xxl\:ml-gutter {
    margin-left: 30px !important;
  }
  .xxl\:mr-gutter {
    margin-right: 30px !important;
  }
  .xxl\:mt-gutter {
    margin-top: 30px !important;
  }
  .xxl\:mx-gutter {
    margin-left: 30px !important;
    margin-right: 30px !important;
  }
  .xxl\:my-gutter {
    margin-bottom: 30px !important;
    margin-top: 30px !important;
  }
}

@media (min-width: 82.625em) {
  .xxl-e\:m-auto {
    margin: auto !important;
  }
  .xxl-e\:mb-auto {
    margin-bottom: auto !important;
  }
  .xxl-e\:ml-auto {
    margin-left: auto !important;
  }
  .xxl-e\:mr-auto {
    margin-right: auto !important;
  }
  .xxl-e\:mt-auto {
    margin-top: auto !important;
  }
  .xxl-e\:mx-auto {
    margin-left: auto !important;
    margin-right: auto !important;
  }
  .xxl-e\:my-auto {
    margin-bottom: auto !important;
    margin-top: auto !important;
  }
  .xxl-e\:m-0 {
    margin: 0 !important;
  }
  .xxl-e\:mb-0 {
    margin-bottom: 0 !important;
  }
  .xxl-e\:ml-0 {
    margin-left: 0 !important;
  }
  .xxl-e\:mr-0 {
    margin-right: 0 !important;
  }
  .xxl-e\:mt-0 {
    margin-top: 0 !important;
  }
  .xxl-e\:mx-0 {
    margin-left: 0 !important;
    margin-right: 0 !important;
  }
  .xxl-e\:my-0 {
    margin-bottom: 0 !important;
    margin-top: 0 !important;
  }
  .xxl-e\:m-1 {
    margin: 0.25rem !important;
  }
  .xxl-e\:mb-1 {
    margin-bottom: 0.25rem !important;
  }
  .xxl-e\:ml-1 {
    margin-left: 0.25rem !important;
  }
  .xxl-e\:mr-1 {
    margin-right: 0.25rem !important;
  }
  .xxl-e\:mt-1 {
    margin-top: 0.25rem !important;
  }
  .xxl-e\:mx-1 {
    margin-left: 0.25rem !important;
    margin-right: 0.25rem !important;
  }
  .xxl-e\:my-1 {
    margin-bottom: 0.25rem !important;
    margin-top: 0.25rem !important;
  }
  .xxl-e\:m-2 {
    margin: 0.5rem !important;
  }
  .xxl-e\:mb-2 {
    margin-bottom: 0.5rem !important;
  }
  .xxl-e\:ml-2 {
    margin-left: 0.5rem !important;
  }
  .xxl-e\:mr-2 {
    margin-right: 0.5rem !important;
  }
  .xxl-e\:mt-2 {
    margin-top: 0.5rem !important;
  }
  .xxl-e\:mx-2 {
    margin-left: 0.5rem !important;
    margin-right: 0.5rem !important;
  }
  .xxl-e\:my-2 {
    margin-bottom: 0.5rem !important;
    margin-top: 0.5rem !important;
  }
  .xxl-e\:m-3 {
    margin: 0.75rem !important;
  }
  .xxl-e\:mb-3 {
    margin-bottom: 0.75rem !important;
  }
  .xxl-e\:ml-3 {
    margin-left: 0.75rem !important;
  }
  .xxl-e\:mr-3 {
    margin-right: 0.75rem !important;
  }
  .xxl-e\:mt-3 {
    margin-top: 0.75rem !important;
  }
  .xxl-e\:mx-3 {
    margin-left: 0.75rem !important;
    margin-right: 0.75rem !important;
  }
  .xxl-e\:my-3 {
    margin-bottom: 0.75rem !important;
    margin-top: 0.75rem !important;
  }
  .xxl-e\:m-4 {
    margin: 1rem !important;
  }
  .xxl-e\:mb-4 {
    margin-bottom: 1rem !important;
  }
  .xxl-e\:ml-4 {
    margin-left: 1rem !important;
  }
  .xxl-e\:mr-4 {
    margin-right: 1rem !important;
  }
  .xxl-e\:mt-4 {
    margin-top: 1rem !important;
  }
  .xxl-e\:mx-4 {
    margin-left: 1rem !important;
    margin-right: 1rem !important;
  }
  .xxl-e\:my-4 {
    margin-bottom: 1rem !important;
    margin-top: 1rem !important;
  }
  .xxl-e\:m-6 {
    margin: 1.5rem !important;
  }
  .xxl-e\:mb-6 {
    margin-bottom: 1.5rem !important;
  }
  .xxl-e\:ml-6 {
    margin-left: 1.5rem !important;
  }
  .xxl-e\:mr-6 {
    margin-right: 1.5rem !important;
  }
  .xxl-e\:mt-6 {
    margin-top: 1.5rem !important;
  }
  .xxl-e\:mx-6 {
    margin-left: 1.5rem !important;
    margin-right: 1.5rem !important;
  }
  .xxl-e\:my-6 {
    margin-bottom: 1.5rem !important;
    margin-top: 1.5rem !important;
  }
  .xxl-e\:m-8 {
    margin: 2rem !important;
  }
  .xxl-e\:mb-8 {
    margin-bottom: 2rem !important;
  }
  .xxl-e\:ml-8 {
    margin-left: 2rem !important;
  }
  .xxl-e\:mr-8 {
    margin-right: 2rem !important;
  }
  .xxl-e\:mt-8 {
    margin-top: 2rem !important;
  }
  .xxl-e\:mx-8 {
    margin-left: 2rem !important;
    margin-right: 2rem !important;
  }
  .xxl-e\:my-8 {
    margin-bottom: 2rem !important;
    margin-top: 2rem !important;
  }
  .xxl-e\:m-10 {
    margin: 2.5rem !important;
  }
  .xxl-e\:mb-10 {
    margin-bottom: 2.5rem !important;
  }
  .xxl-e\:ml-10 {
    margin-left: 2.5rem !important;
  }
  .xxl-e\:mr-10 {
    margin-right: 2.5rem !important;
  }
  .xxl-e\:mt-10 {
    margin-top: 2.5rem !important;
  }
  .xxl-e\:mx-10 {
    margin-left: 2.5rem !important;
    margin-right: 2.5rem !important;
  }
  .xxl-e\:my-10 {
    margin-bottom: 2.5rem !important;
    margin-top: 2.5rem !important;
  }
  .xxl-e\:m-12 {
    margin: 3rem !important;
  }
  .xxl-e\:mb-12 {
    margin-bottom: 3rem !important;
  }
  .xxl-e\:ml-12 {
    margin-left: 3rem !important;
  }
  .xxl-e\:mr-12 {
    margin-right: 3rem !important;
  }
  .xxl-e\:mt-12 {
    margin-top: 3rem !important;
  }
  .xxl-e\:mx-12 {
    margin-left: 3rem !important;
    margin-right: 3rem !important;
  }
  .xxl-e\:my-12 {
    margin-bottom: 3rem !important;
    margin-top: 3rem !important;
  }
  .xxl-e\:m-16 {
    margin: 4rem !important;
  }
  .xxl-e\:mb-16 {
    margin-bottom: 4rem !important;
  }
  .xxl-e\:ml-16 {
    margin-left: 4rem !important;
  }
  .xxl-e\:mr-16 {
    margin-right: 4rem !important;
  }
  .xxl-e\:mt-16 {
    margin-top: 4rem !important;
  }
  .xxl-e\:mx-16 {
    margin-left: 4rem !important;
    margin-right: 4rem !important;
  }
  .xxl-e\:my-16 {
    margin-bottom: 4rem !important;
    margin-top: 4rem !important;
  }
  .xxl-e\:m-18 {
    margin: 5rem !important;
  }
  .xxl-e\:mb-18 {
    margin-bottom: 5rem !important;
  }
  .xxl-e\:ml-18 {
    margin-left: 5rem !important;
  }
  .xxl-e\:mr-18 {
    margin-right: 5rem !important;
  }
  .xxl-e\:mt-18 {
    margin-top: 5rem !important;
  }
  .xxl-e\:mx-18 {
    margin-left: 5rem !important;
    margin-right: 5rem !important;
  }
  .xxl-e\:my-18 {
    margin-bottom: 5rem !important;
    margin-top: 5rem !important;
  }
  .xxl-e\:m-gutter {
    margin: 30px !important;
  }
  .xxl-e\:mb-gutter {
    margin-bottom: 30px !important;
  }
  .xxl-e\:ml-gutter {
    margin-left: 30px !important;
  }
  .xxl-e\:mr-gutter {
    margin-right: 30px !important;
  }
  .xxl-e\:mt-gutter {
    margin-top: 30px !important;
  }
  .xxl-e\:mx-gutter {
    margin-left: 30px !important;
    margin-right: 30px !important;
  }
  .xxl-e\:my-gutter {
    margin-bottom: 30px !important;
    margin-top: 30px !important;
  }
}

@media (min-width: 100em) {
  .xxxl\:m-auto {
    margin: auto !important;
  }
  .xxxl\:mb-auto {
    margin-bottom: auto !important;
  }
  .xxxl\:ml-auto {
    margin-left: auto !important;
  }
  .xxxl\:mr-auto {
    margin-right: auto !important;
  }
  .xxxl\:mt-auto {
    margin-top: auto !important;
  }
  .xxxl\:mx-auto {
    margin-left: auto !important;
    margin-right: auto !important;
  }
  .xxxl\:my-auto {
    margin-bottom: auto !important;
    margin-top: auto !important;
  }
  .xxxl\:m-0 {
    margin: 0 !important;
  }
  .xxxl\:mb-0 {
    margin-bottom: 0 !important;
  }
  .xxxl\:ml-0 {
    margin-left: 0 !important;
  }
  .xxxl\:mr-0 {
    margin-right: 0 !important;
  }
  .xxxl\:mt-0 {
    margin-top: 0 !important;
  }
  .xxxl\:mx-0 {
    margin-left: 0 !important;
    margin-right: 0 !important;
  }
  .xxxl\:my-0 {
    margin-bottom: 0 !important;
    margin-top: 0 !important;
  }
  .xxxl\:m-1 {
    margin: 0.25rem !important;
  }
  .xxxl\:mb-1 {
    margin-bottom: 0.25rem !important;
  }
  .xxxl\:ml-1 {
    margin-left: 0.25rem !important;
  }
  .xxxl\:mr-1 {
    margin-right: 0.25rem !important;
  }
  .xxxl\:mt-1 {
    margin-top: 0.25rem !important;
  }
  .xxxl\:mx-1 {
    margin-left: 0.25rem !important;
    margin-right: 0.25rem !important;
  }
  .xxxl\:my-1 {
    margin-bottom: 0.25rem !important;
    margin-top: 0.25rem !important;
  }
  .xxxl\:m-2 {
    margin: 0.5rem !important;
  }
  .xxxl\:mb-2 {
    margin-bottom: 0.5rem !important;
  }
  .xxxl\:ml-2 {
    margin-left: 0.5rem !important;
  }
  .xxxl\:mr-2 {
    margin-right: 0.5rem !important;
  }
  .xxxl\:mt-2 {
    margin-top: 0.5rem !important;
  }
  .xxxl\:mx-2 {
    margin-left: 0.5rem !important;
    margin-right: 0.5rem !important;
  }
  .xxxl\:my-2 {
    margin-bottom: 0.5rem !important;
    margin-top: 0.5rem !important;
  }
  .xxxl\:m-3 {
    margin: 0.75rem !important;
  }
  .xxxl\:mb-3 {
    margin-bottom: 0.75rem !important;
  }
  .xxxl\:ml-3 {
    margin-left: 0.75rem !important;
  }
  .xxxl\:mr-3 {
    margin-right: 0.75rem !important;
  }
  .xxxl\:mt-3 {
    margin-top: 0.75rem !important;
  }
  .xxxl\:mx-3 {
    margin-left: 0.75rem !important;
    margin-right: 0.75rem !important;
  }
  .xxxl\:my-3 {
    margin-bottom: 0.75rem !important;
    margin-top: 0.75rem !important;
  }
  .xxxl\:m-4 {
    margin: 1rem !important;
  }
  .xxxl\:mb-4 {
    margin-bottom: 1rem !important;
  }
  .xxxl\:ml-4 {
    margin-left: 1rem !important;
  }
  .xxxl\:mr-4 {
    margin-right: 1rem !important;
  }
  .xxxl\:mt-4 {
    margin-top: 1rem !important;
  }
  .xxxl\:mx-4 {
    margin-left: 1rem !important;
    margin-right: 1rem !important;
  }
  .xxxl\:my-4 {
    margin-bottom: 1rem !important;
    margin-top: 1rem !important;
  }
  .xxxl\:m-6 {
    margin: 1.5rem !important;
  }
  .xxxl\:mb-6 {
    margin-bottom: 1.5rem !important;
  }
  .xxxl\:ml-6 {
    margin-left: 1.5rem !important;
  }
  .xxxl\:mr-6 {
    margin-right: 1.5rem !important;
  }
  .xxxl\:mt-6 {
    margin-top: 1.5rem !important;
  }
  .xxxl\:mx-6 {
    margin-left: 1.5rem !important;
    margin-right: 1.5rem !important;
  }
  .xxxl\:my-6 {
    margin-bottom: 1.5rem !important;
    margin-top: 1.5rem !important;
  }
  .xxxl\:m-8 {
    margin: 2rem !important;
  }
  .xxxl\:mb-8 {
    margin-bottom: 2rem !important;
  }
  .xxxl\:ml-8 {
    margin-left: 2rem !important;
  }
  .xxxl\:mr-8 {
    margin-right: 2rem !important;
  }
  .xxxl\:mt-8 {
    margin-top: 2rem !important;
  }
  .xxxl\:mx-8 {
    margin-left: 2rem !important;
    margin-right: 2rem !important;
  }
  .xxxl\:my-8 {
    margin-bottom: 2rem !important;
    margin-top: 2rem !important;
  }
  .xxxl\:m-10 {
    margin: 2.5rem !important;
  }
  .xxxl\:mb-10 {
    margin-bottom: 2.5rem !important;
  }
  .xxxl\:ml-10 {
    margin-left: 2.5rem !important;
  }
  .xxxl\:mr-10 {
    margin-right: 2.5rem !important;
  }
  .xxxl\:mt-10 {
    margin-top: 2.5rem !important;
  }
  .xxxl\:mx-10 {
    margin-left: 2.5rem !important;
    margin-right: 2.5rem !important;
  }
  .xxxl\:my-10 {
    margin-bottom: 2.5rem !important;
    margin-top: 2.5rem !important;
  }
  .xxxl\:m-12 {
    margin: 3rem !important;
  }
  .xxxl\:mb-12 {
    margin-bottom: 3rem !important;
  }
  .xxxl\:ml-12 {
    margin-left: 3rem !important;
  }
  .xxxl\:mr-12 {
    margin-right: 3rem !important;
  }
  .xxxl\:mt-12 {
    margin-top: 3rem !important;
  }
  .xxxl\:mx-12 {
    margin-left: 3rem !important;
    margin-right: 3rem !important;
  }
  .xxxl\:my-12 {
    margin-bottom: 3rem !important;
    margin-top: 3rem !important;
  }
  .xxxl\:m-16 {
    margin: 4rem !important;
  }
  .xxxl\:mb-16 {
    margin-bottom: 4rem !important;
  }
  .xxxl\:ml-16 {
    margin-left: 4rem !important;
  }
  .xxxl\:mr-16 {
    margin-right: 4rem !important;
  }
  .xxxl\:mt-16 {
    margin-top: 4rem !important;
  }
  .xxxl\:mx-16 {
    margin-left: 4rem !important;
    margin-right: 4rem !important;
  }
  .xxxl\:my-16 {
    margin-bottom: 4rem !important;
    margin-top: 4rem !important;
  }
  .xxxl\:m-18 {
    margin: 5rem !important;
  }
  .xxxl\:mb-18 {
    margin-bottom: 5rem !important;
  }
  .xxxl\:ml-18 {
    margin-left: 5rem !important;
  }
  .xxxl\:mr-18 {
    margin-right: 5rem !important;
  }
  .xxxl\:mt-18 {
    margin-top: 5rem !important;
  }
  .xxxl\:mx-18 {
    margin-left: 5rem !important;
    margin-right: 5rem !important;
  }
  .xxxl\:my-18 {
    margin-bottom: 5rem !important;
    margin-top: 5rem !important;
  }
  .xxxl\:m-gutter {
    margin: 30px !important;
  }
  .xxxl\:mb-gutter {
    margin-bottom: 30px !important;
  }
  .xxxl\:ml-gutter {
    margin-left: 30px !important;
  }
  .xxxl\:mr-gutter {
    margin-right: 30px !important;
  }
  .xxxl\:mt-gutter {
    margin-top: 30px !important;
  }
  .xxxl\:mx-gutter {
    margin-left: 30px !important;
    margin-right: 30px !important;
  }
  .xxxl\:my-gutter {
    margin-bottom: 30px !important;
    margin-top: 30px !important;
  }
}

/*
================================================================================
Max width
================================================================================
*/
.max-w-none {
  max-width: none !important;
}

.max-w-150 {
  max-width: 150px !important;
}

.max-w-250 {
  max-width: 250px !important;
}

.max-w-300 {
  max-width: 300px !important;
}

.max-w-500 {
  max-width: 500px !important;
}

.max-w-700 {
  max-width: 700px !important;
}

.max-w-1500 {
  max-width: 1500px !important;
}

.max-w-full {
  max-width: 100% !important;
}

@media (min-width: 37.5em) {
  .sm\:max-w-none {
    max-width: none !important;
  }
  .sm\:max-w-150 {
    max-width: 150px !important;
  }
  .sm\:max-w-250 {
    max-width: 250px !important;
  }
  .sm\:max-w-300 {
    max-width: 300px !important;
  }
  .sm\:max-w-500 {
    max-width: 500px !important;
  }
  .sm\:max-w-700 {
    max-width: 700px !important;
  }
  .sm\:max-w-1500 {
    max-width: 1500px !important;
  }
  .sm\:max-w-full {
    max-width: 100% !important;
  }
}

@media (min-width: 45em) {
  .md\:max-w-none {
    max-width: none !important;
  }
  .md\:max-w-150 {
    max-width: 150px !important;
  }
  .md\:max-w-250 {
    max-width: 250px !important;
  }
  .md\:max-w-300 {
    max-width: 300px !important;
  }
  .md\:max-w-500 {
    max-width: 500px !important;
  }
  .md\:max-w-700 {
    max-width: 700px !important;
  }
  .md\:max-w-1500 {
    max-width: 1500px !important;
  }
  .md\:max-w-full {
    max-width: 100% !important;
  }
}

@media (min-width: 50.625em) {
  .mdf\:max-w-none {
    max-width: none !important;
  }
  .mdf\:max-w-150 {
    max-width: 150px !important;
  }
  .mdf\:max-w-250 {
    max-width: 250px !important;
  }
  .mdf\:max-w-300 {
    max-width: 300px !important;
  }
  .mdf\:max-w-500 {
    max-width: 500px !important;
  }
  .mdf\:max-w-700 {
    max-width: 700px !important;
  }
  .mdf\:max-w-1500 {
    max-width: 1500px !important;
  }
  .mdf\:max-w-full {
    max-width: 100% !important;
  }
}

@media (min-width: 60em) {
  .lg\:max-w-none {
    max-width: none !important;
  }
  .lg\:max-w-150 {
    max-width: 150px !important;
  }
  .lg\:max-w-250 {
    max-width: 250px !important;
  }
  .lg\:max-w-300 {
    max-width: 300px !important;
  }
  .lg\:max-w-500 {
    max-width: 500px !important;
  }
  .lg\:max-w-700 {
    max-width: 700px !important;
  }
  .lg\:max-w-1500 {
    max-width: 1500px !important;
  }
  .lg\:max-w-full {
    max-width: 100% !important;
  }
}

@media (min-width: 68.75em) {
  .xl\:max-w-none {
    max-width: none !important;
  }
  .xl\:max-w-150 {
    max-width: 150px !important;
  }
  .xl\:max-w-250 {
    max-width: 250px !important;
  }
  .xl\:max-w-300 {
    max-width: 300px !important;
  }
  .xl\:max-w-500 {
    max-width: 500px !important;
  }
  .xl\:max-w-700 {
    max-width: 700px !important;
  }
  .xl\:max-w-1500 {
    max-width: 1500px !important;
  }
  .xl\:max-w-full {
    max-width: 100% !important;
  }
}

@media (min-width: 81.25em) {
  .xxl\:max-w-none {
    max-width: none !important;
  }
  .xxl\:max-w-150 {
    max-width: 150px !important;
  }
  .xxl\:max-w-250 {
    max-width: 250px !important;
  }
  .xxl\:max-w-300 {
    max-width: 300px !important;
  }
  .xxl\:max-w-500 {
    max-width: 500px !important;
  }
  .xxl\:max-w-700 {
    max-width: 700px !important;
  }
  .xxl\:max-w-1500 {
    max-width: 1500px !important;
  }
  .xxl\:max-w-full {
    max-width: 100% !important;
  }
}

@media (min-width: 82.625em) {
  .xxl-e\:max-w-none {
    max-width: none !important;
  }
  .xxl-e\:max-w-150 {
    max-width: 150px !important;
  }
  .xxl-e\:max-w-250 {
    max-width: 250px !important;
  }
  .xxl-e\:max-w-300 {
    max-width: 300px !important;
  }
  .xxl-e\:max-w-500 {
    max-width: 500px !important;
  }
  .xxl-e\:max-w-700 {
    max-width: 700px !important;
  }
  .xxl-e\:max-w-1500 {
    max-width: 1500px !important;
  }
  .xxl-e\:max-w-full {
    max-width: 100% !important;
  }
}

@media (min-width: 100em) {
  .xxxl\:max-w-none {
    max-width: none !important;
  }
  .xxxl\:max-w-150 {
    max-width: 150px !important;
  }
  .xxxl\:max-w-250 {
    max-width: 250px !important;
  }
  .xxxl\:max-w-300 {
    max-width: 300px !important;
  }
  .xxxl\:max-w-500 {
    max-width: 500px !important;
  }
  .xxxl\:max-w-700 {
    max-width: 700px !important;
  }
  .xxxl\:max-w-1500 {
    max-width: 1500px !important;
  }
  .xxxl\:max-w-full {
    max-width: 100% !important;
  }
}

/*
================================================================================
Overflow
================================================================================
*/
.overflow-auto {
  overflow: auto !important;
}

.overflow-hidden {
  overflow: hidden !important;
}

.overflow-x-auto {
  overflow-x: auto !important;
}

.overflow-y-auto {
  overflow-y: auto !important;
}

/*
================================================================================
Padding
================================================================================
*/
.p-0 {
  padding: 0 !important;
}

.pb-0 {
  padding-bottom: 0 !important;
}

.pl-0 {
  padding-left: 0 !important;
}

.pr-0 {
  padding-right: 0 !important;
}

.pt-0 {
  padding-top: 0 !important;
}

.px-0 {
  padding-left: 0 !important;
  padding-right: 0 !important;
}

.py-0 {
  padding-bottom: 0 !important;
  padding-top: 0 !important;
}

.p-15px {
  padding: 15px !important;
}

.pb-15px {
  padding-bottom: 15px !important;
}

.pl-15px {
  padding-left: 15px !important;
}

.pr-15px {
  padding-right: 15px !important;
}

.pt-15px {
  padding-top: 15px !important;
}

.px-15px {
  padding-left: 15px !important;
  padding-right: 15px !important;
}

.py-15px {
  padding-bottom: 15px !important;
  padding-top: 15px !important;
}

.p-1 {
  padding: 0.25rem !important;
}

.pb-1 {
  padding-bottom: 0.25rem !important;
}

.pl-1 {
  padding-left: 0.25rem !important;
}

.pr-1 {
  padding-right: 0.25rem !important;
}

.pt-1 {
  padding-top: 0.25rem !important;
}

.px-1 {
  padding-left: 0.25rem !important;
  padding-right: 0.25rem !important;
}

.py-1 {
  padding-bottom: 0.25rem !important;
  padding-top: 0.25rem !important;
}

.p-2 {
  padding: 0.5rem !important;
}

.pb-2 {
  padding-bottom: 0.5rem !important;
}

.pl-2 {
  padding-left: 0.5rem !important;
}

.pr-2 {
  padding-right: 0.5rem !important;
}

.pt-2 {
  padding-top: 0.5rem !important;
}

.px-2 {
  padding-left: 0.5rem !important;
  padding-right: 0.5rem !important;
}

.py-2 {
  padding-bottom: 0.5rem !important;
  padding-top: 0.5rem !important;
}

.p-3 {
  padding: 0.75rem !important;
}

.pb-3 {
  padding-bottom: 0.75rem !important;
}

.pl-3 {
  padding-left: 0.75rem !important;
}

.pr-3 {
  padding-right: 0.75rem !important;
}

.pt-3 {
  padding-top: 0.75rem !important;
}

.px-3 {
  padding-left: 0.75rem !important;
  padding-right: 0.75rem !important;
}

.py-3 {
  padding-bottom: 0.75rem !important;
  padding-top: 0.75rem !important;
}

.p-4 {
  padding: 1rem !important;
}

.pb-4 {
  padding-bottom: 1rem !important;
}

.pl-4 {
  padding-left: 1rem !important;
}

.pr-4 {
  padding-right: 1rem !important;
}

.pt-4 {
  padding-top: 1rem !important;
}

.px-4 {
  padding-left: 1rem !important;
  padding-right: 1rem !important;
}

.py-4 {
  padding-bottom: 1rem !important;
  padding-top: 1rem !important;
}

.p-6 {
  padding: 1.5rem !important;
}

.pb-6 {
  padding-bottom: 1.5rem !important;
}

.pl-6 {
  padding-left: 1.5rem !important;
}

.pr-6 {
  padding-right: 1.5rem !important;
}

.pt-6 {
  padding-top: 1.5rem !important;
}

.px-6 {
  padding-left: 1.5rem !important;
  padding-right: 1.5rem !important;
}

.py-6 {
  padding-bottom: 1.5rem !important;
  padding-top: 1.5rem !important;
}

.p-8 {
  padding: 2rem !important;
}

.pb-8 {
  padding-bottom: 2rem !important;
}

.pl-8 {
  padding-left: 2rem !important;
}

.pr-8 {
  padding-right: 2rem !important;
}

.pt-8 {
  padding-top: 2rem !important;
}

.px-8 {
  padding-left: 2rem !important;
  padding-right: 2rem !important;
}

.py-8 {
  padding-bottom: 2rem !important;
  padding-top: 2rem !important;
}

.p-12 {
  padding: 3rem !important;
}

.pb-12 {
  padding-bottom: 3rem !important;
}

.pl-12 {
  padding-left: 3rem !important;
}

.pr-12 {
  padding-right: 3rem !important;
}

.pt-12 {
  padding-top: 3rem !important;
}

.px-12 {
  padding-left: 3rem !important;
  padding-right: 3rem !important;
}

.py-12 {
  padding-bottom: 3rem !important;
  padding-top: 3rem !important;
}

.p-16 {
  padding: 4rem !important;
}

.pb-16 {
  padding-bottom: 4rem !important;
}

.pl-16 {
  padding-left: 4rem !important;
}

.pr-16 {
  padding-right: 4rem !important;
}

.pt-16 {
  padding-top: 4rem !important;
}

.px-16 {
  padding-left: 4rem !important;
  padding-right: 4rem !important;
}

.py-16 {
  padding-bottom: 4rem !important;
  padding-top: 4rem !important;
}

@media (min-width: 37.5em) {
  .sm\:p-0 {
    padding: 0 !important;
  }
  .sm\:pb-0 {
    padding-bottom: 0 !important;
  }
  .sm\:pl-0 {
    padding-left: 0 !important;
  }
  .sm\:pr-0 {
    padding-right: 0 !important;
  }
  .sm\:pt-0 {
    padding-top: 0 !important;
  }
  .sm\:px-0 {
    padding-left: 0 !important;
    padding-right: 0 !important;
  }
  .sm\:py-0 {
    padding-bottom: 0 !important;
    padding-top: 0 !important;
  }
  .sm\:p-15px {
    padding: 15px !important;
  }
  .sm\:pb-15px {
    padding-bottom: 15px !important;
  }
  .sm\:pl-15px {
    padding-left: 15px !important;
  }
  .sm\:pr-15px {
    padding-right: 15px !important;
  }
  .sm\:pt-15px {
    padding-top: 15px !important;
  }
  .sm\:px-15px {
    padding-left: 15px !important;
    padding-right: 15px !important;
  }
  .sm\:py-15px {
    padding-bottom: 15px !important;
    padding-top: 15px !important;
  }
  .sm\:p-1 {
    padding: 0.25rem !important;
  }
  .sm\:pb-1 {
    padding-bottom: 0.25rem !important;
  }
  .sm\:pl-1 {
    padding-left: 0.25rem !important;
  }
  .sm\:pr-1 {
    padding-right: 0.25rem !important;
  }
  .sm\:pt-1 {
    padding-top: 0.25rem !important;
  }
  .sm\:px-1 {
    padding-left: 0.25rem !important;
    padding-right: 0.25rem !important;
  }
  .sm\:py-1 {
    padding-bottom: 0.25rem !important;
    padding-top: 0.25rem !important;
  }
  .sm\:p-2 {
    padding: 0.5rem !important;
  }
  .sm\:pb-2 {
    padding-bottom: 0.5rem !important;
  }
  .sm\:pl-2 {
    padding-left: 0.5rem !important;
  }
  .sm\:pr-2 {
    padding-right: 0.5rem !important;
  }
  .sm\:pt-2 {
    padding-top: 0.5rem !important;
  }
  .sm\:px-2 {
    padding-left: 0.5rem !important;
    padding-right: 0.5rem !important;
  }
  .sm\:py-2 {
    padding-bottom: 0.5rem !important;
    padding-top: 0.5rem !important;
  }
  .sm\:p-3 {
    padding: 0.75rem !important;
  }
  .sm\:pb-3 {
    padding-bottom: 0.75rem !important;
  }
  .sm\:pl-3 {
    padding-left: 0.75rem !important;
  }
  .sm\:pr-3 {
    padding-right: 0.75rem !important;
  }
  .sm\:pt-3 {
    padding-top: 0.75rem !important;
  }
  .sm\:px-3 {
    padding-left: 0.75rem !important;
    padding-right: 0.75rem !important;
  }
  .sm\:py-3 {
    padding-bottom: 0.75rem !important;
    padding-top: 0.75rem !important;
  }
  .sm\:p-4 {
    padding: 1rem !important;
  }
  .sm\:pb-4 {
    padding-bottom: 1rem !important;
  }
  .sm\:pl-4 {
    padding-left: 1rem !important;
  }
  .sm\:pr-4 {
    padding-right: 1rem !important;
  }
  .sm\:pt-4 {
    padding-top: 1rem !important;
  }
  .sm\:px-4 {
    padding-left: 1rem !important;
    padding-right: 1rem !important;
  }
  .sm\:py-4 {
    padding-bottom: 1rem !important;
    padding-top: 1rem !important;
  }
  .sm\:p-6 {
    padding: 1.5rem !important;
  }
  .sm\:pb-6 {
    padding-bottom: 1.5rem !important;
  }
  .sm\:pl-6 {
    padding-left: 1.5rem !important;
  }
  .sm\:pr-6 {
    padding-right: 1.5rem !important;
  }
  .sm\:pt-6 {
    padding-top: 1.5rem !important;
  }
  .sm\:px-6 {
    padding-left: 1.5rem !important;
    padding-right: 1.5rem !important;
  }
  .sm\:py-6 {
    padding-bottom: 1.5rem !important;
    padding-top: 1.5rem !important;
  }
  .sm\:p-8 {
    padding: 2rem !important;
  }
  .sm\:pb-8 {
    padding-bottom: 2rem !important;
  }
  .sm\:pl-8 {
    padding-left: 2rem !important;
  }
  .sm\:pr-8 {
    padding-right: 2rem !important;
  }
  .sm\:pt-8 {
    padding-top: 2rem !important;
  }
  .sm\:px-8 {
    padding-left: 2rem !important;
    padding-right: 2rem !important;
  }
  .sm\:py-8 {
    padding-bottom: 2rem !important;
    padding-top: 2rem !important;
  }
  .sm\:p-12 {
    padding: 3rem !important;
  }
  .sm\:pb-12 {
    padding-bottom: 3rem !important;
  }
  .sm\:pl-12 {
    padding-left: 3rem !important;
  }
  .sm\:pr-12 {
    padding-right: 3rem !important;
  }
  .sm\:pt-12 {
    padding-top: 3rem !important;
  }
  .sm\:px-12 {
    padding-left: 3rem !important;
    padding-right: 3rem !important;
  }
  .sm\:py-12 {
    padding-bottom: 3rem !important;
    padding-top: 3rem !important;
  }
  .sm\:p-16 {
    padding: 4rem !important;
  }
  .sm\:pb-16 {
    padding-bottom: 4rem !important;
  }
  .sm\:pl-16 {
    padding-left: 4rem !important;
  }
  .sm\:pr-16 {
    padding-right: 4rem !important;
  }
  .sm\:pt-16 {
    padding-top: 4rem !important;
  }
  .sm\:px-16 {
    padding-left: 4rem !important;
    padding-right: 4rem !important;
  }
  .sm\:py-16 {
    padding-bottom: 4rem !important;
    padding-top: 4rem !important;
  }
}

@media (min-width: 45em) {
  .md\:p-0 {
    padding: 0 !important;
  }
  .md\:pb-0 {
    padding-bottom: 0 !important;
  }
  .md\:pl-0 {
    padding-left: 0 !important;
  }
  .md\:pr-0 {
    padding-right: 0 !important;
  }
  .md\:pt-0 {
    padding-top: 0 !important;
  }
  .md\:px-0 {
    padding-left: 0 !important;
    padding-right: 0 !important;
  }
  .md\:py-0 {
    padding-bottom: 0 !important;
    padding-top: 0 !important;
  }
  .md\:p-15px {
    padding: 15px !important;
  }
  .md\:pb-15px {
    padding-bottom: 15px !important;
  }
  .md\:pl-15px {
    padding-left: 15px !important;
  }
  .md\:pr-15px {
    padding-right: 15px !important;
  }
  .md\:pt-15px {
    padding-top: 15px !important;
  }
  .md\:px-15px {
    padding-left: 15px !important;
    padding-right: 15px !important;
  }
  .md\:py-15px {
    padding-bottom: 15px !important;
    padding-top: 15px !important;
  }
  .md\:p-1 {
    padding: 0.25rem !important;
  }
  .md\:pb-1 {
    padding-bottom: 0.25rem !important;
  }
  .md\:pl-1 {
    padding-left: 0.25rem !important;
  }
  .md\:pr-1 {
    padding-right: 0.25rem !important;
  }
  .md\:pt-1 {
    padding-top: 0.25rem !important;
  }
  .md\:px-1 {
    padding-left: 0.25rem !important;
    padding-right: 0.25rem !important;
  }
  .md\:py-1 {
    padding-bottom: 0.25rem !important;
    padding-top: 0.25rem !important;
  }
  .md\:p-2 {
    padding: 0.5rem !important;
  }
  .md\:pb-2 {
    padding-bottom: 0.5rem !important;
  }
  .md\:pl-2 {
    padding-left: 0.5rem !important;
  }
  .md\:pr-2 {
    padding-right: 0.5rem !important;
  }
  .md\:pt-2 {
    padding-top: 0.5rem !important;
  }
  .md\:px-2 {
    padding-left: 0.5rem !important;
    padding-right: 0.5rem !important;
  }
  .md\:py-2 {
    padding-bottom: 0.5rem !important;
    padding-top: 0.5rem !important;
  }
  .md\:p-3 {
    padding: 0.75rem !important;
  }
  .md\:pb-3 {
    padding-bottom: 0.75rem !important;
  }
  .md\:pl-3 {
    padding-left: 0.75rem !important;
  }
  .md\:pr-3 {
    padding-right: 0.75rem !important;
  }
  .md\:pt-3 {
    padding-top: 0.75rem !important;
  }
  .md\:px-3 {
    padding-left: 0.75rem !important;
    padding-right: 0.75rem !important;
  }
  .md\:py-3 {
    padding-bottom: 0.75rem !important;
    padding-top: 0.75rem !important;
  }
  .md\:p-4 {
    padding: 1rem !important;
  }
  .md\:pb-4 {
    padding-bottom: 1rem !important;
  }
  .md\:pl-4 {
    padding-left: 1rem !important;
  }
  .md\:pr-4 {
    padding-right: 1rem !important;
  }
  .md\:pt-4 {
    padding-top: 1rem !important;
  }
  .md\:px-4 {
    padding-left: 1rem !important;
    padding-right: 1rem !important;
  }
  .md\:py-4 {
    padding-bottom: 1rem !important;
    padding-top: 1rem !important;
  }
  .md\:p-6 {
    padding: 1.5rem !important;
  }
  .md\:pb-6 {
    padding-bottom: 1.5rem !important;
  }
  .md\:pl-6 {
    padding-left: 1.5rem !important;
  }
  .md\:pr-6 {
    padding-right: 1.5rem !important;
  }
  .md\:pt-6 {
    padding-top: 1.5rem !important;
  }
  .md\:px-6 {
    padding-left: 1.5rem !important;
    padding-right: 1.5rem !important;
  }
  .md\:py-6 {
    padding-bottom: 1.5rem !important;
    padding-top: 1.5rem !important;
  }
  .md\:p-8 {
    padding: 2rem !important;
  }
  .md\:pb-8 {
    padding-bottom: 2rem !important;
  }
  .md\:pl-8 {
    padding-left: 2rem !important;
  }
  .md\:pr-8 {
    padding-right: 2rem !important;
  }
  .md\:pt-8 {
    padding-top: 2rem !important;
  }
  .md\:px-8 {
    padding-left: 2rem !important;
    padding-right: 2rem !important;
  }
  .md\:py-8 {
    padding-bottom: 2rem !important;
    padding-top: 2rem !important;
  }
  .md\:p-12 {
    padding: 3rem !important;
  }
  .md\:pb-12 {
    padding-bottom: 3rem !important;
  }
  .md\:pl-12 {
    padding-left: 3rem !important;
  }
  .md\:pr-12 {
    padding-right: 3rem !important;
  }
  .md\:pt-12 {
    padding-top: 3rem !important;
  }
  .md\:px-12 {
    padding-left: 3rem !important;
    padding-right: 3rem !important;
  }
  .md\:py-12 {
    padding-bottom: 3rem !important;
    padding-top: 3rem !important;
  }
  .md\:p-16 {
    padding: 4rem !important;
  }
  .md\:pb-16 {
    padding-bottom: 4rem !important;
  }
  .md\:pl-16 {
    padding-left: 4rem !important;
  }
  .md\:pr-16 {
    padding-right: 4rem !important;
  }
  .md\:pt-16 {
    padding-top: 4rem !important;
  }
  .md\:px-16 {
    padding-left: 4rem !important;
    padding-right: 4rem !important;
  }
  .md\:py-16 {
    padding-bottom: 4rem !important;
    padding-top: 4rem !important;
  }
}

@media (min-width: 50.625em) {
  .mdf\:p-0 {
    padding: 0 !important;
  }
  .mdf\:pb-0 {
    padding-bottom: 0 !important;
  }
  .mdf\:pl-0 {
    padding-left: 0 !important;
  }
  .mdf\:pr-0 {
    padding-right: 0 !important;
  }
  .mdf\:pt-0 {
    padding-top: 0 !important;
  }
  .mdf\:px-0 {
    padding-left: 0 !important;
    padding-right: 0 !important;
  }
  .mdf\:py-0 {
    padding-bottom: 0 !important;
    padding-top: 0 !important;
  }
  .mdf\:p-15px {
    padding: 15px !important;
  }
  .mdf\:pb-15px {
    padding-bottom: 15px !important;
  }
  .mdf\:pl-15px {
    padding-left: 15px !important;
  }
  .mdf\:pr-15px {
    padding-right: 15px !important;
  }
  .mdf\:pt-15px {
    padding-top: 15px !important;
  }
  .mdf\:px-15px {
    padding-left: 15px !important;
    padding-right: 15px !important;
  }
  .mdf\:py-15px {
    padding-bottom: 15px !important;
    padding-top: 15px !important;
  }
  .mdf\:p-1 {
    padding: 0.25rem !important;
  }
  .mdf\:pb-1 {
    padding-bottom: 0.25rem !important;
  }
  .mdf\:pl-1 {
    padding-left: 0.25rem !important;
  }
  .mdf\:pr-1 {
    padding-right: 0.25rem !important;
  }
  .mdf\:pt-1 {
    padding-top: 0.25rem !important;
  }
  .mdf\:px-1 {
    padding-left: 0.25rem !important;
    padding-right: 0.25rem !important;
  }
  .mdf\:py-1 {
    padding-bottom: 0.25rem !important;
    padding-top: 0.25rem !important;
  }
  .mdf\:p-2 {
    padding: 0.5rem !important;
  }
  .mdf\:pb-2 {
    padding-bottom: 0.5rem !important;
  }
  .mdf\:pl-2 {
    padding-left: 0.5rem !important;
  }
  .mdf\:pr-2 {
    padding-right: 0.5rem !important;
  }
  .mdf\:pt-2 {
    padding-top: 0.5rem !important;
  }
  .mdf\:px-2 {
    padding-left: 0.5rem !important;
    padding-right: 0.5rem !important;
  }
  .mdf\:py-2 {
    padding-bottom: 0.5rem !important;
    padding-top: 0.5rem !important;
  }
  .mdf\:p-3 {
    padding: 0.75rem !important;
  }
  .mdf\:pb-3 {
    padding-bottom: 0.75rem !important;
  }
  .mdf\:pl-3 {
    padding-left: 0.75rem !important;
  }
  .mdf\:pr-3 {
    padding-right: 0.75rem !important;
  }
  .mdf\:pt-3 {
    padding-top: 0.75rem !important;
  }
  .mdf\:px-3 {
    padding-left: 0.75rem !important;
    padding-right: 0.75rem !important;
  }
  .mdf\:py-3 {
    padding-bottom: 0.75rem !important;
    padding-top: 0.75rem !important;
  }
  .mdf\:p-4 {
    padding: 1rem !important;
  }
  .mdf\:pb-4 {
    padding-bottom: 1rem !important;
  }
  .mdf\:pl-4 {
    padding-left: 1rem !important;
  }
  .mdf\:pr-4 {
    padding-right: 1rem !important;
  }
  .mdf\:pt-4 {
    padding-top: 1rem !important;
  }
  .mdf\:px-4 {
    padding-left: 1rem !important;
    padding-right: 1rem !important;
  }
  .mdf\:py-4 {
    padding-bottom: 1rem !important;
    padding-top: 1rem !important;
  }
  .mdf\:p-6 {
    padding: 1.5rem !important;
  }
  .mdf\:pb-6 {
    padding-bottom: 1.5rem !important;
  }
  .mdf\:pl-6 {
    padding-left: 1.5rem !important;
  }
  .mdf\:pr-6 {
    padding-right: 1.5rem !important;
  }
  .mdf\:pt-6 {
    padding-top: 1.5rem !important;
  }
  .mdf\:px-6 {
    padding-left: 1.5rem !important;
    padding-right: 1.5rem !important;
  }
  .mdf\:py-6 {
    padding-bottom: 1.5rem !important;
    padding-top: 1.5rem !important;
  }
  .mdf\:p-8 {
    padding: 2rem !important;
  }
  .mdf\:pb-8 {
    padding-bottom: 2rem !important;
  }
  .mdf\:pl-8 {
    padding-left: 2rem !important;
  }
  .mdf\:pr-8 {
    padding-right: 2rem !important;
  }
  .mdf\:pt-8 {
    padding-top: 2rem !important;
  }
  .mdf\:px-8 {
    padding-left: 2rem !important;
    padding-right: 2rem !important;
  }
  .mdf\:py-8 {
    padding-bottom: 2rem !important;
    padding-top: 2rem !important;
  }
  .mdf\:p-12 {
    padding: 3rem !important;
  }
  .mdf\:pb-12 {
    padding-bottom: 3rem !important;
  }
  .mdf\:pl-12 {
    padding-left: 3rem !important;
  }
  .mdf\:pr-12 {
    padding-right: 3rem !important;
  }
  .mdf\:pt-12 {
    padding-top: 3rem !important;
  }
  .mdf\:px-12 {
    padding-left: 3rem !important;
    padding-right: 3rem !important;
  }
  .mdf\:py-12 {
    padding-bottom: 3rem !important;
    padding-top: 3rem !important;
  }
  .mdf\:p-16 {
    padding: 4rem !important;
  }
  .mdf\:pb-16 {
    padding-bottom: 4rem !important;
  }
  .mdf\:pl-16 {
    padding-left: 4rem !important;
  }
  .mdf\:pr-16 {
    padding-right: 4rem !important;
  }
  .mdf\:pt-16 {
    padding-top: 4rem !important;
  }
  .mdf\:px-16 {
    padding-left: 4rem !important;
    padding-right: 4rem !important;
  }
  .mdf\:py-16 {
    padding-bottom: 4rem !important;
    padding-top: 4rem !important;
  }
}

@media (min-width: 60em) {
  .lg\:p-0 {
    padding: 0 !important;
  }
  .lg\:pb-0 {
    padding-bottom: 0 !important;
  }
  .lg\:pl-0 {
    padding-left: 0 !important;
  }
  .lg\:pr-0 {
    padding-right: 0 !important;
  }
  .lg\:pt-0 {
    padding-top: 0 !important;
  }
  .lg\:px-0 {
    padding-left: 0 !important;
    padding-right: 0 !important;
  }
  .lg\:py-0 {
    padding-bottom: 0 !important;
    padding-top: 0 !important;
  }
  .lg\:p-15px {
    padding: 15px !important;
  }
  .lg\:pb-15px {
    padding-bottom: 15px !important;
  }
  .lg\:pl-15px {
    padding-left: 15px !important;
  }
  .lg\:pr-15px {
    padding-right: 15px !important;
  }
  .lg\:pt-15px {
    padding-top: 15px !important;
  }
  .lg\:px-15px {
    padding-left: 15px !important;
    padding-right: 15px !important;
  }
  .lg\:py-15px {
    padding-bottom: 15px !important;
    padding-top: 15px !important;
  }
  .lg\:p-1 {
    padding: 0.25rem !important;
  }
  .lg\:pb-1 {
    padding-bottom: 0.25rem !important;
  }
  .lg\:pl-1 {
    padding-left: 0.25rem !important;
  }
  .lg\:pr-1 {
    padding-right: 0.25rem !important;
  }
  .lg\:pt-1 {
    padding-top: 0.25rem !important;
  }
  .lg\:px-1 {
    padding-left: 0.25rem !important;
    padding-right: 0.25rem !important;
  }
  .lg\:py-1 {
    padding-bottom: 0.25rem !important;
    padding-top: 0.25rem !important;
  }
  .lg\:p-2 {
    padding: 0.5rem !important;
  }
  .lg\:pb-2 {
    padding-bottom: 0.5rem !important;
  }
  .lg\:pl-2 {
    padding-left: 0.5rem !important;
  }
  .lg\:pr-2 {
    padding-right: 0.5rem !important;
  }
  .lg\:pt-2 {
    padding-top: 0.5rem !important;
  }
  .lg\:px-2 {
    padding-left: 0.5rem !important;
    padding-right: 0.5rem !important;
  }
  .lg\:py-2 {
    padding-bottom: 0.5rem !important;
    padding-top: 0.5rem !important;
  }
  .lg\:p-3 {
    padding: 0.75rem !important;
  }
  .lg\:pb-3 {
    padding-bottom: 0.75rem !important;
  }
  .lg\:pl-3 {
    padding-left: 0.75rem !important;
  }
  .lg\:pr-3 {
    padding-right: 0.75rem !important;
  }
  .lg\:pt-3 {
    padding-top: 0.75rem !important;
  }
  .lg\:px-3 {
    padding-left: 0.75rem !important;
    padding-right: 0.75rem !important;
  }
  .lg\:py-3 {
    padding-bottom: 0.75rem !important;
    padding-top: 0.75rem !important;
  }
  .lg\:p-4 {
    padding: 1rem !important;
  }
  .lg\:pb-4 {
    padding-bottom: 1rem !important;
  }
  .lg\:pl-4 {
    padding-left: 1rem !important;
  }
  .lg\:pr-4 {
    padding-right: 1rem !important;
  }
  .lg\:pt-4 {
    padding-top: 1rem !important;
  }
  .lg\:px-4 {
    padding-left: 1rem !important;
    padding-right: 1rem !important;
  }
  .lg\:py-4 {
    padding-bottom: 1rem !important;
    padding-top: 1rem !important;
  }
  .lg\:p-6 {
    padding: 1.5rem !important;
  }
  .lg\:pb-6 {
    padding-bottom: 1.5rem !important;
  }
  .lg\:pl-6 {
    padding-left: 1.5rem !important;
  }
  .lg\:pr-6 {
    padding-right: 1.5rem !important;
  }
  .lg\:pt-6 {
    padding-top: 1.5rem !important;
  }
  .lg\:px-6 {
    padding-left: 1.5rem !important;
    padding-right: 1.5rem !important;
  }
  .lg\:py-6 {
    padding-bottom: 1.5rem !important;
    padding-top: 1.5rem !important;
  }
  .lg\:p-8 {
    padding: 2rem !important;
  }
  .lg\:pb-8 {
    padding-bottom: 2rem !important;
  }
  .lg\:pl-8 {
    padding-left: 2rem !important;
  }
  .lg\:pr-8 {
    padding-right: 2rem !important;
  }
  .lg\:pt-8 {
    padding-top: 2rem !important;
  }
  .lg\:px-8 {
    padding-left: 2rem !important;
    padding-right: 2rem !important;
  }
  .lg\:py-8 {
    padding-bottom: 2rem !important;
    padding-top: 2rem !important;
  }
  .lg\:p-12 {
    padding: 3rem !important;
  }
  .lg\:pb-12 {
    padding-bottom: 3rem !important;
  }
  .lg\:pl-12 {
    padding-left: 3rem !important;
  }
  .lg\:pr-12 {
    padding-right: 3rem !important;
  }
  .lg\:pt-12 {
    padding-top: 3rem !important;
  }
  .lg\:px-12 {
    padding-left: 3rem !important;
    padding-right: 3rem !important;
  }
  .lg\:py-12 {
    padding-bottom: 3rem !important;
    padding-top: 3rem !important;
  }
  .lg\:p-16 {
    padding: 4rem !important;
  }
  .lg\:pb-16 {
    padding-bottom: 4rem !important;
  }
  .lg\:pl-16 {
    padding-left: 4rem !important;
  }
  .lg\:pr-16 {
    padding-right: 4rem !important;
  }
  .lg\:pt-16 {
    padding-top: 4rem !important;
  }
  .lg\:px-16 {
    padding-left: 4rem !important;
    padding-right: 4rem !important;
  }
  .lg\:py-16 {
    padding-bottom: 4rem !important;
    padding-top: 4rem !important;
  }
}

@media (min-width: 68.75em) {
  .xl\:p-0 {
    padding: 0 !important;
  }
  .xl\:pb-0 {
    padding-bottom: 0 !important;
  }
  .xl\:pl-0 {
    padding-left: 0 !important;
  }
  .xl\:pr-0 {
    padding-right: 0 !important;
  }
  .xl\:pt-0 {
    padding-top: 0 !important;
  }
  .xl\:px-0 {
    padding-left: 0 !important;
    padding-right: 0 !important;
  }
  .xl\:py-0 {
    padding-bottom: 0 !important;
    padding-top: 0 !important;
  }
  .xl\:p-15px {
    padding: 15px !important;
  }
  .xl\:pb-15px {
    padding-bottom: 15px !important;
  }
  .xl\:pl-15px {
    padding-left: 15px !important;
  }
  .xl\:pr-15px {
    padding-right: 15px !important;
  }
  .xl\:pt-15px {
    padding-top: 15px !important;
  }
  .xl\:px-15px {
    padding-left: 15px !important;
    padding-right: 15px !important;
  }
  .xl\:py-15px {
    padding-bottom: 15px !important;
    padding-top: 15px !important;
  }
  .xl\:p-1 {
    padding: 0.25rem !important;
  }
  .xl\:pb-1 {
    padding-bottom: 0.25rem !important;
  }
  .xl\:pl-1 {
    padding-left: 0.25rem !important;
  }
  .xl\:pr-1 {
    padding-right: 0.25rem !important;
  }
  .xl\:pt-1 {
    padding-top: 0.25rem !important;
  }
  .xl\:px-1 {
    padding-left: 0.25rem !important;
    padding-right: 0.25rem !important;
  }
  .xl\:py-1 {
    padding-bottom: 0.25rem !important;
    padding-top: 0.25rem !important;
  }
  .xl\:p-2 {
    padding: 0.5rem !important;
  }
  .xl\:pb-2 {
    padding-bottom: 0.5rem !important;
  }
  .xl\:pl-2 {
    padding-left: 0.5rem !important;
  }
  .xl\:pr-2 {
    padding-right: 0.5rem !important;
  }
  .xl\:pt-2 {
    padding-top: 0.5rem !important;
  }
  .xl\:px-2 {
    padding-left: 0.5rem !important;
    padding-right: 0.5rem !important;
  }
  .xl\:py-2 {
    padding-bottom: 0.5rem !important;
    padding-top: 0.5rem !important;
  }
  .xl\:p-3 {
    padding: 0.75rem !important;
  }
  .xl\:pb-3 {
    padding-bottom: 0.75rem !important;
  }
  .xl\:pl-3 {
    padding-left: 0.75rem !important;
  }
  .xl\:pr-3 {
    padding-right: 0.75rem !important;
  }
  .xl\:pt-3 {
    padding-top: 0.75rem !important;
  }
  .xl\:px-3 {
    padding-left: 0.75rem !important;
    padding-right: 0.75rem !important;
  }
  .xl\:py-3 {
    padding-bottom: 0.75rem !important;
    padding-top: 0.75rem !important;
  }
  .xl\:p-4 {
    padding: 1rem !important;
  }
  .xl\:pb-4 {
    padding-bottom: 1rem !important;
  }
  .xl\:pl-4 {
    padding-left: 1rem !important;
  }
  .xl\:pr-4 {
    padding-right: 1rem !important;
  }
  .xl\:pt-4 {
    padding-top: 1rem !important;
  }
  .xl\:px-4 {
    padding-left: 1rem !important;
    padding-right: 1rem !important;
  }
  .xl\:py-4 {
    padding-bottom: 1rem !important;
    padding-top: 1rem !important;
  }
  .xl\:p-6 {
    padding: 1.5rem !important;
  }
  .xl\:pb-6 {
    padding-bottom: 1.5rem !important;
  }
  .xl\:pl-6 {
    padding-left: 1.5rem !important;
  }
  .xl\:pr-6 {
    padding-right: 1.5rem !important;
  }
  .xl\:pt-6 {
    padding-top: 1.5rem !important;
  }
  .xl\:px-6 {
    padding-left: 1.5rem !important;
    padding-right: 1.5rem !important;
  }
  .xl\:py-6 {
    padding-bottom: 1.5rem !important;
    padding-top: 1.5rem !important;
  }
  .xl\:p-8 {
    padding: 2rem !important;
  }
  .xl\:pb-8 {
    padding-bottom: 2rem !important;
  }
  .xl\:pl-8 {
    padding-left: 2rem !important;
  }
  .xl\:pr-8 {
    padding-right: 2rem !important;
  }
  .xl\:pt-8 {
    padding-top: 2rem !important;
  }
  .xl\:px-8 {
    padding-left: 2rem !important;
    padding-right: 2rem !important;
  }
  .xl\:py-8 {
    padding-bottom: 2rem !important;
    padding-top: 2rem !important;
  }
  .xl\:p-12 {
    padding: 3rem !important;
  }
  .xl\:pb-12 {
    padding-bottom: 3rem !important;
  }
  .xl\:pl-12 {
    padding-left: 3rem !important;
  }
  .xl\:pr-12 {
    padding-right: 3rem !important;
  }
  .xl\:pt-12 {
    padding-top: 3rem !important;
  }
  .xl\:px-12 {
    padding-left: 3rem !important;
    padding-right: 3rem !important;
  }
  .xl\:py-12 {
    padding-bottom: 3rem !important;
    padding-top: 3rem !important;
  }
  .xl\:p-16 {
    padding: 4rem !important;
  }
  .xl\:pb-16 {
    padding-bottom: 4rem !important;
  }
  .xl\:pl-16 {
    padding-left: 4rem !important;
  }
  .xl\:pr-16 {
    padding-right: 4rem !important;
  }
  .xl\:pt-16 {
    padding-top: 4rem !important;
  }
  .xl\:px-16 {
    padding-left: 4rem !important;
    padding-right: 4rem !important;
  }
  .xl\:py-16 {
    padding-bottom: 4rem !important;
    padding-top: 4rem !important;
  }
}

@media (min-width: 81.25em) {
  .xxl\:p-0 {
    padding: 0 !important;
  }
  .xxl\:pb-0 {
    padding-bottom: 0 !important;
  }
  .xxl\:pl-0 {
    padding-left: 0 !important;
  }
  .xxl\:pr-0 {
    padding-right: 0 !important;
  }
  .xxl\:pt-0 {
    padding-top: 0 !important;
  }
  .xxl\:px-0 {
    padding-left: 0 !important;
    padding-right: 0 !important;
  }
  .xxl\:py-0 {
    padding-bottom: 0 !important;
    padding-top: 0 !important;
  }
  .xxl\:p-15px {
    padding: 15px !important;
  }
  .xxl\:pb-15px {
    padding-bottom: 15px !important;
  }
  .xxl\:pl-15px {
    padding-left: 15px !important;
  }
  .xxl\:pr-15px {
    padding-right: 15px !important;
  }
  .xxl\:pt-15px {
    padding-top: 15px !important;
  }
  .xxl\:px-15px {
    padding-left: 15px !important;
    padding-right: 15px !important;
  }
  .xxl\:py-15px {
    padding-bottom: 15px !important;
    padding-top: 15px !important;
  }
  .xxl\:p-1 {
    padding: 0.25rem !important;
  }
  .xxl\:pb-1 {
    padding-bottom: 0.25rem !important;
  }
  .xxl\:pl-1 {
    padding-left: 0.25rem !important;
  }
  .xxl\:pr-1 {
    padding-right: 0.25rem !important;
  }
  .xxl\:pt-1 {
    padding-top: 0.25rem !important;
  }
  .xxl\:px-1 {
    padding-left: 0.25rem !important;
    padding-right: 0.25rem !important;
  }
  .xxl\:py-1 {
    padding-bottom: 0.25rem !important;
    padding-top: 0.25rem !important;
  }
  .xxl\:p-2 {
    padding: 0.5rem !important;
  }
  .xxl\:pb-2 {
    padding-bottom: 0.5rem !important;
  }
  .xxl\:pl-2 {
    padding-left: 0.5rem !important;
  }
  .xxl\:pr-2 {
    padding-right: 0.5rem !important;
  }
  .xxl\:pt-2 {
    padding-top: 0.5rem !important;
  }
  .xxl\:px-2 {
    padding-left: 0.5rem !important;
    padding-right: 0.5rem !important;
  }
  .xxl\:py-2 {
    padding-bottom: 0.5rem !important;
    padding-top: 0.5rem !important;
  }
  .xxl\:p-3 {
    padding: 0.75rem !important;
  }
  .xxl\:pb-3 {
    padding-bottom: 0.75rem !important;
  }
  .xxl\:pl-3 {
    padding-left: 0.75rem !important;
  }
  .xxl\:pr-3 {
    padding-right: 0.75rem !important;
  }
  .xxl\:pt-3 {
    padding-top: 0.75rem !important;
  }
  .xxl\:px-3 {
    padding-left: 0.75rem !important;
    padding-right: 0.75rem !important;
  }
  .xxl\:py-3 {
    padding-bottom: 0.75rem !important;
    padding-top: 0.75rem !important;
  }
  .xxl\:p-4 {
    padding: 1rem !important;
  }
  .xxl\:pb-4 {
    padding-bottom: 1rem !important;
  }
  .xxl\:pl-4 {
    padding-left: 1rem !important;
  }
  .xxl\:pr-4 {
    padding-right: 1rem !important;
  }
  .xxl\:pt-4 {
    padding-top: 1rem !important;
  }
  .xxl\:px-4 {
    padding-left: 1rem !important;
    padding-right: 1rem !important;
  }
  .xxl\:py-4 {
    padding-bottom: 1rem !important;
    padding-top: 1rem !important;
  }
  .xxl\:p-6 {
    padding: 1.5rem !important;
  }
  .xxl\:pb-6 {
    padding-bottom: 1.5rem !important;
  }
  .xxl\:pl-6 {
    padding-left: 1.5rem !important;
  }
  .xxl\:pr-6 {
    padding-right: 1.5rem !important;
  }
  .xxl\:pt-6 {
    padding-top: 1.5rem !important;
  }
  .xxl\:px-6 {
    padding-left: 1.5rem !important;
    padding-right: 1.5rem !important;
  }
  .xxl\:py-6 {
    padding-bottom: 1.5rem !important;
    padding-top: 1.5rem !important;
  }
  .xxl\:p-8 {
    padding: 2rem !important;
  }
  .xxl\:pb-8 {
    padding-bottom: 2rem !important;
  }
  .xxl\:pl-8 {
    padding-left: 2rem !important;
  }
  .xxl\:pr-8 {
    padding-right: 2rem !important;
  }
  .xxl\:pt-8 {
    padding-top: 2rem !important;
  }
  .xxl\:px-8 {
    padding-left: 2rem !important;
    padding-right: 2rem !important;
  }
  .xxl\:py-8 {
    padding-bottom: 2rem !important;
    padding-top: 2rem !important;
  }
  .xxl\:p-12 {
    padding: 3rem !important;
  }
  .xxl\:pb-12 {
    padding-bottom: 3rem !important;
  }
  .xxl\:pl-12 {
    padding-left: 3rem !important;
  }
  .xxl\:pr-12 {
    padding-right: 3rem !important;
  }
  .xxl\:pt-12 {
    padding-top: 3rem !important;
  }
  .xxl\:px-12 {
    padding-left: 3rem !important;
    padding-right: 3rem !important;
  }
  .xxl\:py-12 {
    padding-bottom: 3rem !important;
    padding-top: 3rem !important;
  }
  .xxl\:p-16 {
    padding: 4rem !important;
  }
  .xxl\:pb-16 {
    padding-bottom: 4rem !important;
  }
  .xxl\:pl-16 {
    padding-left: 4rem !important;
  }
  .xxl\:pr-16 {
    padding-right: 4rem !important;
  }
  .xxl\:pt-16 {
    padding-top: 4rem !important;
  }
  .xxl\:px-16 {
    padding-left: 4rem !important;
    padding-right: 4rem !important;
  }
  .xxl\:py-16 {
    padding-bottom: 4rem !important;
    padding-top: 4rem !important;
  }
}

@media (min-width: 82.625em) {
  .xxl-e\:p-0 {
    padding: 0 !important;
  }
  .xxl-e\:pb-0 {
    padding-bottom: 0 !important;
  }
  .xxl-e\:pl-0 {
    padding-left: 0 !important;
  }
  .xxl-e\:pr-0 {
    padding-right: 0 !important;
  }
  .xxl-e\:pt-0 {
    padding-top: 0 !important;
  }
  .xxl-e\:px-0 {
    padding-left: 0 !important;
    padding-right: 0 !important;
  }
  .xxl-e\:py-0 {
    padding-bottom: 0 !important;
    padding-top: 0 !important;
  }
  .xxl-e\:p-15px {
    padding: 15px !important;
  }
  .xxl-e\:pb-15px {
    padding-bottom: 15px !important;
  }
  .xxl-e\:pl-15px {
    padding-left: 15px !important;
  }
  .xxl-e\:pr-15px {
    padding-right: 15px !important;
  }
  .xxl-e\:pt-15px {
    padding-top: 15px !important;
  }
  .xxl-e\:px-15px {
    padding-left: 15px !important;
    padding-right: 15px !important;
  }
  .xxl-e\:py-15px {
    padding-bottom: 15px !important;
    padding-top: 15px !important;
  }
  .xxl-e\:p-1 {
    padding: 0.25rem !important;
  }
  .xxl-e\:pb-1 {
    padding-bottom: 0.25rem !important;
  }
  .xxl-e\:pl-1 {
    padding-left: 0.25rem !important;
  }
  .xxl-e\:pr-1 {
    padding-right: 0.25rem !important;
  }
  .xxl-e\:pt-1 {
    padding-top: 0.25rem !important;
  }
  .xxl-e\:px-1 {
    padding-left: 0.25rem !important;
    padding-right: 0.25rem !important;
  }
  .xxl-e\:py-1 {
    padding-bottom: 0.25rem !important;
    padding-top: 0.25rem !important;
  }
  .xxl-e\:p-2 {
    padding: 0.5rem !important;
  }
  .xxl-e\:pb-2 {
    padding-bottom: 0.5rem !important;
  }
  .xxl-e\:pl-2 {
    padding-left: 0.5rem !important;
  }
  .xxl-e\:pr-2 {
    padding-right: 0.5rem !important;
  }
  .xxl-e\:pt-2 {
    padding-top: 0.5rem !important;
  }
  .xxl-e\:px-2 {
    padding-left: 0.5rem !important;
    padding-right: 0.5rem !important;
  }
  .xxl-e\:py-2 {
    padding-bottom: 0.5rem !important;
    padding-top: 0.5rem !important;
  }
  .xxl-e\:p-3 {
    padding: 0.75rem !important;
  }
  .xxl-e\:pb-3 {
    padding-bottom: 0.75rem !important;
  }
  .xxl-e\:pl-3 {
    padding-left: 0.75rem !important;
  }
  .xxl-e\:pr-3 {
    padding-right: 0.75rem !important;
  }
  .xxl-e\:pt-3 {
    padding-top: 0.75rem !important;
  }
  .xxl-e\:px-3 {
    padding-left: 0.75rem !important;
    padding-right: 0.75rem !important;
  }
  .xxl-e\:py-3 {
    padding-bottom: 0.75rem !important;
    padding-top: 0.75rem !important;
  }
  .xxl-e\:p-4 {
    padding: 1rem !important;
  }
  .xxl-e\:pb-4 {
    padding-bottom: 1rem !important;
  }
  .xxl-e\:pl-4 {
    padding-left: 1rem !important;
  }
  .xxl-e\:pr-4 {
    padding-right: 1rem !important;
  }
  .xxl-e\:pt-4 {
    padding-top: 1rem !important;
  }
  .xxl-e\:px-4 {
    padding-left: 1rem !important;
    padding-right: 1rem !important;
  }
  .xxl-e\:py-4 {
    padding-bottom: 1rem !important;
    padding-top: 1rem !important;
  }
  .xxl-e\:p-6 {
    padding: 1.5rem !important;
  }
  .xxl-e\:pb-6 {
    padding-bottom: 1.5rem !important;
  }
  .xxl-e\:pl-6 {
    padding-left: 1.5rem !important;
  }
  .xxl-e\:pr-6 {
    padding-right: 1.5rem !important;
  }
  .xxl-e\:pt-6 {
    padding-top: 1.5rem !important;
  }
  .xxl-e\:px-6 {
    padding-left: 1.5rem !important;
    padding-right: 1.5rem !important;
  }
  .xxl-e\:py-6 {
    padding-bottom: 1.5rem !important;
    padding-top: 1.5rem !important;
  }
  .xxl-e\:p-8 {
    padding: 2rem !important;
  }
  .xxl-e\:pb-8 {
    padding-bottom: 2rem !important;
  }
  .xxl-e\:pl-8 {
    padding-left: 2rem !important;
  }
  .xxl-e\:pr-8 {
    padding-right: 2rem !important;
  }
  .xxl-e\:pt-8 {
    padding-top: 2rem !important;
  }
  .xxl-e\:px-8 {
    padding-left: 2rem !important;
    padding-right: 2rem !important;
  }
  .xxl-e\:py-8 {
    padding-bottom: 2rem !important;
    padding-top: 2rem !important;
  }
  .xxl-e\:p-12 {
    padding: 3rem !important;
  }
  .xxl-e\:pb-12 {
    padding-bottom: 3rem !important;
  }
  .xxl-e\:pl-12 {
    padding-left: 3rem !important;
  }
  .xxl-e\:pr-12 {
    padding-right: 3rem !important;
  }
  .xxl-e\:pt-12 {
    padding-top: 3rem !important;
  }
  .xxl-e\:px-12 {
    padding-left: 3rem !important;
    padding-right: 3rem !important;
  }
  .xxl-e\:py-12 {
    padding-bottom: 3rem !important;
    padding-top: 3rem !important;
  }
  .xxl-e\:p-16 {
    padding: 4rem !important;
  }
  .xxl-e\:pb-16 {
    padding-bottom: 4rem !important;
  }
  .xxl-e\:pl-16 {
    padding-left: 4rem !important;
  }
  .xxl-e\:pr-16 {
    padding-right: 4rem !important;
  }
  .xxl-e\:pt-16 {
    padding-top: 4rem !important;
  }
  .xxl-e\:px-16 {
    padding-left: 4rem !important;
    padding-right: 4rem !important;
  }
  .xxl-e\:py-16 {
    padding-bottom: 4rem !important;
    padding-top: 4rem !important;
  }
}

@media (min-width: 100em) {
  .xxxl\:p-0 {
    padding: 0 !important;
  }
  .xxxl\:pb-0 {
    padding-bottom: 0 !important;
  }
  .xxxl\:pl-0 {
    padding-left: 0 !important;
  }
  .xxxl\:pr-0 {
    padding-right: 0 !important;
  }
  .xxxl\:pt-0 {
    padding-top: 0 !important;
  }
  .xxxl\:px-0 {
    padding-left: 0 !important;
    padding-right: 0 !important;
  }
  .xxxl\:py-0 {
    padding-bottom: 0 !important;
    padding-top: 0 !important;
  }
  .xxxl\:p-15px {
    padding: 15px !important;
  }
  .xxxl\:pb-15px {
    padding-bottom: 15px !important;
  }
  .xxxl\:pl-15px {
    padding-left: 15px !important;
  }
  .xxxl\:pr-15px {
    padding-right: 15px !important;
  }
  .xxxl\:pt-15px {
    padding-top: 15px !important;
  }
  .xxxl\:px-15px {
    padding-left: 15px !important;
    padding-right: 15px !important;
  }
  .xxxl\:py-15px {
    padding-bottom: 15px !important;
    padding-top: 15px !important;
  }
  .xxxl\:p-1 {
    padding: 0.25rem !important;
  }
  .xxxl\:pb-1 {
    padding-bottom: 0.25rem !important;
  }
  .xxxl\:pl-1 {
    padding-left: 0.25rem !important;
  }
  .xxxl\:pr-1 {
    padding-right: 0.25rem !important;
  }
  .xxxl\:pt-1 {
    padding-top: 0.25rem !important;
  }
  .xxxl\:px-1 {
    padding-left: 0.25rem !important;
    padding-right: 0.25rem !important;
  }
  .xxxl\:py-1 {
    padding-bottom: 0.25rem !important;
    padding-top: 0.25rem !important;
  }
  .xxxl\:p-2 {
    padding: 0.5rem !important;
  }
  .xxxl\:pb-2 {
    padding-bottom: 0.5rem !important;
  }
  .xxxl\:pl-2 {
    padding-left: 0.5rem !important;
  }
  .xxxl\:pr-2 {
    padding-right: 0.5rem !important;
  }
  .xxxl\:pt-2 {
    padding-top: 0.5rem !important;
  }
  .xxxl\:px-2 {
    padding-left: 0.5rem !important;
    padding-right: 0.5rem !important;
  }
  .xxxl\:py-2 {
    padding-bottom: 0.5rem !important;
    padding-top: 0.5rem !important;
  }
  .xxxl\:p-3 {
    padding: 0.75rem !important;
  }
  .xxxl\:pb-3 {
    padding-bottom: 0.75rem !important;
  }
  .xxxl\:pl-3 {
    padding-left: 0.75rem !important;
  }
  .xxxl\:pr-3 {
    padding-right: 0.75rem !important;
  }
  .xxxl\:pt-3 {
    padding-top: 0.75rem !important;
  }
  .xxxl\:px-3 {
    padding-left: 0.75rem !important;
    padding-right: 0.75rem !important;
  }
  .xxxl\:py-3 {
    padding-bottom: 0.75rem !important;
    padding-top: 0.75rem !important;
  }
  .xxxl\:p-4 {
    padding: 1rem !important;
  }
  .xxxl\:pb-4 {
    padding-bottom: 1rem !important;
  }
  .xxxl\:pl-4 {
    padding-left: 1rem !important;
  }
  .xxxl\:pr-4 {
    padding-right: 1rem !important;
  }
  .xxxl\:pt-4 {
    padding-top: 1rem !important;
  }
  .xxxl\:px-4 {
    padding-left: 1rem !important;
    padding-right: 1rem !important;
  }
  .xxxl\:py-4 {
    padding-bottom: 1rem !important;
    padding-top: 1rem !important;
  }
  .xxxl\:p-6 {
    padding: 1.5rem !important;
  }
  .xxxl\:pb-6 {
    padding-bottom: 1.5rem !important;
  }
  .xxxl\:pl-6 {
    padding-left: 1.5rem !important;
  }
  .xxxl\:pr-6 {
    padding-right: 1.5rem !important;
  }
  .xxxl\:pt-6 {
    padding-top: 1.5rem !important;
  }
  .xxxl\:px-6 {
    padding-left: 1.5rem !important;
    padding-right: 1.5rem !important;
  }
  .xxxl\:py-6 {
    padding-bottom: 1.5rem !important;
    padding-top: 1.5rem !important;
  }
  .xxxl\:p-8 {
    padding: 2rem !important;
  }
  .xxxl\:pb-8 {
    padding-bottom: 2rem !important;
  }
  .xxxl\:pl-8 {
    padding-left: 2rem !important;
  }
  .xxxl\:pr-8 {
    padding-right: 2rem !important;
  }
  .xxxl\:pt-8 {
    padding-top: 2rem !important;
  }
  .xxxl\:px-8 {
    padding-left: 2rem !important;
    padding-right: 2rem !important;
  }
  .xxxl\:py-8 {
    padding-bottom: 2rem !important;
    padding-top: 2rem !important;
  }
  .xxxl\:p-12 {
    padding: 3rem !important;
  }
  .xxxl\:pb-12 {
    padding-bottom: 3rem !important;
  }
  .xxxl\:pl-12 {
    padding-left: 3rem !important;
  }
  .xxxl\:pr-12 {
    padding-right: 3rem !important;
  }
  .xxxl\:pt-12 {
    padding-top: 3rem !important;
  }
  .xxxl\:px-12 {
    padding-left: 3rem !important;
    padding-right: 3rem !important;
  }
  .xxxl\:py-12 {
    padding-bottom: 3rem !important;
    padding-top: 3rem !important;
  }
  .xxxl\:p-16 {
    padding: 4rem !important;
  }
  .xxxl\:pb-16 {
    padding-bottom: 4rem !important;
  }
  .xxxl\:pl-16 {
    padding-left: 4rem !important;
  }
  .xxxl\:pr-16 {
    padding-right: 4rem !important;
  }
  .xxxl\:pt-16 {
    padding-top: 4rem !important;
  }
  .xxxl\:px-16 {
    padding-left: 4rem !important;
    padding-right: 4rem !important;
  }
  .xxxl\:py-16 {
    padding-bottom: 4rem !important;
    padding-top: 4rem !important;
  }
}

/*
================================================================================
Position
================================================================================
*/
.absolute {
  position: absolute !important;
}

.fixed {
  position: fixed !important;
}

.relative {
  position: relative !important;
}

.static {
  position: static !important;
}

.sticky {
  position: sticky !important;
}

.bottom-0 {
  bottom: 0 !important;
}

.bottom-auto {
  bottom: auto !important;
}

.left-0 {
  left: 0 !important;
}

.left-auto {
  left: auto !important;
}

.right-0 {
  right: 0 !important;
}

.right-auto {
  right: auto !important;
}

.top-0 {
  top: 0 !important;
}

.top-auto {
  top: auto !important;
}

@media (min-width: 37.5em) {
  .sm\:absolute {
    position: absolute !important;
  }
  .sm\:fixed {
    position: fixed !important;
  }
  .sm\:relative {
    position: relative !important;
  }
  .sm\:static {
    position: static !important;
  }
  .sm\:sticky {
    position: sticky !important;
  }
  .sm\:bottom-0 {
    bottom: 0 !important;
  }
  .sm\:bottom-auto {
    bottom: auto !important;
  }
  .sm\:left-0 {
    left: 0 !important;
  }
  .sm\:left-auto {
    left: auto !important;
  }
  .sm\:right-0 {
    right: 0 !important;
  }
  .sm\:right-auto {
    right: auto !important;
  }
  .sm\:top-0 {
    top: 0 !important;
  }
  .sm\:top-auto {
    top: auto !important;
  }
}

@media (min-width: 45em) {
  .md\:absolute {
    position: absolute !important;
  }
  .md\:fixed {
    position: fixed !important;
  }
  .md\:relative {
    position: relative !important;
  }
  .md\:static {
    position: static !important;
  }
  .md\:sticky {
    position: sticky !important;
  }
  .md\:bottom-0 {
    bottom: 0 !important;
  }
  .md\:bottom-auto {
    bottom: auto !important;
  }
  .md\:left-0 {
    left: 0 !important;
  }
  .md\:left-auto {
    left: auto !important;
  }
  .md\:right-0 {
    right: 0 !important;
  }
  .md\:right-auto {
    right: auto !important;
  }
  .md\:top-0 {
    top: 0 !important;
  }
  .md\:top-auto {
    top: auto !important;
  }
}

@media (min-width: 50.625em) {
  .mdf\:absolute {
    position: absolute !important;
  }
  .mdf\:fixed {
    position: fixed !important;
  }
  .mdf\:relative {
    position: relative !important;
  }
  .mdf\:static {
    position: static !important;
  }
  .mdf\:sticky {
    position: sticky !important;
  }
  .mdf\:bottom-0 {
    bottom: 0 !important;
  }
  .mdf\:bottom-auto {
    bottom: auto !important;
  }
  .mdf\:left-0 {
    left: 0 !important;
  }
  .mdf\:left-auto {
    left: auto !important;
  }
  .mdf\:right-0 {
    right: 0 !important;
  }
  .mdf\:right-auto {
    right: auto !important;
  }
  .mdf\:top-0 {
    top: 0 !important;
  }
  .mdf\:top-auto {
    top: auto !important;
  }
}

@media (min-width: 60em) {
  .lg\:absolute {
    position: absolute !important;
  }
  .lg\:fixed {
    position: fixed !important;
  }
  .lg\:relative {
    position: relative !important;
  }
  .lg\:static {
    position: static !important;
  }
  .lg\:sticky {
    position: sticky !important;
  }
  .lg\:bottom-0 {
    bottom: 0 !important;
  }
  .lg\:bottom-auto {
    bottom: auto !important;
  }
  .lg\:left-0 {
    left: 0 !important;
  }
  .lg\:left-auto {
    left: auto !important;
  }
  .lg\:right-0 {
    right: 0 !important;
  }
  .lg\:right-auto {
    right: auto !important;
  }
  .lg\:top-0 {
    top: 0 !important;
  }
  .lg\:top-auto {
    top: auto !important;
  }
}

@media (min-width: 68.75em) {
  .xl\:absolute {
    position: absolute !important;
  }
  .xl\:fixed {
    position: fixed !important;
  }
  .xl\:relative {
    position: relative !important;
  }
  .xl\:static {
    position: static !important;
  }
  .xl\:sticky {
    position: sticky !important;
  }
  .xl\:bottom-0 {
    bottom: 0 !important;
  }
  .xl\:bottom-auto {
    bottom: auto !important;
  }
  .xl\:left-0 {
    left: 0 !important;
  }
  .xl\:left-auto {
    left: auto !important;
  }
  .xl\:right-0 {
    right: 0 !important;
  }
  .xl\:right-auto {
    right: auto !important;
  }
  .xl\:top-0 {
    top: 0 !important;
  }
  .xl\:top-auto {
    top: auto !important;
  }
}

@media (min-width: 81.25em) {
  .xxl\:absolute {
    position: absolute !important;
  }
  .xxl\:fixed {
    position: fixed !important;
  }
  .xxl\:relative {
    position: relative !important;
  }
  .xxl\:static {
    position: static !important;
  }
  .xxl\:sticky {
    position: sticky !important;
  }
  .xxl\:bottom-0 {
    bottom: 0 !important;
  }
  .xxl\:bottom-auto {
    bottom: auto !important;
  }
  .xxl\:left-0 {
    left: 0 !important;
  }
  .xxl\:left-auto {
    left: auto !important;
  }
  .xxl\:right-0 {
    right: 0 !important;
  }
  .xxl\:right-auto {
    right: auto !important;
  }
  .xxl\:top-0 {
    top: 0 !important;
  }
  .xxl\:top-auto {
    top: auto !important;
  }
}

@media (min-width: 82.625em) {
  .xxl-e\:absolute {
    position: absolute !important;
  }
  .xxl-e\:fixed {
    position: fixed !important;
  }
  .xxl-e\:relative {
    position: relative !important;
  }
  .xxl-e\:static {
    position: static !important;
  }
  .xxl-e\:sticky {
    position: sticky !important;
  }
  .xxl-e\:bottom-0 {
    bottom: 0 !important;
  }
  .xxl-e\:bottom-auto {
    bottom: auto !important;
  }
  .xxl-e\:left-0 {
    left: 0 !important;
  }
  .xxl-e\:left-auto {
    left: auto !important;
  }
  .xxl-e\:right-0 {
    right: 0 !important;
  }
  .xxl-e\:right-auto {
    right: auto !important;
  }
  .xxl-e\:top-0 {
    top: 0 !important;
  }
  .xxl-e\:top-auto {
    top: auto !important;
  }
}

@media (min-width: 100em) {
  .xxxl\:absolute {
    position: absolute !important;
  }
  .xxxl\:fixed {
    position: fixed !important;
  }
  .xxxl\:relative {
    position: relative !important;
  }
  .xxxl\:static {
    position: static !important;
  }
  .xxxl\:sticky {
    position: sticky !important;
  }
  .xxxl\:bottom-0 {
    bottom: 0 !important;
  }
  .xxxl\:bottom-auto {
    bottom: auto !important;
  }
  .xxxl\:left-0 {
    left: 0 !important;
  }
  .xxxl\:left-auto {
    left: auto !important;
  }
  .xxxl\:right-0 {
    right: 0 !important;
  }
  .xxxl\:right-auto {
    right: auto !important;
  }
  .xxxl\:top-0 {
    top: 0 !important;
  }
  .xxxl\:top-auto {
    top: auto !important;
  }
}

/*
================================================================================
Shadow
================================================================================
*/
.shadow {
  box-shadow: 0 2px 4px rgba(0, 0, 0, 0.1) !important;
}

.shadow-lg {
  box-shadow: 0 4px 8px -2px rgba(0, 0, 0, 0.2) !important;
}

.shadow-none {
  box-shadow: none !important;
}

/*
================================================================================
SVG color
================================================================================
*/
/*
         * Combine with a text-color utility to set the fill color of an SVG.
         *
         * Credit: https://tailwindcss.com
         */
.fill-current {
  fill: currentColor !important;
}

/*
         * Combine with a text-color utility to set the stroke color of an SVG.
         *
         * Credit: https://tailwindcss.com
         */
.stroke-current {
  stroke: currentColor !important;
}

/*
================================================================================
SVG size
================================================================================
*/
.svg-w-auto > * {
  height: auto !important;
  width: auto !important;
}

.svg-w-1 > * {
  height: 0.25em !important;
  width: 0.25em !important;
}

.svg-w-2 > * {
  height: 0.5em !important;
  width: 0.5em !important;
}

.svg-w-3 > * {
  height: 0.75em !important;
  width: 0.75em !important;
}

.svg-w-4 > * {
  height: 1em !important;
  width: 1em !important;
}

.svg-w-5 > * {
  height: 1.25em !important;
  width: 1.25em !important;
}

.svg-w-6 > * {
  height: 1.5em !important;
  width: 1.5em !important;
}

.svg-w-7 > * {
  height: 1.75em !important;
  width: 1.75em !important;
}

.svg-w-8 > * {
  height: 2em !important;
  width: 2em !important;
}

@media (min-width: 37.5em) {
  .sm\:svg-w-auto > * {
    height: auto !important;
    width: auto !important;
  }
  .sm\:svg-w-1 > * {
    height: 0.25em !important;
    width: 0.25em !important;
  }
  .sm\:svg-w-2 > * {
    height: 0.5em !important;
    width: 0.5em !important;
  }
  .sm\:svg-w-3 > * {
    height: 0.75em !important;
    width: 0.75em !important;
  }
  .sm\:svg-w-4 > * {
    height: 1em !important;
    width: 1em !important;
  }
  .sm\:svg-w-5 > * {
    height: 1.25em !important;
    width: 1.25em !important;
  }
  .sm\:svg-w-6 > * {
    height: 1.5em !important;
    width: 1.5em !important;
  }
  .sm\:svg-w-7 > * {
    height: 1.75em !important;
    width: 1.75em !important;
  }
  .sm\:svg-w-8 > * {
    height: 2em !important;
    width: 2em !important;
  }
}

@media (min-width: 45em) {
  .md\:svg-w-auto > * {
    height: auto !important;
    width: auto !important;
  }
  .md\:svg-w-1 > * {
    height: 0.25em !important;
    width: 0.25em !important;
  }
  .md\:svg-w-2 > * {
    height: 0.5em !important;
    width: 0.5em !important;
  }
  .md\:svg-w-3 > * {
    height: 0.75em !important;
    width: 0.75em !important;
  }
  .md\:svg-w-4 > * {
    height: 1em !important;
    width: 1em !important;
  }
  .md\:svg-w-5 > * {
    height: 1.25em !important;
    width: 1.25em !important;
  }
  .md\:svg-w-6 > * {
    height: 1.5em !important;
    width: 1.5em !important;
  }
  .md\:svg-w-7 > * {
    height: 1.75em !important;
    width: 1.75em !important;
  }
  .md\:svg-w-8 > * {
    height: 2em !important;
    width: 2em !important;
  }
}

@media (min-width: 50.625em) {
  .mdf\:svg-w-auto > * {
    height: auto !important;
    width: auto !important;
  }
  .mdf\:svg-w-1 > * {
    height: 0.25em !important;
    width: 0.25em !important;
  }
  .mdf\:svg-w-2 > * {
    height: 0.5em !important;
    width: 0.5em !important;
  }
  .mdf\:svg-w-3 > * {
    height: 0.75em !important;
    width: 0.75em !important;
  }
  .mdf\:svg-w-4 > * {
    height: 1em !important;
    width: 1em !important;
  }
  .mdf\:svg-w-5 > * {
    height: 1.25em !important;
    width: 1.25em !important;
  }
  .mdf\:svg-w-6 > * {
    height: 1.5em !important;
    width: 1.5em !important;
  }
  .mdf\:svg-w-7 > * {
    height: 1.75em !important;
    width: 1.75em !important;
  }
  .mdf\:svg-w-8 > * {
    height: 2em !important;
    width: 2em !important;
  }
}

@media (min-width: 60em) {
  .lg\:svg-w-auto > * {
    height: auto !important;
    width: auto !important;
  }
  .lg\:svg-w-1 > * {
    height: 0.25em !important;
    width: 0.25em !important;
  }
  .lg\:svg-w-2 > * {
    height: 0.5em !important;
    width: 0.5em !important;
  }
  .lg\:svg-w-3 > * {
    height: 0.75em !important;
    width: 0.75em !important;
  }
  .lg\:svg-w-4 > * {
    height: 1em !important;
    width: 1em !important;
  }
  .lg\:svg-w-5 > * {
    height: 1.25em !important;
    width: 1.25em !important;
  }
  .lg\:svg-w-6 > * {
    height: 1.5em !important;
    width: 1.5em !important;
  }
  .lg\:svg-w-7 > * {
    height: 1.75em !important;
    width: 1.75em !important;
  }
  .lg\:svg-w-8 > * {
    height: 2em !important;
    width: 2em !important;
  }
}

@media (min-width: 68.75em) {
  .xl\:svg-w-auto > * {
    height: auto !important;
    width: auto !important;
  }
  .xl\:svg-w-1 > * {
    height: 0.25em !important;
    width: 0.25em !important;
  }
  .xl\:svg-w-2 > * {
    height: 0.5em !important;
    width: 0.5em !important;
  }
  .xl\:svg-w-3 > * {
    height: 0.75em !important;
    width: 0.75em !important;
  }
  .xl\:svg-w-4 > * {
    height: 1em !important;
    width: 1em !important;
  }
  .xl\:svg-w-5 > * {
    height: 1.25em !important;
    width: 1.25em !important;
  }
  .xl\:svg-w-6 > * {
    height: 1.5em !important;
    width: 1.5em !important;
  }
  .xl\:svg-w-7 > * {
    height: 1.75em !important;
    width: 1.75em !important;
  }
  .xl\:svg-w-8 > * {
    height: 2em !important;
    width: 2em !important;
  }
}

@media (min-width: 81.25em) {
  .xxl\:svg-w-auto > * {
    height: auto !important;
    width: auto !important;
  }
  .xxl\:svg-w-1 > * {
    height: 0.25em !important;
    width: 0.25em !important;
  }
  .xxl\:svg-w-2 > * {
    height: 0.5em !important;
    width: 0.5em !important;
  }
  .xxl\:svg-w-3 > * {
    height: 0.75em !important;
    width: 0.75em !important;
  }
  .xxl\:svg-w-4 > * {
    height: 1em !important;
    width: 1em !important;
  }
  .xxl\:svg-w-5 > * {
    height: 1.25em !important;
    width: 1.25em !important;
  }
  .xxl\:svg-w-6 > * {
    height: 1.5em !important;
    width: 1.5em !important;
  }
  .xxl\:svg-w-7 > * {
    height: 1.75em !important;
    width: 1.75em !important;
  }
  .xxl\:svg-w-8 > * {
    height: 2em !important;
    width: 2em !important;
  }
}

@media (min-width: 82.625em) {
  .xxl-e\:svg-w-auto > * {
    height: auto !important;
    width: auto !important;
  }
  .xxl-e\:svg-w-1 > * {
    height: 0.25em !important;
    width: 0.25em !important;
  }
  .xxl-e\:svg-w-2 > * {
    height: 0.5em !important;
    width: 0.5em !important;
  }
  .xxl-e\:svg-w-3 > * {
    height: 0.75em !important;
    width: 0.75em !important;
  }
  .xxl-e\:svg-w-4 > * {
    height: 1em !important;
    width: 1em !important;
  }
  .xxl-e\:svg-w-5 > * {
    height: 1.25em !important;
    width: 1.25em !important;
  }
  .xxl-e\:svg-w-6 > * {
    height: 1.5em !important;
    width: 1.5em !important;
  }
  .xxl-e\:svg-w-7 > * {
    height: 1.75em !important;
    width: 1.75em !important;
  }
  .xxl-e\:svg-w-8 > * {
    height: 2em !important;
    width: 2em !important;
  }
}

@media (min-width: 100em) {
  .xxxl\:svg-w-auto > * {
    height: auto !important;
    width: auto !important;
  }
  .xxxl\:svg-w-1 > * {
    height: 0.25em !important;
    width: 0.25em !important;
  }
  .xxxl\:svg-w-2 > * {
    height: 0.5em !important;
    width: 0.5em !important;
  }
  .xxxl\:svg-w-3 > * {
    height: 0.75em !important;
    width: 0.75em !important;
  }
  .xxxl\:svg-w-4 > * {
    height: 1em !important;
    width: 1em !important;
  }
  .xxxl\:svg-w-5 > * {
    height: 1.25em !important;
    width: 1.25em !important;
  }
  .xxxl\:svg-w-6 > * {
    height: 1.5em !important;
    width: 1.5em !important;
  }
  .xxxl\:svg-w-7 > * {
    height: 1.75em !important;
    width: 1.75em !important;
  }
  .xxxl\:svg-w-8 > * {
    height: 2em !important;
    width: 2em !important;
  }
}

/*
================================================================================
Table layout
================================================================================
*/
.table-auto {
  table-layout: auto !important;
}

.table-fixed {
  table-layout: fixed !important;
}

/*
================================================================================
Width
================================================================================
*/
.w-auto {
  width: auto !important;
}

.w-1\/12 {
  width: 8.33333333% !important;
}

.w-1\/10 {
  width: 10% !important;
}

.w-1\/6 {
  width: 16.66666667% !important;
}

.w-1\/5 {
  width: 20% !important;
}

.w-1\/4 {
  width: 25% !important;
}

.w-3\/10 {
  width: 30% !important;
}

.w-1\/3 {
  width: 33.33333333% !important;
}

.w-2\/5 {
  width: 40% !important;
}

.w-5\/12 {
  width: 41.66666667% !important;
}

.w-1\/2 {
  width: 50% !important;
}

.w-7\/12 {
  width: 58.33333333% !important;
}

.w-3\/5 {
  width: 60% !important;
}

.w-2\/3 {
  width: 66.66666667% !important;
}

.w-7\/10 {
  width: 70% !important;
}

.w-3\/4 {
  width: 75% !important;
}

.w-4\/5 {
  width: 80% !important;
}

.w-5\/6 {
  width: 83.33333333% !important;
}

.w-9\/10 {
  width: 90% !important;
}

.w-11\/12 {
  width: 91.66666667% !important;
}

.w-full {
  width: 100% !important;
}

@media (min-width: 37.5em) {
  .sm\:w-auto {
    width: auto !important;
  }
  .sm\:w-1\/12 {
    width: 8.33333333% !important;
  }
  .sm\:w-1\/10 {
    width: 10% !important;
  }
  .sm\:w-1\/6 {
    width: 16.66666667% !important;
  }
  .sm\:w-1\/5 {
    width: 20% !important;
  }
  .sm\:w-1\/4 {
    width: 25% !important;
  }
  .sm\:w-3\/10 {
    width: 30% !important;
  }
  .sm\:w-1\/3 {
    width: 33.33333333% !important;
  }
  .sm\:w-2\/5 {
    width: 40% !important;
  }
  .sm\:w-5\/12 {
    width: 41.66666667% !important;
  }
  .sm\:w-1\/2 {
    width: 50% !important;
  }
  .sm\:w-7\/12 {
    width: 58.33333333% !important;
  }
  .sm\:w-3\/5 {
    width: 60% !important;
  }
  .sm\:w-2\/3 {
    width: 66.66666667% !important;
  }
  .sm\:w-7\/10 {
    width: 70% !important;
  }
  .sm\:w-3\/4 {
    width: 75% !important;
  }
  .sm\:w-4\/5 {
    width: 80% !important;
  }
  .sm\:w-5\/6 {
    width: 83.33333333% !important;
  }
  .sm\:w-9\/10 {
    width: 90% !important;
  }
  .sm\:w-11\/12 {
    width: 91.66666667% !important;
  }
  .sm\:w-full {
    width: 100% !important;
  }
}

@media (min-width: 45em) {
  .md\:w-auto {
    width: auto !important;
  }
  .md\:w-1\/12 {
    width: 8.33333333% !important;
  }
  .md\:w-1\/10 {
    width: 10% !important;
  }
  .md\:w-1\/6 {
    width: 16.66666667% !important;
  }
  .md\:w-1\/5 {
    width: 20% !important;
  }
  .md\:w-1\/4 {
    width: 25% !important;
  }
  .md\:w-3\/10 {
    width: 30% !important;
  }
  .md\:w-1\/3 {
    width: 33.33333333% !important;
  }
  .md\:w-2\/5 {
    width: 40% !important;
  }
  .md\:w-5\/12 {
    width: 41.66666667% !important;
  }
  .md\:w-1\/2 {
    width: 50% !important;
  }
  .md\:w-7\/12 {
    width: 58.33333333% !important;
  }
  .md\:w-3\/5 {
    width: 60% !important;
  }
  .md\:w-2\/3 {
    width: 66.66666667% !important;
  }
  .md\:w-7\/10 {
    width: 70% !important;
  }
  .md\:w-3\/4 {
    width: 75% !important;
  }
  .md\:w-4\/5 {
    width: 80% !important;
  }
  .md\:w-5\/6 {
    width: 83.33333333% !important;
  }
  .md\:w-9\/10 {
    width: 90% !important;
  }
  .md\:w-11\/12 {
    width: 91.66666667% !important;
  }
  .md\:w-full {
    width: 100% !important;
  }
}

@media (min-width: 50.625em) {
  .mdf\:w-auto {
    width: auto !important;
  }
  .mdf\:w-1\/12 {
    width: 8.33333333% !important;
  }
  .mdf\:w-1\/10 {
    width: 10% !important;
  }
  .mdf\:w-1\/6 {
    width: 16.66666667% !important;
  }
  .mdf\:w-1\/5 {
    width: 20% !important;
  }
  .mdf\:w-1\/4 {
    width: 25% !important;
  }
  .mdf\:w-3\/10 {
    width: 30% !important;
  }
  .mdf\:w-1\/3 {
    width: 33.33333333% !important;
  }
  .mdf\:w-2\/5 {
    width: 40% !important;
  }
  .mdf\:w-5\/12 {
    width: 41.66666667% !important;
  }
  .mdf\:w-1\/2 {
    width: 50% !important;
  }
  .mdf\:w-7\/12 {
    width: 58.33333333% !important;
  }
  .mdf\:w-3\/5 {
    width: 60% !important;
  }
  .mdf\:w-2\/3 {
    width: 66.66666667% !important;
  }
  .mdf\:w-7\/10 {
    width: 70% !important;
  }
  .mdf\:w-3\/4 {
    width: 75% !important;
  }
  .mdf\:w-4\/5 {
    width: 80% !important;
  }
  .mdf\:w-5\/6 {
    width: 83.33333333% !important;
  }
  .mdf\:w-9\/10 {
    width: 90% !important;
  }
  .mdf\:w-11\/12 {
    width: 91.66666667% !important;
  }
  .mdf\:w-full {
    width: 100% !important;
  }
}

@media (min-width: 60em) {
  .lg\:w-auto {
    width: auto !important;
  }
  .lg\:w-1\/12 {
    width: 8.33333333% !important;
  }
  .lg\:w-1\/10 {
    width: 10% !important;
  }
  .lg\:w-1\/6 {
    width: 16.66666667% !important;
  }
  .lg\:w-1\/5 {
    width: 20% !important;
  }
  .lg\:w-1\/4 {
    width: 25% !important;
  }
  .lg\:w-3\/10 {
    width: 30% !important;
  }
  .lg\:w-1\/3 {
    width: 33.33333333% !important;
  }
  .lg\:w-2\/5 {
    width: 40% !important;
  }
  .lg\:w-5\/12 {
    width: 41.66666667% !important;
  }
  .lg\:w-1\/2 {
    width: 50% !important;
  }
  .lg\:w-7\/12 {
    width: 58.33333333% !important;
  }
  .lg\:w-3\/5 {
    width: 60% !important;
  }
  .lg\:w-2\/3 {
    width: 66.66666667% !important;
  }
  .lg\:w-7\/10 {
    width: 70% !important;
  }
  .lg\:w-3\/4 {
    width: 75% !important;
  }
  .lg\:w-4\/5 {
    width: 80% !important;
  }
  .lg\:w-5\/6 {
    width: 83.33333333% !important;
  }
  .lg\:w-9\/10 {
    width: 90% !important;
  }
  .lg\:w-11\/12 {
    width: 91.66666667% !important;
  }
  .lg\:w-full {
    width: 100% !important;
  }
}

@media (min-width: 68.75em) {
  .xl\:w-auto {
    width: auto !important;
  }
  .xl\:w-1\/12 {
    width: 8.33333333% !important;
  }
  .xl\:w-1\/10 {
    width: 10% !important;
  }
  .xl\:w-1\/6 {
    width: 16.66666667% !important;
  }
  .xl\:w-1\/5 {
    width: 20% !important;
  }
  .xl\:w-1\/4 {
    width: 25% !important;
  }
  .xl\:w-3\/10 {
    width: 30% !important;
  }
  .xl\:w-1\/3 {
    width: 33.33333333% !important;
  }
  .xl\:w-2\/5 {
    width: 40% !important;
  }
  .xl\:w-5\/12 {
    width: 41.66666667% !important;
  }
  .xl\:w-1\/2 {
    width: 50% !important;
  }
  .xl\:w-7\/12 {
    width: 58.33333333% !important;
  }
  .xl\:w-3\/5 {
    width: 60% !important;
  }
  .xl\:w-2\/3 {
    width: 66.66666667% !important;
  }
  .xl\:w-7\/10 {
    width: 70% !important;
  }
  .xl\:w-3\/4 {
    width: 75% !important;
  }
  .xl\:w-4\/5 {
    width: 80% !important;
  }
  .xl\:w-5\/6 {
    width: 83.33333333% !important;
  }
  .xl\:w-9\/10 {
    width: 90% !important;
  }
  .xl\:w-11\/12 {
    width: 91.66666667% !important;
  }
  .xl\:w-full {
    width: 100% !important;
  }
}

@media (min-width: 81.25em) {
  .xxl\:w-auto {
    width: auto !important;
  }
  .xxl\:w-1\/12 {
    width: 8.33333333% !important;
  }
  .xxl\:w-1\/10 {
    width: 10% !important;
  }
  .xxl\:w-1\/6 {
    width: 16.66666667% !important;
  }
  .xxl\:w-1\/5 {
    width: 20% !important;
  }
  .xxl\:w-1\/4 {
    width: 25% !important;
  }
  .xxl\:w-3\/10 {
    width: 30% !important;
  }
  .xxl\:w-1\/3 {
    width: 33.33333333% !important;
  }
  .xxl\:w-2\/5 {
    width: 40% !important;
  }
  .xxl\:w-5\/12 {
    width: 41.66666667% !important;
  }
  .xxl\:w-1\/2 {
    width: 50% !important;
  }
  .xxl\:w-7\/12 {
    width: 58.33333333% !important;
  }
  .xxl\:w-3\/5 {
    width: 60% !important;
  }
  .xxl\:w-2\/3 {
    width: 66.66666667% !important;
  }
  .xxl\:w-7\/10 {
    width: 70% !important;
  }
  .xxl\:w-3\/4 {
    width: 75% !important;
  }
  .xxl\:w-4\/5 {
    width: 80% !important;
  }
  .xxl\:w-5\/6 {
    width: 83.33333333% !important;
  }
  .xxl\:w-9\/10 {
    width: 90% !important;
  }
  .xxl\:w-11\/12 {
    width: 91.66666667% !important;
  }
  .xxl\:w-full {
    width: 100% !important;
  }
}

@media (min-width: 82.625em) {
  .xxl-e\:w-auto {
    width: auto !important;
  }
  .xxl-e\:w-1\/12 {
    width: 8.33333333% !important;
  }
  .xxl-e\:w-1\/10 {
    width: 10% !important;
  }
  .xxl-e\:w-1\/6 {
    width: 16.66666667% !important;
  }
  .xxl-e\:w-1\/5 {
    width: 20% !important;
  }
  .xxl-e\:w-1\/4 {
    width: 25% !important;
  }
  .xxl-e\:w-3\/10 {
    width: 30% !important;
  }
  .xxl-e\:w-1\/3 {
    width: 33.33333333% !important;
  }
  .xxl-e\:w-2\/5 {
    width: 40% !important;
  }
  .xxl-e\:w-5\/12 {
    width: 41.66666667% !important;
  }
  .xxl-e\:w-1\/2 {
    width: 50% !important;
  }
  .xxl-e\:w-7\/12 {
    width: 58.33333333% !important;
  }
  .xxl-e\:w-3\/5 {
    width: 60% !important;
  }
  .xxl-e\:w-2\/3 {
    width: 66.66666667% !important;
  }
  .xxl-e\:w-7\/10 {
    width: 70% !important;
  }
  .xxl-e\:w-3\/4 {
    width: 75% !important;
  }
  .xxl-e\:w-4\/5 {
    width: 80% !important;
  }
  .xxl-e\:w-5\/6 {
    width: 83.33333333% !important;
  }
  .xxl-e\:w-9\/10 {
    width: 90% !important;
  }
  .xxl-e\:w-11\/12 {
    width: 91.66666667% !important;
  }
  .xxl-e\:w-full {
    width: 100% !important;
  }
}

@media (min-width: 100em) {
  .xxxl\:w-auto {
    width: auto !important;
  }
  .xxxl\:w-1\/12 {
    width: 8.33333333% !important;
  }
  .xxxl\:w-1\/10 {
    width: 10% !important;
  }
  .xxxl\:w-1\/6 {
    width: 16.66666667% !important;
  }
  .xxxl\:w-1\/5 {
    width: 20% !important;
  }
  .xxxl\:w-1\/4 {
    width: 25% !important;
  }
  .xxxl\:w-3\/10 {
    width: 30% !important;
  }
  .xxxl\:w-1\/3 {
    width: 33.33333333% !important;
  }
  .xxxl\:w-2\/5 {
    width: 40% !important;
  }
  .xxxl\:w-5\/12 {
    width: 41.66666667% !important;
  }
  .xxxl\:w-1\/2 {
    width: 50% !important;
  }
  .xxxl\:w-7\/12 {
    width: 58.33333333% !important;
  }
  .xxxl\:w-3\/5 {
    width: 60% !important;
  }
  .xxxl\:w-2\/3 {
    width: 66.66666667% !important;
  }
  .xxxl\:w-7\/10 {
    width: 70% !important;
  }
  .xxxl\:w-3\/4 {
    width: 75% !important;
  }
  .xxxl\:w-4\/5 {
    width: 80% !important;
  }
  .xxxl\:w-5\/6 {
    width: 83.33333333% !important;
  }
  .xxxl\:w-9\/10 {
    width: 90% !important;
  }
  .xxxl\:w-11\/12 {
    width: 91.66666667% !important;
  }
  .xxxl\:w-full {
    width: 100% !important;
  }
}

/*
================================================================================
Alignment
================================================================================
*/
.text-center {
  text-align: center !important;
}

.text-left {
  text-align: left !important;
}

.text-right {
  text-align: right !important;
}

/*
================================================================================
Color
================================================================================
*/
.color-transparent {
  color: transparent !important;
}

.color-primary {
  color: #BA0000 !important;
}

.color-black {
  color: #000 !important;
}

.color-white {
  color: #fff !important;
}

.color-link {
  color: #39c !important;
}

.color-gray-10 {
  color: #f9fafa !important;
}

.color-gray-20 {
  color: #f0f2f3 !important;
}

.color-gray-30 {
  color: #e7e9ec !important;
}

.color-gray-40 {
  color: #d6dadd !important;
}

.color-gray-50 {
  color: #adb5bd !important;
}

.color-gray-60 {
  color: #8a96a1 !important;
}

.color-gray-70 {
  color: #5f6b78 !important;
}

.color-gray-80 {
  color: #3a4148 !important;
}

.color-gray-90 {
  color: #202428 !important;
}

.color-blue-10 {
  color: #ebf5fa !important;
}

.color-blue-20 {
  color: #d1e8f3 !important;
}

.color-blue-30 {
  color: #9acde6 !important;
}

.color-blue-40 {
  color: #67b3d9 !important;
}

.color-blue-50 {
  color: #39c !important;
}

.color-blue-60 {
  color: #2d86b3 !important;
}

.color-blue-70 {
  color: #246b8e !important;
}

.color-blue-80 {
  color: #154258 !important;
}

.color-blue-90 {
  color: #0f2e3d !important;
}

.color-info {
  color: #2d86b3 !important;
}

.color-info-light {
  color: #d1e8f3 !important;
}

.color-info-text {
  color: #154258 !important;
}

.color-success {
  color: #20c372 !important;
}

.color-success-light {
  color: #b6f3d5 !important;
}

.color-success-text {
  color: #126b3f !important;
}

.color-danger {
  color: #d03a40 !important;
}

.color-danger-light {
  color: #f3cecf !important;
}

.color-danger-text {
  color: #a1262b !important;
}

.color-warning {
  color: #ffca34 !important;
}

.color-warning-light {
  color: #fff2cc !important;
}

.color-warning-text {
  color: #7b5b00 !important;
}

.color-db {
  color: #50ab87 !important;
}

.color-text {
  color: #3a4148 !important;
}

.color-link-focus {
  color: #246b8e !important;
}

@media (min-width: 37.5em) {
  .sm\:color-transparent {
    color: transparent !important;
  }
  .sm\:color-primary {
    color: #BA0000 !important;
  }
  .sm\:color-black {
    color: #000 !important;
  }
  .sm\:color-white {
    color: #fff !important;
  }
  .sm\:color-link {
    color: #39c !important;
  }
  .sm\:color-gray-10 {
    color: #f9fafa !important;
  }
  .sm\:color-gray-20 {
    color: #f0f2f3 !important;
  }
  .sm\:color-gray-30 {
    color: #e7e9ec !important;
  }
  .sm\:color-gray-40 {
    color: #d6dadd !important;
  }
  .sm\:color-gray-50 {
    color: #adb5bd !important;
  }
  .sm\:color-gray-60 {
    color: #8a96a1 !important;
  }
  .sm\:color-gray-70 {
    color: #5f6b78 !important;
  }
  .sm\:color-gray-80 {
    color: #3a4148 !important;
  }
  .sm\:color-gray-90 {
    color: #202428 !important;
  }
  .sm\:color-blue-10 {
    color: #ebf5fa !important;
  }
  .sm\:color-blue-20 {
    color: #d1e8f3 !important;
  }
  .sm\:color-blue-30 {
    color: #9acde6 !important;
  }
  .sm\:color-blue-40 {
    color: #67b3d9 !important;
  }
  .sm\:color-blue-50 {
    color: #39c !important;
  }
  .sm\:color-blue-60 {
    color: #2d86b3 !important;
  }
  .sm\:color-blue-70 {
    color: #246b8e !important;
  }
  .sm\:color-blue-80 {
    color: #154258 !important;
  }
  .sm\:color-blue-90 {
    color: #0f2e3d !important;
  }
  .sm\:color-info {
    color: #2d86b3 !important;
  }
  .sm\:color-info-light {
    color: #d1e8f3 !important;
  }
  .sm\:color-info-text {
    color: #154258 !important;
  }
  .sm\:color-success {
    color: #20c372 !important;
  }
  .sm\:color-success-light {
    color: #b6f3d5 !important;
  }
  .sm\:color-success-text {
    color: #126b3f !important;
  }
  .sm\:color-danger {
    color: #d03a40 !important;
  }
  .sm\:color-danger-light {
    color: #f3cecf !important;
  }
  .sm\:color-danger-text {
    color: #a1262b !important;
  }
  .sm\:color-warning {
    color: #ffca34 !important;
  }
  .sm\:color-warning-light {
    color: #fff2cc !important;
  }
  .sm\:color-warning-text {
    color: #7b5b00 !important;
  }
  .sm\:color-db {
    color: #50ab87 !important;
  }
  .sm\:color-text {
    color: #3a4148 !important;
  }
  .sm\:color-link-focus {
    color: #246b8e !important;
  }
}

@media (min-width: 45em) {
  .md\:color-transparent {
    color: transparent !important;
  }
  .md\:color-primary {
    color: #BA0000 !important;
  }
  .md\:color-black {
    color: #000 !important;
  }
  .md\:color-white {
    color: #fff !important;
  }
  .md\:color-link {
    color: #39c !important;
  }
  .md\:color-gray-10 {
    color: #f9fafa !important;
  }
  .md\:color-gray-20 {
    color: #f0f2f3 !important;
  }
  .md\:color-gray-30 {
    color: #e7e9ec !important;
  }
  .md\:color-gray-40 {
    color: #d6dadd !important;
  }
  .md\:color-gray-50 {
    color: #adb5bd !important;
  }
  .md\:color-gray-60 {
    color: #8a96a1 !important;
  }
  .md\:color-gray-70 {
    color: #5f6b78 !important;
  }
  .md\:color-gray-80 {
    color: #3a4148 !important;
  }
  .md\:color-gray-90 {
    color: #202428 !important;
  }
  .md\:color-blue-10 {
    color: #ebf5fa !important;
  }
  .md\:color-blue-20 {
    color: #d1e8f3 !important;
  }
  .md\:color-blue-30 {
    color: #9acde6 !important;
  }
  .md\:color-blue-40 {
    color: #67b3d9 !important;
  }
  .md\:color-blue-50 {
    color: #39c !important;
  }
  .md\:color-blue-60 {
    color: #2d86b3 !important;
  }
  .md\:color-blue-70 {
    color: #246b8e !important;
  }
  .md\:color-blue-80 {
    color: #154258 !important;
  }
  .md\:color-blue-90 {
    color: #0f2e3d !important;
  }
  .md\:color-info {
    color: #2d86b3 !important;
  }
  .md\:color-info-light {
    color: #d1e8f3 !important;
  }
  .md\:color-info-text {
    color: #154258 !important;
  }
  .md\:color-success {
    color: #20c372 !important;
  }
  .md\:color-success-light {
    color: #b6f3d5 !important;
  }
  .md\:color-success-text {
    color: #126b3f !important;
  }
  .md\:color-danger {
    color: #d03a40 !important;
  }
  .md\:color-danger-light {
    color: #f3cecf !important;
  }
  .md\:color-danger-text {
    color: #a1262b !important;
  }
  .md\:color-warning {
    color: #ffca34 !important;
  }
  .md\:color-warning-light {
    color: #fff2cc !important;
  }
  .md\:color-warning-text {
    color: #7b5b00 !important;
  }
  .md\:color-db {
    color: #50ab87 !important;
  }
  .md\:color-text {
    color: #3a4148 !important;
  }
  .md\:color-link-focus {
    color: #246b8e !important;
  }
}

@media (min-width: 50.625em) {
  .mdf\:color-transparent {
    color: transparent !important;
  }
  .mdf\:color-primary {
    color: #BA0000 !important;
  }
  .mdf\:color-black {
    color: #000 !important;
  }
  .mdf\:color-white {
    color: #fff !important;
  }
  .mdf\:color-link {
    color: #39c !important;
  }
  .mdf\:color-gray-10 {
    color: #f9fafa !important;
  }
  .mdf\:color-gray-20 {
    color: #f0f2f3 !important;
  }
  .mdf\:color-gray-30 {
    color: #e7e9ec !important;
  }
  .mdf\:color-gray-40 {
    color: #d6dadd !important;
  }
  .mdf\:color-gray-50 {
    color: #adb5bd !important;
  }
  .mdf\:color-gray-60 {
    color: #8a96a1 !important;
  }
  .mdf\:color-gray-70 {
    color: #5f6b78 !important;
  }
  .mdf\:color-gray-80 {
    color: #3a4148 !important;
  }
  .mdf\:color-gray-90 {
    color: #202428 !important;
  }
  .mdf\:color-blue-10 {
    color: #ebf5fa !important;
  }
  .mdf\:color-blue-20 {
    color: #d1e8f3 !important;
  }
  .mdf\:color-blue-30 {
    color: #9acde6 !important;
  }
  .mdf\:color-blue-40 {
    color: #67b3d9 !important;
  }
  .mdf\:color-blue-50 {
    color: #39c !important;
  }
  .mdf\:color-blue-60 {
    color: #2d86b3 !important;
  }
  .mdf\:color-blue-70 {
    color: #246b8e !important;
  }
  .mdf\:color-blue-80 {
    color: #154258 !important;
  }
  .mdf\:color-blue-90 {
    color: #0f2e3d !important;
  }
  .mdf\:color-info {
    color: #2d86b3 !important;
  }
  .mdf\:color-info-light {
    color: #d1e8f3 !important;
  }
  .mdf\:color-info-text {
    color: #154258 !important;
  }
  .mdf\:color-success {
    color: #20c372 !important;
  }
  .mdf\:color-success-light {
    color: #b6f3d5 !important;
  }
  .mdf\:color-success-text {
    color: #126b3f !important;
  }
  .mdf\:color-danger {
    color: #d03a40 !important;
  }
  .mdf\:color-danger-light {
    color: #f3cecf !important;
  }
  .mdf\:color-danger-text {
    color: #a1262b !important;
  }
  .mdf\:color-warning {
    color: #ffca34 !important;
  }
  .mdf\:color-warning-light {
    color: #fff2cc !important;
  }
  .mdf\:color-warning-text {
    color: #7b5b00 !important;
  }
  .mdf\:color-db {
    color: #50ab87 !important;
  }
  .mdf\:color-text {
    color: #3a4148 !important;
  }
  .mdf\:color-link-focus {
    color: #246b8e !important;
  }
}

@media (min-width: 60em) {
  .lg\:color-transparent {
    color: transparent !important;
  }
  .lg\:color-primary {
    color: #BA0000 !important;
  }
  .lg\:color-black {
    color: #000 !important;
  }
  .lg\:color-white {
    color: #fff !important;
  }
  .lg\:color-link {
    color: #39c !important;
  }
  .lg\:color-gray-10 {
    color: #f9fafa !important;
  }
  .lg\:color-gray-20 {
    color: #f0f2f3 !important;
  }
  .lg\:color-gray-30 {
    color: #e7e9ec !important;
  }
  .lg\:color-gray-40 {
    color: #d6dadd !important;
  }
  .lg\:color-gray-50 {
    color: #adb5bd !important;
  }
  .lg\:color-gray-60 {
    color: #8a96a1 !important;
  }
  .lg\:color-gray-70 {
    color: #5f6b78 !important;
  }
  .lg\:color-gray-80 {
    color: #3a4148 !important;
  }
  .lg\:color-gray-90 {
    color: #202428 !important;
  }
  .lg\:color-blue-10 {
    color: #ebf5fa !important;
  }
  .lg\:color-blue-20 {
    color: #d1e8f3 !important;
  }
  .lg\:color-blue-30 {
    color: #9acde6 !important;
  }
  .lg\:color-blue-40 {
    color: #67b3d9 !important;
  }
  .lg\:color-blue-50 {
    color: #39c !important;
  }
  .lg\:color-blue-60 {
    color: #2d86b3 !important;
  }
  .lg\:color-blue-70 {
    color: #246b8e !important;
  }
  .lg\:color-blue-80 {
    color: #154258 !important;
  }
  .lg\:color-blue-90 {
    color: #0f2e3d !important;
  }
  .lg\:color-info {
    color: #2d86b3 !important;
  }
  .lg\:color-info-light {
    color: #d1e8f3 !important;
  }
  .lg\:color-info-text {
    color: #154258 !important;
  }
  .lg\:color-success {
    color: #20c372 !important;
  }
  .lg\:color-success-light {
    color: #b6f3d5 !important;
  }
  .lg\:color-success-text {
    color: #126b3f !important;
  }
  .lg\:color-danger {
    color: #d03a40 !important;
  }
  .lg\:color-danger-light {
    color: #f3cecf !important;
  }
  .lg\:color-danger-text {
    color: #a1262b !important;
  }
  .lg\:color-warning {
    color: #ffca34 !important;
  }
  .lg\:color-warning-light {
    color: #fff2cc !important;
  }
  .lg\:color-warning-text {
    color: #7b5b00 !important;
  }
  .lg\:color-db {
    color: #50ab87 !important;
  }
  .lg\:color-text {
    color: #3a4148 !important;
  }
  .lg\:color-link-focus {
    color: #246b8e !important;
  }
}

@media (min-width: 68.75em) {
  .xl\:color-transparent {
    color: transparent !important;
  }
  .xl\:color-primary {
    color: #BA0000 !important;
  }
  .xl\:color-black {
    color: #000 !important;
  }
  .xl\:color-white {
    color: #fff !important;
  }
  .xl\:color-link {
    color: #39c !important;
  }
  .xl\:color-gray-10 {
    color: #f9fafa !important;
  }
  .xl\:color-gray-20 {
    color: #f0f2f3 !important;
  }
  .xl\:color-gray-30 {
    color: #e7e9ec !important;
  }
  .xl\:color-gray-40 {
    color: #d6dadd !important;
  }
  .xl\:color-gray-50 {
    color: #adb5bd !important;
  }
  .xl\:color-gray-60 {
    color: #8a96a1 !important;
  }
  .xl\:color-gray-70 {
    color: #5f6b78 !important;
  }
  .xl\:color-gray-80 {
    color: #3a4148 !important;
  }
  .xl\:color-gray-90 {
    color: #202428 !important;
  }
  .xl\:color-blue-10 {
    color: #ebf5fa !important;
  }
  .xl\:color-blue-20 {
    color: #d1e8f3 !important;
  }
  .xl\:color-blue-30 {
    color: #9acde6 !important;
  }
  .xl\:color-blue-40 {
    color: #67b3d9 !important;
  }
  .xl\:color-blue-50 {
    color: #39c !important;
  }
  .xl\:color-blue-60 {
    color: #2d86b3 !important;
  }
  .xl\:color-blue-70 {
    color: #246b8e !important;
  }
  .xl\:color-blue-80 {
    color: #154258 !important;
  }
  .xl\:color-blue-90 {
    color: #0f2e3d !important;
  }
  .xl\:color-info {
    color: #2d86b3 !important;
  }
  .xl\:color-info-light {
    color: #d1e8f3 !important;
  }
  .xl\:color-info-text {
    color: #154258 !important;
  }
  .xl\:color-success {
    color: #20c372 !important;
  }
  .xl\:color-success-light {
    color: #b6f3d5 !important;
  }
  .xl\:color-success-text {
    color: #126b3f !important;
  }
  .xl\:color-danger {
    color: #d03a40 !important;
  }
  .xl\:color-danger-light {
    color: #f3cecf !important;
  }
  .xl\:color-danger-text {
    color: #a1262b !important;
  }
  .xl\:color-warning {
    color: #ffca34 !important;
  }
  .xl\:color-warning-light {
    color: #fff2cc !important;
  }
  .xl\:color-warning-text {
    color: #7b5b00 !important;
  }
  .xl\:color-db {
    color: #50ab87 !important;
  }
  .xl\:color-text {
    color: #3a4148 !important;
  }
  .xl\:color-link-focus {
    color: #246b8e !important;
  }
}

@media (min-width: 81.25em) {
  .xxl\:color-transparent {
    color: transparent !important;
  }
  .xxl\:color-primary {
    color: #BA0000 !important;
  }
  .xxl\:color-black {
    color: #000 !important;
  }
  .xxl\:color-white {
    color: #fff !important;
  }
  .xxl\:color-link {
    color: #39c !important;
  }
  .xxl\:color-gray-10 {
    color: #f9fafa !important;
  }
  .xxl\:color-gray-20 {
    color: #f0f2f3 !important;
  }
  .xxl\:color-gray-30 {
    color: #e7e9ec !important;
  }
  .xxl\:color-gray-40 {
    color: #d6dadd !important;
  }
  .xxl\:color-gray-50 {
    color: #adb5bd !important;
  }
  .xxl\:color-gray-60 {
    color: #8a96a1 !important;
  }
  .xxl\:color-gray-70 {
    color: #5f6b78 !important;
  }
  .xxl\:color-gray-80 {
    color: #3a4148 !important;
  }
  .xxl\:color-gray-90 {
    color: #202428 !important;
  }
  .xxl\:color-blue-10 {
    color: #ebf5fa !important;
  }
  .xxl\:color-blue-20 {
    color: #d1e8f3 !important;
  }
  .xxl\:color-blue-30 {
    color: #9acde6 !important;
  }
  .xxl\:color-blue-40 {
    color: #67b3d9 !important;
  }
  .xxl\:color-blue-50 {
    color: #39c !important;
  }
  .xxl\:color-blue-60 {
    color: #2d86b3 !important;
  }
  .xxl\:color-blue-70 {
    color: #246b8e !important;
  }
  .xxl\:color-blue-80 {
    color: #154258 !important;
  }
  .xxl\:color-blue-90 {
    color: #0f2e3d !important;
  }
  .xxl\:color-info {
    color: #2d86b3 !important;
  }
  .xxl\:color-info-light {
    color: #d1e8f3 !important;
  }
  .xxl\:color-info-text {
    color: #154258 !important;
  }
  .xxl\:color-success {
    color: #20c372 !important;
  }
  .xxl\:color-success-light {
    color: #b6f3d5 !important;
  }
  .xxl\:color-success-text {
    color: #126b3f !important;
  }
  .xxl\:color-danger {
    color: #d03a40 !important;
  }
  .xxl\:color-danger-light {
    color: #f3cecf !important;
  }
  .xxl\:color-danger-text {
    color: #a1262b !important;
  }
  .xxl\:color-warning {
    color: #ffca34 !important;
  }
  .xxl\:color-warning-light {
    color: #fff2cc !important;
  }
  .xxl\:color-warning-text {
    color: #7b5b00 !important;
  }
  .xxl\:color-db {
    color: #50ab87 !important;
  }
  .xxl\:color-text {
    color: #3a4148 !important;
  }
  .xxl\:color-link-focus {
    color: #246b8e !important;
  }
}

@media (min-width: 82.625em) {
  .xxl-e\:color-transparent {
    color: transparent !important;
  }
  .xxl-e\:color-primary {
    color: #BA0000 !important;
  }
  .xxl-e\:color-black {
    color: #000 !important;
  }
  .xxl-e\:color-white {
    color: #fff !important;
  }
  .xxl-e\:color-link {
    color: #39c !important;
  }
  .xxl-e\:color-gray-10 {
    color: #f9fafa !important;
  }
  .xxl-e\:color-gray-20 {
    color: #f0f2f3 !important;
  }
  .xxl-e\:color-gray-30 {
    color: #e7e9ec !important;
  }
  .xxl-e\:color-gray-40 {
    color: #d6dadd !important;
  }
  .xxl-e\:color-gray-50 {
    color: #adb5bd !important;
  }
  .xxl-e\:color-gray-60 {
    color: #8a96a1 !important;
  }
  .xxl-e\:color-gray-70 {
    color: #5f6b78 !important;
  }
  .xxl-e\:color-gray-80 {
    color: #3a4148 !important;
  }
  .xxl-e\:color-gray-90 {
    color: #202428 !important;
  }
  .xxl-e\:color-blue-10 {
    color: #ebf5fa !important;
  }
  .xxl-e\:color-blue-20 {
    color: #d1e8f3 !important;
  }
  .xxl-e\:color-blue-30 {
    color: #9acde6 !important;
  }
  .xxl-e\:color-blue-40 {
    color: #67b3d9 !important;
  }
  .xxl-e\:color-blue-50 {
    color: #39c !important;
  }
  .xxl-e\:color-blue-60 {
    color: #2d86b3 !important;
  }
  .xxl-e\:color-blue-70 {
    color: #246b8e !important;
  }
  .xxl-e\:color-blue-80 {
    color: #154258 !important;
  }
  .xxl-e\:color-blue-90 {
    color: #0f2e3d !important;
  }
  .xxl-e\:color-info {
    color: #2d86b3 !important;
  }
  .xxl-e\:color-info-light {
    color: #d1e8f3 !important;
  }
  .xxl-e\:color-info-text {
    color: #154258 !important;
  }
  .xxl-e\:color-success {
    color: #20c372 !important;
  }
  .xxl-e\:color-success-light {
    color: #b6f3d5 !important;
  }
  .xxl-e\:color-success-text {
    color: #126b3f !important;
  }
  .xxl-e\:color-danger {
    color: #d03a40 !important;
  }
  .xxl-e\:color-danger-light {
    color: #f3cecf !important;
  }
  .xxl-e\:color-danger-text {
    color: #a1262b !important;
  }
  .xxl-e\:color-warning {
    color: #ffca34 !important;
  }
  .xxl-e\:color-warning-light {
    color: #fff2cc !important;
  }
  .xxl-e\:color-warning-text {
    color: #7b5b00 !important;
  }
  .xxl-e\:color-db {
    color: #50ab87 !important;
  }
  .xxl-e\:color-text {
    color: #3a4148 !important;
  }
  .xxl-e\:color-link-focus {
    color: #246b8e !important;
  }
}

@media (min-width: 100em) {
  .xxxl\:color-transparent {
    color: transparent !important;
  }
  .xxxl\:color-primary {
    color: #BA0000 !important;
  }
  .xxxl\:color-black {
    color: #000 !important;
  }
  .xxxl\:color-white {
    color: #fff !important;
  }
  .xxxl\:color-link {
    color: #39c !important;
  }
  .xxxl\:color-gray-10 {
    color: #f9fafa !important;
  }
  .xxxl\:color-gray-20 {
    color: #f0f2f3 !important;
  }
  .xxxl\:color-gray-30 {
    color: #e7e9ec !important;
  }
  .xxxl\:color-gray-40 {
    color: #d6dadd !important;
  }
  .xxxl\:color-gray-50 {
    color: #adb5bd !important;
  }
  .xxxl\:color-gray-60 {
    color: #8a96a1 !important;
  }
  .xxxl\:color-gray-70 {
    color: #5f6b78 !important;
  }
  .xxxl\:color-gray-80 {
    color: #3a4148 !important;
  }
  .xxxl\:color-gray-90 {
    color: #202428 !important;
  }
  .xxxl\:color-blue-10 {
    color: #ebf5fa !important;
  }
  .xxxl\:color-blue-20 {
    color: #d1e8f3 !important;
  }
  .xxxl\:color-blue-30 {
    color: #9acde6 !important;
  }
  .xxxl\:color-blue-40 {
    color: #67b3d9 !important;
  }
  .xxxl\:color-blue-50 {
    color: #39c !important;
  }
  .xxxl\:color-blue-60 {
    color: #2d86b3 !important;
  }
  .xxxl\:color-blue-70 {
    color: #246b8e !important;
  }
  .xxxl\:color-blue-80 {
    color: #154258 !important;
  }
  .xxxl\:color-blue-90 {
    color: #0f2e3d !important;
  }
  .xxxl\:color-info {
    color: #2d86b3 !important;
  }
  .xxxl\:color-info-light {
    color: #d1e8f3 !important;
  }
  .xxxl\:color-info-text {
    color: #154258 !important;
  }
  .xxxl\:color-success {
    color: #20c372 !important;
  }
  .xxxl\:color-success-light {
    color: #b6f3d5 !important;
  }
  .xxxl\:color-success-text {
    color: #126b3f !important;
  }
  .xxxl\:color-danger {
    color: #d03a40 !important;
  }
  .xxxl\:color-danger-light {
    color: #f3cecf !important;
  }
  .xxxl\:color-danger-text {
    color: #a1262b !important;
  }
  .xxxl\:color-warning {
    color: #ffca34 !important;
  }
  .xxxl\:color-warning-light {
    color: #fff2cc !important;
  }
  .xxxl\:color-warning-text {
    color: #7b5b00 !important;
  }
  .xxxl\:color-db {
    color: #50ab87 !important;
  }
  .xxxl\:color-text {
    color: #3a4148 !important;
  }
  .xxxl\:color-link-focus {
    color: #246b8e !important;
  }
}

/*
================================================================================
Leading
================================================================================
*/
.leading-none {
  line-height: 1 !important;
}

.leading-tight {
  line-height: 1.2 !important;
}

.leading-normal {
  line-height: 1.6 !important;
}

.leading-loose {
  line-height: 2 !important;
}

/*
================================================================================
Size
================================================================================
*/
.size-base {
  font-size: 16px !important;
}

.size-xs {
  font-size: 65% !important;
}

.size-sm {
  font-size: 80% !important;
}

.size-caption {
  font-size: 90% !important;
}

.size-normal {
  font-size: 100% !important;
}

.size-lg {
  font-size: 112% !important;
}

.size-xl {
  font-size: 125% !important;
}

/*
================================================================================
Ellipsis
================================================================================
*/
/*
         * Truncate long text with an ellipsis.
         */
.truncate {
  overflow: hidden !important;
  text-overflow: ellipsis !important;
  white-space: nowrap !important;
}

/*
         * Reset the properties of the `truncate` class to default values.
         */
.truncate-none {
  overflow: visible !important;
  text-overflow: clip !important;
  white-space: normal !important;
}

@media (min-width: 37.5em) {
  /*
         * Truncate long text with an ellipsis.
         */
  .sm\:truncate {
    overflow: hidden !important;
    text-overflow: ellipsis !important;
    white-space: nowrap !important;
  }
  /*
         * Reset the properties of the `truncate` class to default values.
         */
  .sm\:truncate-none {
    overflow: visible !important;
    text-overflow: clip !important;
    white-space: normal !important;
  }
}

@media (min-width: 45em) {
  /*
         * Truncate long text with an ellipsis.
         */
  .md\:truncate {
    overflow: hidden !important;
    text-overflow: ellipsis !important;
    white-space: nowrap !important;
  }
  /*
         * Reset the properties of the `truncate` class to default values.
         */
  .md\:truncate-none {
    overflow: visible !important;
    text-overflow: clip !important;
    white-space: normal !important;
  }
}

@media (min-width: 50.625em) {
  /*
         * Truncate long text with an ellipsis.
         */
  .mdf\:truncate {
    overflow: hidden !important;
    text-overflow: ellipsis !important;
    white-space: nowrap !important;
  }
  /*
         * Reset the properties of the `truncate` class to default values.
         */
  .mdf\:truncate-none {
    overflow: visible !important;
    text-overflow: clip !important;
    white-space: normal !important;
  }
}

@media (min-width: 60em) {
  /*
         * Truncate long text with an ellipsis.
         */
  .lg\:truncate {
    overflow: hidden !important;
    text-overflow: ellipsis !important;
    white-space: nowrap !important;
  }
  /*
         * Reset the properties of the `truncate` class to default values.
         */
  .lg\:truncate-none {
    overflow: visible !important;
    text-overflow: clip !important;
    white-space: normal !important;
  }
}

@media (min-width: 68.75em) {
  /*
         * Truncate long text with an ellipsis.
         */
  .xl\:truncate {
    overflow: hidden !important;
    text-overflow: ellipsis !important;
    white-space: nowrap !important;
  }
  /*
         * Reset the properties of the `truncate` class to default values.
         */
  .xl\:truncate-none {
    overflow: visible !important;
    text-overflow: clip !important;
    white-space: normal !important;
  }
}

@media (min-width: 81.25em) {
  /*
         * Truncate long text with an ellipsis.
         */
  .xxl\:truncate {
    overflow: hidden !important;
    text-overflow: ellipsis !important;
    white-space: nowrap !important;
  }
  /*
         * Reset the properties of the `truncate` class to default values.
         */
  .xxl\:truncate-none {
    overflow: visible !important;
    text-overflow: clip !important;
    white-space: normal !important;
  }
}

@media (min-width: 82.625em) {
  /*
         * Truncate long text with an ellipsis.
         */
  .xxl-e\:truncate {
    overflow: hidden !important;
    text-overflow: ellipsis !important;
    white-space: nowrap !important;
  }
  /*
         * Reset the properties of the `truncate` class to default values.
         */
  .xxl-e\:truncate-none {
    overflow: visible !important;
    text-overflow: clip !important;
    white-space: normal !important;
  }
}

@media (min-width: 100em) {
  /*
         * Truncate long text with an ellipsis.
         */
  .xxxl\:truncate {
    overflow: hidden !important;
    text-overflow: ellipsis !important;
    white-space: nowrap !important;
  }
  /*
         * Reset the properties of the `truncate` class to default values.
         */
  .xxxl\:truncate-none {
    overflow: visible !important;
    text-overflow: clip !important;
    white-space: normal !important;
  }
}

/*
================================================================================
Whitespace
================================================================================
*/
.nowrap {
  white-space: nowrap;
}

/*
================================================================================
Vertical alignment
================================================================================
*/
.align-baseline {
  vertical-align: baseline !important;
}

.align-bottom {
  vertical-align: bottom !important;
}

.align-middle {
  vertical-align: middle !important;
}

.align-top {
  vertical-align: top !important;
}

.align-text-bottom {
  vertical-align: text-bottom !important;
}

.align-text-top {
  vertical-align: text-top !important;
}

/*
================================================================================
Visibility
================================================================================
*/
/*
         * Hide visually and from screenreaders, but maintain layout.
         */
.invisible {
  visibility: hidden !important;
}

.visible {
  visibility: visible !important;
}

/*
         * Hide only visually, but have it available for screen readers:
         * https://snook.ca/archives/html_and_css/hiding-content-for-accessibility
         * Credit: https://github.com/h5bp/html5-boilerplate
         *
         * 1. The `focusable` modifier allows the element to be focusable
         *    when navigated to via keyboard.
         */
.visually-hidden {
  border: 0;
  clip: rect(0 0 0 0);
  height: 1px;
  margin: -1px;
  overflow: hidden;
  padding: 0;
  position: absolute;
  white-space: nowrap;
  width: 1px;
}

.visually-hidden--focusable:focus, .visually-hidden--focusable:active {
  clip: auto;
  height: auto;
  margin: 0;
  overflow: visible;
  position: static;
  white-space: inherit;
  width: auto;
  /* 1 */
}

/*
================================================================================
Breadcrumbs
================================================================================
*/
.breadcrumbs {
  border-bottom: 1px solid #e7e9ec;
  color: #8a96a1;
  font-size: 0.75rem;
  line-height: 1.4;
  margin-bottom: 0;
  padding: 0.6em 15px;
}

@media (min-width: 37.5em) {
  .breadcrumbs {
    padding-left: 30px;
    padding-right: 30px;
  }
}

.breadcrumbs li {
  display: inline-block;
}

.breadcrumbs li:not(:last-child)::after {
  background: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='14' height='14' viewBox='0 0 24 24' fill='none' stroke='%238a96a1' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpolyline points='9 18 15 12 9 6'%3E%3C/polyline%3E%3C/svg%3E") no-repeat center center;
  content: "";
  display: inline-block;
  height: 8px;
  padding: 0 1em;
  vertical-align: middle;
  width: 8px;
}

.breadcrumbs__current {
  color: #5f6b78;
  font-weight: 600;
}

.breadcrumbs__link {
  color: #8a96a1;
}

.breadcrumbs__current > .breadcrumbs__link {
  color: #5f6b78;
}

.breadcrumbs__link:hover {
  color: #5f6b78;
}

/*
================================================================================
Dashboard heading
================================================================================
*/
.db-heading__title {
  font-size: 24px;
  padding: 40px 0;
}

.db-heading--admin {
  background-color: #fff;
  box-shadow: 0 3px 6px rgba(0, 0, 0, 0.16);
}

.db-heading--admin__title {
  color: #202428;
  font-size: 1.5rem;
  font-weight: normal;
  padding: 15px;
}

@media (min-width: 37.5em) {
  .db-heading--admin__title {
    padding-left: 30px;
    padding-right: 30px;
  }
}

/*
================================================================================
Student dashboard menu
================================================================================
*/
.db-menu {
  --menu-program-height: 46px;
  background-color: #fff;
  box-shadow: 0 4px 8px -2px rgba(0, 0, 0, 0.2);
  height: 100vh;
  position: absolute;
  top: 0;
  left: 0;
  width: 220px;
  z-index: 10;
}

.db-menu--editable-program {
  --menu-program-height: 64px;
}

.db-menu--editing-program {
  --menu-program-height: 105px;
}

.db-menu--mobile {
  width: 280px;
}

.db-menu--collapsed {
  width: 60px;
}

.db-menu--enter {
  animation: show-student-menu 200ms ease-out forwards;
}

.db-menu--leave {
  animation: show-student-menu 200ms ease-in reverse forwards;
}

.db-menu__scrollable-container {
  height: calc(100% - 60px);
}

.db-menu--collapsed .db-menu__scrollable-container {
  overflow-y: auto;
}

@media screen and (max-height: 37.4375em) {
  .db-menu__scrollable-container {
    overflow-y: auto;
  }
}

/* Header
============================================================================= */
.db-menu__header {
  align-items: center;
  background-color: #BA0000;
  color: #fff;
  display: flex;
  height: 60px;
  justify-content: center;
  width: 100%;
}

.db-menu__header-btn {
  height: 60px;
  margin-left: 0;
  padding: 0;
  position: absolute;
  top: 0;
  left: 0;
  width: 60px;
}

@media (min-width: 68.75em) {
  .db-menu__header-btn:not(:focus-visible) {
    border: 0;
    clip: rect(0 0 0 0);
    height: 1px;
    margin: -1px;
    overflow: hidden;
    padding: 0;
    position: absolute;
    white-space: nowrap;
    width: 1px;
  }
}

.db-menu__header-btn .user-bar__btn-icon {
  background-color: transparent;
  border: 0;
  box-sizing: content-box;
  display: inline-block;
  height: 20px;
  margin-bottom: 0;
  padding: 0;
  position: relative;
  top: -1px;
  vertical-align: middle;
  width: 20px;
}

.db-menu__header-btn .user-bar__btn-icon::after, .db-menu__header-btn .user-bar__btn-icon::before,
.db-menu__header-btn .user-bar__btn-icon > span {
  background-color: #fff;
  border-radius: 1px;
  display: block;
  height: 2px;
  margin-top: 9px;
  position: absolute;
  left: 0;
  transition: all 150ms ease-out;
  width: 20px;
}

.db-menu__header-btn .user-bar__btn-icon::after, .db-menu__header-btn .user-bar__btn-icon::before {
  content: "";
}

.db-menu__header-btn .user-bar__btn-icon::before {
  top: -6px;
}

.db-menu__header-btn .user-bar__btn-icon > span {
  top: 0;
}

.db-menu__header-btn .user-bar__btn-icon::after {
  top: 6px;
}

.db-menu__header-btn .user-bar__btn-icon--active::before {
  transform: translate(0, 6px) rotate(45deg);
}

.db-menu__header-btn .user-bar__btn-icon--active::after {
  transform: translate(0, -6px) rotate(-45deg);
}

.db-menu__header-btn .user-bar__btn-icon--active > span {
  opacity: 0;
}

.db-menu__header-btn .user-bar__btn-icon > span {
  background: url("data:image/svg+xml;utf8,<svg xmlns='http://www.w3.org/2000/svg' width='146' height='30' viewBox='0 0 146 30' fill='%23fff'><path d='M94.258 10H51.743C49.123 10 47 12.24 47 15c0 2.762 2.126 5 4.743 5h42.515C96.873 20 99 17.762 99 15c0-2.76-2.123-5-4.742-5zM15 0L0 15l15 15V20h22V10H15M146 15L131 0v10h-22v10h22v10'/></svg>") no-repeat 0 0;
  background-size: auto 6px;
  height: 6px;
  top: -2px;
  width: 20px;
}

[aria-expanded="false"] > .db-menu__header-btn .user-bar__btn-icon > span {
  background-position: 100% 0;
}

.db-menu__header-logo {
  width: 90px;
}

.db-menu__header-icon {
  width: 35px;
}

/* User
============================================================================= */
.db-menu__avatar-container {
  align-items: center;
  display: flex;
  flex-direction: column;
  font-size: 0.9375rem;
  font-weight: 700;
  height: 160px;
  justify-content: center;
  padding: 0 15px;
}

.db-menu__avatar {
  border-radius: 50%;
  display: inline-block;
  height: 100px;
  margin-bottom: 0.5em;
  width: auto;
}

.db-menu__avatar--collapsed {
  height: 46px;
  margin-bottom: 0;
  width: 46px;
}

.db-menu__avatar-tile {
  background-color: transparent;
  border-bottom: 1px solid #e7e9ec;
  border-left: 3px solid #fff;
  border-right: 3px solid #fff;
  border-top: 0;
  height: 60px;
  text-align: center;
  margin: 0;
  outline: none;
  padding: 0;
  width: 60px;
}

.db-menu__avatar-tile:focus {
  outline: none;
}

.db-menu__avatar-tile:focus-visible {
  box-shadow: 0 0 0 2px #39c inset;
}

.db-menu--collapsed .db-menu__user {
  background-color: #fff;
  box-shadow: 0 4px 8px -2px rgba(0, 0, 0, 0.2);
  position: absolute;
  top: 60px;
  left: 60px;
  width: 220px;
}

.db-menu__program {
  border-bottom: 1px solid #e7e9ec;
  border-top: 1px solid #e7e9ec;
  color: #5f6b78;
  font-size: 0.875rem;
  height: var(--menu-program-height);
  padding: 0.75em 15px;
  text-align: center;
}

.db-menu__program.program-select--editing {
  padding-left: 5px;
  padding-right: 5px;
}

/* Submenus
============================================================================= */
@media screen and (min-height: 37.5em) {
  .db-menu__submenus {
    height: calc(100% - 160px - var(--menu-program-height));
    overflow-y: auto;
  }
}

.db-menu__submenus--collapsed {
  height: auto;
}

/* - - - - - Tile/Button - - - - - */
.db-menu__submenu-btn {
  align-items: center;
  background-color: #fff;
  border: 0;
  border-left: 3px solid #fff;
  color: #3a4148;
  display: flex;
  justify-content: space-between;
  padding: 1.1rem 0;
  position: relative;
  transition: border-color 100ms ease-out;
  width: 100%;
}

.db-menu__submenu-btn:focus {
  outline: none;
}

.db-menu__submenu-btn:focus-visible {
  box-shadow: 0 0 0 2px #39c inset;
}

.db-menu__submenu-btn:focus-visible, .db-menu__submenu-btn:hover, .db-menu__submenu-btn:active {
  color: #BA0000;
}

.db-menu__submenu--active .db-menu__submenu-btn {
  border-color: #BA0000;
}

.db-menu--collapsed .db-menu__submenu-btn {
  border-right: 3px solid #fff;
  height: 60px;
  justify-content: center;
  width: 60px;
}

.db-menu__submenu-chevron {
  color: #adb5bd;
  flex-shrink: 0;
  height: 18px;
  margin: 0 10px;
  width: 16px;
}

.db-menu__submenu-chevron svg {
  margin-top: -5px;
  transition: transform 100ms ease-out;
  width: 100%;
}

.db-menu__submenu--open .db-menu__submenu-chevron svg {
  transform: rotate(180deg);
}

.db-menu--collapsed .db-menu__submenu-chevron {
  display: none;
}

.db-menu__submenu-tile {
  color: #8a96a1;
  text-align: center;
  transition: color 150ms ease-out;
}

.db-menu__submenu-tile svg {
  height: 18px;
  width: 18px;
}

.db-menu__submenu--active .db-menu__submenu-tile,
.db-menu__submenu-btn:focus-visible .db-menu__submenu-tile,
.db-menu__submenu-btn:hover .db-menu__submenu-tile,
.db-menu__submenu-btn:active .db-menu__submenu-tile {
  color: #BA0000;
}

.db-menu:not(.db-menu--collapsed) .db-menu__submenu-tile {
  position: absolute;
  top: 0.95rem;
  left: 0.7rem;
}

.db-menu--collapsed .db-menu__submenu-tile svg {
  height: 22px;
  width: 22px;
}

.db-menu__submenu-title {
  flex-shrink: 1;
  font-size: 0.9375rem;
  margin: 0 0 0 2.5rem;
  text-align: left;
}

.db-menu--collapsed .db-menu__submenu-title {
  background-color: #fff;
  font-size: 1rem;
  margin-left: 0;
  padding: 1rem;
}

/* - - - - - Submenu list - - - - - */
.db-menu__submenu-list {
  background-color: #f9fafa;
  border-left: 3px solid transparent;
  font-size: 0.8125rem;
  transition: border-color 100ms ease-out;
}

.db-menu__submenu--active .db-menu__submenu-list {
  border-color: #BA0000;
}

.db-menu--collapsed .db-menu__submenu-list {
  border-left: 0;
  box-shadow: 0 4px 8px -2px rgba(0, 0, 0, 0.2);
  position: fixed;
  top: 0;
  left: 60px;
  width: 220px;
  z-index: 1;
}

.db-menu___submenu-li {
  margin-bottom: 3px;
}

.db-menu__link {
  color: #5f6b78;
  display: block;
  margin: 0 0.5em 0 2.6em;
  padding: 0.5em;
}

.db-menu__link--active, .db-menu__link:focus, .db-menu__link:hover, .db-menu__link:active {
  color: #3a4148;
  font-weight: 700;
  text-decoration: none;
}

.db-menu--collapsed .db-menu__link {
  margin: 0;
  padding: 0.5rem 1rem;
}

/* Animations
============================================================================= */
@keyframes show-student-menu {
  from {
    transform: translateX(-100%);
  }
  to {
    transform: translateX(0);
  }
}

/*
================================================================================
Dashboard panel
================================================================================
*/
.db-panel {
  --db-panel-padding-x: 15px;
  background-color: #fff;
  border-radius: 3px;
  box-shadow: 0 2px 4px rgba(0, 0, 0, 0.1);
  margin-bottom: 30px;
  overflow: auto;
  padding: 30px var(--db-panel-padding-x);
  position: relative;
}

.db-panel--wide {
  --db-panel-padding-x: 30px;
}

.db-panel__hr {
  margin: 1.5rem 0 1.5rem calc(var(--db-panel-padding-x) * -1);
  width: calc(100% + (var(--db-panel-padding-x) * 2));
}

/* Heading
============================================================================= */
.db-panel__title {
  border-bottom: 1px solid #e7e9ec;
  color: #686d7a;
  font-size: 0.875rem;
  font-weight: 700;
  line-height: 1.2;
  margin: -30px 0 30px calc(var(--db-panel-padding-x) * -1);
  padding: 1.3em var(--db-panel-padding-x);
  text-align: left;
  width: calc(100% + (var(--db-panel-padding-x) * 2));
}

.db-panel__title-link {
  display: inline-block;
  font-weight: 400;
  margin-left: 0.3em;
  text-transform: none;
}

/* Order by
============================================================================= */
.db-panel__order-row {
  align-items: flex-start;
  display: flex;
  flex-direction: column;
  justify-content: space-between;
}

@media (min-width: 60em) {
  .db-panel__order-row {
    align-items: center;
    flex-direction: row;
  }
}

.db-panel__order-col {
  align-items: center;
  display: flex;
  flex-direction: row;
  max-width: 400px;
  width: 100%;
}

@media (min-width: 60em) {
  .db-panel__order-col {
    margin-left: auto;
  }
}

.dots-container {
  align-items: center;
  display: flex;
  justify-content: center;
  margin-bottom: 40px;
  margin-top: 30px;
}

.dots-step {
  background-color: #e7e9ec;
  border-radius: 50%;
  display: block;
  height: 15px;
  min-width: 15px;
  position: relative;
  width: 15px;
}

.dots-step--current {
  background-color: #fff;
  border: 2px solid #BA0000;
}

.dots-step--success {
  background-color: #20c372;
  border: none;
}

.dots-step--success svg {
  color: #fff;
  height: 11px;
  left: 2px;
  position: absolute;
  top: 2px;
}

.dots-progress {
  background-color: #e7e9ec;
  border-radius: 2px;
  height: 2px;
  margin: 0px 5px;
  width: 40px;
}

.dots-progress--success {
  background-color: #20c372;
}

@media (min-width: 25em) {
  .dots-progress {
    width: 90px;
  }
}

.dots-request {
  align-items: center;
  display: flex;
  height: 60px;
  margin-bottom: 40px;
  justify-content: center;
  position: relative;
}

.dots-request-step {
  background-color: #f0f2f3;
  border: 2px solid transparent;
  border-radius: 50%;
  color: #5f6b78;
  font-size: 13px;
  font-weight: 600;
  height: 25px;
  position: relative;
  text-align: center;
  width: 25px;
}

.dots-request-step--current {
  background-color: #fff;
  border: 2px solid #BA0000;
  color: #BA0000;
}

.dots-request-step--current > .dots-request-text {
  color: #BA0000;
}

.dots-request-step--success {
  background-color: #20c372;
}

.dots-request-step--success svg {
  color: #2e2e2e;
  height: 17px;
  left: 2px;
  position: absolute;
  top: 2px;
}

.dots-request-step--success > .dots-request-text {
  color: #5f6b78;
}

.dots-request-progress {
  background-color: #F0F2F3;
  border-radius: 2px;
  height: 2px;
  margin: 0px 5px;
  width: 90px;
}

.dots-request-progress--success {
  background-color: #20c372;
}

.dots-request-text {
  color: #5f6b78;
  font-size: 12px;
  font-weight: 400;
  position: absolute;
  transform: translate(-58%, 30px);
}

/*
================================================================================
Header profile
================================================================================
*/
.header-profile {
  background: #fff;
  box-shadow: 0 3px 6px rgba(0, 0, 0, 0.1);
}

.header-profile__container {
  align-items: center;
  display: flex;
  flex-flow: column;
  justify-content: center;
  min-height: 160px;
  text-align: center;
  width: 100%;
}

@media (max-width: 37.4375em) {
  .header-profile__container {
    padding: 20px 0 0;
  }
}

@media (min-width: 37.5em) {
  .header-profile__container {
    align-items: stretch;
    flex-flow: row;
    justify-content: left;
    padding-bottom: 14px;
    padding-top: 14px;
    text-align: left;
  }
}

/* Avatar
============================================================================= */
.header-profile__avatar {
  flex-shrink: 0;
  margin-bottom: 15px;
  width: 130px;
}

.header-profile__avatar img {
  border-radius: 17px;
  width: 100%;
}

@media (min-width: 37.5em) {
  .header-profile__avatar {
    margin-bottom: 0;
  }
}

/* Info
============================================================================= */
.header-profile__info {
  padding-left: 0;
  width: 100%;
}

@media (min-width: 37.5em) {
  .header-profile__info {
    display: flex;
    flex-direction: column;
    padding-left: 30px;
  }
  .header-profile__info--multiple-programs {
    justify-content: space-between;
  }
}

.header-profile__name {
  color: #3a4148;
  font-size: 1.625rem;
  line-height: 1.2;
  margin-bottom: 0;
  padding: 0 15px;
}

@media (min-width: 37.5em) {
  .header-profile__name {
    font-size: 1.875rem;
    padding: 0;
  }
}

.header-profile__program {
  border-top: 1px solid #e7e9ec;
  color: #202428;
  margin-bottom: 0;
  margin-top: 20px;
  padding: 0.7rem 0;
}

@media (min-width: 37.5em) {
  .header-profile__program {
    border-top: 0;
    font-size: 1.0625rem;
    margin-top: 1.5rem;
    padding: 0;
  }
  .header-profile__info--multiple-programs .header-profile__program {
    font-size: 1rem;
    margin-top: 0;
  }
}

.header-profile__ujed-id {
  color: #8a96a1;
  font-size: 1.125rem;
  font-weight: 300;
  padding: 0 15px;
}

@media (min-width: 37.5em) {
  .header-profile__ujed-id {
    padding: 0;
  }
}

.photo_button {
  margin: -46px 0px 0px 93px;
  width: 34%;
  border-radius: 50%;
  height: 42px;
}

/*
===============================================================================
Icon tabs responsive
===============================================================================
*/
.icon-tabs {
  border-radius: 4px;
  width: 100%;
}

.icon-tabs .tabs__menu {
  border-top: 1px solid #e7e9ec;
  color: #8a96a1;
  display: flex;
  justify-content: center;
  font-size: 11px;
  list-style: none;
  margin-left: 0;
  text-align: center;
}

.icon-tabs .tabs__li {
  border-bottom: 1px solid #e7e9ec;
  cursor: pointer;
  height: 75px;
  line-height: 13px;
  width: 33.3%;
}

.icon-tabs .tabs__li:focus,
.icon-tabs .tabs__li :hover {
  cursor: pointer;
  outline: 0;
}

.icon-tabs .tabs__li:first-child {
  border-right: 1px solid #e7e9ec;
}

.icon-tabs .tabs__li:nth-child(2) {
  border-right: 1px solid #e7e9ec;
}

.icon-tabs .tabs__li:nth-child(3) {
  border-right: 1px solid #e7e9ec;
}

.icon-tabs .tabs__li:nth-child(4) {
  border-right: 1px solid #e7e9ec;
}

.icon-tabs .tabs__li--active {
  border-bottom: 2px solid #BA0000;
  color: #BA0000;
}

.icon-tabs .tabs__li .icon {
  height: 20px;
  margin: auto;
  min-height: 100%;
  min-width: 100%;
  width: 30px;
}

.icon-tabs .tabs__menu .tabs__li::before {
  background-position: center;
  background-repeat: no-repeat;
  color: transparent;
  content: '.';
  display: block;
  filter: invert(78%) sepia(17%) saturate(137%) hue-rotate(169deg) brightness(91%) contrast(86%);
  margin-bottom: 7px;
  height: 22px;
  margin-top: 13px;
  cursor: pointer;
}

.icon-tabs .tabs__menu .tabs__li--active::before {
  filter: invert(14%) sepia(85%) saturate(3865%) hue-rotate(341deg) brightness(82%) contrast(93%);
}

.icon-tabs--profile .tabs__menu .tabs__li:first-child::before {
  background-image: url("/static/img/icons/teacher.svg");
}

.icon-tabs--profile .tabs__menu .tabs__li:nth-child(2)::before {
  background-image: url("/static/img/icons/user.svg");
}

.icon-tabs--profile .tabs__menu .tabs__li:nth-child(3)::before {
  background-image: url("/static/img/icons/calendar.svg");
}

.icon-tabs--profile .tabs__menu .tabs__li:nth-child(4)::before {
  background-image: url("/static/img/icons/calendar.svg");
}

.icon-tabs--data .tabs__menu {
  border-top: 1px solid white;
  border-bottom: 1px solid #e7e9ec;
  color: #8a96a1;
  display: flex;
  justify-content: center;
  font-size: 11px;
  list-style: none;
  margin-left: 0;
  text-align: center;
}

.icon-tabs--data .tabs__li {
  cursor: pointer;
  height: 75px;
  line-height: 13px;
  max-width: 20%;
  border-bottom: 0px;
}

.icon-tabs--data .tabs__li:first-child {
  border-left: 1px solid #e7e9ec;
}

.icon-tabs--data .tabs__li .icon {
  height: 20px;
  margin: auto;
  min-height: 100%;
  min-width: 100%;
  width: 30px;
}

.icon-tabs--data .tabs__menu .tabs__li::before {
  background-position: center;
  background-repeat: no-repeat;
  color: transparent;
  content: '.';
  display: block;
  filter: invert(78%) sepia(17%) saturate(137%) hue-rotate(169deg) brightness(91%) contrast(86%);
  margin-bottom: 7px;
  height: 22px;
  margin-top: 13px;
  cursor: pointer;
}

.icon-tabs--data .tabs__menu .tabs__li--active::before {
  filter: invert(14%) sepia(85%) saturate(3865%) hue-rotate(341deg) brightness(82%) contrast(93%);
}

.icon-tabs--data .tabs__menu .tabs__li:first-child::before {
  background-image: url("/static/img/icons/user.svg");
}

.icon-tabs--data .tabs__menu .tabs__li:nth-child(2)::before {
  background-image: url("/static/img/icons/map-pin.svg");
}

.icon-tabs--data .tabs__menu .tabs__li:nth-child(3)::before {
  background-image: url("/static/img/icons/teacher.svg");
}

.icon-tabs--data .tabs__menu .tabs__li:nth-child(4)::before {
  background-image: url("/static/img/icons/seguro.svg");
}

.success-icon {
  align-items: center;
  border-radius: 50%;
  border: 2px solid #f0f2f3;
  display: flex;
  height: 66px;
  justify-content: center;
  margin: auto;
  width: 66px;
}

.success-icon svg {
  color: #20c372;
  height: 40px;
}

.icon-chevron svg {
  color: #adb5bd;
  height: 20px;
  width: 15px;
}

.icon-solicitado--info {
  background: none;
  background-repeat: no-repeat;
  color: #20c372;
  width: 20%;
  height: 100%;
  padding-right: 0px;
  padding-left: 25px !important;
  margin-top: 15px;
  margin-right: 0px;
}

@media (min-width: 77.5em) {
  .icon-solicitado--info {
    margin-top: 0px;
    width: 10%;
  }
}

.inner__fee-name {
  width: 100%;
}

.inner__fee-card {
  width: 100%;
}

.online-fee {
  background-color: #fff;
  border-radius: 6px;
  height: auto;
  margin: 50px auto;
  width: 100%;
}

@media (min-width: 43.75em) {
  .online-fee {
    width: 380px;
  }
}

.online-fee__header {
  align-items: center;
  background-color: #000;
  border-radius: 6px 6px 0 0;
  box-shadow: 0px 3px 6px #00000029;
  color: #fff;
  display: flex;
  font-size: 8px;
  font-weight: 600;
  height: 26px;
  justify-content: center;
}

.online-fee__info {
  display: flex;
  justify-content: space-between;
  margin-bottom: 10px;
  padding: 0px 30px;
}

.online-fee__amount {
  color: #154258;
}

.online-fee__amount-title {
  font-size: 11px;
  font-weight: 600;
  margin: 0px;
}

.online-fee__amount-money {
  color: #202428;
  font-size: 26px;
  font-weight: 600;
  margin: 0px;
}

.online-fee__amount-commission {
  font-size: 10px;
  margin: 0px;
}

.online-fee__logo {
  height: auto;
  margin-right: 30px;
  width: 130px;
}

.online-fee__reference {
  margin-bottom: 25px;
  padding: 0px 30px;
}

.online-fee__reference-box {
  align-items: center;
  background-color: #f9fafa;
  border: 1px solid #d6dadd;
  border-radius: 4px;
  display: flex;
  font-size: 19px;
  font-weight: 600;
  height: 40px;
  justify-content: center;
  letter-spacing: 1.9px;
}

.online-fee__title {
  font-size: 11px;
  font-weight: 600;
  margin-bottom: 5px;
}

.online-fee__instructions {
  border-radius: 0 0 6px 6px;
  border-top: 1px solid #d6dadd;
  background-color: #f9fafa;
  color: #3a4148;
  font-size: 11px;
  padding: 20px 30px;
}

.online-fee__instructions-list {
  margin-left: 1em;
}

.online-fee__instructions-list li {
  margin-bottom: 10px;
}

.online-fee__instructions p {
  margin-bottom: 0px;
}

.online-fee__instructions-note {
  background-color: #fff;
  border: 1px solid #246b8e;
  border-radius: 4px;
  color: #246b8e;
  font-size: 11px;
  padding: 10px 15px;
}

.select-asistencias {
  display: flex;
  flex-direction: column;
  justify-content: center;
  align-items: center;
}

.select {
  width: 250px;
}

.asistencia-verde {
  background-color: #d4edda;
  color: #155724;
}

.asistencia-rojo {
  background-color: #f8d7da;
  color: #721c24;
}

.asistencia-amarillo {
  background-color: #fff3cd;
  color: #856404;
}

.modal-overlay {
  position: fixed;
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
  background-color: rgba(0, 0, 0, 0.5);
  display: flex;
  flex-direction: column;
  align-items: center;
  justify-content: center;
}

.modal-content {
  display: flex;
  flex-direction: column;
  justify-content: space-between;
  background-color: white;
  border-radius: 16px;
  box-shadow: 0 5px 15px rgba(0, 0, 0, 0.3);
  width: 300px;
  min-height: 500px;
}

.modal-header {
  display: flex;
  justify-content: flex-start;
}

.modal-header a svg {
  width: 24px;
  height: 24px;
  margin-right: 8px;
  vertical-align: middle;
}

.modal-footer {
  margin-top: 4rem;
}

.cerrar {
  margin-top: 2rem;
}

.cerrar p {
  font-size: 12px;
  color: #807f7f;
  line-height: 1.2;
  margin: 0 10%;
}

.img-perfil {
  background-color: #8b5050;
  display: flex;
  align-items: center;
  justify-content: center;
  margin: 0 auto 1rem auto;
  overflow: hidden;
  border-radius: 50%;
  width: 150px;
  height: 150px;
}

.img-perfil img {
  width: 100%;
  height: 100%;
  -o-object-fit: cover;
     object-fit: cover;
}

.nom_alumno {
  padding: 1rem;
  height: 3.6em;
  display: flex;
  align-items: center;
  justify-content: center;
}

.nom_alumno h3, .nom_alumno .h3 {
  font-size: 18px;
  margin: 0;
  max-width: 100%;
  text-align: center;
  line-height: 1.2;
  max-height: 2.4em;
  overflow: hidden;
  word-break: break-word;
}

.card {
  display: flex;
  flex-direction: column;
  flex: 1;
  align-items: center;
  position: relative;
  padding: 1rem;
}

.profile-pic {
  width: 120px;
  height: 120px;
  border-radius: 50%;
  -o-object-fit: cover;
     object-fit: cover;
  margin-bottom: 1rem;
}

.botones {
  display: flex;
  justify-content: center;
  gap: 1rem;
  flex-wrap: wrap;
  margin-top: 1rem;
}

.boton {
  display: flex;
  align-items: center;
  justify-content: center;
  padding: 0.5rem;
  border: none;
  cursor: pointer;
  transition: 0.2s;
}

.boton.no,
.boton.si {
  width: 60px;
  height: 60px;
  border-radius: 50%;
  background-color: #eeeeee;
}

.restaurar {
  display: flex;
  align-items: center;
  text-decoration: none;
  color: inherit;
}

.boton:hover {
  opacity: 0.8;
}

.botones-wrapper {
  display: flex;
  justify-content: space-between;
  align-items: center;
  flex-wrap: wrap;
}

.oxxo-pay {
  background-color: #fff;
  border: 1px solid #d6dadd;
  border-radius: 6px;
  box-shadow: 0px 3px 6px #00000029;
  height: auto;
  margin: 50px auto;
  width: 100%;
}

@media (min-width: 43.75em) {
  .oxxo-pay {
    width: 380px;
  }
}

.oxxo-pay__header {
  align-items: center;
  background-color: #000;
  border-radius: 6px 6px 0 0;
  box-shadow: 0px 3px 6px #00000029;
  color: #fff;
  display: flex;
  font-size: 8px;
  font-weight: 600;
  height: 26px;
  justify-content: center;
}

.oxxo-pay__info {
  display: flex;
  justify-content: space-between;
  margin-bottom: 10px;
  padding: 0px 30px;
}

.oxxo-pay__amount {
  color: #154258;
}

.oxxo-pay__amount-title {
  font-size: 11px;
  font-weight: 600;
  margin: 0px;
}

.oxxo-pay__amount-money {
  color: #202428;
  font-size: 26px;
  font-weight: 600;
  margin: 0px;
}

.oxxo-pay__amount-commission {
  font-size: 10px;
  margin: 0px;
}

.oxxo-pay__logo {
  height: auto;
  margin-right: 30px;
  width: 130px;
}

.oxxo-pay__reference {
  margin-bottom: 25px;
  padding: 0px 30px;
}

.oxxo-pay__reference-box {
  align-items: center;
  background-color: #f9fafa;
  border: 1px solid #d6dadd;
  border-radius: 4px;
  display: flex;
  font-size: 19px;
  font-weight: 600;
  height: 40px;
  justify-content: center;
  letter-spacing: 1.9px;
}

.oxxo-pay__title {
  font-size: 11px;
  font-weight: 600;
  margin-bottom: 5px;
}

.oxxo-pay__instructions {
  border-radius: 0 0 6px 6px;
  border-top: 1px solid #d6dadd;
  background-color: #f9fafa;
  color: #3a4148;
  font-size: 11px;
  padding: 20px 30px;
}

.oxxo-pay__instructions-list {
  margin-left: 1em;
}

.oxxo-pay__instructions-list li {
  margin-bottom: 10px;
}

.oxxo-pay__instructions p {
  margin-bottom: 0px;
}

.oxxo-pay__instructions-note {
  background-color: #fff;
  border: 1px solid #246b8e;
  border-radius: 4px;
  color: #246b8e;
  font-size: 11px;
  padding: 10px 15px;
}

.online-payment {
  margin: auto;
  margin-top: 60px;
  width: 100%;
}

.pagination {
  display: none;
  justify-content: center;
  list-style-type: none;
  margin-left: 0;
  margin-top: 90px;
}

@media (min-width: 37.5em) {
  .pagination {
    display: flex;
  }
}

.pagination-container {
  margin-bottom: 30px;
  width: 100%;
}

.pagination-item {
  align-items: center;
  background-color: transparent;
  border: 0;
  border-radius: 4px;
  color: #3a4148;
  display: flex;
  height: 34px;
  justify-content: center;
  margin-right: 4px;
  min-width: 34px;
  padding-left: 2px;
  padding-right: 2px;
}

.pagination-item:focus, .pagination-item:hover, .pagination-item:active {
  background-color: #f0f2f3;
  color: #3a4148;
  text-decoration: none;
}

:root .pagination-item--selected {
  background-color: #BA0000;
  color: #fff;
  cursor: default;
}

:root:root .pagination-item--text {
  color: #d6dadd;
  margin: 0;
  width: 1.5em;
}

:root:root .pagination-item--text:focus, :root:root .pagination-item--text:hover, :root:root .pagination-item--text:active {
  background-color: transparent;
  color: #d6dadd;
}

.pagination-next {
  margin-left: 2.5rem;
}

.pagination-previous {
  margin-right: 2.5rem;
}

.pagination-next,
.pagination-previous {
  background-color: transparent;
  border: 0;
  color: #3a4148;
  height: 100%;
  padding: 0;
  text-decoration: none;
}

.pagination-next:focus, .pagination-next:hover, .pagination-next:active,
.pagination-previous:focus,
.pagination-previous:hover,
.pagination-previous:active {
  color: #BA0000;
  text-decoration: none;
}

.pagination-next__icon,
.pagination-previous__icon {
  font-size: 20px;
}

:root .pagination-next--disabled, :root
.pagination-previous--disabled {
  color: #adb5bd;
  cursor: default;
}

/*
================================================================================
Dashboard pagination
================================================================================
*/
.pagination--dashboard {
  align-items: center;
  display: none;
  justify-content: center;
  margin-top: 60px;
}

@media (min-width: 37.5em) {
  .pagination--dashboard {
    display: flex;
  }
}

.pagination--dashboard .pagination-item {
  color: #8a96a1;
}

.pagination--dashboard .pagination-item:focus, .pagination--dashboard .pagination-item:hover, .pagination--dashboard .pagination-item:active {
  background-color: #f0f2f3;
  color: #3a4148;
  text-decoration: none;
}

:root .pagination--dashboard .pagination-item--selected {
  background-color: #BA0000;
  color: #fff;
  cursor: default;
  font-weight: bold;
}

.dashboard--admin .pagination--dashboard .pagination-item--selected {
  background-color: #50ab87;
}

.pagination--dashboard .pagination-item .pagination-item__link {
  color: #8a96a1;
  text-decoration: none;
}

.pagination--dashboard .pagination-next {
  margin-left: 0.25rem;
}

.pagination--dashboard .pagination-previous {
  margin-right: 0.25rem;
}

.pagination--dashboard .pagination-next,
.pagination--dashboard .pagination-previous {
  align-items: center;
  border-radius: 4px;
  color: #8a96a1;
  display: flex;
  height: 34px;
  justify-content: center;
  margin-right: 4px;
  width: 34px;
}

.pagination--dashboard .pagination-next:focus, .pagination--dashboard .pagination-next:hover, .pagination--dashboard .pagination-next:active,
.pagination--dashboard .pagination-previous:focus,
.pagination--dashboard .pagination-previous:hover,
.pagination--dashboard .pagination-previous:active {
  background-color: #f0f2f3;
  color: #3a4148;
  text-decoration: none;
}

:root .pagination--dashboard .pagination-next--disabled, :root
.pagination--dashboard .pagination-previous--disabled {
  background-color: transparent;
  color: #adb5bd;
  cursor: default;
}

.pagination--dashboard .pagination-next .pagination-previous__link,
.pagination--dashboard .pagination-previous .pagination-previous__link {
  color: #8a96a1;
  text-decoration: none;
}

.pagination--dashboard .pagination-next .pagination-next__link,
.pagination--dashboard .pagination-previous .pagination-next__link {
  color: #8a96a1;
  text-decoration: none;
}

.pagination--dashboard .pagination-next__link svg {
  width: 16px;
}

.pagination--dashboard .pagination-previous__link svg {
  width: 16px;
}

.pagination--dashboard .pagination-next svg,
.pagination--dashboard .pagination-previous svg {
  stroke-width: 1.5;
  width: 1.3em;
}

/*
================================================================================
Responsive pagination
================================================================================
*/
.pagination--responsive {
  display: flex;
  justify-content: space-between;
}

@media (min-width: 37.5em) {
  .pagination--responsive {
    display: none;
  }
}

.pagination--responsive .pagination-pages {
  align-items: flex-end;
  display: inline-flex;
}

.pagination--responsive .pagination-next,
.pagination--responsive .pagination-previous {
  margin: 0;
}

.pagination--responsive .pagination-next__icon,
.pagination--responsive .pagination-previous__icon {
  font-size: 25px;
}

.pagination--responsive .form-field, .pagination--responsive .form-file__text,
.pagination--responsive .form-file__upload {
  border: 0;
  font-size: 16px;
  height: 24px;
  padding: 0;
}

.pagination--responsive__dashboard {
  color: #8a96a1 !important;
  justify-content: center;
  margin-top: 30px;
}

.pagination--responsive__dashboard .pagination-next {
  margin-left: 20px;
}

.pagination--responsive__dashboard .pagination-previous {
  margin-right: 20px;
}

.pagination--responsive__dashboard .pagination-pages {
  align-items: baseline;
}

.pagination--responsive__dashboard .form-field, .pagination--responsive__dashboard .form-file__text,
.pagination--responsive__dashboard .form-file__upload {
  border: 1px solid #d6dadd;
  font-size: 16px;
  height: 34px;
  padding: 5px 10px;
}

/*
================================================================================
Program select
================================================================================
*/
.program-select__link {
  font-size: 0.8125rem;
}

.program-select__field {
  margin-right: 0.75rem;
}

@media (max-width: 37.4375em) {
  .program-select__field {
    margin-bottom: 0.5rem;
  }
}

.program-select__form-control {
  display: flex;
  max-width: 500px;
}

@media (max-width: 37.4375em) {
  .program-select__form-control {
    flex-direction: column;
    margin-left: auto;
    margin-right: auto;
    max-width: 400px;
  }
}

.program-select--menu .program-select__form-control {
  flex-direction: column;
}

.program-select--menu .program-select__btn {
  font-size: 0.9375rem;
  margin-top: 0.5rem;
  padding-bottom: 0.5rem;
  padding-top: 0.5rem;
}

.search-container {
  width: 100%;
}

@media (min-width: 43.75em) {
  .search-container {
    width: 500px;
  }
}

.search-container .btn--ujed svg {
  height: 20px;
}

.score-options {
  text-align: center;
  margin: 60px 0;
}

.score-options .btn {
  width: 170px;
}

.selected-subject {
  background-color: #f9fafa;
  border: 1px solid #e7e9ec;
  border-radius: 8px;
  display: block;
  margin-bottom: 1.5px;
  margin-right: 7px;
  overflow: hidden;
  padding: 8px;
  position: relative;
  width: 215px;
}

.selected-subject--bordered {
  border-top: 8px solid #e262c4;
}

.selected-subject--last {
  display: none;
}

.selected-subject--overlaped {
  display: none;
}

.selected-subject--height-1 {
  height: 99px;
}

.selected-subject--height-2 {
  height: 198px;
}

.selected-subject--height-3 {
  height: 297px;
}

.selected-subject--height-4 {
  height: 396px;
}

.selected-subject--height-5 {
  height: 495px;
}

.selected-subject--height-6 {
  height: 594px;
}

.selected-subject--height-7 {
  height: 693px;
}

.selected-subject--height-8 {
  height: 792px;
}

.selected-subject--height-9 {
  height: 891px;
}

.selected-subject--height-10 {
  height: 990px;
}

.selected-subject__badge {
  background-color: #fdd25a;
  border-radius: 2px;
  color: #0000009f;
  font-size: 8px;
  margin-top: 10px;
  padding: 3px 6px;
  position: absolute;
}

.selected-subject__classroom, .selected-subject__credits {
  bottom: 8px;
  font-size: 12px;
}

.selected-subject__classroom {
  color: #8a96a1;
  font-size: 11px;
  margin-bottom: 0;
  padding-bottom: 0;
}

.selected-subject__title {
  -webkit-box-orient: vertical;
  -webkit-line-clamp: 2;
  color: #3a4148;
  display: -webkit-box;
  font-size: 13px;
  margin: 0;
  overflow: hidden;
}

.selected-subject__footer {
  bottom: 8px;
  display: flex;
  justify-content: space-between;
  min-width: 197px;
  position: absolute;
}

.selected-subject__type {
  border-radius: 2px;
  font-size: 9px;
  font-weight: 600;
  padding: 2px 8px;
}

.selected-subject__type--lab {
  background-color: #e262c4;
  color: #fff;
}

.selected-subject__type--elective {
  background-color: #fdd25a;
  color: #0000009f;
}

.status-subject {
  border-radius: 4px;
  display: inline-block;
  height: 17px;
  margin-right: 5px;
  vertical-align: text-bottom;
  width: 17px;
}

.status-subject--elegible {
  background-color: #fff;
  border: 1px solid #d6dadd;
  box-shadow: 0px 3px 3px #0000000D;
}

.status-subject--approved {
  background-color: #e3fdf1;
}

.status-subject--credits {
  display: inline-block;
  font-size: 14px;
  height: 20px;
  text-align: center;
  width: 20px;
}

.status-subject--failed {
  background-color: #ffe8e8;
}

.status-subject--restricted {
  background: repeating-linear-gradient(-45deg, #fff, #fff 5px, #ffe8e8 0, #ffe8e8 7px);
}

.status-subject--chain {
  color: #39c;
}

.status-subject--chain svg,
.status-subject--mandatory svg {
  height: 20px;
  width: 20px;
}

.status-subject__info {
  color: #8a96a1;
  max-width: 318px;
}

.instructions-schedule {
  max-width: 938px;
}

.subject-schedule {
  display: flex;
  height: auto;
  margin-bottom: 60px;
  margin-top: 60px;
  max-width: 1381px;
  overflow-x: auto;
  position: relative;
}

.subject-schedule__day {
  background: repeating-linear-gradient(#f0f2f3, #f0f2f3 1px, #fff 0, #fff 99px);
  margin-right: 2px;
  margin-top: 55px;
  min-width: 215px;
}

.subject-schedule__day-title {
  background-color: #fff;
  color: #686d7a;
  font-size: 17px;
  height: 30px;
  line-height: 17px;
  margin-bottom: 13px;
  position: absolute;
  text-align: center;
  top: 0;
  width: 215px;
}

.subject-schedule__hours {
  background-color: #fff;
  left: 0;
  margin-top: 50px;
  padding-right: 30px;
  padding-top: 0;
  position: sticky;
  z-index: 1;
}

.subject-schedule__hours p {
  color: #686d7a;
  font-size: 14px;
  line-height: 14px;
  margin-bottom: 85px;
}

.select-plan {
  align-items: flex-start;
  display: flex;
  flex-flow: column;
  justify-content: flex-start;
  margin-bottom: 30px;
}

@media (min-width: 37.5em) {
  .select-plan {
    align-items: center;
    flex-flow: row;
  }
}

.select-plan label {
  width: 170px;
}

.select-plan select {
  width: 100%;
}

@media (min-width: 37.5em) {
  .select-plan select {
    width: 200px;
  }
}

/*
================================================================================
Sweet alert
================================================================================
*/
:root .swal2-title {
  margin-bottom: 1em;
}

.swal2-validation-message {
  font-size: 0.8em !important;
  margin-top: 1em;
}

.swal2-popup {
  padding: 35px !important;
  width: 600px !important;
}

.swal2-icon {
  margin-bottom: 50px;
}

#swal2-title {
  color: #3a4148;
  font-family: "Lato", sans-serif;
  font-size: 24px;
  margin-bottom: 30px;
}

.swal2-content #swal2-content {
  color: #8a96a1;
  font-family: "Lato", sans-serif;
  font-size: 16px;
  font-weight: normal;
  line-height: 27px;
  margin-bottom: 40px;
}

.swal2-confirm {
  font-family: "Lato", sans-serif;
  font-size: 16px !important;
}

.swal2-actions {
  font-family: "Lato", sans-serif !important;
  margin-top: 0px !important;
  margin-bottom: 10px !important;
}

.swal2-actions button {
  border-radius: 3px !important;
  font-size: 16px !important;
  height: 44px;
  margin: 0px !important;
  width: 150px;
}

.swal2-actions button:focus {
  box-shadow: none !important;
}

.swal2-popup .swal2-styled.swal2-confirm {
  background-color: #20c372;
  border: 1px solid transparent;
  color: #fff;
  transition: background-color 150ms ease-out, border-color 150ms ease-out, color 150ms ease-out;
  margin-left: 10px !important;
  order: 2;
}

.swal2-popup .swal2-styled.swal2-confirm:focus, .swal2-popup .swal2-styled.swal2-confirm:hover, .swal2-popup .swal2-styled.swal2-confirm:active {
  color: #fff;
  text-decoration: none;
}

.swal2-popup .swal2-styled.swal2-confirm:focus, .swal2-popup .swal2-styled.swal2-confirm:hover {
  background-color: #1db369;
  border-color: transparent;
}

.swal2-popup .swal2-styled.swal2-confirm:active {
  background-color: #1cac64;
  border-color: transparent;
}

.swal2-popup .swal2-styled.swal2-confirm:disabled:focus, .swal2-popup .swal2-styled.swal2-confirm:disabled:hover, .swal2-popup .swal2-styled.swal2-confirm:disabled:active {
  background-color: #20c372;
  border-color: transparent;
  color: #fff;
}

.swal2-popup .swal2-styled.swal2-confirm.btn--loading::after {
  border-right-color: #fff;
  border-top-color: #fff;
}

.swal2-popup .swal2-styled.swal2-cancel {
  background-color: #fff;
  border: 1px solid transparent;
  color: #202428 !important;
  transition: background-color 150ms ease-out, border-color 150ms ease-out, color 150ms ease-out;
  background-color: #f0f2f3 !important;
  margin-right: 10px !important;
  order: 1;
}

.swal2-popup .swal2-styled.swal2-cancel:focus, .swal2-popup .swal2-styled.swal2-cancel:hover, .swal2-popup .swal2-styled.swal2-cancel:active {
  color: #202428 !important;
  text-decoration: none;
}

.swal2-popup .swal2-styled.swal2-cancel:focus, .swal2-popup .swal2-styled.swal2-cancel:hover {
  background-color: rgba(240, 242, 243, 0.15) !important;
  border-color: transparent;
}

.swal2-popup .swal2-styled.swal2-cancel:active {
  background-color: #e0e0e0;
  border-color: transparent;
}

.swal2-popup .swal2-styled.swal2-cancel:disabled:focus, .swal2-popup .swal2-styled.swal2-cancel:disabled:hover, .swal2-popup .swal2-styled.swal2-cancel:disabled:active {
  background-color: #fff;
  border-color: transparent;
  color: #202428 !important;
}

.swal2-popup .swal2-styled.swal2-cancel.btn--loading::after {
  border-right-color: #202428 !important;
  border-top-color: #202428 !important;
}

/*
================================================================================
Face radio
================================================================================
*/
.survey-radio {
  cursor: pointer;
  height: 46px;
  position: relative;
  width: 46px;
}

.survey-radio__bg {
  background-color: #fff;
  border: 1px solid #adb5bd;
  border-radius: 50%;
  display: inline-block;
  height: 46px;
  transition: background-color 200ms ease-out, border-color 150ms ease-out;
  width: 46px;
}

.survey-radio:hover .survey-radio__bg {
  border-color: #5f6b78;
}

.survey-radio__face {
  color: #adb5bd;
  display: none;
  height: 46px;
  position: absolute;
  top: 0;
  left: 0;
  transition: color 200ms ease-out;
  width: 46px;
}

.survey-radio__face:hover {
  color: #5f6b78;
}

.survey-radio__input:not(:checked) ~ .survey-radio__face--inactive {
  display: block;
}

.survey-radio__input:checked ~ .survey-radio__face--active {
  display: block;
}

.survey-radio__input:checked + .survey-radio__bg {
  animation: survey-radio-checked 300ms ease-out forwards;
}

.survey-radio__input:checked + .survey-radio__bg--1 {
  background-color: #eb928f;
  border-color: #eb928f;
}

.survey-radio__input:checked + .survey-radio__bg--2 {
  background-color: #f5ac52;
  border-color: #f5ac52;
}

.survey-radio__input:checked + .survey-radio__bg--3 {
  background-color: #ffd95f;
  border-color: #ffd95f;
}

.survey-radio__input:checked + .survey-radio__bg--4 {
  background-color: #8ee5d9;
  border-color: #8ee5d9;
}

.survey-radio__input:checked + .survey-radio__bg--5 {
  background-color: #50d393;
  border-color: #50d393;
}

.survey-radio__input:checked:focus + .survey-radio__bg--1 {
  border-color: #a52523;
}

.survey-radio__input:checked:focus + .survey-radio__bg--2 {
  border-color: #bd6d0b;
}

.survey-radio__input:checked:focus + .survey-radio__bg--3 {
  border-color: #dfaa00;
}

.survey-radio__input:checked:focus + .survey-radio__bg--4 {
  border-color: #2ec6b1;
}

.survey-radio__input:checked:focus + .survey-radio__bg--5 {
  border-color: #218353;
}

/* Checked states
============================================================================= */
.survey-radio__heart {
  color: #c00;
  display: none;
  position: absolute;
  top: -20px;
  left: 50%;
  margin-left: -15px;
  opacity: 0;
  width: 30px;
}

.survey-radio__input:checked ~ .survey-radio__heart {
  animation: survey-radio-up 800ms ease-out forwards;
  display: block;
}

.survey-radio__smoke {
  color: #adb5bd;
  display: none;
  position: absolute;
  top: -30px;
  left: 50%;
  margin-left: -15px;
  opacity: 0;
  width: 30px;
}

.survey-radio__input:checked ~ .survey-radio__smoke {
  animation: survey-radio-up 1s ease-out forwards;
  display: block;
}

.survey-radio__tear {
  color: #ebf5fa;
  display: none;
  position: absolute;
  top: 12px;
  left: 35px;
  opacity: 0;
  width: 8px;
}

.survey-radio__input:checked ~ .survey-radio__tear {
  animation: survey-radio-tear 800ms ease-out forwards;
  display: block;
}

.survey-radio__input:checked ~ .survey-radio__face .happy-eyes {
  animation: survey-radio-wink 800ms ease-out;
  transform-origin: center center;
}

.survey-radio__input:checked ~ .survey-radio__face .eyes {
  animation: survey-radio-blink 300ms 350ms;
  transform-origin: center center;
}

.survey-radio__input:checked ~ .survey-radio__face .mouth {
  animation: survey-radio-mouth 1s ease-out;
  transform-origin: center center;
}

.survey-radio__input:checked ~ .survey-radio__face .sad-mouth {
  animation: survey-radio-shake 300ms 600ms;
  transform-origin: center center;
}

.survey-radio__input:checked ~ .survey-radio__bg--1 {
  animation: survey-radio-angry 1s ease-in;
}

/* Animations
============================================================================= */
@keyframes survey-radio-angry {
  50% {
    background-color: #e77d79;
  }
}

@keyframes survey-radio-blink {
  0% {
    transform: scale(1, 1);
  }
  50% {
    transform: scale(1, 0.5);
  }
  100% {
    transform: scale(1, 1);
  }
}

@keyframes survey-radio-checked {
  0% {
    transform: scale(1);
  }
  50% {
    transform: scale(1.1);
  }
  100% {
    transform: scale(1);
  }
}

@keyframes survey-radio-up {
  0% {
    opacity: 0;
    transform: scale(0.5) translate(0, 15px);
  }
  50% {
    opacity: 1;
  }
  100% {
    opacity: 0;
    transform: scale(0.8) translate(0, -15px);
  }
}

@keyframes survey-radio-mouth {
  0% {
    transform: rotate(0);
  }
  15% {
    transform: rotate(-12deg) translate(-1px, 1px) scale(1.1, 1);
  }
  75% {
    transform: rotate(-12deg) translate(-1px, 1px) scale(1.1, 1);
  }
  100% {
    transform: rotate(0);
  }
}

@keyframes survey-radio-shake {
  0% {
    transform: translate(0);
  }
  20% {
    transform: translate(0, 1px) scale(0.85);
  }
  40% {
    transform: translate(0, 0) scale(0.85);
  }
  60% {
    transform: translate(0, 1px) scale(0.85);
  }
  80% {
    transform: translate(0, 0) scale(0.85);
  }
  100% {
    transform: translate(0);
  }
}

@keyframes survey-radio-tear {
  0% {
    opacity: 0;
    transform: scale(0.5);
  }
  50% {
    opacity: 1;
    transform: scale(1);
  }
  100% {
    opacity: 0;
    transform: scale(1.2) translate(0, 15px);
  }
}

@keyframes survey-radio-wink {
  0% {
    transform: scale(1, 1);
  }
  25% {
    transform: scale(1, 0.5);
  }
  75% {
    transform: scale(1, 0.5);
  }
  100% {
    transform: scale(1, 1);
  }
}

.subjects-collapsible {
  border: 1px solid #ccc;
  border-radius: 4px;
  margin-bottom: 30px;
  max-width: 920px;
}

.subjects-collapsible--active {
  box-shadow: 3px 3px 3px #0000001A;
}

.subjects-collapsible--active > .subjects-collapsible__content {
  display: block;
  opacity: 1;
}

.subjects-collapsible--active .subjects-collapsible__header > .btn--light::after {
  content: 'Ocultar grupos';
}

.subjects-collapsible--active > .subjects-collapsible__content--grid {
  display: flex;
}

.subjects-collapsible__header {
  display: block;
  position: relative;
  justify-content: space-between;
  padding: 1em;
}

.subjects-collapsible__header > .btn--light::after {
  content: 'Ver grupos';
}

@media (min-width: 43.75em) {
  .subjects-collapsible__header {
    display: flex;
  }
}

.subjects-collapsible__content {
  background-color: #f0f2f3;
  border-bottom-right-radius: 4px;
  border-bottom-left-radius: 4px;
  border-top: 1px solid #d6dadd;
  display: none;
  opacity: 0;
  padding: 30px 20px;
}

.subjects-collapsible__content--grid {
  align-items: stretch;
  flex-wrap: wrap;
  height: auto;
}

.subjects-collapsible .btn--text {
  display: block;
}

@media (min-width: 43.75em) {
  .subjects-collapsible .btn--text {
    display: none;
  }
}

.subjects-collapsible .btn--icon {
  display: none;
}

@media (min-width: 43.75em) {
  .subjects-collapsible .btn--icon {
    display: block;
  }
}

.subjects-collapsible .btn-icon svg {
  color: #67b3d9;
  height: 20px;
  margin-right: 5px;
  width: 15px;
}

.subjects-collapsible .btn--icon svg {
  height: 20px;
  width: 20px;
}

.progress-container {
  color: #3a4148;
  display: flex;
  font-size: 14px;
  flex-flow: column;
  justify-content: center;
  min-width: 150px;
  position: absolute;
  right: 15px;
  text-align: center;
  top: 10px;
}

@media (min-width: 43.75em) {
  .progress-container {
    right: 180px;
    top: auto;
  }
}

/*
================================================================================
Subject map
================================================================================
*/
.subject-map {
  display: flex;
  margin-top: 50px;
  max-width: 1380px;
  overflow-x: auto;
}

.subject-map__current-semester {
  background-color: #ffca34;
  display: block;
  height: 3px;
  margin-bottom: 10px;
  width: 100%;
}

.subject-map__filter {
  margin-top: 70px;
}

@media (min-width: 37.5em) {
  .subject-map__filter {
    margin-top: 90px;
  }
}

.subject-map__icon svg {
  height: 17px;
  vertical-align: bottom;
  width: 17px;
}

.subject-map__icon--left svg {
  margin-left: -5px;
  margin-right: 3px;
}

.subject-map__icon--right svg {
  margin-left: 3px;
  margin-right: -5px;
}

.subject-map__semester-title {
  color: #686d7a;
  font-size: 17px;
  margin-bottom: 27px;
  margin-top: 13px;
  text-align: center;
  width: 140px;
}

.subject-map__semester-title--bold {
  font-weight: 700;
  margin-top: 0;
}

/* Card
============================================================================= */
.subject-card {
  background-color: #f9fafa;
  border-radius: 8px;
  cursor: pointer;
  font-size: 13px;
  height: 100px;
  line-height: 1.4;
  margin-bottom: 15px;
  margin-right: 15px;
  min-width: 140px;
  padding: 8px;
  position: relative;
  width: 140px;
}

.subject-card--approved {
  background-color: #e3fdf1;
}

.subject-card--default {
  background-color: #fff;
  border: 1px solid #d6dadd;
  box-shadow: 0 3px 3px #0000000d;
}

.subject-card--failed {
  background-color: #ffe8e8;
}

.subject-card--restricted {
  background: repeating-linear-gradient(-45deg, #fff, #fff 5px, #ffe8e8 0, #ffe8e8 7px);
}

.subject-card--selected {
  background: #ebf5fa;
  border: 3px solid #39c;
}

.subject-card--required {
  color: #d03a40;
}

@media (min-width: 60em) {
  .subject-card:focus .subject-card__connection,
  .subject-card:hover .subject-card__connection,
  .subject-card:active .subject-card__connection {
    opacity: 1;
  }
}

.subject-card__chain {
  bottom: 8px;
  color: #39c;
  left: 8px;
  position: absolute;
}

.subject-card__chain svg {
  height: 17px;
}

.subject-card__credits {
  bottom: 8px;
  font-size: 12px;
  position: absolute;
  right: 8px;
}

.subject-card__name {
  -webkit-box-orient: vertical;
  -webkit-line-clamp: 3;
  display: -webkit-box;
  overflow: hidden;
}

.subject-card__required {
  bottom: 8px;
  color: #d03a40;
  left: 8px;
}

/* - - - - - Connection - - - - - */
.subject-card__connection {
  color: #67b3d9;
  height: 1px;
  opacity: 0;
  overflow: visible;
  pointer-events: none;
  transition: opacity 200ms ease-out;
  position: absolute;
  top: 50%;
  left: 100%;
  width: 1px;
}

/* Grid card
============================================================================= */
.subject-card-grid {
  background-color: #fff;
  border: 1px solid #d6dadd;
  border-top: 0px;
  border-radius: 4px;
  margin-bottom: 20px;
  margin-right: 0px;
  width: 100%;
}

@media (min-width: 43.75em) {
  .subject-card-grid {
    margin-right: 20px;
    width: 280px;
  }
}

.subject-card-grid__title {
  align-items: center;
  background-color: #f9fafa;
  border: 1px solid #d6dadd;
  border-left: 0;
  border-right: 0;
  border-radius: 4px 4px 0px 0px;
  color: #3a4148;
  display: flex;
  height: 70px;
  padding: 0px 15px;
}

.subject-card-grid__body {
  border-radius: 0px 0px 4px 4px;
  padding: 25px 0px;
}

.subject-card-grid__body section {
  padding: 0px 15px;
}

.subject-card-grid .group-day {
  color: #8a96a1;
  display: block;
  margin-right: 15px;
  width: 60px;
}

/*
================================================================================
Index table
================================================================================
*/
.table-index {
  line-height: 1.4;
  width: 100%;
}

.table-index tbody > :nth-child(even) {
  background-color: #f0f2f3;
}

.table-index tbody > tr > td.calificaciones {
  border-left-width: 3.5px;
  border-left-color: #ddd;
}

.table-index thead > tr > th.calificaciones {
  border-left-width: 3.5px;
  border-left-color: #ddd;
}

.table-index:last-child {
  margin-bottom: 0;
}

.table-index--full-w {
  margin-left: calc(var(--db-panel-padding-x) * -1);
  max-width: none;
  width: calc(100% + (var(--db-panel-padding-x) * 2));
}

.table-index--mobile {
  display: inline-block;
  font-size: 0.9375rem;
}

/* Heading
============================================================================= */
.table-index thead th {
  padding-bottom: 1em;
}

.table-index thead tr {
  border-bottom: 0;
}

.table-index--mobile thead {
  border: 0;
  clip: rect(0 0 0 0);
  height: 1px;
  margin: -1px;
  overflow: hidden;
  padding: 0;
  position: absolute;
  white-space: nowrap;
  width: 1px;
}

/* Body
============================================================================= */
.table-index tbody {
  border-top: 1px solid #d6dadd;
}

.table-index td {
  vertical-align: middle;
}

.table-index--spaced td {
  padding-bottom: 1.3em;
  padding-top: 1.3em;
}

.table-index--mobile tbody {
  border-top: 0;
  display: block;
}

.table-index--mobile tr {
  display: block;
  padding-bottom: 0.5em;
  padding-top: 0.5em;
}

.table-index--mobile td, .table-index--mobile th {
  display: flex;
}

.table-index--mobile td {
  padding: 5px 15px;
  text-align: left;
}

.table-index--mobile.table-index--spaced td {
  padding: 0.75em 15px;
}

.table-index__label {
  color: #8a96a1;
  display: none;
  flex-shrink: 0;
  margin-right: 30px;
  max-width: 35%;
  text-align: left;
}

.table-index--mobile .table-index__label {
  display: inline;
}

.table-index__thumb {
  align-self: flex-start;
  color: #8a96a1;
  display: inline-block;
  flex-shrink: 0;
  font-size: 0.625rem;
  line-height: 1.2;
  margin-right: 15px;
  overflow: hidden;
}

.table-index__thumb--avatar {
  border-radius: 50%;
  height: 40px;
  width: 40px;
}

.table-index__thumb--product {
  height: 70px;
  width: 70px;
}

.table-index--mobile .table-index__thumb--product,
.table-index--full-w .table-index__thumb--product {
  height: 50px;
  width: 50px;
}

.table-index__row-title {
  align-items: center;
  display: flex;
}

.table-index--mobile .table-index__row-title {
  margin-bottom: 10px;
}

.table-index--mobile .table-index__row-title--lg {
  font-size: 1.0625rem;
  font-weight: 600;
}

.table-index__row-title:focus .description,
.table-index__row-title:hover .description,
.table-index__row-title:active .description {
  text-decoration: none;
}

/* Controls
============================================================================= */
.table-index__checkbox {
  align-self: center;
  background-size: 100%;
  display: inline-block;
  flex-shrink: 0;
  height: 1em;
  margin-right: 30px;
  width: 1em;
}

.table-index--mobile .table-index__checkbox {
  background-size: 100%;
  height: 1.25em;
  margin-left: auto;
  margin-right: 0;
  order: 1;
  width: 1.25em;
}

.table-index__edit-btn {
  align-items: center;
  background-color: transparent;
  border: 0;
  border-radius: 3px;
  color: #8a96a1;
  display: inline-flex;
  height: 40px;
  justify-content: center;
  transition: background-color 150ms ease-out;
  width: 40px;
}

.table-index__edit-btn:focus, .table-index__edit-btn:hover, .table-index__edit-btn:active {
  background-color: #f5f6f7;
  color: #8a96a1;
}

.table-index--mobile .table-index__edit-btn {
  background-color: #f5f6f7;
}

.table-index--mobile .table-index__edit-btn:focus, .table-index--mobile .table-index__edit-btn:hover, .table-index--mobile .table-index__edit-btn:active {
  background-color: #e7e9ec;
}

.table-index__edit-btn svg {
  height: 22px;
  stroke-width: 1.5;
  width: 22px;
}

/* Utilities
============================================================================= */
.table-index__pr-10:not(.table-index--mobile) {
  padding-right: 2.75rem;
}

@page {
  margin: 4.3cm 1.3cm 1.4cm 1.3cm;
  size: 21.6cm 35.4cm;
}

@media print {
  body {
    line-height: 1.3;
  }
  .text-center-nombre {
    width: 100%;
  }
  .grado {
    max-width: 400px;
    margin: 0 auto;
  }
  .header-container {
    display: flex;
    align-items: center;
    justify-content: space-around;
    text-align: center;
  }
  .foto {
    border-radius: 50%;
    border: solid 3px black;
    width: 200px !important;
    height: 230px !important;
  }
  .container-foto--certificado {
    display: flex;
    justify-content: center;
    align-items: flex-end;
    width: 2.2cm;
    height: 3.3cm;
    border-radius: 50%;
    background-color: white !important;
    margin-left: 1.5rem;
    margin-right: 2.5rem;
    overflow: hidden;
  }
  .foto-certificado {
    width: 2.2cm;
    height: auto;
    -o-object-fit: cover;
       object-fit: cover;
  }
  .container-foto--titulo {
    display: flex;
    justify-content: center;
    align-items: flex-end;
    width: 4cm;
    height: 6cm;
    background-color: white !important;
    border-radius: 50%;
    overflow: hidden;
  }
  .foto-titulo {
    width: 4cm;
    height: auto;
    -o-object-fit: cover;
       object-fit: cover;
  }
  .texto-foto {
    flex: 1;
    min-width: 0;
    text-align: justify;
    align-items: center;
  }
  .logo_left {
    width: 80px;
  }
  .logo_right {
    width: 100px;
  }
  .title-text {
    flex: 1;
    margin: 0;
    font-family: 'Arial';
    font-size: 25px;
    line-height: normal;
  }
  .marco-1 {
    border: 4px solid #5b463c;
    /* gruesa */
    padding: 5px;
    height: 100%;
    box-sizing: border-box;
  }
  .marco-2 {
    border: 1px solid #5b463c;
    /* delgada */
    padding: 5px;
    height: 100%;
    box-sizing: border-box;
  }
  .marco-3 {
    border: 6px solid #5b463c;
    /* gruesa */
    padding: 5px;
    height: 100%;
    box-sizing: border-box;
  }
  .marco-4 {
    border: 1px solid #5b463c;
    /* delgada */
    padding: 20px;
    height: 100%;
    box-sizing: border-box;
  }
  .flex {
    display: flex;
    justify-content: space-between;
  }
  .qr {
    display: block;
    width: 10%;
    height: 10%;
  }
  .qr-acta {
    display: block;
    width: 13%;
    height: 13%;
  }
  .qr-titulo {
    width: 2cm;
    height: 2cm;
  }
  .acta_qr {
    float: right;
    width: 15%;
    height: 15%;
    margin: 220px 0px 0px 600px;
  }
  .qr-certificado {
    width: 70px;
    height: 70px;
  }
  .qr-posgrado {
    width: 60px;
    height: 60px;
  }
  .container-qr {
    display: flex;
    flex-direction: column;
    align-items: flex-end;
    justify-content: flex-end;
    width: auto;
  }
  .sello {
    word-wrap: break-word;
    white-space: space;
    width: auto !important;
  }
  .container-firmas {
    margin-top: 0.5rem;
    width: 88%;
    box-sizing: border-box;
    align-items: start;
  }
  .container-firmas--posgrado {
    margin-top: 0.5rem;
    width: 82%;
    box-sizing: border-box;
    align-items: start;
  }
  .col-sello {
    display: flex;
    flex-direction: column;
    text-align: center;
    justify-content: center;
  }
  .container-sellos {
    display: flex;
    justify-content: space-between;
    align-items: flex-end;
  }
  .firma-rector {
    height: 65px;
    width: auto;
    margin: 0;
  }
  .firma-secretario {
    height: 90px;
    width: auto;
    margin: 0;
  }
  .titulo--firma-rector {
    height: 75px;
    width: auto;
    margin: 0;
  }
  .titulo--firma-secretario {
    height: 115px;
    width: auto;
    margin: 0;
  }
  .autority {
    width: 50%;
  }
  .title {
    font-size: 23px;
    font-weight: bold;
  }
  .letter_title {
    font-size: 25px;
    font-weight: bold;
    margin-left: 40px;
    margin-right: 40px;
  }
  .acta_title {
    font-size: 50px;
    line-height: 100%;
  }
  .pr-20 {
    padding-right: 120px;
  }
  .mt_50 {
    margin-top: 50px;
  }
  .mt_40 {
    margin-top: 40px;
  }
  .mt_10 {
    margin-top: 10px;
  }
  .mb_80 {
    margin-bottom: 80px;
  }
  .mb_50 {
    margin-bottom: 50px;
  }
  .mb_40 {
    margin-bottom: 40px;
  }
  .mb_30 {
    margin-bottom: 30px;
  }
  .mb_5 {
    margin-bottom: 5px;
  }
  .mb_-3 {
    margin-bottom: -3px;
  }
  .mr_25 {
    margin-right: 25px;
  }
  .ml_550 {
    margin-left: 550px;
  }
  .mx_50 {
    margin-left: 50px;
    margin-right: 50px;
  }
  .mx_40 {
    margin-left: 40px;
    margin-right: 40px;
  }
  .mx_70 {
    margin-left: 35px;
    margin-right: 35px;
  }
  .ml_600 {
    margin-left: 50px;
    margin-right: 50px;
  }
  .mx_30 {
    margin-left: 30px;
    margin-right: 30px;
  }
  .mx_20 {
    margin-left: 20px;
    margin-right: 20px;
  }
  .my_20 {
    margin-top: 20px;
    margin-bottom: 20px;
  }
  .mx_15 {
    margin-left: 15px;
    margin-right: 15px;
  }
  .size_60 {
    font-size: 60px;
  }
  .size_titulo_title {
    font-size: 60px;
  }
  .size_35 {
    font-size: 35px;
  }
  .size_33 {
    font-size: 33px;
  }
  .size_30 {
    font-size: 30px;
  }
  .size_26 {
    font-size: 26px;
  }
  .size_24 {
    font-size: 24px;
  }
  .size_22 {
    font-size: 22px;
  }
  .size_20 {
    font-size: 20px;
  }
  .size_19 {
    font-size: 19px;
  }
  .size_18 {
    font-size: 18px;
  }
  .size_17 {
    font-size: 17px;
  }
  .size_15 {
    font-size: 15px;
  }
  .size_14 {
    font-size: 14px;
  }
  .size_13 {
    font-size: 13px;
  }
  .size_12 {
    font-size: 12px;
  }
  .size_11 {
    font-size: 11px;
  }
  .size_10-5 {
    font-size: 10.5px;
  }
  .size_10 {
    font-size: 10px;
  }
  .size_9 {
    font-size: 9px;
  }
  .size_8 {
    font-size: 8px;
  }
  .size_7 {
    font-size: 7px;
  }
  .text-justify {
    text-align: justify;
  }
  .text-center {
    text-align: center;
  }
  .bold {
    font-weight: bold;
  }
  .arial {
    font-family: 'Arial';
  }
  .font {
    font-family: 'Arial';
  }
  .letter_font {
    font-family: 'Dancing Script', cursive;
    font-size: 45px;
  }
  .f-r {
    float: right;
  }
  .subscribed {
    margin-bottom: -1px;
    margin-top: -20px;
  }
  .program {
    margin-top: -15px;
    margin-bottom: 0px;
  }
  /* Aplica solo para la segunda mitad de tablas */
  .tabla-con-padding td:first-child,
  .tabla-con-padding th:first-child {
    padding-left: 8px !important;
  }
  .tabla-padding-derecho td:last-child,
  .tabla-padding-derecho th:last-child {
    padding-right: 8px !important;
  }
  .table_subjects {
    width: 50%;
    display: table-cell;
    font-family: 'Arial';
  }
  .table_subjects tbody {
    line-height: 1.2 !important;
  }
  .table_subjects td:first-child,
  .table_subjects th:first-child {
    padding-left: 0;
  }
  .table_subjects td, .table_subjects th {
    padding-left: 10px;
    vertical-align: top;
  }
  .table_subjects th {
    font-weight: bold;
  }
  .table_subjects tfoot {
    font-weight: bold;
  }
  .table_subjects thead th {
    vertical-align: bottom;
  }
}

.acta-flex-contenedor {
  display: flex;
  justify-content: space-between;
  align-items: stretch;
  line-height: 1.8;
  margin-bottom: 3.5rem;
  padding-left: 1.5rem;
}

.acta-datos {
  display: flex;
  flex-direction: column;
  gap: 20px;
  flex: 1;
}

.acta-campo {
  display: flex;
  flex-direction: column;
}

.acta-etiqueta {
  font-weight: bold;
  text-align: left;
}

.acta-valor {
  text-transform: uppercase;
  padding-left: 50px;
  word-break: break-word;
}

.acta-qr {
  display: flex;
  flex-direction: column;
  justify-content: flex-end;
}

.acta-qr-img {
  width: 100px;
  height: 100px;
}

.header-posgrado {
  display: flex;
  align-items: center;
  justify-content: space-between;
  text-align: center;
  padding-left: 1rem;
}

/*
===============================================================================
Simple tabs
===============================================================================
*/
.tabs--simple {
  margin: auto;
  margin-bottom: 2rem;
  width: 100%;
}

.tabs--simple .tabs__select {
  margin-bottom: 3rem;
}

.tabs--simple .tabs__menu {
  margin: auto;
  margin-bottom: 60px;
}

.tabs--simple .tabs__menu .tabs__li {
  position: relative;
  top: 1px;
  background-color: #f0f2f3;
  border-radius: 3px;
  border: 1px solid #f0f2f3;
  color: #202428;
  cursor: pointer;
  display: block;
  margin-bottom: 0.5em;
  padding: 0.75em 1em;
  text-align: center;
  width: 100%;
  transition: background-color 150ms ease-out, border-color 150ms ease-out;
}

.tabs--simple .tabs__menu .tabs__li:focus, .tabs--simple .tabs__menu .tabs__li:hover, .tabs--simple .tabs__menu .tabs__li:active {
  border-color: #adb5bd;
}

.tabs--simple .tabs__menu .tabs__li[aria-selected="true"] {
  background-color: #BA0000;
  color: #fff;
}

.tabs--simple .tabs__menu .tabs__li[aria-selected="true"]:focus, .tabs--simple .tabs__menu .tabs__li[aria-selected="true"]:hover, .tabs--simple .tabs__menu .tabs__li[aria-selected="true"]:active {
  background-color: #BA0000;
  color: #fff;
  cursor: auto;
}

@media (min-width: 43.75em) {
  .tabs--simple .tabs__menu {
    border-bottom: 1px solid #e7e9ec;
    margin-bottom: 80px;
    max-width: 511px;
  }
  .tabs--simple .tabs__menu .tabs__li {
    background-color: transparent;
    border-bottom: 0;
    border-radius: 3px 3px 0 0;
    border: 1px solid transparent;
    color: #8a96a1;
    display: inline-block;
    margin-bottom: 0;
    padding-bottom: 10px;
    width: auto;
  }
  .tabs--simple .tabs__menu .tabs__li:focus, .tabs--simple .tabs__menu .tabs__li:hover, .tabs--simple .tabs__menu .tabs__li:active {
    border-color: transparent;
    color: #3a4148;
  }
  .tabs--simple .tabs__menu .tabs__li[aria-selected="true"] {
    background-color: transparent;
    border-bottom: 2px solid #BA0000;
    color: #3a4148;
    font-weight: 600;
  }
  .tabs--simple .tabs__menu .tabs__li[aria-selected="true"]:focus, .tabs--simple .tabs__menu .tabs__li[aria-selected="true"]:hover, .tabs--simple .tabs__menu .tabs__li[aria-selected="true"]:active {
    background-color: transparent;
    color: #3a4148;
    font-weight: 600;
  }
}

/*
===============================================================================
User bar
===============================================================================
*/
.user-bar {
  align-items: center;
  background-color: #3a4148;
  display: flex;
  font-size: 0.8125rem;
  height: 60px;
  justify-content: space-between;
  line-height: 1.2;
  position: relative;
}

.user-bar__logout {
  align-items: center;
  color: #fff;
  display: flex;
  font-size: 0.875rem;
  height: 100%;
  margin: 0;
  padding: 0 1.5rem;
}

.user-bar__logout:focus, .user-bar__logout:hover, .user-bar__logout:active {
  background-color: rgba(255, 255, 255, 0.05);
  color: #fff;
  text-decoration: none;
}

.user-bar__logout-icon {
  line-height: 1;
  margin-right: 6px;
  position: relative;
  stroke: #adb5bd;
  top: 0.1em;
  width: 17px;
}

.user-bar__logout:focus .user-bar__logout-icon,
.user-bar__logout:hover .user-bar__logout-icon,
.user-bar__logout:active .user-bar__logout-icon {
  stroke: #ffca34;
}

/* Button
============================================================================ */
.user-bar__btn {
  background-color: transparent;
  border: 2px solid transparent;
  color: #f9fafa;
  font-size: 0.8125rem;
  margin: 0;
  padding: 1rem;
  transition: color 150ms ease-out;
}

.user-bar__btn:active, .user-bar__btn:focus, .user-bar__btn:hover {
  color: #fff;
}

.user-bar__btn:focus {
  border: 2px solid #39c;
  outline: 0;
}

.user-bar__btn:focus:not(:focus-visible) {
  border: 0;
}

@media (min-width: 37.5em) {
  .user-bar__btn {
    margin-left: 60px;
  }
}

@media (min-width: 68.75em) {
  .user-bar__btn {
    margin-left: 220px;
  }
  .user-bar--menu-collapsed .user-bar__btn {
    margin-left: 60px;
  }
}

.user-bar__btn-icon {
  background-color: transparent;
  border: 0;
  box-sizing: content-box;
  display: inline-block;
  height: 20px;
  margin-bottom: 0;
  padding: 0;
  position: relative;
  top: -1px;
  vertical-align: middle;
  width: 20px;
  margin-right: 7px;
}

.user-bar__btn-icon::after, .user-bar__btn-icon::before,
.user-bar__btn-icon > span {
  background-color: #adb5bd;
  border-radius: 1px;
  display: block;
  height: 2px;
  margin-top: 9px;
  position: absolute;
  left: 0;
  transition: all 150ms ease-out;
  width: 20px;
}

.user-bar__btn-icon::after, .user-bar__btn-icon::before {
  content: "";
}

.user-bar__btn-icon::before {
  top: -6px;
}

.user-bar__btn-icon > span {
  top: 0;
}

.user-bar__btn-icon::after {
  top: 6px;
}

.user-bar__btn-icon--active::before {
  transform: translate(0, 6px) rotate(45deg);
}

.user-bar__btn-icon--active::after {
  transform: translate(0, -6px) rotate(-45deg);
}

.user-bar__btn-icon--active > span {
  opacity: 0;
}

.user-bar__btn-icon > span {
  background: url("data:image/svg+xml;utf8,<svg xmlns='http://www.w3.org/2000/svg' width='146' height='30' viewBox='0 0 146 30' fill='%23adb5bd'><path d='M94.258 10H51.743C49.123 10 47 12.24 47 15c0 2.762 2.126 5 4.743 5h42.515C96.873 20 99 17.762 99 15c0-2.76-2.123-5-4.742-5zM15 0L0 15l15 15V20h22V10H15M146 15L131 0v10h-22v10h22v10'/></svg>") no-repeat 0 0;
  background-size: auto 6px;
  height: 6px;
  top: -2px;
  width: 20px;
}

[aria-expanded="false"] > .user-bar__btn-icon > span {
  background-position: 100% 0;
}

.user-bar__btn-text {
  color: #adb5bd;
}

/*
===============================================================================
User bar
===============================================================================
*/
.user-bar-admin {
  align-items: center;
  background-color: #202428;
  box-shadow: 0 3px 6px rgba(0, 0, 0, 0.16);
  display: flex;
  font-size: 0.8125rem;
  height: 60px;
  justify-content: space-between;
  position: relative;
}

.user-bar-admin__dashboard-link {
  color: #adb5bd;
  font-weight: 300;
  padding: 0 20px;
  transition: color 150ms ease-out;
}

.user-bar-admin__dashboard-link:active, .user-bar-admin__dashboard-link:focus, .user-bar-admin__dashboard-link:hover {
  color: #fff;
  text-decoration: none;
}

/* Button
============================================================================ */
.user-bar-admin__btn {
  background-color: transparent;
  border: 2px solid transparent;
  color: #f9fafa;
  font-size: 0.8125rem;
  margin: 0;
  padding: 1em 1.5em;
  transition: color 150ms ease-out;
}

.user-bar-admin__btn:active, .user-bar-admin__btn:focus, .user-bar-admin__btn:hover {
  color: #fff;
}

.user-bar-admin__btn:focus {
  border: 2px solid #39c;
  outline: 0;
}

.user-bar-admin__btn:focus:not(:focus-visible) {
  border: 0;
}

.user-bar-admin__btn-icon {
  background-color: transparent;
  border: 0;
  box-sizing: content-box;
  display: inline-block;
  height: 20px;
  margin-bottom: 0;
  padding: 0;
  position: relative;
  top: -1px;
  vertical-align: middle;
  width: 20px;
  margin-right: 7px;
}

.user-bar-admin__btn-icon::after, .user-bar-admin__btn-icon::before,
.user-bar-admin__btn-icon > span {
  background-color: #adb5bd;
  border-radius: 1px;
  display: block;
  height: 2px;
  margin-top: 9px;
  position: absolute;
  left: 0;
  transition: all 150ms ease-out;
  width: 20px;
}

.user-bar-admin__btn-icon::after, .user-bar-admin__btn-icon::before {
  content: "";
}

.user-bar-admin__btn-icon::before {
  top: -6px;
}

.user-bar-admin__btn-icon > span {
  top: 0;
}

.user-bar-admin__btn-icon::after {
  top: 6px;
}

.user-bar-admin__btn-icon--active::before {
  transform: translate(0, 6px) rotate(45deg);
}

.user-bar-admin__btn-icon--active::after {
  transform: translate(0, -6px) rotate(-45deg);
}

.user-bar-admin__btn-icon--active > span {
  opacity: 0;
}

.user-bar-admin__btn-icon > span {
  background: url("data:image/svg+xml;utf8,<svg xmlns='http://www.w3.org/2000/svg' width='146' height='30' viewBox='0 0 146 30' fill='%23adb5bd'><path d='M94.258 10H51.743C49.123 10 47 12.24 47 15c0 2.762 2.126 5 4.743 5h42.515C96.873 20 99 17.762 99 15c0-2.76-2.123-5-4.742-5zM15 0L0 15l15 15V20h22V10H15M146 15L131 0v10h-22v10h22v10'/></svg>") no-repeat 0 0;
  background-size: auto 6px;
  height: 6px;
  top: -2px;
  width: 20px;
}

[aria-expanded="false"] > .user-bar-admin__btn-icon > span {
  background-position: 100% 0;
}

.user-bar-admin__btn-text {
  color: #adb5bd;
}

/* Profile
============================================================================ */
.user-bar-admin__profile {
  align-items: center;
  display: flex;
  height: 60px;
  justify-content: right;
  padding-right: 15px;
  position: relative;
}

.user-bar-admin__profile::after {
  background: url("data:image/svg+xml;utf8,<svg xmlns='http://www.w3.org/2000/svg' width='8' height='5' viewBox='496 497.5 8 5'><path fill='%23e7e9ec' d='M497.048 497.972c-.252-.295-.526-.295-.825 0-.297.25-.297.523 0 .818l3.366 3.272c.25.25.524.25.822 0l3.364-3.272c.298-.295.298-.568 0-.818-.274-.273-.56-.273-.858 0L500 500.63l-2.952-2.658z'/></svg>") no-repeat 0 0;
  content: "";
  display: inline-block;
  height: 5px;
  margin-left: 0.5em;
  margin-top: 0.2em;
  vertical-align: middle;
  width: 8px;
}

.user-bar-admin__avatar {
  height: auto;
  vertical-align: initial;
  width: 100%;
}

.user-bar-admin__avatar-container {
  border-radius: 9999px;
  box-shadow: inset 0 2px 2px rgba(0, 0, 0, 0.4);
  display: inline-block;
  height: 40px;
  overflow: hidden;
  width: 40px;
}

.user-bar-admin__avatar-container--count {
  border: 1px solid #d6dadd;
  border-radius: 50%;
  box-shadow: none;
  text-align: center;
}

.user-bar-admin__avatar-container--add {
  background-color: #f9fafa;
  border: 1px solid #d6dadd;
  border-radius: 50%;
  box-shadow: none;
  overflow: hidden;
  text-align: center;
  vertical-align: top;
}

.user-bar-admin__avatar-container--add:hover {
  border: 1px solid #8a96a1;
}

.user-bar-admin__count {
  color: #8a96a1;
  display: block;
  font-size: 0.75rem;
  line-height: 2.1;
}

.user-bar-admin__plus {
  align-items: center;
  background-color: #f9fafa;
  color: #8a96a1;
  display: flex;
  font-size: 0.75rem;
  height: 100%;
  justify-content: center;
  line-height: 2.1;
}

.user-bar-admin__plus:hover {
  color: #50AB87;
  cursor: pointer;
}

.user-bar-admin__user-name {
  color: #e7e9ec;
  display: none;
  font-size: 0.9375rem;
  font-weight: 100;
  margin-bottom: 0;
  margin-left: 0.75em;
}

@media (min-width: 31.25em) {
  .user-bar-admin__user-name {
    display: block;
  }
}

/* Profile menu
============================================================================ */
.user-bar-admin__menu-avatar-container {
  color: #fff;
  font-size: 0.875rem;
  padding: 0.25em 1em;
  text-align: center;
}

.user-bar-admin__menu-avatar {
  border-radius: 50%;
  display: inline-block;
  height: 80px;
  width: 80px;
}

.user-bar-admin__profile-menu {
  background-color: #37424d;
  border-radius: 4px;
  box-shadow: 0 5px 5px rgba(0, 0, 0, 0.2);
  font-size: 13px;
  list-style: none;
  margin: 0;
  max-width: 300px;
  min-width: 200px;
  position: absolute;
  top: 70px;
  right: 10px;
  z-index: 5;
}

.user-bar-admin__profile-menu::before {
  border-left: 8px solid transparent;
  border-right: 8px solid transparent;
  border-bottom: 8px solid #37424d;
  content: "";
  display: block;
  height: 0;
  width: 0;
  position: absolute;
  top: -7px;
  right: 6px;
  z-index: 2;
}

@media (min-width: 31.25em) {
  .user-bar-admin__profile-menu::before {
    right: 40px;
  }
}

.user-bar-admin__profile-menu::after {
  content: "";
  display: block;
  height: 10px;
  position: absolute;
  top: -10px;
  left: 0;
  width: 100%;
}

.user-bar-admin__profile-menu--hide {
  animation: hide-profile-menu 150ms ease-in forwards;
}

.user-bar-admin__profile-menu--show {
  animation: show-profile-menu 250ms ease-out forwards;
}

.user-bar-admin__profile-menu-item {
  border-top: 1px solid #505963;
}

.user-bar-admin__profile-menu-item .name {
  color: #fff;
  font-size: 0.875rem;
  margin-bottom: 0;
  padding-top: 10px;
  text-align: center;
}

.user-bar-admin__profile-menu-item .rol {
  color: #8a96a1;
  font-size: 0.6875rem;
  padding-bottom: 18px;
  text-align: center;
}

.user-bar-admin__profile-menu-item .user-bar__avatar-container {
  display: block;
  height: 82px;
  margin: 15px auto 0;
  width: 82px;
}

.user-bar-admin__profile-menu-item:first-child {
  border-top: 0;
}

.user--info {
  background: #2d363e;
  border-radius: 4px 4px 0 0;
  padding-top: 15px;
}

.user-bar-admin__profile-menu-link {
  border-bottom: 1px solid rgba(255, 255, 255, 0.1);
  border-radius: 3px;
  color: #adb5bd;
  display: block;
  font-size: 0.8125rem;
  font-weight: 400;
  min-width: 180px;
  padding: 1em 15px;
  text-decoration: none;
  transition: background-color 200ms ease-out, color 200ms ease-out;
}

.user-bar-admin__profile-menu-link:active, .user-bar-admin__profile-menu-link:focus, .user-bar-admin__profile-menu-link:hover {
  background-color: #3d4a56;
  color: #fff;
  text-decoration: none;
}

.user-bar-admin__profile-menu-link--logout {
  background-color: #2d363e;
  font-size: 0.75rem;
  position: relative;
}

.user-bar-admin__profile-menu-link--logout:active, .user-bar-admin__profile-menu-link--logout:focus, .user-bar-admin__profile-menu-link--logout:hover {
  background-color: #272e35;
}

.user-bar-admin__profile-menu-link--logout:active > .user-bar__logout-icon, .user-bar-admin__profile-menu-link--logout:focus > .user-bar__logout-icon, .user-bar-admin__profile-menu-link--logout:hover > .user-bar__logout-icon {
  color: #b55;
}

/**
 * 1. Icon position might change depending on used fonts.
 */
.user-bar-admin__logout-icon {
  line-height: 1;
  margin-right: 0.4em;
  stroke: #adb5bd;
  position: relative;
  top: 0.1em;
  /* 1 */
  transition: stroke 150ms ease-out;
  vertical-align: top;
  width: 0.9375rem;
}

:active > .user-bar-admin__logout-icon,
:focus > .user-bar-admin__logout-icon,
:hover > .user-bar-admin__logout-icon {
  stroke: #b55;
}

.dashboard .user-bar-admin__logout-icon {
  top: 0.1em;
  /* 1 */
}

/* Animations
============================================================================ */
@keyframes show-profile-menu {
  0% {
    opacity: 0;
    transform: scale(0.5);
    transform-origin: right top;
    visibility: visible;
  }
  70% {
    opacity: 1;
    transform: scale(1.075);
  }
  100% {
    opacity: 1;
    transform: scale(1);
    transform-origin: right top;
    visibility: visible;
  }
}

@keyframes hide-profile-menu {
  0% {
    opacity: 1;
    transform: scale(1);
    transform-origin: right top;
    visibility: visible;
  }
  100% {
    opacity: 0;
    transform: scale(0.5);
    transform-origin: right top;
  }
}

.table-container {
  display: none;
}

.db-search-form {
  display: flex;
  align-items: center;
  justify-content: center;
  width: 100%;
  margin: 0 auto;
}

.search-wrapper {
  position: relative;
  display: inline-block;
  width: 100%;
}

.search-input {
  padding-right: 30px;
}

.search-icon {
  position: absolute;
  right: 10px;
  top: 50%;
  transform: translateY(-50%);
  pointer-events: none;
}

.db-panel-p {
  padding: 0;
  margin: 0;
  background-color: #fff;
  box-shadow: 0 2px 4px rgba(0, 0, 0, 0.1);
  margin-bottom: 30px;
  overflow: auto;
  padding: 30px var(--db-panel-padding-x);
  position: relative;
}

.list-container {
  width: 100%;
}

.list-container a {
  text-decoration: none;
  color: inherit;
}

.record {
  padding: 1rem;
  border-bottom: 0.5px solid #ddd;
}

.record__title {
  color: #adb5bd;
  font-weight: 700;
  font-size: 14px;
}

.record__name {
  font-size: 18px;
  font-weight: 400;
  cursor: pointer;
}

.record__name span {
  color: #BA0000;
}

.record__contaier {
  display: flex;
  flex-direction: row;
  gap: 30px;
}

.title {
  color: #82878C;
  font-weight: 700;
  font-size: 14px;
}

.subtitle {
  font-weight: 400;
  font-size: 14px;
}

.record__container--sub {
  display: flex;
  flex-direction: column;
}

.record:nth-child(odd) {
  background-color: white;
}

.record:nth-child(even) {
  background-color: #F9FAFB;
}

.unidad-academica {
  page-break-before: always;
  /* Salto de página antes de cada unidad académica */
}

@media (min-width: 768px) {
  .list-container {
    display: none;
  }
  .table-container {
    display: block;
    padding: 2rem;
  }
  table {
    width: 100%;
    border-collapse: collapse;
    margin-top: 10px;
  }
  thead {
    border-bottom: 2px solid #000;
  }
  th, td {
    padding: 10px;
    text-align: left;
  }
  th {
    font-weight: bold;
  }
  .search-wrapper {
    width: 40%;
  }
}

._responsive_actas_div_left, ._responsive_actas_div_right {
  float: left;
  width: 20%;
  /* The width is 20%, by default */
}

._responsive_actas_div_main {
  float: left;
  width: 60%;
  /* The width is 60%, by default */
}

/* Use a media query to add a breakpoint at 800px: */
@media screen and (max-width: 800px) {
  .left, .main, .right {
    width: 100%;
    /* The width is 100%, when the viewport is 800px or smaller */
  }
}

.btn-timetable {
  width: -webkit-fill-available;
  padding: 1em;
  text-align: left;
  background: darkgray;
  border: none;
}

.timetable-s {
  width: -webkit-fill-available;
  background: #E9E9E9;
  margin-bottom: 10px;
}

.btn-timetable-s {
  width: -webkit-fill-available;
  padding: 10px;
  text-align: left;
  background: lightgray;
  border: none;
}

.semester-space {
  padding: 20px;
}

.div-withe-space {
  height: 10px;
  background: lightgray;
}

.tabletime-row {
  display: flex;
  width: 100%;
}

.tabletime-parts {
  width: 50%;
}